cgl.h

/*

MIT License

Copyright (c) 2023 Jaysmito Mukherjee

Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:

The above copyright notice and this permission notice shall be included in all
copies or substantial portions of the Software.

THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
SOFTWARE.

*/

/** file: cgl.h
 *
 * CGL is a cross platform C library for game development.
 * It is designed to be simple, fast and easy to use.
 * It is also designed to be modular, so that you can use
 * only the parts you need.
 *
 * @author Jaysmito Mukherjee
 */

#ifndef CGL_H
#define CGL_H

#if defined(_WIN32) || defined(_WIN64)
#define CGL_WINDOWS
#else
 // TODO: seperate linux and macos and android
#define CGL_UNIX
#endif

// check if its gcc
#if defined(__GNUC__) || defined(__GNUG__)
#define CGL_GCC
// disable warnings for overlength strings as we have 
// shaders embedded in the code as strings
#pragma GCC diagnostic ignored "-Woverlength-strings"
#endif

// check if its clang
#if defined(__clang__)
#define CGL_CLANG
#endif

// check if its msvc
#if defined(_MSC_VER)
#define CGL_MSVC
#endif


#ifdef CGL_WASM
#define CGL_EXCLUDE_NETWORKING
#define CGL_EXCLUDES_THREADS
#ifdef CGL_EXCLUDE_WINDOW_API
#undef CGL_EXCLUDE_WINDOW_API
#endif
#ifdef __EMSCRIPTEN__
#include <emscripten/emscripten.h>
#endif
#define CGL_wasm_set_loop_func(func, data) emscripten_set_main_loop_arg((em_arg_callback_func)func, data, 0, true);
#endif


// common
#if 1 // Just to use code folding

// std includes
#include <stdio.h>
#include <stdlib.h>
#include <string.h>
#include <math.h>
#include <time.h>
#include <assert.h>
#include <stdarg.h>
#include <stdbool.h>
#include <stdint.h>
#include <limits.h>
#include <stddef.h>
#include <float.h>
#include <ctype.h>
#include <wchar.h>
#include <wctype.h>
#include <locale.h>
#include <errno.h>
#include <time.h>
#if !(defined(_WIN32) || defined(_WIN64))
#include <unistd.h>
#endif

/*
 *  Detect the current platform
 */
#if defined(_WIN32) || defined(_WIN64)
#define CGL_WINDOWS
#elif defined(__linux__)
#define CGL_LINUX
#elif defined(__APPLE__)
#define CGL_MACOS
#warning "MacOS is not tested yet"
#elif defined(__ANDROID__)
#define CGL_ANDROID
#warning "Android is not tested yet"
#elif defined(__EMSCRIPTEN__)
#define CGL_WASM
#endif

 /*
  *  Detect the current compiler
  */
#if defined(__clang__)
#define CGL_CLANG
#elif defined(__GNUC__) || defined(__GNUG__)
#if defined(__MINGW32__) || defined(__MINGW64__)
#define CGL_MINGW
#endif
#define CGL_GCC
#elif defined(_MSC_VER)
#define CGL_MSVC
#endif


  /*
   * CGL types
   */
typedef unsigned char CGL_ubyte;
typedef unsigned short CGL_ushort;
typedef unsigned int CGL_uint;
typedef unsigned long CGL_ulong;
typedef unsigned long long CGL_ulonglong;
typedef char CGL_byte;
typedef short CGL_short;
typedef int CGL_int;
typedef long CGL_long;
typedef long long CGL_longlong;
typedef float CGL_float;
typedef double CGL_double;
typedef long double CGL_longdouble;
typedef size_t CGL_sizei;
typedef bool CGL_bool;
typedef void CGL_void;

#define CGL_TRUE true
#define CGL_FALSE false

#ifndef CGL_NEWLINE
#ifdef CGL_WINDOWS
#define CGL_NEWLINE "\r\n"
#else
#define CGL_NEWLINE "\n"
#endif
#endif


#ifndef max
#define max(a,b)                                \
    ({ __typeof__ (a) _a = (a);                 \
        __typeof__ (b) _b = (b);                \
     _a > _b ? _a : _b; })
#endif

#ifndef min
#define min(a,b)                                \
    ({ __typeof__ (a) _a = (a);                 \
        __typeof__ (b) _b = (b);                \
     _a < _b ? _a : _b; })
#endif

#ifdef CGL_LOGGING_ENABLED
#define CGL_LOG(...) CGL_log_internal(__VA_ARGS__)
#else
#define CGL_LOG(...)
#endif // CGL_LOG_ENABLED

struct CGL_context;
typedef struct CGL_context CGL_context;

/** @brief Initializes CGL
 *
 * This function initializes CGL. It must be called before
 * any other CGL function.
 *
 * @return true if CGL was initialized successfully
*/
bool CGL_init(); // initialize CGL

/** @brief Shuts down CGL
 *
 * This function shuts down CGL. It must be called after
 * all other CGL functions.
 *
 * @return returns nothing
*/
CGL_void CGL_shutdown(); // shutdown CGL

#endif

#ifndef CGL_EXCLUDE_NETWORKING

/*
 * The error codes for CGL networking
 */
#define CGL_NET_NO_ERROR                    0xAB000
#define CGL_NET_NAME_RESOLUTION_ERROR       0xAB001
#define CGL_NET_INVALID_PARAMATER_ERROR     0xAB002
#define CGL_NET_UNSUPPORTED_ERROR           0xAB003
#define CGL_NET_MEMORY_ERROR                0xAB004
#define CGL_NET_NOT_FOUND_ERROR             0xAB005

struct CGL_net_addrinfo;
typedef struct CGL_net_addrinfo CGL_net_addrinfo;

struct CGL_net_socket;
typedef struct CGL_net_socket CGL_net_socket;

/** @brief Initializes CGL networking system
 *
 * This function initializes CGL networking system.
 * It must be called before any other CGL networking function.
 *
 * @return true if CGL networking was initialized successfully
*/
bool CGL_net_init();

/** @brief Shuts down CGL networking system
 *
 * This function shuts down CGL networking system.
 * Also frees all the resources allocated by CGL
 * networking system.
 *
 * @return returns nothing
 */
CGL_void CGL_net_shutdown();

/** @brief Query system for addrinfo
 *
 * This function queries the system for addrinfo
 * for the given name and port. The addrinfo is
 * stored in the CGL_net_addrinfo struct.
 *
 * @param name the name of the host
 * @param port the port of the host
 * @param count the number of addrinfo returned (output)
 * @return the addrinfo of the host
*/
CGL_net_addrinfo* CGL_net_addrinfo_query(const char* name, const char* port, size_t* count);

/** @brief Destroys the addrinfo
 *
 * This function destroys the addrinfo and frees
 * all the resources allocated by CGL networking
 *
 * @param infos the addrinfo to destroy *
*/
CGL_void CGL_net_addrinfo_destroy(CGL_net_addrinfo* infos);

/** @brief Creates a socket
 *
 * This function creates a socket object and returns
 * it.
 *
 * NOTE: This must be destroyed using CGL_net_socket_destroy
 *
 * @return the socket object
*/
CGL_net_socket* CGL_net_socket_create();

/** @brief Connects a socket to a target addrinfo
 *
 * This function connects the socket to the target
 * specified by the addrinfo.
 *
 * @param socket The socket to connect
 * @param target The target addrinfo
 * @return true if the socket was connected successfully
*/
bool CGL_net_socket_connect(CGL_net_socket* socket, CGL_net_addrinfo* target);

/** @brief Binds a socket to a target addrinfo
 *
 * This function binds the socket to the target
 * specified by the addrinfo.
 *
 * @param socket The socket to bind
 * @param target The target addrinfo
 * @return true if the socket was bound successfully
*/
bool CGL_net_socket_bind(CGL_net_socket* socket, CGL_net_addrinfo* target);

/** @brief Listens for connections on a socket (Server)
 *
 * This function makes the socket listen for connections.
 * This basically sets up the socket as a server.
 *
 * @param socket The socket to listen on
 * @param max_connections The maximum number of connections
 * @return true if the socket was listening successfully
*/
bool CGL_net_socket_listen(CGL_net_socket* socket, size_t max_connections);

/** @brief Accepts a connection on a socket (Server)
 *
 * This function accepts a connection on the socket
 * and returns a new socket object for the connection.
 * The returned object has a connection established
 * with the client and can be used to send and receive
 * data packets over the connection.
 *
 * NOTE: The returned object must be destroyed using CGL_net_socket_close
 *
 * @param socket The socket to accept a connection on
 * @param addrinfo The addrinfo of the socket
 * @return the socket object for the connection if successful, NULL otherwise
*/
CGL_net_socket* CGL_net_socket_accept(CGL_net_socket* socket, CGL_net_addrinfo* addrinfo);

/** @brief Destroys a socket
 *
 * This function destroys the socket and frees
 * all the resources allocated for the socket.
 * It also releases the internal handles of the socket.
 *
 * @param socket The socket to destroy
 * @return returns nothing
*/
CGL_void CGL_net_socket_close(CGL_net_socket* socket);

/** @brief Sends data over a socket
 *
 * This function sends data over the socket.
 *
 * @param socket The socket to send data over
 * @param buffer The buffer to send
 * @param size The size of the buffer
 * @param size_sent The size of the data sent (output)
 * @return true if the data was sent successfully
*/
bool CGL_net_socket_send(CGL_net_socket* socket, void* buffer, size_t size, size_t* size_sent);

/** @brief Receives data over a socket
 *
 * This function receives data over the socket.
 *
 * @param socket The socket to receive data over
 * @param buffer The buffer to receive data into
 * @param size The size of the buffer
 * @param size_recieved The size of the data recieved (output)
 * @return true if the data was recieved successfully
*/
bool CGL_net_socket_recv(CGL_net_socket* socket, void* buffer, size_t size, size_t* size_recieved);

/** @brief Shuts down the send side of a socket
 *
 * This function shuts down the send side of the socket.
 *
 * @param socket The socket to shutdown
 * @return true if the socket was shutdown successfully
*/
bool CGL_net_socket_shutdown_send(CGL_net_socket* socket);

/** @brief Shuts down the receive side of a socket
 *
 * This function shuts down the receive side of the socket.
 *
 * @param socket The socket to shutdown
 * @return true if the socket was shutdown successfully
*/
bool CGL_net_socket_shutdown_recv(CGL_net_socket* socket);

/** @brief Performs a HTTP request
 *
 * This function performs a HTTP request.
 * It internally allocates sockets, establishes
 * connections, sends and receives data.
 * This function is blocking.
 *
 * NOTE: This function is not very stable yet
 *       and should be avoided in production
 *       environments.
 *
 * @param method The HTTP method to use (GET, POST, etc.)
 * @param host The host to connect to (Ex: www.google.com)
 * @param path The path to request (Ex: /search)
 * @param response_buffer The buffer to store the response in (output)
 * @param size The size of the buffer (input) and the size of the response (output)
 * @param accept The accept header to send
 * @param user_agent The user agent header to send
 * @param body The request body to send
 * @return HTTP status code is successful, 0 otherwise
*/
CGL_int CGL_net_http_request(const char* method, const char* host, const char* path, void* response_buffer, size_t* size, const char* accept, const char* user_agent, const char* body);

/** @brief Performs a HTTP GET request
 *
 * This function performs a HTTP GET request.
 *
 * NOTE: This internally calls CGL_net_http_request
 *
 * @param host The host to connect to (Ex: www.google.com)
 * @param path The path to request (Ex: /search)
 * @param buffer The buffer to store the response in (output)
 * @param size The size of the buffer (input) and the size of the response (output)
 * @param accept The accept header to send
 * @param user_agent The user agent header to send
 * @return HTTP status code is successful, 0 otherwise
*/
CGL_int CGL_net_http_get(const char* host, const char* path, void* buffer, size_t* size, const char* accept, const char* user_agent);

/** @brief Performs a HTTP POST request
 *
 * This function performs a HTTP POST request.
 *
 * NOTE: This internally calls CGL_net_http_request
 *
 * @param host The host to connect to (Ex: www.google.com)
 * @param path The path to request (Ex: /search)
 * @param buffer The buffer to store the response in (output)
 * @param size The size of the buffer (input) and the size of the response (output)
 * @param accept The accept header to send
 * @param user_agent The user agent header to send
 * @param body The request body to send
 * @return HTTP status code is successful, 0 otherwise
*/
CGL_int CGL_net_http_post(const char* host, const char* path, void* buffer, size_t* size, const char* accept, const char* user_agent, const char* body);

#ifndef CGL_EXCLUDE_SSL_SOCKET

/** @brief Performs a HTTPS request
 *
 * NOTE: Not implemented yet
 *
 * @param method The HTTP method to use (GET, POST, etc.)
 * @param host The host to connect to (Ex: www.google.com)
 * @param path The path to request (Ex: /search)
 * @param response_buffer The buffer to store the response in (output)
 * @param size The size of the buffer (input) and the size of the response (output)
 * @param accept The accept header to send
 * @param user_agent The user agent header to send
 * @param body The request body to send
 * @return HTTP status code is successful, 0 otherwise
*/
CGL_int CGL_net_https_request(const char* method, const char* host, const char* path, void* response_buffer, size_t* size, const char* accept, const char* user_agent, const char* body);

/** @brief Performs a HTTPS GET request
 *
 * Performs a HTTPS GET request.
 *
 * NOTE: This internally calls CGL_net_https_request
 *
 * @param host The host to connect to (Ex: www.google.com)
 * @param path The path to request (Ex: /search)
 * @param buffer The buffer to store the response in (output)
 * @param size The size of the buffer (input) and the size of the response (output)
 * @param accept The accept header to send
 * @param user_agent The user agent header to send
 * @return HTTP status code is successful, 0 otherwise
*/
CGL_int CGL_net_https_get(const char* host, const char* path, void* buffer, size_t* size, const char* accept, const char* user_agent);

/** @brief Performs a HTTPS POST request
 *
 * Performs a HTTPS POST request.
 *
 * NOTE: This internally calls CGL_net_https_request
 *
 * @param host The host to connect to (Ex: www.google.com)
 * @param path The path to request (Ex: /search)
 * @param buffer The buffer to store the response in (output)
 * @param size The size of the buffer (input) and the size of the response (output)
 * @param accept The accept header to send
 * @param user_agent The user agent header to send
 * @param body The request body to send
 * @return HTTP status code is successful, 0 otherwise
*/
CGL_int CGL_net_https_post(const char* host, const char* path, void* buffer, size_t* size, const char* accept, const char* user_agent, const char* body);


struct CGL_net_ssl_socket;
typedef struct CGL_net_ssl_socket CGL_net_ssl_socket;

/** @brief Creates a new SSL socket
 *
 * This function creates a new SSL socket from
 * the given socket.
 *
 * NOTE: (1) The socket object must be connected before
 *           calling this function.
 *       (2) The socket object will automatically be
 *           destroyed when the SSL socket is destroyed.
 *  *
 * @param socket The socket to create the SSL socket from
 * @return The new SSL socket
*/
CGL_net_ssl_socket* CGL_net_ssl_socket_create(CGL_net_socket* socket);

/** @brief Sends data over the SSL socket
 *
 * This function sends data over the SSL socket.
 *
 * @param socket The SSL socket to send data over
 * @param buffer The buffer to send
 * @param size The size of the buffer
 * @param size_sent The size of the data sent
 * @return CGL_TRUE if successful, CGL_FALSE otherwise
*/
CGL_bool CGL_net_ssl_socket_send(CGL_net_ssl_socket* socket, void* buffer, size_t size, size_t* size_sent);

/** @brief Receives data over the SSL socket
 *
 * This function receives data over the SSL socket.
 *
 * @param socket The SSL socket to receive data over
 * @param buffer The buffer to store the data in
 * @param size The size of the buffer
 * @param size_recieved The size of the data recieved
 * @return CGL_TRUE if successful, CGL_FALSE otherwise
*/

CGL_bool CGL_net_ssl_socket_recv(CGL_net_ssl_socket* socket, void* buffer, size_t size, size_t* size_recieved);

/** @brief Destroys the SSL socket
 *
 * This function destroys the SSL socket.
 * This also destroys the socket object.
 *
 * @param socket The SSL socket to destroy
 * @return returns nothing
*/
CGL_void CGL_net_ssl_socket_destroy(CGL_net_ssl_socket* soc);

/** @brief Logs the SSL errors
 *
 * This function logs the SSL errors if any.
 *
 * @return returns nothing
*/
CGL_void CGL_net_ssl_log_errors();

#endif

#endif

// utils
#if 1
// CGL utils

#ifndef CGL_RAND_GEN_WITH_PROBABILITY_MAX_COUNT
#define CGL_RAND_GEN_WITH_PROBABILITY_MAX_COUNT 100000
#endif

#define CGL_UTILS_FAST_RAND_MAX 32767

CGL_void CGL_utils_sleep(const CGL_sizei milis);
CGL_byte* CGL_utils_read_file(const CGL_byte* path, size_t* size); // read file into memory
const CGL_byte* CGL_utils_get_executable_path();
const CGL_byte* CGL_utils_get_executable_directory();
CGL_sizei CGL_utils_get_file_size(const CGL_byte* path);
CGL_bool CGL_utils_append_file(const CGL_byte* path, const CGL_byte* data, size_t size);
CGL_bool CGL_utils_write_file(const CGL_byte* path, const CGL_byte* data, size_t size); // write data to file
CGL_float CGL_utils_get_time();
CGL_void CGL_utils_get_timestamp(char* buffer);
CGL_bool CGL_utils_is_little_endian();
CGL_sizei CGL_utils_get_random_with_probability(CGL_float* probabilities, CGL_sizei count);
CGL_void CGL_utils_reverse_bytes(void* data, size_t size);
CGL_void CGL_utils_little_endian_to_current(void* data, size_t size);
CGL_void CGL_utils_big_endian_to_current(void* data, size_t size);
CGL_void CGL_utils_fast_srand(CGL_int seed);
CGL_int CGL_utils_fast_rand();
CGL_ulong CGL_utils_xorshf96();
CGL_void CGL_utils_srand31(CGL_uint seed);
CGL_uint CGL_utils_rand31();

#define CGL_utils_is_point_in_rect(px, py, x, y, sx, sy, scx, scy) (bool)((px) >= (x) * (scx) && (px) <= ((x) + (sx)) * (scx) && (py) >= (y) * (scy) && (py) <= ((y) + (sy)) * (scy))
#define CGL_utils_random_float() ((float)rand() / (float)RAND_MAX)
#define CGL_utils_random_float_in_range(min, max) (CGL_utils_random_float() * (max - min) + min)
#define CGL_utils_random_int(min, max) (rand() % (max - min + 1) + min)
#define CGL_utils_random_bool() (rand() % 2)
#define CGL_utils_random_vec2(min, max) (CGL_vec2_init(CGL_utils_random_float() * (max.x - min.x) + min.x, CGL_utils_random_float() * (max.y - min.y) + min.y))
#define CGL_utils_random_vec3(min, max) (CGL_vec3_init(CGL_utils_random_float() * (max.x - min.x) + min.x, CGL_utils_random_float() * (max.y - min.y) + min.y, CGL_utils_random_float() * (max.z - min.z) + min.z))
#define CGL_utils_random_vec4(min, max) (CGL_vec4_init(CGL_utils_random_float() * (max.x - min.x) + min.x, CGL_utils_random_float() * (max.y - min.y) + min.y, CGL_utils_random_float() * (max.z - min.z) + min.z, CGL_utils_random_float() * (max.w - min.w) + min.w))
#define CGL_utils_random_color() (CGL_vec4_init(CGL_utils_random_float(), CGL_utils_random_float(), CGL_utils_random_float(), 1.0f))
#define CGL_utils_clamp(x, minl, maxl) (x < minl ? minl : (x > maxl ? maxl : x))
#define CGL_utils_array_size(array) (sizeof(array) / sizeof(array[0]))
#define CGL_utils_max(a, b) ( ((a) > (b)) ? (a) : (b) )
#define CGL_utils_min(a, b) ( ((a) < (b)) ? (a) : (b) )
#define CGL_utils_mix(x, y, f) (x * f + y * (1.0f - f))
#define CGL_utils_lerp(a, b, t) (a + (b - a) * t)
#define CGL_utils_square(x) ((x) * (x))
#define CGL_utils_cube(x) ((x) * (x) * (x))
#define CGL_utils_map(x, in_min, in_max, out_min, out_max) ( ((x) - (in_min)) * ((out_max) - (out_min)) / ((in_max) - (in_min)) + (out_min) )
CGL_float CGL_utils_sigmoid(CGL_float x);
CGL_float CGL_utils_sigmoid_derivative(CGL_float x);
CGL_float CGL_utils_relu(CGL_float x);
CGL_float CGL_utils_relu_derivative(CGL_float x);
CGL_float CGL_utils_tanh(CGL_float x);
CGL_float CGL_utils_tanh_derivative(CGL_float x);
CGL_float CGL_utils_step(CGL_float x);
CGL_float CGL_utils_step_derivative(CGL_float x);
CGL_float CGL_utils_relu_leaky(CGL_float x);
CGL_float CGL_utils_relu_leaky_derivative(CGL_float x);
CGL_float CGL_utils_relu_smooth(CGL_float x);
CGL_float CGL_utils_relu_smooth_derivative(CGL_float x);
// CGL_vec3 CGL_utils_hsl_to_rgb(CGL_vec3 hsv);

#ifndef CGL_QUICK_SORT_SWAP_BUFFER_SIZE
#define CGL_QUICK_SORT_SWAP_BUFFER_SIZE 1024
#endif
CGL_bool CGL_utils_quick_sort(CGL_void* array, CGL_sizei item_count, CGL_sizei item_size, CGL_int(*comparator)(const CGL_void*, const CGL_void*));

#define CGL_malloc(size) malloc(size)
#define CGL_realloc(ptr, size) realloc(ptr, size)
#define CGL_free(ptr) free(ptr)
#define CGL_exit(code) exit(code)

#define CGL_CONSOLE_COLOR_RESET  0
#define CGL_CONSOLE_COLOR_RED    1
#define CGL_CONSOLE_COLOR_GREEN  2
#define CGL_CONSOLE_COLOR_GRAY   3
#define CGL_CONSOLE_COLOR_BLUE   4

CGL_void CGL_console_set_color(uint8_t color);

CGL_void CGL_printf_red(const char* format, ...);
CGL_void CGL_printf_green(const char* format, ...);
CGL_void CGL_printf_gray(const char* format, ...);
CGL_void CGL_printf_blue(const char* format, ...);
CGL_void CGL_console_progress_bar(CGL_float progress, CGL_int width, CGL_byte* prefix, CGL_byte* suffix, CGL_byte complete_char, CGL_byte incomplete_char);

#endif

#define CGL_LOG_LEVEL_TRACE         0
#define CGL_LOG_LEVEL_INFO          1
#define CGL_LOG_LEVEL_WARN          2
#define CGL_LOG_LEVEL_ERROR         3 
#define CGL_LOG_LEVEL_INTERNAL      4 
#define CGL_LOGGER_MAX_LOG_FILES    32
#define CGL_LOGGER_LOG_BUFFER_SIZE  (1024 * 4)

#ifndef CGL_ENABLE_CONSOLE_LOGGING
#define CGL_ENABLE_CONSOLE_LOGGING true
#endif

#ifndef CGL_DISABLE_LOGGER


struct CGL_logger_context;
typedef struct CGL_logger_context CGL_logger_context;

CGL_void CGL_logger_init(bool enable_console_logging);
CGL_void CGL_logger_shutdown();
CGL_logger_context* CGL_logger_get_context();
CGL_void CGL_logger_set_context(CGL_logger_context* context);
bool CGL_logger_attach_log_file(const char* path);
bool CGL_logger_detach_log_file(const char* path);
CGL_void CGL_logger_flush();
CGL_void CGL_logger_disable_console_logging();
CGL_void CGL_logger_enable_console_logging();
CGL_void CGL_logger_log(CGL_int level, const char* log_format, ...);

#define CGL_trace(...)        CGL_logger_log(CGL_LOG_LEVEL_TRACE, __VA_ARGS__)
#define CGL_info(...)         CGL_logger_log(CGL_LOG_LEVEL_INFO, __VA_ARGS__)
#define CGL_warn(...)         CGL_logger_log(CGL_LOG_LEVEL_WARN, __VA_ARGS__)
#define CGL_error(...)        CGL_logger_log(CGL_LOG_LEVEL_ERROR, __VA_ARGS__)
#ifndef CGL_DISABLE_INTERNAL_LOGGING
#define CGL_log_internal(...) CGL_logger_log(CGL_LOG_LEVEL_INTERNAL, __VA_ARGS__)
#endif

#else
#define CGL_logger_init(...)
#define CGL_logger_shutdown()
#define CGL_logger_get_context() NULL
#define CGL_logger_set_context(...)
#define CGL_logger_attach_log_file(path)
#define CGL_logger_dettach_log_file(path)
#define CGL_logger_flush()
#define CGL_logger_disable_console_logging()
#define CGL_logger_enable_console_logging()
#define CGL_logger_log(...)
#define CGL_info(...)
#define CGL_trace(...)
#define CGL_warn(...)
#define CGL_error(...)
#define CGL_log_internal(...)
#endif

// math and data structures
#if 1 // Just to use code folding

// data structures

struct CGL_list;
typedef struct CGL_list CGL_list;

CGL_list* CGL_list_create(size_t item_size, size_t initial_capacity);
CGL_void CGL_list_destroy(CGL_list* list);
CGL_void CGL_list_set_increase_factor(CGL_list* list, CGL_float increase_factor);
CGL_float CGL_list_get_increase_factor(CGL_list* list);
CGL_sizei CGL_list_get_item_size(CGL_list* list);
CGL_sizei CGL_list_get_size(CGL_list* list);
CGL_sizei CGL_list_get_capacity(CGL_list* list);
CGL_sizei  CGL_list_push(CGL_list* list, void* data);
CGL_sizei CGL_list_pop(CGL_list* list, void* data);
CGL_void* CGL_list_get(CGL_list* list, size_t index, void* data);
CGL_void* CGL_list_get_random(CGL_list* list, void* data);
CGL_void* CGL_list_set(CGL_list* list, size_t index, void* data);
CGL_bool CGL_list_is_empty(CGL_list* list);
CGL_void CGL_list_clear(CGL_list* list);
CGL_sizei CGL_list_find(CGL_list* list, void* data);
CGL_void CGL_list_reserve(CGL_list* list, size_t size);
CGL_void CGL_list_fill(CGL_list* list, size_t size);

#ifndef CGL_HASHTABLE_MAX_KEY_SIZE
#define CGL_HASHTABLE_MAX_KEY_SIZE 256
#endif

#ifndef CGL_HASHTABLE_ENTRY_STATIC_VALUE_SIZE
#define CGL_HASHTABLE_ENTRY_STATIC_VALUE_SIZE sizeof(uint64_t)
#endif

struct CGL_hashtable_entry;
typedef struct CGL_hashtable_entry CGL_hashtable_entry;

struct CGL_hashtable;
typedef struct CGL_hashtable CGL_hashtable;

struct CGL_hashtable_iterator;
typedef struct CGL_hashtable_iterator CGL_hashtable_iterator;

typedef uint32_t(*CGL_hash_function)(const void*, size_t);

// set key size to 0 if it is a string (it will be auto calculated using strlen)
CGL_hashtable* CGL_hashtable_create(size_t table_size, size_t key_size, size_t initial_capacity);
CGL_void CGL_hashtable_set_growth_rate(CGL_hashtable* table, CGL_float rate);
size_t CGL_hashtable_get_size(CGL_hashtable* table);
CGL_void CGL_hashtable_destroy(CGL_hashtable* table);
CGL_void CGL_hashtable_set(CGL_hashtable* table, const void* key, const void* value, size_t value_size);
size_t CGL_hashtable_get(CGL_hashtable* table, const void* key, void* value);
CGL_void* CGL_hashtable_get_ptr(CGL_hashtable* table, const void* key, size_t* value);
bool CGL_hashtable_exists(CGL_hashtable* table, const void* key);
bool CGL_hashtable_remove(CGL_hashtable* table, const void* key);
CGL_void CGL_hashtable_set_hash_function(CGL_hashtable* table, CGL_hash_function hash_function);
CGL_hashtable_iterator* CGL_hashtable_iterator_create(CGL_hashtable* table);
CGL_void CGL_hashtable_iterator_destroy(CGL_hashtable_iterator* iterator);
CGL_void CGL_hashtable_iterator_reset(CGL_hashtable_iterator* iterator);
bool CGL_hashtable_iterator_next(CGL_hashtable_iterator* iterator, void* key, void* data, size_t* size);
bool CGL_hashtable_iterator_curr(CGL_hashtable_iterator* iterator, void* key, void* data, size_t* size);
CGL_void* CGL_hashtable_iterator_curr_key(CGL_hashtable_iterator* iterator);

// getter setters for data types
#define CGL_DECLARE_HASHTABLE_GETTER_SETTER(type) \
    inline type CGL_hashtable_get_##type (CGL_hashtable* table, const void* key)\
    { \
        type value; \
        CGL_hashtable_get(table, key, &value); \
        return value; \
    } \
    \
    inline void CGL_hashtable_set_##type (CGL_hashtable* table, const void* key, type value) \
    { \
        CGL_hashtable_set(table, key, &value, sizeof(value)); \
    }

#ifndef CDL_DONT_DECLARE_HASHTABLE_STD_GETTER_SETTERS

inline void CGL_hashtable_set_string(CGL_hashtable* table, const void* key, const char* value)
{
	CGL_hashtable_set(table, key, value, strlen(value) + 1);
}

CGL_DECLARE_HASHTABLE_GETTER_SETTER(int8_t)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(int16_t)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(int32_t)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(int64_t)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(uint8_t)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(uint16_t)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(uint32_t)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(uint64_t)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(float)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(double)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(bool)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(int)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(long)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(short)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(char)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(intptr_t)
CGL_DECLARE_HASHTABLE_GETTER_SETTER(uintptr_t)

#endif


// algorithms
uint32_t CGL_utils_crc32(const void* data, size_t size);
uint64_t CGL_utils_crc64(const void* data, size_t size);
CGL_void CGL_utils_rot13(const char* data_in, char* data_out);
uint32_t CGL_utils_super_fast_hash(const void* data, size_t size);

// threads
#ifndef CGL_EXCLUDES_THREADS
struct CGL_thread;
typedef struct CGL_thread CGL_thread;

#ifdef CGL_WINDOWS
typedef void (*CGL_thread_function)(void*);
#else
typedef void* (*CGL_thread_function)(void*);
#endif

struct CGL_mutex;
typedef struct CGL_mutex CGL_mutex;

CGL_thread* CGL_thread_create();
bool CGL_thread_start(CGL_thread* thread, CGL_thread_function function, void* argument);
CGL_void CGL_thread_destroy(CGL_thread* thread);
bool CGL_thread_join(CGL_thread* thread);
bool CGL_thread_joinable(CGL_thread* thread);
bool CGL_thread_is_running(CGL_thread* thread);

uintptr_t CGL_thread_get_id(CGL_thread* thread);

CGL_mutex* CGL_mutex_create(bool set);
CGL_void CGL_mutex_destroy(CGL_mutex* mutex);
int CGL_mutex_lock(CGL_mutex* mutex, uint64_t timeout);
CGL_void CGL_mutex_release(CGL_mutex* mutex);
#endif

// math

struct CGL_vec2
{
	CGL_float x;
	CGL_float y;
#ifdef __cplusplus
	CGL_vec2() : x(0), y(0) {}
	CGL_vec2(CGL_float x, CGL_float y) : x(x), y(y) {}
#endif
};
typedef struct CGL_vec2 CGL_vec2;

struct CGL_vec3
{
	CGL_float x;
	CGL_float y;
	CGL_float z;
#ifdef __cplusplus
	CGL_vec3() : x(0), y(0), z(0) {}
	CGL_vec3(CGL_float x, CGL_float y, CGL_float z) : x(x), y(y), z(z) {}
#endif
};
typedef struct CGL_vec3 CGL_vec3;

struct CGL_vec4
{
	CGL_float x;
	CGL_float y;
	CGL_float z;
	CGL_float w;
#ifdef __cplusplus
	CGL_vec4() : x(0), y(0), z(0), w(0) {}
	CGL_vec4(CGL_float x, CGL_float y, CGL_float z, CGL_float w) : x(x), y(y), z(z), w(w) {}
#endif
};
typedef struct CGL_vec4 CGL_vec4;
typedef struct CGL_vec4 CGL_color;

struct CGL_ivec4
{
	CGL_int x;
	CGL_int y;
	CGL_int z;
	CGL_int w;
#ifdef __cplusplus
	CGL_ivec4() : x(0), y(0), z(0), w(0) {}
	CGL_ivec4(CGL_int x, CGL_int y, CGL_int z, CGL_int w) : x(x), y(y), z(z), w(w) {}
#endif
};
typedef struct CGL_ivec4 CGL_ivec4;

struct CGL_mat3
{
	CGL_float m[9];
#ifdef __cplusplus
	CGL_mat3()
	{
		m[0] = 1; m[3] = 0; m[6] = 0;
		m[1] = 0; m[4] = 1; m[7] = 0;
		m[2] = 0; m[5] = 0; m[8] = 1;
	}

	CGL_mat3(CGL_float m0, CGL_float m1, CGL_float m2, CGL_float m3, CGL_float m4, CGL_float m5, CGL_float m6, CGL_float m7, CGL_float m8)
	{
		m[0] = m0; m[3] = m1; m[6] = m2;
		m[1] = m3; m[4] = m4; m[7] = m5;
		m[2] = m6; m[5] = m7; m[8] = m8;
	}
#endif
};
typedef struct CGL_mat3 CGL_mat3;

struct CGL_mat4
{
	CGL_float m[16];
#ifdef __cplusplus
	CGL_mat4()
	{
		m[0] = 1;   m[4] = 0;   m[8] = 0;     m[12] = 0;
		m[1] = 0;   m[5] = 1;   m[9] = 0;     m[13] = 0;
		m[2] = 0;   m[6] = 0;   m[10] = 1;    m[14] = 0;
		m[3] = 0;   m[7] = 0;   m[11] = 0;    m[15] = 1;
	}

	CGL_mat4(CGL_float m0, CGL_float m1, CGL_float m2, CGL_float m3,
		CGL_float m4, CGL_float m5, CGL_float m6, CGL_float m7,
		CGL_float m8, CGL_float m9, CGL_float m10, CGL_float m11,
		CGL_float m12, CGL_float m13, CGL_float m14, CGL_float m15)
	{
		m[0] = m0;   m[4] = m1;   m[8] = m2;     m[12] = m3;
		m[1] = m4;   m[5] = m5;   m[9] = m6;     m[13] = m7;
		m[2] = m8;   m[6] = m9;   m[10] = m10;   m[14] = m11;
		m[3] = m12;  m[7] = m13;  m[11] = m14;   m[15] = m15;
	}
#endif
};
typedef struct CGL_mat4 CGL_mat4;

struct CGL_quat
{
	CGL_vec3 vec;
	CGL_float w;
#ifdef __cplusplus
	CGL_quat() : vec(CGL_vec3(0, 0, 0)), w(0) {}
	CGL_quat(CGL_float x, CGL_float y, CGL_float z, CGL_float w) : vec(CGL_vec3(x, y, z)), w(w) {}
#endif
};
typedef struct CGL_quat CGL_quat;

// math functions with macros

#define CGL_PI (3.14159265358979323846f)
#define CGL_2PI (6.28318530717958647692f)
#define CGL_PI_2 (1.57079632679489661923f)
#define CGL_E (2.71828182845904523536f)
#define CGL_SQRT2 (1.41421356237309504880f)
#define CGL_SQRT3 (1.73205080756887729352f)
#define CGL_SQRT5 (2.23606797749978969640f)
#define CGL_SQRT6 (2.44948974278317809820f)
#define CGL_SQRT7 (2.64575131106459059050f)
#define CGL_SQRT8 (2.82842712474619009760f)
#define CGL_deg_to_rad(deg) ((deg) * (CGL_PI / 180.0f))
#define CGL_rad_to_deg(rad) ((rad) * (180.0f / CGL_PI))

#define CGL_float_lerp(a, b, t) (((a) * (1.0f - (t))) + ((b) * (t)))
CGL_float CGL_float_quadratic_lerp(CGL_float a, CGL_float b, CGL_float c, CGL_float t);
CGL_float CGL_float_cubic_lerp(CGL_float a, CGL_float b, CGL_float c, CGL_float d, CGL_float t);


#ifdef __cplusplus
#define CGL_vec2_init(x, y) CGL_vec2(x, y)
#else
#define CGL_vec2_init(x, y) ((CGL_vec2){(x), (y)})
#endif

#define CGL_vec2_add(a, b) CGL_vec2_init(a.x + b.x, a.y + b.y)
#define CGL_vec2_add_scaled(a, b, scale) CGL_vec2_init((a).x + (b).x * (scale), (a).y + (b).y * (scale))
#define CGL_vec2_sub(a, b) CGL_vec2_init(a.x - b.x, a.y - b.y)
#define CGL_vec2_mul(a, b) CGL_vec2_init(a.x * b.x, a.y * b.y)
#define CGL_vec2_div(a, b) CGL_vec2_init(a.x / b.x, a.y / b.y)
#define CGL_vec2_scale(a, s) CGL_vec2_init(a.x * (s), a.y * (s))
#define CGL_vec2_dot(a, b) (a.x * b.x + a.y * b.y)
#define CGL_vec2_length(a) sqrtf(a.x * a.x + a.y * a.y)
#define CGL_vec2_normalize(a) { CGL_float __CGL_vector_length##__LINE__ = 1.0f / CGL_vec2_length(a); a.x *= __CGL_vector_length##__LINE__; a.y *= __CGL_vector_length##__LINE__; }
#define CGL_vec2_lerp(a, b, t) CGL_vec2_init(a.x + (b.x - a.x) * t, a.y + (b.y - a.y) * t)
#define CGL_vec2_min(a, b) CGL_vec2_init(a.x < b.x ? a.x : b.x, a.y < b.y ? a.y : b.y)
#define CGL_vec2_max(a, b) CGL_vec2_init(a.x > b.x ? a.x : b.x, a.y > b.y ? a.y : b.y)
#define CGL_vec2_equal(a, b) (a.x == b.x && a.y == b.y)
#define CGL_vec2_rotate_about_point(a, p, theta) CGL_vec2_init(((a.x - p.x) * cosf(theta) - (a.y - p.y) * sinf(theta) ), ((a.x - p.x) * sinf(theta) + (a.y - p.y) * cosf(theta)))
#define CGL_vec2_centroid_of_triangle(a, b, c) CGL_vec2_init((a.x + b.x + c.x) / 3.0f, (a.y + b.y + c.y) / 3.0f)
#define CGL_vec2_from_angle(theta) CGL_vec2_init(cosf(theta), sinf(theta))
#define CGL_vec2_angle_between(a, b) acosf(CGL_vec2_dot(a, b) / (CGL_vec2_length(a) * CGL_vec2_length(b)))
#define CGL_vec2_angle(a) atan2f(a.y, a.x)
#define CGL_vec2_angle_from_to(a, b) atan2f(b.y - a.y, b.x - a.x)
#define CGL_vec2_reflect(a, n) CGL_vec2_sub(a, CGL_vec2_scale(n, 2.0f * CGL_vec2_dot(a, n)))
#define CGL_vec2_perpendicular(a) CGL_vec2_init(-a.y, a.x)
#define CGL_vec2_create_from_higher_dimension(a) CGL_vec2_init(a.x, a.y)
#define CGL_vec2_elem_get(a, i) ((float*)&a)[i]
#define CGL_vec2_elem_set(a, i, v) (((float*)&a)[i] = v)
#define CGL_vec2_distance(a, b) (CGL_float)(sqrtf(((a).x - (b).x) * ((a).x - (b).x) + ((a).y - (b).y) * ((a).y - (b).y)))
CGL_vec2 CGL_vec2_triple_product(CGL_vec2 a, CGL_vec2 b, CGL_vec2 c);

#ifdef __cplusplus
#define CGL_vec3_init(x, y, z) CGL_vec3(x, y, z)
#else
#define CGL_vec3_init(x, y, z) ((CGL_vec3){(x), (y), (z)})
#endif
#define CGL_vec3_add(a, b) CGL_vec3_init(a.x + b.x, a.y + b.y, a.z + b.z)
#define CGL_vec3_add_scaled(a, b, scale) CGL_vec3_init((a).x + (b).x * (scale), (a).y + (b).y * (scale), (a).z + (b).z * (scale))
#define CGL_vec3_sub(a, b) CGL_vec3_init(a.x - b.x, a.y - b.y, a.z - b.z)
#define CGL_vec3_mul(a, b) CGL_vec3_init(a.x * b.x, a.y * b.y, a.z * b.z)
#define CGL_vec3_div(a, b) CGL_vec3_init(a.x / b.x, a.y / b.y, a.z / b.z)
#define CGL_vec3_scale(a, s) CGL_vec3_init(a.x * (s), a.y * (s), a.z * (s))
#define CGL_vec3_dot(a, b) (a.x * b.x + a.y * b.y + a.z * b.z)
#define CGL_vec3_cross(a, b) CGL_vec3_init(a.y * b.z - a.z * b.y, a.z * b.x - a.x * b.z, a.x * b.y - a.y * b.x)
#define CGL_vec3_length(a) sqrtf(a.x * a.x + a.y * a.y + a.z * a.z)
#define CGL_vec3_distance(a, b) (CGL_float)(sqrtf(((a).x - (b).x) * ((a).x - (b).x) + ((a).y - (b).y) * ((a).y - (b).y) + ((a).z - (b).z) * ((a).z - (b).z)))
#define CGL_vec3_normalize(a) { CGL_float __CGL_vector_length##__LINE__ = 1.0f / CGL_vec3_length(a); a.x *= __CGL_vector_length##__LINE__; a.y *= __CGL_vector_length##__LINE__; a.z *= __CGL_vector_length##__LINE__; }
#define CGL_vec3_lerp(a, b, t) CGL_vec3_init(a.x + (b.x - a.x) * t, a.y + (b.y - a.y) * t, a.z + (b.z - a.z) * t)
#define CGL_vec3_min(a, b) CGL_vec3_init(a.x < b.x ? a.x : b.x, a.y < b.y ? a.y : b.y, a.z < b.z ? a.z : b.z)
#define CGL_vec3_max(a, b) CGL_vec3_init(a.x > b.x ? a.x : b.x, a.y > b.y ? a.y : b.y, a.z > b.z ? a.z : b.z)
#define CGL_vec3_equal(a, b) (a.x == b.x && a.y == b.y && a.z == b.z)
#define CGL_vec3_rotate_x(a, theta) CGL_vec3_init(a.x, a.y * cosf(theta) - a.z * sinf(theta), a.y * sinf(theta) + a.z * cosf(theta))
#define CGL_vec3_rotate_y(v, theta) CGL_vec3_init(v.x * cosf(theta) + v.z * sinf(theta), v.y, -v.x * sinf(theta) + v.z * cosf(theta))
#define CGL_vec3_rotate_z(v, theta) CGL_vec3_init(v.x * cosf(theta) - v.y * sinf(theta), v.x * sinf(theta) + v.y * cosf(theta), v.z)
#define CGL_vec3_centroid_of_triangle(a, b, c) CGL_vec3_init((a.x + b.x + c.x) / 3.0f, (a.y + b.y + c.y) / 3.0f, (a.z + b.z + c.z) / 3.0f)
#define CGL_vec3_from_angle(theta) CGL_vec3_init(cosf(theta), sinf(theta), 0.0f)
#define CGL_vec3_angle_between(a, b) acosf(CGL_vec3_dot(a, b) / (CGL_vec3_length(a) * CGL_vec3_length(b)))
#define CGL_vec3_from_spherical_coordinates(r, theta, phi) CGL_vec3_init(r * sinf(theta) * cosf(phi), r * sinf(theta) * sinf(phi), r * cosf(theta))
#define CGL_vec3_to_spherical_coordinates(a) CGL_vec3_init(sqrtf(a.x * a.x + a.y * a.y + a.z * a.z), acosf(a.z / sqrtf(a.x * a.x + a.y * a.y + a.z * a.z)), atan2f(a.y, a.x))
#define CGL_vec3_from_higher_dimension(a) CGL_vec3_init(a.x, a.y, a.z)
#define CGL_vec3_from_vec2(a, z) CGL_vec3_init(a.x, a.y, z)
#define CGL_vec3_elem_get(a, i) ((float*)&a)[i]
#define CGL_vec3_elem_set(a, i, v) (((float*)&a)[i] = v)
CGL_vec3 CGL_vec3_reflect(CGL_vec3 a, CGL_vec3 n);
CGL_vec3 CGL_vec3_rotate_about_axis(CGL_vec3 v, CGL_vec3 axis, CGL_float theta);
CGL_vec3 CGL_vec3_triple_product(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c);
CGL_void CGL_vec3_calculate_orthonormal_basis_from_one_vector(CGL_vec3 a, CGL_vec3* pb, CGL_vec3* pc);

#ifdef __cplusplus
#define CGL_vec4_init(x, y, z, w) CGL_vec4(x, y, z, w)
#else
#define CGL_vec4_init(x, y, z, w) ((CGL_vec4){x, y, z, w})
#endif
#define CGL_vec4_add(a, b) CGL_vec4_init(a.x + b.x, a.y + b.y, a.z + b.z, a.w + b.w)
#define CGL_vec4_sub(a, b) CGL_vec4_init(a.x - b.x, a.y - b.y, a.z - b.z, a.w - b.w)
#define CGL_vec4_mul(a, b) CGL_vec4_init(a.x * b.x, a.y * b.y, a.z * b.z, a.w * b.w)
#define CGL_vec4_div(a, b) CGL_vec4_init(a.x / b.x, a.y / b.y, a.z / b.z, a.w / b.w)
#define CGL_vec4_scale(a, s) CGL_vec4_init(a.x * s, a.y * s, a.z * s, a.w * s)
#define CGL_vec4_dot(a, b) (a.x * b.x + a.y * b.y + a.z * b.z + a.w * b.w)
#define CGL_vec4_lerp(a, b, t) CGL_vec4_init(a.x + (b.x - a.x) * t, a.y + (b.y - a.y) * t, a.z + (b.z - a.z) * t, a.w + (b.w - a.w) * t)
#define CGL_vec4_min(a, b) CGL_vec4_init(a.x < b.x ? a.x : b.x, a.y < b.y ? a.y : b.y, a.z < b.z ? a.z : b.z, a.w < b.w ? a.w : b.w)
#define CGL_vec4_max(a, b) CGL_vec4_init(a.x > b.x ? a.x : b.x, a.y > b.y ? a.y : b.y, a.z > b.z ? a.z : b.z, a.w > b.w ? a.w : b.w)
#define CGL_vec4_equal(a, b) (a.x == b.x && a.y == b.y && a.z == b.z && a.w == b.w)
#define CGL_vec4_normalize(a) { CGL_float __CGL_vector_length##__LINE__ = 1.0f / CGL_vec4_length(a); a.x *= __CGL_vector_length##__LINE__; a.y *= __CGL_vector_length##__LINE__; a.z *= __CGL_vector_length##__LINE__; a.w *= __CGL_vector_length##__LINE__; }
#define CGL_vec4_normalize_vec3(a) { CGL_float __CGL_vector_length##__LINE__ = 1.0f / CGL_vec3_length(a); a.x *= __CGL_vector_length##__LINE__; a.y *= __CGL_vector_length##__LINE__; a.z *= __CGL_vector_length##__LINE__; }
#define CGL_vec4_centroid_of_triangle(a, b, c) CGL_vec4_init((a.x + b.x + c.x) / 3.0f, (a.y + b.y + c.y) / 3.0f, (a.z + b.z + c.z) / 3.0f, (a.w + b.w + c.w) / 3.0f)
#define CGL_vec4_from_vec3(a, w) CGL_vec4_init(a.x, a.y, a.z, w)
#define CGL_vec4_from_vec2(a, z, w) CGL_vec4_init(a.x, a.y, z, w)
#define CGL_vec4_elem_get(a, i) ((float*)&a)[i]
#define CGL_vec4_elem_set(a, i, v) (((float*)&a)[i] = v)
CGL_vec4 CGL_vec4_triple_product(CGL_vec4 a, CGL_vec4 b, CGL_vec4 c);

#ifdef __cplusplus
#define CGL_ivec4_init(x, y, z, w) CGL_ivec4(x, y, z, w)
#else
#define CGL_ivec4_init(x, y, z, w) ((CGL_ivec4){x, y, z, w})
#endif

#ifdef __cplusplus
#define CGL_mat3_init(a, b, c, d, e, f, g, h, i) CGL_mat3(a, b, c, d, e, f, g, h, i)
#else
#define CGL_mat3_init(m00, m01, m02, m10, m11, m12, m20, m21, m22) (CGL_mat3) \
{ \
    { \
        m00, m10, m20, \
        m01, m11, m21, \
        m02, m12, m22  \
    } \
}
#endif

#define CGL_mat3_add(a, b) (CGL_mat3){a.m[0] + b.m[0], a.m[1] + b.m[1], a.m[2] + b.m[2], a.m[3] + b.m[3], a.m[4] + b.m[4], a.m[5] + b.m[5], a.m[6] + b.m[6], a.m[7] + b.m[7], a.m[8] + b.m[8]}
#define CGL_mat3_sub(a, b) (CGL_mat3){a.m[0] - b.m[0], a.m[1] - b.m[1], a.m[2] - b.m[2], a.m[3] - b.m[3], a.m[4] - b.m[4], a.m[5] - b.m[5], a.m[6] - b.m[6], a.m[7] - b.m[7], a.m[8] - b.m[8]}
CGL_float CGL_mat3_det(CGL_mat3 a);
CGL_float CGL_mat3_trace(CGL_mat3 a);
CGL_mat3 CGL_mat3_transpose(CGL_mat3 a);

#define CGL_mat3_zero() CGL_mat3_init( \
    0.0f, 0.0f, 0.0f, \
    0.0f, 0.0f, 0.0f, \
    0.0f, 0.0f, 0.0f  \
)

#define CGL_mat3_identity() CGL_mat3_init( \
    1.0f, 0.0f, 0.0f, \
    0.0f, 1.0f, 0.0f, \
    0.0f, 0.0f, 1.0f  \
)

#define CGL_mat3_log(a) CGL_info( \
    "\n{\n" \
    "    {%f, %f, %f}\n" \
    "    {%f, %f, %f}\n" \
    "    {%f, %f, %f}\n" \
    "}\n", \
    a.m[0], a.m[3], a.m[6], \
    a.m[1], a.m[4], a.m[7], \
    a.m[2], a.m[5], a.m[8]  \
)


/*
#define CGL_mat4_init(m00, m01, m02, m03, m10, m11, m12, m13, m20, m21, m22, m23, m30, m31, m32, m33) (CGL_mat4) \
{ \
	{ \
		m00, m01, m02, m03, \
		m10, m11, m12, m13, \
		m20, m21, m22, m23, \
		m30, m31, m32, m33 \
	} \
}
*/

#ifdef __cplusplus
#define CGL_mat4_init(a, b, c, d, e, f, g, h, i, j, k, l, m, n, o, p) CGL_mat4(a, b, c, d, e, f, g, h, i, j, k, l, m, n, o, p)
#else
#define CGL_mat4_init(m00, m01, m02, m03, m10, m11, m12, m13, m20, m21, m22, m23, m30, m31, m32, m33) (CGL_mat4) \
{ \
    { \
        m00, m10, m20, m30, \
        m01, m11, m21, m31, \
        m02, m12, m22, m32, \
        m03, m13, m23, m33 \
    } \
}
#endif

#define CGL_mat4_add(a, b) CGL_mat_init( \
    CGL_mat4_elem_get(a, 0, 0) + CGL_mat4_elem_get(b, 0, 0), CGL_mat4_elem_get(a, 0, 1) + CGL_mat4_elem_get(b, 0, 1), CGL_mat4_elem_get(a, 0, 2) + CGL_mat4_elem_get(b, 0, 2), CGL_mat4_elem_get(a, 0, 3) + CGL_mat4_elem_get(b, 0, 3), \
    CGL_mat4_elem_get(a, 1, 0) + CGL_mat4_elem_get(b, 1, 0), CGL_mat4_elem_get(a, 1, 1) + CGL_mat4_elem_get(b, 1, 1), CGL_mat4_elem_get(a, 1, 2) + CGL_mat4_elem_get(b, 1, 2), CGL_mat4_elem_get(a, 1, 3) + CGL_mat4_elem_get(b, 1, 3), \
    CGL_mat4_elem_get(a, 2, 0) + CGL_mat4_elem_get(b, 2, 0), CGL_mat4_elem_get(a, 2, 1) + CGL_mat4_elem_get(b, 2, 1), CGL_mat4_elem_get(a, 2, 2) + CGL_mat4_elem_get(b, 2, 2), CGL_mat4_elem_get(a, 2, 3) + CGL_mat4_elem_get(b, 2, 3), \
    CGL_mat4_elem_get(a, 3, 0) + CGL_mat4_elem_get(b, 3, 0), CGL_mat4_elem_get(a, 3, 1) + CGL_mat4_elem_get(b, 3, 1), CGL_mat4_elem_get(a, 3, 2) + CGL_mat4_elem_get(b, 3, 2), CGL_mat4_elem_get(a, 3, 3) + CGL_mat4_elem_get(b, 3, 3)  \
)

#define CGL_mat4_sub(a, b) CGL_mat_init( \
    CGL_mat4_elem_get(a, 0, 0) - CGL_mat4_elem_get(b, 0, 0), CGL_mat4_elem_get(a, 0, 1) - CGL_mat4_elem_get(b, 0, 1), CGL_mat4_elem_get(a, 0, 2) - CGL_mat4_elem_get(b, 0, 2), CGL_mat4_elem_get(a, 0, 3) - CGL_mat4_elem_get(b, 0, 3), \
    CGL_mat4_elem_get(a, 1, 0) - CGL_mat4_elem_get(b, 1, 0), CGL_mat4_elem_get(a, 1, 1) - CGL_mat4_elem_get(b, 1, 1), CGL_mat4_elem_get(a, 1, 2) - CGL_mat4_elem_get(b, 1, 2), CGL_mat4_elem_get(a, 1, 3) - CGL_mat4_elem_get(b, 1, 3), \
    CGL_mat4_elem_get(a, 2, 0) - CGL_mat4_elem_get(b, 2, 0), CGL_mat4_elem_get(a, 2, 1) - CGL_mat4_elem_get(b, 2, 1), CGL_mat4_elem_get(a, 2, 2) - CGL_mat4_elem_get(b, 2, 2), CGL_mat4_elem_get(a, 2, 3) - CGL_mat4_elem_get(b, 2, 3), \
    CGL_mat4_elem_get(a, 3, 0) - CGL_mat4_elem_get(b, 3, 0), CGL_mat4_elem_get(a, 3, 1) - CGL_mat4_elem_get(b, 3, 1), CGL_mat4_elem_get(a, 3, 2) - CGL_mat4_elem_get(b, 3, 2), CGL_mat4_elem_get(a, 3, 3) - CGL_mat4_elem_get(b, 3, 3)  \
)

#define CGL_mat4_mul_scalar(a, s) CGL_mat4_init( \
    CGL_mat4_elem_get(a, 0, 0) * s, CGL_mat4_elem_get(a, 0, 1) * s, CGL_mat4_elem_get(a, 0, 2) * s, CGL_mat4_elem_get(a, 0, 3) * s, \
    CGL_mat4_elem_get(a, 1, 0) * s, CGL_mat4_elem_get(a, 1, 1) * s, CGL_mat4_elem_get(a, 1, 2) * s, CGL_mat4_elem_get(a, 1, 3) * s, \
    CGL_mat4_elem_get(a, 2, 0) * s, CGL_mat4_elem_get(a, 2, 1) * s, CGL_mat4_elem_get(a, 2, 2) * s, CGL_mat4_elem_get(a, 2, 3) * s, \
    CGL_mat4_elem_get(a, 3, 0) * s, CGL_mat4_elem_get(a, 3, 1) * s, CGL_mat4_elem_get(a, 3, 2) * s, CGL_mat4_elem_get(a, 3, 3) * s  \
)

CGL_mat4 CGL_mat4_mul(CGL_mat4 a, CGL_mat4 b);
CGL_float CGL_mat4_det(CGL_mat4 m);
CGL_float CGL_mat4_det_by_lu(CGL_mat4 m);
CGL_float CGL_mat4_det_by_gauss(CGL_mat4 m);
CGL_vec4 CGL_mat4_mul_vec4(CGL_mat4 m, CGL_vec4 v);
CGL_mat4 CGL_mat4_inverse(CGL_mat4 m);
CGL_mat4 CGL_mat4_transpose(CGL_mat4 m);
CGL_mat4 CGL_mat4_adjoint(CGL_mat4 m);
CGL_mat4 CGL_mat4_gauss_elim(CGL_mat4 m);
CGL_int CGL_mat4_rank(CGL_mat4 m);
CGL_float CGL_mat4_trace(CGL_mat4 m);
CGL_mat3 CGL_mat4_to_mat3(CGL_mat4 m);
CGL_mat4 CGL_mat4_from_mat3(CGL_mat3 m);
CGL_mat4 CGL_mat4_rotate_about_axis(CGL_vec3 axis, CGL_float angle);
CGL_mat4 CGL_mat4_look_at(CGL_vec3 eye, CGL_vec3 target, CGL_vec3 up);
CGL_mat4 CGL_mat4_lerp(CGL_mat4 a, CGL_mat4 b, CGL_float t);
CGL_void CGL_mat4_decompose_lu(CGL_mat4 m, CGL_mat4* l, CGL_mat4* u);

#define CGL_mat4_is_invertible(m) (CGL_mat4_det(m) != 0.0f)

//#define CGL_mat4_elem_get(mat, row, col) ((mat).m[row + col * 4])
//#define CGL_mat4_elem_set(mat, row, col, value) ((mat).m[row + col * 4] = value)

#define CGL_mat4_elem_get(mat, row, col) ((mat).m[row * 4 + col])
#define CGL_mat4_elem_set(mat, row, col, value) ((mat).m[row * 4 + col] = value)

#define CGL_mat3_elem_get(mat, row, col) ((mat).m[row + col * 3])
#define CGL_mat3_elem_set(mat, row, col, value) ((mat).m[row + col * 3] = value)

#define CGL_mat4_zero() CGL_mat4_init(\
    0.0f, 0.0f, 0.0f, 0.0f, \
    0.0f, 0.0f, 0.0f, 0.0f, \
    0.0f, 0.0f, 0.0f, 0.0f, \
    0.0f, 0.0f, 0.0f, 0.0f \
)

#define CGL_mat4_identity() CGL_mat4_init(\
    1.0f, 0.0f, 0.0f, 0.0f, \
    0.0f, 1.0f, 0.0f, 0.0f, \
    0.0f, 0.0f, 1.0f, 0.0f, \
    0.0f, 0.0f, 0.0f, 1.0f \
)

#define CGL_mat4_scale(x, y, z) CGL_mat4_init(\
    x, 0.0f, 0.0f, 0.0f, \
    0.0f, y, 0.0f, 0.0f, \
    0.0f, 0.0f, z, 0.0f, \
    0.0f, 0.0f, 0.0f, 1.0f \
)

#define CGL_mat4_translate(x, y, z) CGL_mat4_init(\
    1.0f, 0.0f, 0.0f, x, \
    0.0f, 1.0f, 0.0f, y, \
    0.0f, 0.0f, 1.0f, z, \
    0.0f, 0.0f, 0.0f, 1.0f \
)

#define CGL_mat4_rotate_x(angle) CGL_mat4_init(\
    1.0f, 0.0f, 0.0f, 0.0f, \
    0.0f, cosf(angle), -sinf(angle), 0.0f, \
    0.0f, sinf(angle), cosf(angle), 0.0f, \
    0.0f, 0.0f, 0.0f, 1.0f \
)

#define CGL_mat4_rotate_y(angle) CGL_mat4_init(\
    cosf(angle), 0.0f, sinf(angle), 0.0f, \
    0.0f, 1.0f, 0.0f, 0.0f, \
    -sinf(angle), 0.0f, cosf(angle), 0.0f, \
    0.0f, 0.0f, 0.0f, 1.0f \
)

#define CGL_mat4_rotate_z(angle) CGL_mat4_init(\
    cosf(angle), -sinf(angle), 0.0f, 0.0f, \
    sinf(angle), cosf(angle), 0.0f, 0.0f, \
    0.0f, 0.0f, 1.0f, 0.0f, \
    0.0f, 0.0f, 0.0f, 1.0f \
)

#define CGL_mat4_perspective(fov, aspect, near, far) CGL_mat4_init(\
    1.0f / (aspect * tanf(fov / 2.0f)), 0.0f, 0.0f, 0.0f, \
    0.0f, 1.0f / tanf(fov / 2.0f), 0.0f, 0.0f, \
    0.0f, 0.0f, (far + near) / (near - far), (2.0f * far * near) / (near - far), \
    0.0f, 0.0f, -1.0f, 0.0f \
)


/*
#define CGL_mat4_perspective(fov, aspect, fnear, ffar) CGL_mat4_init(\
	1.0f / (aspect * tanf(fov / 2.0f)), 0.0f, 0.0f, 0.0f, \
	0.0f, 1.0f / tanf(fov / 2.0f), 0.0f, 0.0f, \
	0.0f, 0.0f, (ffar + fnear) / (fnear - ffar), -1.0f, \
	0.0f, 0.0f, (2.0f * ffar * fnear) / (fnear - ffar), 0.0f \
)
*/



#define CGL_mat4_orthographic(left, right, bottom, top, fnear, ffar) CGL_mat4_init( \
    2.0f / (right - left), 0.0f, 0.0f, -(right + left) / (right - left), \
    0.0f, 2.0f / (top - bottom), 0.0f, -(top + bottom) / (top - bottom), \
    0.0f, 0.0f, -2.0f / (ffar - fnear), -(ffar + fnear) / (ffar - fnear), \
    0.0f, 0.0f, 0.0f, 1.0f \
)

#define CGL_mat4_log(m) CGL_info( \
    "\n{\n" \
    "    { %f, %f, %f, %f },\n" \
    "    { %f, %f, %f, %f },\n" \
    "    { %f, %f, %f, %f },\n" \
    "    { %f, %f, %f, %f }\n" \
    "}\n", \
    CGL_mat4_elem_get(m, 0, 0), CGL_mat4_elem_get(m, 0, 1), CGL_mat4_elem_get(m, 0, 2), CGL_mat4_elem_get(m, 0, 3), \
    CGL_mat4_elem_get(m, 1, 0), CGL_mat4_elem_get(m, 1, 1), CGL_mat4_elem_get(m, 1, 2), CGL_mat4_elem_get(m, 1, 3), \
    CGL_mat4_elem_get(m, 2, 0), CGL_mat4_elem_get(m, 2, 1), CGL_mat4_elem_get(m, 2, 2), CGL_mat4_elem_get(m, 2, 3), \
    CGL_mat4_elem_get(m, 3, 0), CGL_mat4_elem_get(m, 3, 1), CGL_mat4_elem_get(m, 3, 2), CGL_mat4_elem_get(m, 3, 3) \
)


typedef CGL_vec3(*CGL_parametric_function)(CGL_float, CGL_float);

#ifdef __cplusplus
#define CGL_quat_init(x, y, z, w) CGL_quat(x, y, z, w)
#else
#define CGL_quat_init(x, y, z, w) (CGL_quat){{x, y, z}, w}
#endif

#define CGL_quat_identity() CGL_quat_init(0.0f, 0.0f, 0.0f, 1.0f)
#define CGL_quat_equal(a, b) (CGL_vec3_equal(a.vec, b.vec) && (a.w == b.w))
#define CGL_quat_from_axis_angle(x, y, z, angle) CGL_quat_init(sinf(angle / 2.0f) * x, sinf(angle / 2.0f) * y, sinf(angle / 2.0f) * z, cosf(angle / 2.0f))
#define CGL_quat_from_x_rotation(angle) CGL_quat_from_axis_angle(1.0f, 0.0f, 0.0f, angle)
#define CGL_quat_from_y_rotation(angle) CGL_quat_from_axis_angle(0.0f, 1.0f, 0.0f, angle)
#define CGL_quat_from_z_rotation(angle) CGL_quat_from_axis_angle(0.0f, 0.0f, 1.0f, angle)
#define CGL_quat_from_euler_zyx(z, y, x) CGL_quat_init(cosf(x * 0.5f) * sinf(z * 0.5f) * cosf(y * 0.5f) - sinf(x * 0.5f) * cosf(z * 0.5f) * sinf(y * 0.5f), cosf(x * 0.5f) * cosf(z * 0.5f) * sinf(y * 0.5f) + sinf(x * 0.5f) * sinf(z * 0.5f) * cosf(y * 0.5f), sinf(x * 0.5f) * cosf(z * 0.5f) * cosf(y * 0.5f) - cosf(x * 0.5f) * sinf(z * 0.5f) * sinf(y * 0.5f), cosf(x * 0.5f) * cosf(z * 0.5f) * cosf(y * 0.5f) + sinf(x * 0.5f) * sinf(z * 0.5f) * sinf(y * 0.5f))
#define CGL_quat_conjuigate(q) CGL_quat_init(-q.vec.x, -q.vec.y, -q.vec.z, q.w)
#define CGL_quat_length(q) sqrtf(q.w * q.w + q.vec.x * q.vec.x + q.vec.y * q.vec.y + q.vec.z * q.vec.z)
#define CGL_quat_norm(q) CGL_quat_length(q)
#define CGL_quat_normalize(q) {CGL_float __CGL_quat_length##__LINE__ = 1.0f / CGL_quat_length(q); q.w *= __CGL_quat_length##__LINE__; q.vec.x *= __CGL_quat_length##__LINE__; q.vec.y *= __CGL_quat_length##__LINE__; q.vec.z *= __CGL_quat_length##__LINE__; }
#define CGL_quat_add(a, b) CGL_quat_init(a.vec.x + b.vec.x, a.vec.y + b.vec.y, a.vec.z + b.vec.z, a.w + b.w)
#define CGL_quat_sub(a, b) CGL_quat_init(a.vec.x - b.vec.x, a.vec.y - b.vec.y, a.vec.z - b.vec.z, a.w - b.w)
#define CGL_quat_conjugate(q) CGL_quat_init(-q.vec.x, -q.vec.y, -q.vec.z, q.w)
#define CGL_quat_mul_scalar(q, s) CGL_quat_init(q.vec.x * (s), q.vec.y * (s), q.vec.z * (s), q.w * (s))
CGL_void CGL_quat_to_euler_zyx(CGL_quat quat, CGL_float* z, CGL_float* y, CGL_float* x);
CGL_quat CGL_quat_slerp(CGL_quat a, CGL_quat b, CGL_float t);
CGL_quat CGL_quat_squad(CGL_quat a, CGL_quat b, CGL_quat c, CGL_quat d, CGL_float t);
CGL_float CGL_quat_to_axis_angle(CGL_quat quat, CGL_float* x, CGL_float* y, CGL_float* z);
CGL_quat CGL_quat_inverse(CGL_quat quat);
CGL_quat CGL_quat_mul(CGL_quat a, CGL_quat b);
CGL_void CGL_quat_rotate(CGL_quat q, CGL_float x, CGL_float y, CGL_float z, CGL_float* ox, CGL_float* oy, CGL_float* oz);
CGL_mat4 CGL_quat_to_mat4(CGL_quat quat);
CGL_vec3 CGL_vec3_apply_transformations(CGL_vec3 original, const CGL_vec3* translation, const CGL_vec3* rotation, const CGL_vec3* scale);
CGL_vec2 CGL_vec2_apply_transformations(CGL_vec2 original, const CGL_vec2* translation, const CGL_float* rotation, const CGL_vec2* scale);
CGL_vec4 CGL_quat_mul_vec4(CGL_quat q, CGL_vec4 v);

#ifndef CGL_EXCLUDE_MATH_FUNCTIONS
// vec2 
CGL_vec2 CGL_vec2_add_(CGL_vec2 a, CGL_vec2 b);
CGL_vec2 CGL_vec2_sub_(CGL_vec2 a, CGL_vec2 b);
CGL_vec2 CGL_vec2_mul_(CGL_vec2 a, CGL_vec2 b);
CGL_vec2 CGL_vec2_div_(CGL_vec2 a, CGL_vec2 b);
CGL_vec2 CGL_vec2_add_scalar_(CGL_vec2 a, CGL_float b);
CGL_vec2 CGL_vec2_sub_scalar_(CGL_vec2 a, CGL_float b);
CGL_vec2 CGL_vec2_scale_(CGL_vec2 a, CGL_float b);
CGL_vec2 CGL_vec2_normalize_(CGL_vec2 a);
CGL_float CGL_vec2_dot_(CGL_vec2 a, CGL_vec2 b);
CGL_float CGL_vec2_length_(CGL_vec2 a);
CGL_float CGL_vec2_cross_(CGL_vec2 a, CGL_vec2 b);
CGL_vec2 CGL_vec2_reflect_(CGL_vec2 a, CGL_vec2 b);
CGL_vec2 CGL_vec2_refract_(CGL_vec2 a, CGL_vec2 b, CGL_float eta);
CGL_vec2 CGL_vec2_rotate_(CGL_vec2 a, CGL_float angle);
CGL_vec2 CGL_vec2_lerp_(CGL_vec2 a, CGL_vec2 b, CGL_float t);

// vec3
CGL_vec3 CGL_vec3_add_(CGL_vec3 a, CGL_vec3 b);
CGL_vec3 CGL_vec3_add3_(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c);
CGL_vec3 CGL_vec3_sub_(CGL_vec3 a, CGL_vec3 b);
CGL_vec3 CGL_vec3_mul_(CGL_vec3 a, CGL_vec3 b);
CGL_vec3 CGL_vec3_div_(CGL_vec3 a, CGL_vec3 b);
CGL_vec3 CGL_vec3_add_scalar_(CGL_vec3 a, CGL_float b);
CGL_vec3 CGL_vec3_sub_scalar_(CGL_vec3 a, CGL_float b);
CGL_vec3 CGL_vec3_scale_(CGL_vec3 a, CGL_float b);
CGL_vec3 CGL_vec3_normalize_(CGL_vec3 a);
CGL_float CGL_vec3_dot_(CGL_vec3 a, CGL_vec3 b);
CGL_float CGL_vec3_length_(CGL_vec3 a);
CGL_vec3 CGL_vec3_cross_(CGL_vec3 a, CGL_vec3 b);
CGL_vec3 CGL_vec3_reflect_(CGL_vec3 a, CGL_vec3 b);
CGL_vec3 CGL_vec3_refract_(CGL_vec3 a, CGL_vec3 b, CGL_float eta);
CGL_vec3 CGL_vec3_lerp_(CGL_vec3 a, CGL_vec3 b, CGL_float t);

// vec4
CGL_vec4 CGL_vec4_add_(CGL_vec4 a, CGL_vec4 b);
CGL_vec4 CGL_vec4_sub_(CGL_vec4 a, CGL_vec4 b);
CGL_vec4 CGL_vec4_mul_(CGL_vec4 a, CGL_vec4 b);
CGL_vec4 CGL_vec4_div_(CGL_vec4 a, CGL_vec4 b);
CGL_vec4 CGL_vec4_add_scalar_(CGL_vec4 a, CGL_float b);
CGL_vec4 CGL_vec4_sub_scalar_(CGL_vec4 a, CGL_float b);
CGL_vec4 CGL_vec4_scale_(CGL_vec4 a, CGL_float b);
CGL_vec4 CGL_vec4_normalize_(CGL_vec4 a);
CGL_float CGL_vec4_dot_(CGL_vec4 a, CGL_vec4 b);
CGL_float CGL_vec4_length_(CGL_vec4 a);
CGL_vec4 CGL_vec4_lerp_(CGL_vec4 a, CGL_vec4 b, CGL_float t);


struct CGL_transform
{
	CGL_vec4 position;
	CGL_vec4 rotation;
	CGL_vec4 scale;
	CGL_mat4 matrix;
	struct CGL_transform* parent;
};
typedef struct CGL_transform CGL_transform;

CGL_transform CGL_transform_create_empty();
CGL_transform CGL_transform_create(CGL_vec3 position, CGL_vec3 rotation, CGL_vec3 scale);
CGL_transform CGL_transform_create_from_matrix(CGL_mat4 matrix);
CGL_transform* CGL_transform_set_position(CGL_transform* transform, CGL_vec3 position);
CGL_transform* CGL_transform_set_rotation(CGL_transform* transform, CGL_vec3 rotation);
CGL_transform* CGL_transform_set_scale(CGL_transform* transform, CGL_vec3 scale);
CGL_transform* CGL_transform_set_parent(CGL_transform* transform, CGL_transform* parent);
CGL_transform* CGL_transform_update(CGL_transform* transform);
CGL_transform* CGL_transform_update_matrix_local(CGL_transform* transform);
CGL_mat4 CGL_transform_get_matrix(CGL_transform* transform);
CGL_mat4* CGL_transform_get_matrix_ptr(CGL_transform* transform);


#endif


#endif

#ifndef CGL_EXCLUDE_MATRIX_API

#ifndef CGL_MATRIX_DATA_TYPE
#define CGL_MATRIX_DATA_TYPE CGL_float
#endif


struct CGL_matrix;
typedef struct CGL_matrix CGL_matrix;


CGL_matrix* CGL_matrix_create(CGL_int m, CGL_int n);
CGL_void CGL_matrix_destroy(CGL_matrix* m);
CGL_matrix* CGL_matrix_create_from_array(CGL_MATRIX_DATA_TYPE* array, CGL_int m, CGL_int n);
CGL_matrix* CGL_matrix_add_to(CGL_matrix* a, CGL_matrix* b, CGL_matrix* out);
CGL_matrix* CGL_matrix_add(CGL_matrix* a, CGL_matrix* b);
CGL_matrix* CGL_matrix_sub_to(CGL_matrix* a, CGL_matrix* b, CGL_matrix* out);
CGL_matrix* CGL_matrix_sub(CGL_matrix* a, CGL_matrix* b);
CGL_matrix* CGL_matrix_elem_mul_to(CGL_matrix* a, CGL_matrix* b, CGL_matrix* out);
CGL_matrix* CGL_matrix_elem_mul(CGL_matrix* a, CGL_matrix* b);
CGL_matrix* CGL_matrix_mul_to(CGL_matrix* a, CGL_matrix* b, CGL_matrix* out);
CGL_matrix* CGL_matrix_mul(CGL_matrix* a, CGL_matrix* b);
CGL_matrix* CGL_matrix_transpose_to(CGL_matrix* m, CGL_matrix* out);
CGL_matrix* CGL_matrix_transpose(CGL_matrix* m);
CGL_matrix* CGL_matrix_identity_to(CGL_int m, CGL_int n, CGL_matrix* out);
CGL_matrix* CGL_matrix_identity(CGL_int m, CGL_int n);
CGL_matrix* CGL_matrix_scale_to(CGL_matrix* m, CGL_MATRIX_DATA_TYPE s);
CGL_matrix* CGL_matrix_scale(CGL_matrix* m, CGL_MATRIX_DATA_TYPE s);
CGL_MATRIX_DATA_TYPE CGL_matrix_get_elem(CGL_matrix* m, CGL_int i, CGL_int j);
CGL_bool CGL_matrix_set_elem(CGL_matrix* m, CGL_int i, CGL_int j, CGL_MATRIX_DATA_TYPE value);
CGL_bool CGL_matrix_set_row(CGL_matrix* m, CGL_int i, CGL_MATRIX_DATA_TYPE* row);
CGL_bool CGL_matrix_set_col(CGL_matrix* m, CGL_int j, CGL_MATRIX_DATA_TYPE* col);
CGL_bool CGL_matrix_get_row(CGL_matrix* m, CGL_int i, CGL_MATRIX_DATA_TYPE* out);
CGL_bool CGL_matrix_get_col(CGL_matrix* m, CGL_int j, CGL_MATRIX_DATA_TYPE* out);
CGL_matrix* CGL_matrix_row_to_matrix_to(CGL_MATRIX_DATA_TYPE* row, CGL_int n, CGL_matrix* out);
CGL_matrix* CGL_matrix_row_to_matrix(CGL_MATRIX_DATA_TYPE* row, CGL_int n);
CGL_matrix* CGL_matrix_col_to_matrix_to(CGL_MATRIX_DATA_TYPE* col, CGL_int n, CGL_matrix* out);
CGL_matrix* CGL_matrix_col_to_matrix(CGL_MATRIX_DATA_TYPE* col, CGL_int n);
CGL_bool CGL_matrix_is_square(CGL_matrix* m);
CGL_bool CGL_matrix_is_symmetric(CGL_matrix* m);
CGL_bool CGL_matrix_is_orthogonal(CGL_matrix* m);
CGL_bool CGL_matrix_is_diagonal(CGL_matrix* m);
CGL_bool CGL_matrix_is_identity(CGL_matrix* m);
CGL_bool CGL_matrix_is_zero(CGL_matrix* m);
CGL_bool CGL_matrix_is_equal(CGL_matrix* a, CGL_matrix* b);
CGL_MATRIX_DATA_TYPE CGL_matrix_trace(CGL_matrix* m);
CGL_MATRIX_DATA_TYPE CGL_matrix_determinant(CGL_matrix* m);
CGL_matrix* CGL_matrix_inverse_to(CGL_matrix* m, CGL_matrix* out);
CGL_matrix* CGL_matrix_inverse(CGL_matrix* m);
CGL_matrix* CGL_matrix_copy_to(CGL_matrix* m, CGL_matrix* out);
CGL_matrix* CGL_matrix_copy(CGL_matrix* m);
CGL_bool CGL_matrix_print(CGL_matrix* m);
CGL_matrix* CGL_matrix_gauss_jordan_to(CGL_matrix* m, CGL_matrix* out);
CGL_matrix* CGL_matrix_gauss_jordan(CGL_matrix* m);
CGL_matrix* CGL_matrix_submatrix_to(CGL_matrix* mat, CGL_int i, CGL_int j, CGL_int m, CGL_int n, CGL_matrix* out);
CGL_matrix* CGL_matrix_submatrix(CGL_matrix* mat, CGL_int i, CGL_int j, CGL_int m, CGL_int n);
CGL_matrix* CGL_matrix_minor_to(CGL_matrix* mat, CGL_int i, CGL_int j, CGL_matrix* out);
CGL_matrix* CGL_matrix_minor(CGL_matrix* mat, CGL_int i, CGL_int j);
CGL_matrix* CGL_matrix_adjugate_to(CGL_matrix* m, CGL_matrix* out);
CGL_matrix* CGL_matrix_adjugate(CGL_matrix* m);
CGL_matrix* CGL_matrix_transpose_inplace(CGL_matrix* m);
CGL_float CGL_matrix_sum_of_row(CGL_matrix* m, CGL_int i);
CGL_float CGL_matrix_sum_of_col(CGL_matrix* m, CGL_int j);
CGL_float CGL_matrix_product_of_row(CGL_matrix* m, CGL_int i);
CGL_float CGL_matrix_product_of_col(CGL_matrix* m, CGL_int j);
CGL_matrix* CGL_matrix_make_zero(CGL_matrix* m);

#endif


struct CGL_shape_triangle
{
	CGL_vec3 a;
	CGL_vec3 b;
	CGL_vec3 c;
};
typedef struct CGL_shape_triangle CGL_shape_triangle;

struct CGL_shape_quad
{
	CGL_vec3 a;
	CGL_vec3 b;
	CGL_vec3 c;
	CGL_vec3 d;
};
typedef struct CGL_shape_quad CGL_shape_quad;

struct CGL_shape
{
	CGL_vec3* vertices;
	CGL_vec3 position;
	CGL_vec3 rotation;
	CGL_vec3 scale;
	size_t vertices_count;
};
typedef struct CGL_shape CGL_shape;

CGL_void CGL_shape_init(CGL_shape* shape, size_t vertices_count);
CGL_void CGL_shape_destroy(CGL_shape* shape);

#ifndef CGL_SAT_COLLISION_MAX_COLLISIONS
#define CGL_SAT_COLLISION_MAX_COLLISIONS 4096
#endif

bool CGL_sat_collision_overlap_on_axis(CGL_shape* a, CGL_shape* b, CGL_vec2 axis, float* overlap_amount);
bool CGL_sat_collision_detect(CGL_shape* a, CGL_shape* b, CGL_vec2* n_vector);
CGL_void CGL_sat_collision_calculate_axes(CGL_shape* shape, CGL_vec2* axes, CGL_int* axes_count);
CGL_bool CGL_utils_is_point_in_triangle(CGL_vec2 p, CGL_vec2 a, CGL_vec2 b, CGL_vec2 c);
CGL_bool CGL_utils_is_point_in_circle(CGL_vec2 p, CGL_float r);
CGL_bool CGL_utils_calculate_circumcircle(CGL_vec2 a, CGL_vec2 b, CGL_vec2 c, CGL_vec2* center, CGL_float* radius);
CGL_bool CGL_utils_calculate_super_triangle(CGL_vec2* points, CGL_int points_count, CGL_vec2* a, CGL_vec2* b, CGL_vec2* c, CGL_float padding);
CGL_bool CGL_utils_calculate_bounding_square(CGL_vec2* points, CGL_int points_count, CGL_vec2* a, CGL_vec2* b, CGL_vec2* c, CGL_vec2* d, CGL_float padding);
CGL_bool CGL_utils_calculate_bounding_box(CGL_vec2* points, CGL_int points_count, CGL_vec2* a, CGL_vec2* b, CGL_vec2* c, CGL_vec2* d, CGL_float padding);
CGL_float CGL_utils_random_gaussian(CGL_float mean, CGL_float std_dev);

// GJK collision detection & EPA collision resolution

#ifndef CGL_GJK_EPA_MAX_POLYTOPE_VERTICES
#define CGL_GJK_EPA_MAX_POLYTOPE_VERTICES 64
#endif

#ifndef CGL_GJK_EPA_TOLERANCE
#define CGL_GJK_EPA_TOLERANCE 0.001f
#endif

CGL_vec3 CGL_gjk_shape_default_support(CGL_shape* a, CGL_vec3 d);
CGL_vec3 CGL_gjk_default_support(CGL_shape* a, CGL_shape* b, CGL_vec3 d);
CGL_bool CGL_gjk_check_collision_2d(CGL_shape* a, CGL_shape* b, CGL_vec3* simplex_out);
CGL_vec3 CGL_gjk_epa_2d(CGL_shape* a, CGL_shape* b, CGL_vec3* simplex);

#ifndef CGL_INCREMENTAL_TRIANGULATOR_MAX_TRIANGLES
#define CGL_INCREMENTAL_TRIANGULATOR_MAX_TRIANGLES 4096
#endif

CGL_bool CGL_aabb_contains_point(CGL_vec2 aabb_min, CGL_vec2 aabb_max, CGL_vec2 point);
CGL_bool CGL_aabb_intersects_aabb(CGL_vec2 aabb_min, CGL_vec2 aabb_max, CGL_vec2 aabb_min2, CGL_vec2 aabb_max2);
CGL_bool CGL_aabb_subdivide_nd(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabbs_min_out, CGL_float* aabbs_max_out);
CGL_bool CGL_aabb_subdivide_2d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabbs_min_out, CGL_float* aabbs_max_out);
CGL_bool CGL_aabb_subdivide_3d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabbs_min_out, CGL_float* aabbs_max_out);
CGL_bool CGL_aabb_contains_point_nd(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* point);
CGL_bool CGL_aabb_contains_point_2d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* point);
CGL_bool CGL_aabb_contains_point_3d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* point);
CGL_bool CGL_aabb_intersects_aabb_nd(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabb_min2, CGL_float* aabb_max2);
CGL_bool CGL_aabb_intersects_aabb_2d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabb_min2, CGL_float* aabb_max2);
CGL_bool CGL_aabb_intersects_aabb_3d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabb_min2, CGL_float* aabb_max2);

CGL_bool CGL_triangulate_points_incremental(CGL_vec2* points, CGL_int points_count, CGL_int* triangles_out, CGL_int* triangles_count_out);

// window
#if 1 // Just to use code folding

#ifndef CGL_EXCLUDE_WINDOW_API

// CGL window management library (usinfg GLFW)

#ifdef CGL_EXPOSE_GLFW_API
#include <GLFW/glfw3.h> // GLFW
#else
// forrward declare GLFW data types
struct GLFWwindow;
// typedef struct GLFWwindow GLFWwindow;
#endif // EXPOSE_GLFW_API

/* The unknown key */
#define GLFW_KEY_UNKNOWN            -1

/* Printable keys */
#define CGL_KEY_SPACE              32
#define CGL_KEY_APOSTROPHE         39  /* ' */
#define CGL_KEY_COMMA              44  /* , */
#define CGL_KEY_MINUS              45  /* - */
#define CGL_KEY_PERIOD             46  /* . */
#define CGL_KEY_SLASH              47  /* / */
#define CGL_KEY_0                  48
#define CGL_KEY_1                  49
#define CGL_KEY_2                  50
#define CGL_KEY_3                  51
#define CGL_KEY_4                  52
#define CGL_KEY_5                  53
#define CGL_KEY_6                  54
#define CGL_KEY_7                  55
#define CGL_KEY_8                  56
#define CGL_KEY_9                  57
#define CGL_KEY_SEMICOLON          59  /* ; */
#define CGL_KEY_EQUAL              61  /* = */
#define CGL_KEY_A                  65
#define CGL_KEY_B                  66
#define CGL_KEY_C                  67
#define CGL_KEY_D                  68
#define CGL_KEY_E                  69
#define CGL_KEY_F                  70
#define CGL_KEY_G                  71
#define CGL_KEY_H                  72
#define CGL_KEY_I                  73
#define CGL_KEY_J                  74
#define CGL_KEY_K                  75
#define CGL_KEY_L                  76
#define CGL_KEY_M                  77
#define CGL_KEY_N                  78
#define CGL_KEY_O                  79
#define CGL_KEY_P                  80
#define CGL_KEY_Q                  81
#define CGL_KEY_R                  82
#define CGL_KEY_S                  83
#define CGL_KEY_T                  84
#define CGL_KEY_U                  85
#define CGL_KEY_V                  86
#define CGL_KEY_W                  87
#define CGL_KEY_X                  88
#define CGL_KEY_Y                  89
#define CGL_KEY_Z                  90
#define CGL_KEY_LEFT_BRACKET       91  /* [ */
#define CGL_KEY_BACKSLASH          92  /* \ */
#define CGL_KEY_RIGHT_BRACKET      93  /* ] */
#define CGL_KEY_GRAVE_ACCENT       96  /* ` */
#define CGL_KEY_WORLD_1            161 /* non-US #1 */
#define CGL_KEY_WORLD_2            162 /* non-US #2 */

/* Function keys */
#define CGL_KEY_ESCAPE             256
#define CGL_KEY_ENTER              257
#define CGL_KEY_TAB                258
#define CGL_KEY_BACKSPACE          259
#define CGL_KEY_INSERT             260
#define CGL_KEY_DELETE             261
#define CGL_KEY_RIGHT              262
#define CGL_KEY_LEFT               263
#define CGL_KEY_DOWN               264
#define CGL_KEY_UP                 265
#define CGL_KEY_PAGE_UP            266
#define CGL_KEY_PAGE_DOWN          267
#define CGL_KEY_HOME               268
#define CGL_KEY_END                269
#define CGL_KEY_CAPS_LOCK          280
#define CGL_KEY_SCROLL_LOCK        281
#define CGL_KEY_NUM_LOCK           282
#define CGL_KEY_PRINT_SCREEN       283
#define CGL_KEY_PAUSE              284
#define CGL_KEY_F1                 290
#define CGL_KEY_F2                 291
#define CGL_KEY_F3                 292
#define CGL_KEY_F4                 293
#define CGL_KEY_F5                 294
#define CGL_KEY_F6                 295
#define CGL_KEY_F7                 296
#define CGL_KEY_F8                 297
#define CGL_KEY_F9                 298
#define CGL_KEY_F10                299
#define CGL_KEY_F11                300
#define CGL_KEY_F12                301
#define CGL_KEY_F13                302
#define CGL_KEY_F14                303
#define CGL_KEY_F15                304
#define CGL_KEY_F16                305
#define CGL_KEY_F17                306
#define CGL_KEY_F18                307
#define CGL_KEY_F19                308
#define CGL_KEY_F20                309
#define CGL_KEY_F21                310
#define CGL_KEY_F22                311
#define CGL_KEY_F23                312
#define CGL_KEY_F24                313
#define CGL_KEY_F25                314
#define CGL_KEY_KP_0               320
#define CGL_KEY_KP_1               321
#define CGL_KEY_KP_2               322
#define CGL_KEY_KP_3               323
#define CGL_KEY_KP_4               324
#define CGL_KEY_KP_5               325
#define CGL_KEY_KP_6               326
#define CGL_KEY_KP_7               327
#define CGL_KEY_KP_8               328
#define CGL_KEY_KP_9               329
#define CGL_KEY_KP_DECIMAL         330
#define CGL_KEY_KP_DIVIDE          331
#define CGL_KEY_KP_MULTIPLY        332
#define CGL_KEY_KP_SUBTRACT        333
#define CGL_KEY_KP_ADD             334
#define CGL_KEY_KP_ENTER           335
#define CGL_KEY_KP_EQUAL           336
#define CGL_KEY_LEFT_SHIFT         340
#define CGL_KEY_LEFT_CONTROL       341
#define CGL_KEY_LEFT_ALT           342
#define CGL_KEY_LEFT_SUPER         343
#define CGL_KEY_RIGHT_SHIFT        344
#define CGL_KEY_RIGHT_CONTROL      345
#define CGL_KEY_RIGHT_ALT          346
#define CGL_KEY_RIGHT_SUPER        347
#define CGL_KEY_MENU               348

#define CGL_MOUSE_BUTTON_1         0
#define CGL_MOUSE_BUTTON_2         1
#define CGL_MOUSE_BUTTON_3         2
#define CGL_MOUSE_BUTTON_4         3
#define CGL_MOUSE_BUTTON_5         4
#define CGL_MOUSE_BUTTON_6         5
#define CGL_MOUSE_BUTTON_7         6
#define CGL_MOUSE_BUTTON_8         7
#define CGL_MOUSE_BUTTON_LAST      CGL_MOUSE_BUTTON_8
#define CGL_MOUSE_BUTTON_LEFT      CGL_MOUSE_BUTTON_1
#define CGL_MOUSE_BUTTON_RIGHT     CGL_MOUSE_BUTTON_2
#define CGL_MOUSE_BUTTON_MIDDLE    CGL_MOUSE_BUTTON_3

#define CGL_RELEASE                0
#define CGL_PRESS                  1
#define CGL_REPEAT                 2

#define CGL_WINDOW_TABLE_SIZE      10000

// structs
struct CGL_window;
typedef struct CGL_window CGL_window;

// struct GLFWwindow;
// typedef struct GLFWwindow GLFWwindow;

typedef void(*CGL_window_key_callback)(CGL_window* window, CGL_int key, CGL_int scancode, CGL_int action, CGL_int mods);
typedef void(*CGL_window_mouse_button_callback)(CGL_window* window, CGL_int button, CGL_int action, CGL_int mods);
typedef void(*CGL_window_mouse_position_callback)(CGL_window* window, double xpos, double ypos);
typedef void(*CGL_window_mouse_scroll_callback)(CGL_window* window, double xoffset, double yoffset);
typedef void(*CGL_window_framebuffer_size_callback)(CGL_window* window, CGL_int width, CGL_int height);
typedef void(*CGL_window_close_callback)(CGL_window* window);
typedef void(*CGL_window_drag_n_drop_callback)(CGL_window* window, const CGL_byte** paths, CGL_int count);

CGL_window* CGL_window_create(CGL_int width, CGL_int height, const char* title); // create window and initialize GLFW
CGL_window* CGL_window_create_undecorated(CGL_int width, CGL_int height, const char* title);
CGL_void CGL_window_destroy(CGL_window* window); // destroy window and terminate GLFW
CGL_void CGL_window_poll_events(CGL_window* window); // poll events from GLFW
CGL_void CGL_window_swap_buffers(CGL_window* window); // swap buffers
bool CGL_window_should_close(CGL_window* window); // check if window should close
CGL_void CGL_window_set_title(CGL_window* window, const char* title); // set window title
CGL_void CGL_window_set_size(CGL_window* window, CGL_int width, CGL_int height); // set window size
CGL_void CGL_window_set_position(CGL_window* window, CGL_int x, CGL_int y); // set window position
CGL_void CGL_window_set_hidden(CGL_window* window, bool hidden); // set window hidden
CGL_void CGL_window_set_user_data(CGL_window* window, void* user_data); // set window user data
CGL_void* CGL_window_get_user_data(CGL_window* window); // get window user data
CGL_void CGL_window_get_size(CGL_window* window, CGL_int* width, CGL_int* height); // get window size
CGL_void CGL_window_get_position(CGL_window* window, CGL_int* x, CGL_int* y); // get window position
CGL_void CGL_window_get_framebuffer_size(CGL_window* window, CGL_int* width, CGL_int* height); // get window framebuffer size
CGL_void CGL_window_set_key_callback(CGL_window* window, CGL_window_key_callback callback); // set key callback
CGL_void CGL_window_set_mouse_button_callback(CGL_window* window, CGL_window_mouse_button_callback callback); // set mouse button callback
CGL_void CGL_window_set_mouse_position_callback(CGL_window* window, CGL_window_mouse_position_callback callback); // set mouse position callback
CGL_void CGL_window_set_mouse_scroll_callback(CGL_window* window, CGL_window_mouse_scroll_callback callback); // set mouse scroll callback
CGL_void CGL_window_set_framebuffer_size_callback(CGL_window* window, CGL_window_framebuffer_size_callback callback); // set framebuffer size callback
CGL_void CGL_window_set_close_callback(CGL_window* window, CGL_window_close_callback callback); // set close callback
CGL_void CGL_window_set_drag_n_drop_callback(CGL_window* window, CGL_window_drag_n_drop_callback callback); // set drag and drop callback
CGL_void CGL_window_resecure_callbacks(CGL_window* window);
CGL_void CGL_window_make_context_current(CGL_window* window); // make opengl context current
struct GLFWwindow* CGL_window_get_glfw_handle(CGL_window* window);

// inputs
CGL_int CGL_window_get_key(CGL_window* window, CGL_int key); // get key state
CGL_bool CGL_window_is_key_pressed(CGL_window* window, CGL_int key); // check if key is pressed
CGL_int CGL_window_get_mouse_button(CGL_window* window, CGL_int button); // get mouse button state
CGL_void CGL_window_get_mouse_position(CGL_window* window, double* xpos, double* ypos); // get mouse position

#endif

#endif

// opengl
#if 1 // Just to use code folding

struct CGL_image
{
	void* data;
	CGL_int height;
	CGL_int width;
	CGL_int bytes_per_channel;
	CGL_int channels;
};
typedef struct CGL_image CGL_image;

#ifndef CGL_EXCLUDE_GRAPHICS_API

//#ifndef  CGL_EXCLUDE_WINDOW_API
#include <glad/glad.h>


#ifdef CGL_WASM
#define CGL_OPENGL_VERSION_MAJOR 2
#define CGL_OPENGL_VERSION_MINOR 0
#define CGL_OPENGL_VERSION_MAJOR_STR "2"
#define CGL_OPENGL_VERSION_MINOR_STR "0"
#else
#define CGL_OPENGL_VERSION_MAJOR 4
#define CGL_OPENGL_VERSION_MINOR 3
#define CGL_OPENGL_VERSION_MAJOR_STR "4"
#define CGL_OPENGL_VERSION_MINOR_STR "3"
#endif


// forward declarations
struct CGL_texture;
typedef struct CGL_texture CGL_texture;

struct CGL_framebuffer;
typedef struct CGL_framebuffer CGL_framebuffer;

struct CGL_shader;
typedef struct CGL_shader CGL_shader;

struct CGL_mesh_gpu;
typedef struct CGL_mesh_gpu CGL_mesh_gpu;

struct CGL_mesh_vertex
{
	CGL_vec4 position;
	CGL_vec4 normal;
	CGL_vec4 texture_coordinates;
	CGL_vec4 bone_wieghts;
	CGL_ivec4 bone_ids;
};
typedef struct CGL_mesh_vertex CGL_mesh_vertex;

struct CGL_mesh_cpu
{
	size_t index_count;
	size_t index_count_used;
	uint32_t* indices;
	size_t vertex_count;
	size_t vertex_count_used;
	CGL_mesh_vertex* vertices;
};
typedef struct CGL_mesh_cpu CGL_mesh_cpu;


struct CGL_ssbo;
typedef struct CGL_ssbo CGL_ssbo;

struct CGL_ubo;
typedef struct CGL_ubo CGL_ubo;

// Taken directly from OpenGL
#define CGL_CUBEMAP_POSITIVE_X 0x8515 
#define CGL_CUBEMAP_NEGATIVE_X 0x8516 
#define CGL_CUBEMAP_POSITIVE_Y 0x8517 
#define CGL_CUBEMAP_NEGATIVE_Y 0x8518 
#define CGL_CUBEMAP_POSITIVE_Z 0x8519 
#define CGL_CUBEMAP_NEGATIVE_Z 0x851A 

// texture
CGL_texture* CGL_texture_create(CGL_image* image);
CGL_texture* CGL_texture_create_blank(CGL_int width, CGL_int height, GLenum format, GLenum internal_format, GLenum type); // create texture
CGL_texture* CGL_texture_create_array(CGL_int width, CGL_int height, CGL_int layers, GLenum format, GLenum internal_format, GLenum type);
CGL_texture* CGL_texture_create_3d(CGL_int width, CGL_int height, CGL_int depth, GLenum format, GLenum internal_format, GLenum type);
CGL_texture* CGL_texture_create_cubemap();
CGL_void CGL_texture_cubemap_set_face(CGL_texture* texture, CGL_int face, CGL_image* image);
CGL_void CGL_texture_array_set_layer_data(CGL_texture* texture, CGL_int layer, void* data);
CGL_void CGL_texture_destroy(CGL_texture* texture); // destroy texture
CGL_int CGL_texture_bind(CGL_texture* texture, CGL_int unit); // bind texture to unit
CGL_void CGL_texture_set_data(CGL_texture* texture, void* data); // set texture data
CGL_void CGL_texture_set_sub_data(CGL_texture* texture, size_t offset_x, size_t offset_y, size_t size_x, size_t size_y, void* data); // set texture data
CGL_void CGL_texture_set_pixel_data(CGL_texture* texture, int x, int y, void* data); // set texture data at pixel
CGL_void CGL_texture_set_user_data(CGL_texture* texture, void* user_data); // set texture user data
CGL_void* CGL_texture_get_user_data(CGL_texture* texture); // get texture user data
CGL_uint CGL_texture_get_internal_handle(CGL_texture* texture); // get texture user data
CGL_void CGL_texture_get_size(CGL_texture* texture, CGL_int* width, CGL_int* height); // get texture size
CGL_void CGL_texture_set_scaling_method(CGL_texture* texture, GLint method);
CGL_void CGL_texture_set_wrapping_method(CGL_texture* texture, GLint method);

// framebuffer
#ifndef CGL_EXCLUDE_WINDOW_API
CGL_framebuffer* CGL_framebuffer_create_from_default(CGL_window* window); // create framebuffer from default framebuffer
#endif
CGL_framebuffer* CGL_framebuffer_create(CGL_int width, CGL_int height); // create framebuffer (32 bit)
CGL_framebuffer* CGL_framebuffer_create_basic(CGL_int width, CGL_int height);
CGL_void CGL_framebuffer_add_color_attachment(CGL_framebuffer* framebuffer, CGL_texture* texture); // add color attachment to framebuffer
CGL_void CGL_framebuffer_destroy(CGL_framebuffer* framebuffer); // destroy framebuffer
CGL_texture* CGL_framebuffer_get_color_attachment(CGL_framebuffer* framebuffer, CGL_int index); // get color attachment from framebuffer
CGL_void CGL_framebuffer_bind(CGL_framebuffer* framebuffer); // bind framebuffer
CGL_void CGL_framebuffer_get_size(CGL_framebuffer* framebuffer, CGL_int* width, CGL_int* height); // get framebuffer size
CGL_void CGL_framebuffer_set_user_data(CGL_framebuffer* framebuffer, void* user_data); // set framebuffer user data
CGL_void* CGL_framebuffer_get_user_data(CGL_framebuffer* framebuffer); // get framebuffer user data
CGL_void CGL_framebuffer_read_pixels(CGL_framebuffer* framebuffer, CGL_int x, CGL_int y, CGL_int width, CGL_int height, void* pixels); // read pixels from framebuffer
CGL_int CGL_framebuffer_get_mouse_pick_id(CGL_framebuffer* framebuffer, CGL_int x, CGL_int y, CGL_int index); // get mouse pick id
CGL_texture* CGL_framebuffer_get_color_texture(CGL_framebuffer* framebuffer); // get color texture
CGL_texture* CGL_framebuffer_get_depth_texture(CGL_framebuffer* framebuffer); // get depth texture

// gl

CGL_void CGL_gl_clear(CGL_float r, CGL_float g, CGL_float b, CGL_float a); // clear framebuffer
bool CGL_gl_init(); // load opengl functions
CGL_void CGL_gl_shutdown(); // clean up
CGL_void CGL_gl_render_screen_quad();

// mesh

CGL_mesh_gpu* CGL_mesh_gpu_create(); // create mesh (gpu)
CGL_void CGL_mesh_gpu_destroy(CGL_mesh_gpu* mesh); // destroy mesh (gpu)
CGL_void CGL_mesh_gpu_render(CGL_mesh_gpu* mesh); // render mesh (gpu)
CGL_void CGL_mesh_gpu_render_instanced(CGL_mesh_gpu* mesh, uint32_t count); // render mesh instanfced (gpu)
CGL_void CGL_mesh_gpu_set_user_data(CGL_mesh_gpu* mesh, void* user_data); // set mesh user data
CGL_void* CGL_mesh_gpu_get_user_data(CGL_mesh_gpu* mesh); // get mesh user data
CGL_void CGL_mesh_gpu_upload(CGL_mesh_gpu* mesh, CGL_mesh_cpu* mesh_cpu, bool static_draw); // upload mesh from (cpu) to (gpu)

// mesh generation


CGL_mesh_cpu* CGL_mesh_cpu_create(size_t vertex_count, size_t index_count);
CGL_mesh_cpu* CGL_mesh_cpu_recalculate_normals(CGL_mesh_cpu* mesh);
CGL_mesh_cpu* CGL_mesh_cpu_flip_normals(CGL_mesh_cpu* mesh);
CGL_mesh_cpu* CGL_mesh_cpu_load_obj(const char* path);
CGL_mesh_cpu* CGL_mesh_cpu_triangle(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c); // generate triangle mesh
CGL_mesh_cpu* CGL_mesh_cpu_plane(CGL_vec3 front, CGL_vec3 right, CGL_int resolution, CGL_float scale); // generate plane mesh
CGL_mesh_cpu* CGL_mesh_cpu_quad(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c, CGL_vec3 d); // generate quad mesh
CGL_mesh_cpu* CGL_mesh_cpu_cube(CGL_bool use_3d_tex_coords);
CGL_mesh_cpu* CGL_mesh_cpu_sphere(CGL_int res_u, CGL_int res_v);
CGL_mesh_cpu* CGL_mesh_cpu_create_from_parametric_function(CGL_int res_u, CGL_int res_v, CGL_float start_u, CGL_float start_v, CGL_float end_u, CGL_float end_v, CGL_parametric_function function);
CGL_mesh_cpu* CGL_mesh_cpu_create_cylinder(CGL_vec3 start, CGL_vec3 end, CGL_float radius0, CGL_float radius1, CGL_int resolution);
CGL_mesh_cpu* CGL_mesh_cpu_create_cylinder2(CGL_vec3 start, CGL_vec3 end, CGL_float radius0, CGL_float radius1, CGL_int resolution_x, CGL_int resolution_y);
CGL_mesh_cpu* CGL_mesh_cpu_create_torus_elbow(CGL_vec3 center, CGL_float radius0, CGL_float radius1, CGL_int resolution0, CGL_int resolution1, CGL_float elbow_angle);

CGL_mesh_cpu* CGL_mesh_cpu_add_mesh(CGL_mesh_cpu* mesh, CGL_mesh_cpu* mesh_other);
CGL_mesh_cpu* CGL_mesh_cpu_add_cube(CGL_mesh_cpu* mesh, CGL_bool use_3d_tex_coords);
CGL_mesh_cpu* CGL_mesh_cpu_add_triangle(CGL_mesh_cpu* mesh, CGL_vec3 a, CGL_vec3 b, CGL_vec3 c); // generate triangle mesh
CGL_mesh_cpu* CGL_mesh_cpu_add_quad(CGL_mesh_cpu* mesh, CGL_vec3 a, CGL_vec3 b, CGL_vec3 c, CGL_vec3 d); // generate quad mesh
CGL_mesh_cpu* CGL_mesh_cpu_add_from_parametric_function(CGL_mesh_cpu* mesh, CGL_int res_u, CGL_int res_v, CGL_float start_u, CGL_float start_v, CGL_float end_u, CGL_float end_v, CGL_parametric_function function);
CGL_mesh_cpu* CGL_mesh_cpu_add_sphere(CGL_mesh_cpu* mesh, CGL_int res_u, CGL_int res_v);
CGL_mesh_cpu* CGL_mesh_cpu_add_cylinder(CGL_mesh_cpu* mesh, CGL_vec3 start, CGL_vec3 end, CGL_float radius0, CGL_float radius1, CGL_int resolution);
CGL_mesh_cpu* CGL_mesh_cpu_add_cylinder2(CGL_mesh_cpu* mesh, CGL_vec3 start, CGL_vec3 end, CGL_float radius0, CGL_float radius1, CGL_int resolution_x, CGL_int resolution_y);
CGL_mesh_cpu* CGL_mesh_cpu_add_torus(CGL_mesh_cpu* mesh, CGL_vec3 center, CGL_float radius0, CGL_float radius1, CGL_int resolution0, CGL_int resolution1, CGL_float elbow_angle);



CGL_mesh_cpu* CGL_mesh_cpu_offset_vertices(CGL_mesh_cpu* mesh, CGL_vec3 offset);
CGL_mesh_cpu* CGL_mesh_cpu_scale_vertices(CGL_mesh_cpu* mesh, CGL_float scale);
CGL_mesh_cpu* CGL_mesh_cpu_rotate_vertices(CGL_mesh_cpu* mesh, CGL_quat rotation);
CGL_mesh_cpu* CGL_mesh_cpu_transform_vertices(CGL_mesh_cpu* mesh, CGL_mat4 transform);



CGL_void CGL_mesh_cpu_generate_c_initialization_code(CGL_mesh_cpu* mesh, char* buffer, const char* function_name);
CGL_void CGL_mesh_cpu_destroy(CGL_mesh_cpu* mesh); // destroy mesh (cpu)

// shader

CGL_shader* CGL_shader_create(const char* vertex_shader_source, const char* fragment_shader_source, char** error); // create shader
CGL_shader* CGL_shader_compute_create(const char* compute_shader_source, char** error); // create compute shader
CGL_shader* CGL_shader_create_from_files(const char* vertex_shader_file, const char* fragment_shader_file, char** error); // create shader from files
CGL_shader* CGL_shader_compute_create_from_files(const char* compute_shader_file, char** error); // create compute shader from files
CGL_void CGL_shader_destroy(CGL_shader* shader); // destroy shader
CGL_void CGL_shader_bind(CGL_shader* shader); // bind shader
int CGL_shader_get_uniform_location(CGL_shader* shader, const char* name); // get uniform location
CGL_void CGL_shader_set_uniform_mat4(CGL_shader* shader, CGL_int location, CGL_mat4* matrix); // set uniform matrix
CGL_void CGL_shader_set_uniform_vec4(CGL_shader* shader, CGL_int location, CGL_vec4* vector); // set uniform vector
CGL_void CGL_shader_set_uniform_vec3(CGL_shader* shader, CGL_int location, CGL_vec3* vector); // set uniform vector
CGL_void CGL_shader_set_uniform_vec2(CGL_shader* shader, CGL_int location, CGL_vec2* vector); // set uniform vector
CGL_void CGL_shader_set_uniform_int(CGL_shader* shader, CGL_int location, CGL_int value); // set uniform int
CGL_void CGL_shader_set_uniform_bool(CGL_shader* shader, CGL_int location, bool value); // set uniform bool
CGL_void CGL_shader_set_uniform_float(CGL_shader* shader, CGL_int location, CGL_float value); // set uniform float
CGL_void CGL_shader_set_uniform_double(CGL_shader* shader, CGL_int location, CGL_double value); // set uniform double
CGL_void CGL_shader_set_uniform_vec2v(CGL_shader* shader, CGL_int location, CGL_float x, CGL_float y); // set uniform vector
CGL_void CGL_shader_set_uniform_vec3v(CGL_shader* shader, CGL_int location, CGL_float x, CGL_float y, CGL_float z); // set uniform vector
CGL_void CGL_shader_set_uniform_vec4v(CGL_shader* shader, CGL_int location, CGL_float x, CGL_float y, CGL_float z, CGL_float w); // set uniform vector
CGL_void CGL_shader_set_uniform_ivec2v(CGL_shader* shader, CGL_int location, CGL_int x, CGL_int y); // set uniform vector
CGL_void CGL_shader_set_uniform_ivec3v(CGL_shader* shader, CGL_int location, CGL_int x, CGL_int y, CGL_int z); // set uniform vector
CGL_void CGL_shader_set_uniform_ivec4v(CGL_shader* shader, CGL_int location, CGL_int x, CGL_int y, CGL_int z, CGL_int w); // set uniform vector
CGL_void CGL_shader_set_user_data(CGL_shader* shader, void* user_data); // set shader user data
CGL_void* CGL_shader_get_user_data(CGL_shader* shader); // get shader user data
CGL_void CGL_shader_compute_dispatch(CGL_shader* shader, CGL_int x, CGL_int y, CGL_int z); // dispatch compute shader

// ssbo
CGL_ssbo* CGL_ssbo_create(uint32_t binding); // create ssbo
CGL_void CGL_ssbo_destroy(CGL_ssbo* ssbo); // destroy ssbo
CGL_void CGL_ssbo_bind(CGL_ssbo* ssbo); // bind ssbo
CGL_void CGL_ssbo_bind2(CGL_ssbo* ssbo, uint32_t binding); // bind ssbo to binding
CGL_void CGL_ssbo_set_data(CGL_ssbo* ssbo, size_t size, void* data, bool static_draw); // set ssbo data
CGL_void CGL_ssbo_set_sub_data(CGL_ssbo* ssbo, size_t offset, size_t size, void* data, bool static_draw); // set ssbo sub data
CGL_void CGL_ssbo_get_data(CGL_ssbo* ssbo, size_t* size, void* data); // get ssbo data
CGL_void CGL_ssbo_get_sub_data(CGL_ssbo* ssbo, size_t offset, size_t size, void* data); // get ssbo sub data
CGL_void CGL_ssbo_set_user_data(CGL_ssbo* ssbo, void* user_data); // set ssbo user data
CGL_void* CGL_ssbo_get_user_data(CGL_ssbo* ssbo); // get ssbo user data
size_t CGL_ssbo_get_size(CGL_ssbo* ssbo); // get ssbo size
CGL_void CGL_ssbo_copy(CGL_ssbo* dst, CGL_ssbo* src, size_t src_offset, size_t dst_offset, size_t size); // copy ssbo

CGL_ubo* CGL_ubo_create(); // create ubo
CGL_void CGL_ubo_destroy(CGL_ubo* ubo); // destroy ubo
CGL_void CGL_ubo_bind(CGL_ubo* ubo, CGL_shader* shader, const CGL_byte* name, uint32_t binding); // bind ubo
CGL_void CGL_ubo_set_data(CGL_ubo* ubo, size_t size, void* data, bool static_draw); // set ubo data
CGL_void CGL_ubo_set_sub_data(CGL_ubo* ubo, size_t offset, size_t size, void* data, bool static_draw); // set ubo sub data
CGL_void CGL_ubo_get_data(CGL_ubo* ubo, size_t* size, void* data); // get ubo data
CGL_void CGL_ubo_get_sub_data(CGL_ubo* ubo, size_t offset, size_t size, void* data); // get ubo sub data
CGL_void CGL_ubo_set_user_data(CGL_ubo* ubo, void* user_data); // set ubo user data
CGL_void* CGL_ubo_get_user_data(CGL_ubo* ubo); // get ubo user data
size_t CGL_ubo_get_size(CGL_ubo* ubo); // get ubo size



#endif
#endif

// BLOOM
#ifndef CGL_EXCLUDE_BLOOM
#ifdef CGL_EXCLUDE_GRAPHICS_API
#error "CGL Bloom requires CGL Graphics API"
#endif

#define CGL_BLOOM_SHADER_MODE_PREFILTER      0
#define CGL_BLOOM_SHADER_MODE_DOWNSAMPLE     1
#define CGL_BLOOM_SHADER_MODE_UPSAMPLE       2
#define CGL_BLOOM_SHADER_MODE_COMPOSITE      3

#define CGL_BLOOM_MAX_ITERATIONS 8

struct CGL_bloom;
typedef struct CGL_bloom CGL_bloom;

CGL_bloom* CGL_bloom_create(CGL_int width, CGL_int height, CGL_int iterations);
CGL_void CGL_bloom_destroy(CGL_bloom* bloom);
CGL_void CGL_bloom_set_threshold(CGL_bloom* bloom, CGL_float val);
float CGL_bloom_get_threshold(CGL_bloom* bloom);
CGL_void CGL_bloom_set_knee(CGL_bloom* bloom, CGL_float val);
float CGL_bloom_get_knee(CGL_bloom* bloom);
CGL_void CGL_bloom_set_offset(CGL_bloom* bloom, CGL_float x, CGL_float y);
CGL_void CGL_bloom_apply(CGL_bloom* bloom, CGL_texture* tex);
CGL_void CGL_bloom_apply2(CGL_bloom* bloom, CGL_texture* tex_src, CGL_texture* tex_dst);
int CGL_bloom_get_iterations(CGL_bloom* bloom);
CGL_texture* CGL_bloom_get_lod_texture(CGL_bloom* bloom, CGL_int index);
CGL_texture* CGL_bloom_get_prefiltered_texture(CGL_bloom* bloom);

#endif


// camera
#if 1

struct CGL_camera;
typedef struct CGL_camera CGL_camera;

CGL_camera* CGL_camera_create();
CGL_void CGL_camera_destroy(CGL_camera* camera);
bool CGL_camera_is_perspective(CGL_camera* camera);
bool CGL_camera_is_orthographic(CGL_camera* camera);
float CGL_camera_get_fov(CGL_camera* camera);
float CGL_camera_get_aspect_ratio(CGL_camera* camera);
float CGL_camera_get_z_near(CGL_camera* camera);
float CGL_camera_get_z_far(CGL_camera* camera);
CGL_vec4 CGL_camera_get_orthographic_limits(CGL_camera* camera);
CGL_void CGL_camera_set_fov(CGL_camera* camera, CGL_float fov);
CGL_void CGL_camera_set_aspect_ratio(CGL_camera* camera, CGL_float aspect_ratio);
CGL_void CGL_camera_set_z_near(CGL_camera* camera, CGL_float z_near);
CGL_void CGL_camera_set_z_far(CGL_camera* camera, CGL_float z_far);
CGL_void CGL_camera_set_orthographic_limits(CGL_camera* camera, CGL_vec4 ortho_limits);
CGL_void CGL_camera_set_perspective(CGL_camera* camera);
CGL_void CGL_camera_set_orthographic(CGL_camera* camera);
CGL_mat4 CGL_camera_get_projection_mat(CGL_camera* camera);
CGL_mat4* CGL_camera_get_projection_mat_ptr(CGL_camera* camera);
CGL_mat4 CGL_camera_get_view_mat(CGL_camera* camera);
CGL_mat4* CGL_camera_get_view_mat_ptr(CGL_camera* camera);
CGL_mat4 CGL_camera_get_pv_mat(CGL_camera* camera);
CGL_mat4* CGL_camera_get_pv_mat_ptr(CGL_camera* camera);
CGL_void CGL_camera_set_position(CGL_camera* camera, CGL_vec3 position);
CGL_void CGL_camera_set_rotation(CGL_camera* camera, CGL_vec3 ratation);
CGL_vec3 CGL_camera_get_position(CGL_camera* camera);
CGL_vec3 CGL_camera_get_rotation(CGL_camera* camera);
CGL_vec3* CGL_camera_get_position_ptr(CGL_camera* camera);
CGL_vec3* CGL_camera_get_rotation_ptr(CGL_camera* camera);
CGL_vec3 CGL_camera_get_front(CGL_camera* camera);
CGL_vec3 CGL_camera_get_right(CGL_camera* camera);
CGL_vec3 CGL_camera_get_up(CGL_camera* camera);
CGL_void CGL_camera_recalculate_mat(CGL_camera* camera);

#endif

// phong renderer
#ifndef CGL_EXCLUDE_GRAPHICS_API
// The phong renderer
#if 1

#ifndef CGL_EXCLUDE_PHONG_RENDERER

#define CGL_PHONG_MAX_LIGHTS            16

#define CGL_PHONG_LIGHT_DIRECTIONAL     0
#define CGL_PHONG_LIGHT_POINT           1
#define CGL_PHONG_LIGHT_SPOT            2

struct CGL_phong_mat;
typedef struct CGL_phong_mat CGL_phong_mat;

struct CGL_phong_pipeline;
typedef struct CGL_phong_pipeline CGL_phong_pipeline;

struct CGL_phong_light;
typedef struct CGL_phong_light CGL_phong_light;

CGL_phong_pipeline* CGL_phong_pipeline_create();
CGL_void CGL_phong_pipeline_destroy(CGL_phong_pipeline* pipeline);
CGL_void CGL_phong_pipeline_set_user_data(CGL_phong_pipeline* pipeline, void* data);
CGL_void* CGL_phong_pipeline_get_user_data(CGL_phong_pipeline* pipeline);
bool CGL_phong_pipeline_is_using_blinn(CGL_phong_pipeline* pipeline);
CGL_void CGL_phong_pipeline_enable_blinn(CGL_phong_pipeline* pipeline);
CGL_void CGL_phong_pipeline_disable_blinn(CGL_phong_pipeline* pipeline);
CGL_void CGL_phong_pipeline_enable_gamma_correction(CGL_phong_pipeline* pipeline);
CGL_void CGL_phong_pipeline_disable_gamma_correction(CGL_phong_pipeline* pipeline);
CGL_void CGL_phong_pipeline_set_ambient_light_color(CGL_phong_pipeline* pipeline, CGL_vec3 color);
CGL_vec3 CGL_phong_pipeline_get_ambient_light_color(CGL_phong_pipeline* pipeline);
CGL_void CGL_phong_pipeline_set_ambient_light_strength(CGL_phong_pipeline* pipeline, CGL_float strength);
float CGL_phong_pipeline_get_ambient_light_strength(CGL_phong_pipeline* pipeline);
uint32_t CGL_phong_pipeline_add_light(CGL_phong_pipeline* pipeline, CGL_phong_light* light);
CGL_phong_light* CGL_phong_pipeline_remove_light(CGL_phong_pipeline* pipeline, uint32_t light_id);

CGL_phong_mat* CGL_phong_mat_create();
CGL_void CGL_phong_mat_destroy(CGL_phong_mat* mat);
CGL_void CGL_phong_mat_set_diffuse_color(CGL_phong_mat* mat, CGL_vec3 color);
CGL_void CGL_phong_mat_set_diffuse_texture(CGL_phong_mat* mat, CGL_image* image);
CGL_void CGL_phong_mat_set_specular_color(CGL_phong_mat* mat, CGL_vec3 color);
CGL_void CGL_phong_mat_set_specular_texture(CGL_phong_mat* mat, CGL_image* image);
CGL_void CGL_phong_mat_set_normal_texture(CGL_phong_mat* mat, CGL_image* image);
CGL_void CGL_phong_mat_set_shininess(CGL_phong_mat* mat, CGL_float shininess);
CGL_void CGL_phong_mat_set_user_data(CGL_phong_mat* mat, void* data);
CGL_void* CGL_phong_mat_get_user_data(CGL_phong_mat* mat);
CGL_void CGL_phong_mat_disable_normal_map(CGL_phong_mat* mat);
CGL_void CGL_phong_mat_enable_wireframe(CGL_phong_mat* mat);
CGL_void CGL_phong_mat_disable_wireframe(CGL_phong_mat* mat);
float CGL_phong_mat_get_shininess(CGL_phong_mat* mat);

CGL_phong_light* CGL_phong_light_directional(CGL_vec3 direction, CGL_vec3 color, CGL_float itensity);
CGL_phong_light* CGL_phong_light_point(CGL_vec3 position, CGL_vec3 color, CGL_float itensity, CGL_float constant, CGL_float linear, CGL_float quadratic);
CGL_void CGL_phong_light_destroy(CGL_phong_light* light);
CGL_void CGL_phong_light_set_intensity(CGL_phong_light* light, CGL_float intensity);
CGL_void CGL_phong_light_set_color(CGL_phong_light* light, CGL_vec3 color);
float CGL_phong_light_get_intensity(CGL_phong_light* light);
CGL_vec3 CGL_phong_light_get_color(CGL_phong_light* light);
uint32_t CGL_phong_light_get_type(CGL_phong_light* light);

CGL_void CGL_phong_render_begin(CGL_phong_pipeline* pipeline, CGL_camera* camera);
CGL_void CGL_phong_render(CGL_mesh_gpu* mesh, CGL_mat4* model_matrix, CGL_phong_mat* material, CGL_phong_pipeline* pipeline, CGL_camera* camera);
CGL_void CGL_phong_render_end(CGL_phong_pipeline* pipeline, CGL_camera* camera);

#endif

#endif

#endif

// tilemap renderer
#ifndef CGL_EXCLUDE_GRAPHICS_API

// tilemap renderer
#if 1

#ifndef CGL_EXCLUDE_TILEMAP_RENDERER

struct CGL_tilemap;
typedef struct CGL_tilemap CGL_tilemap;

struct CGL_tile;
typedef struct CGL_tile CGL_tile;

CGL_tilemap* CGL_tilemap_create(uint32_t tile_count_x, uint32_t tile_count_y, uint32_t tile_size_x, uint32_t tile_size_y, uint32_t ssbo_binding);
CGL_void CGL_tilemap_destroy(CGL_tilemap* tilemap);
CGL_void CGL_tilemap_set_auto_upload(CGL_tilemap* tilemap, bool value);
bool CGL_tilemap_get_auto_upload(CGL_tilemap* tilemap);
bool CGL_tilemap_upload(CGL_tilemap* tilemap);
CGL_void CGL_tilemap_set_tile_color(CGL_tilemap* tilemap, uint32_t tile_x, uint32_t tile_y, CGL_float r, CGL_float g, CGL_float b);
CGL_void CGL_tilemap_set_tile_texture_from_array(CGL_tilemap* tilemap, uint32_t tile_x, uint32_t tile_y, uint32_t texture_index);
CGL_void CGL_tilemap_set_tile_texture_from_tileset(CGL_tilemap* tilemap, uint32_t tile_x, uint32_t tile_y, CGL_float texture_x_min, CGL_float texture_y_min, CGL_float texture_x_max, CGL_float texture_y_max);
CGL_void CGL_tilemap_set_all_tile_color(CGL_tilemap* tilemap, CGL_float r, CGL_float g, CGL_float b);
CGL_void CGL_tilemap_set_all_tile_texture_from_array(CGL_tilemap* tilemap, uint32_t texture_index);
CGL_void CGL_tilemap_set_all_tile_texture_from_tileset(CGL_tilemap* tilemap, CGL_float texture_x_min, CGL_float texture_y_min, CGL_float texture_x_max, CGL_float texture_y_max);
CGL_void CGL_tilemap_clear_tile(CGL_tilemap* tilemap, uint32_t tile_x, uint32_t tile_y);
CGL_void CGL_tilemap_clear_all_tile(CGL_tilemap* tilemap);
CGL_void CGL_tilemap_render(CGL_tilemap* tilemap, CGL_float scale_x, CGL_float scale_y, CGL_float offset_x, CGL_float offset_y, CGL_texture* texture);
CGL_void CGL_tilemap_reset(CGL_tilemap* tilemap);

#endif

#endif

#endif

// sky renderer
#ifndef CGL_EXCLUDE_GRAPHICS_API
#ifndef CGL_EXCLUDE_SKY_RENDERER

struct CGL_sky;
typedef struct CGL_sky CGL_sky;

CGL_sky* CGL_sky_create();
CGL_void CGL_sky_destroy(CGL_sky* sky);
CGL_void CGL_sky_use_skybox(CGL_sky* sky);
CGL_void CGL_sky_use_skysphere(CGL_sky* sky);
CGL_void CGL_sky_use_cubemap(CGL_sky* sky);
CGL_void CGL_sky_use_procedural(CGL_sky* sky);
CGL_void CGL_sky_cubemap_set_face(CGL_sky* sky, CGL_int face, CGL_image* image);
CGL_void CGL_sky_procedural_set_options(CGL_sky* sky, CGL_float cirrus, CGL_float cumulus, CGL_float upf);
CGL_void CGL_sky_procedural_set_time(CGL_sky* sky, CGL_float time);
CGL_void CGL_sky_procedural_set_sun_position(CGL_sky* sky, CGL_vec3 position);
CGL_void CGL_sky_render(CGL_sky* sky, CGL_camera* camera);

#endif // CGL_EXCLUDE_SKY_RENDERER
#endif // CGL_EXCLUDE_GRAPHICS_API

// markov chains
#ifndef CGL_EXCLUDE_MARKOV_API

struct CGL_markov;
typedef struct CGL_markov CGL_markov;

typedef bool(*CGL_markov_token_function)(void*, const void*, const size_t, void*, void*); // (void* context, const void* data, const size_t data_size, void* key, void* value)

struct CGL_markov_token_function_ngram_text_context;
typedef struct CGL_markov_token_function_ngram_text_context CGL_markov_token_function_ngram_text_context;

CGL_markov_token_function_ngram_text_context* CGL_markov_token_function_ngram_text_context_create(size_t n);
CGL_void CGL_markov_token_function_ngram_text_context_destroy(CGL_markov_token_function_ngram_text_context* context);
bool CGL_markov_token_function_ngram_text(void* context, const void* data, const size_t data_size, void* key, void* value);

CGL_markov* CGL_markov_create(const size_t key_size, const size_t value_size);
bool CGL_markov_train(CGL_markov* markov, void* context, const void* data, const size_t data_size, const CGL_markov_token_function function);
bool CGL_markov_generate(const CGL_markov* markov, const void* key, void* value);
CGL_void CGL_markov_destroy(CGL_markov* markov);

#endif

// text rendering
#ifndef CGL_EXCLUDE_TEXT_RENDER

#ifndef CGL_EXCLUDE_GRAPHICS_API

struct CGL_font_character
{
	CGL_vec2 size;
	CGL_vec2 normalized_size;
	CGL_vec2 offset;
	CGL_vec2 normalized_offset;
	CGL_vec2 bearing;
	CGL_vec2 bearing_normalized;
	CGL_vec2 advance;
	CGL_vec2 advance_normalized;
	unsigned char* bitmap;
	char ch;
};
typedef struct CGL_font_character CGL_font_character;

struct CGL_font;
typedef struct CGL_font CGL_font;

CGL_bool CGL_text_init();
CGL_void CGL_text_shutdown();
CGL_font* CGL_font_load(const char* path);
CGL_font* CGL_font_load_from_memory(const char* data, CGL_sizei size);
CGL_void CGL_font_destory(CGL_font* font);
CGL_texture* CGL_font_get_atlas(CGL_font* font);
CGL_bool CGL_font_build_atlas(CGL_font* font, size_t width, size_t height, size_t font_size);
CGL_font_character* CGL_font_get_characters(CGL_font* font);
CGL_texture* CGL_text_bake_to_texture(const char* string, size_t string_length, CGL_font* font, size_t* width, size_t* height);

#endif

#endif

// widgets
#ifndef CGL_EXCLUDE_WIDGETS
#ifndef CGL_GRAPHICS_API

#ifndef CGL_WIDGETS_MAX_VERTICES
#define CGL_WIDGETS_MAX_VERTICES 1024 * 128
#endif

#ifndef CGL_WIDGETS_MAX_INDICES
#define CGL_WIDGETS_MAX_INDICES 1024 * 128
#endif

#ifndef CGL_WIDGETS_MAX_TEXTURES
#define CGL_WIDGETS_MAX_TEXTURES 64
#endif

struct CGL_widgets_context;
typedef struct CGL_widgets_context CGL_widgets_context;

CGL_widgets_context* CGL_widgets_context_create(size_t max_vertices, size_t max_indices);
CGL_void CGL_widgets_context_destroy(CGL_widgets_context* context);
CGL_widgets_context* CGL_window_get_current_context();
CGL_bool CGL_widgets_init();
CGL_void CGL_widgets_shutdown();
CGL_void CGL_window_set_current_context(CGL_widgets_context* context);
CGL_bool CGL_widgets_begin();
CGL_bool CGL_widgets_begin_int(CGL_float scale_x, CGL_float scale_y, CGL_float offset_x, CGL_float offset_y);
CGL_bool CGL_widgets_end();
CGL_bool CGL_widgets_flush();
CGL_bool CGL_widgets_flush_if_required();
// bool CGL_widgets_add_vertices(CGL_mesh_vertex* vertices, size_t vertex_count, uint32_t* indices, size_t index_count); // DEPRECATED
CGL_void CGL_widgets_add_vertex(CGL_mesh_vertex* vertex);
CGL_void CGL_widgets_add_mesh(CGL_mesh_cpu* mesh);
CGL_void CGL_widgets_add_vertex_p(CGL_vec3 position);
CGL_void CGL_widgets_add_vertex_p3f(CGL_float pos_x, CGL_float pos_y, CGL_float pos_z);
CGL_void CGL_widgets_add_vertex_pt(CGL_vec3 position, CGL_vec2 tex_coord);
CGL_void CGL_widgets_add_vertex_p3ft(CGL_float pos_x, CGL_float pos_y, CGL_float pos_z, CGL_vec2 tex_coord);
CGL_void CGL_widgets_add_vertex_pt2f(CGL_vec3 position, CGL_float tex_x, CGL_float tex_y);
CGL_void CGL_widgets_add_vertex_p3ft2f(CGL_float pos_x, CGL_float pos_y, CGL_float pos_z, CGL_float tex_x, CGL_float tex_y);
CGL_void CGL_widgets_set_stroke_color(CGL_color color);
CGL_void CGL_widgets_set_stroke_colorf(CGL_float r, CGL_float g, CGL_float b, CGL_float a);
CGL_void CGL_widgets_set_mask(CGL_vec4 mask);
CGL_void CGL_widgets_set_maskf(CGL_float min_x, CGL_float min_y, CGL_float max_x, CGL_float max_y);
// for backwards compatibility
#define CGL_widgets_set_stroke_thickness CGL_widgets_set_stroke_thicnkess 
CGL_void CGL_widgets_set_stroke_thicnkess(CGL_float thickness);
CGL_void CGL_widgets_set_fill_color(CGL_color color);
CGL_void CGL_widgets_set_fill_colorf(CGL_float r, CGL_float g, CGL_float b, CGL_float a);
CGL_void CGL_widgets_set_fill_mode(CGL_bool is_enabled);
CGL_void CGL_widgets_set_projection_matrix(CGL_mat4* matrix);
CGL_void CGL_widgets_enable_diffuse_shading(CGL_vec3 light_position, CGL_vec3 light_color);
CGL_void CGL_widgets_disable_diffuse_shading();
CGL_void CGL_widgets_set_view_matrix(CGL_mat4* matrix);
CGL_void CGL_widgets_set_model_matrix(CGL_mat4* matrix);
CGL_void CGL_widgets_set_texture(CGL_texture* texture);
CGL_void CGL_widgets_set_font_texture(CGL_texture* texture);
CGL_void CGL_widgets_set_texture_coordinate_so(CGL_float scale_x, CGL_float scale_y, CGL_float offset_x, CGL_float offset_y);
CGL_void CGL_widgets_apply_transformations_on_cpu();
CGL_void CGL_widgets_apply_transformations_on_gpu();
CGL_void CGL_widgets_add_triangle(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c);
CGL_void CGL_widgets_add_quad(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c, CGL_vec3 d);
CGL_void CGL_widgets_add_quad_8f(CGL_float ax, CGL_float ay, CGL_float bx, CGL_float by, CGL_float cx, CGL_float cy, CGL_float dx, CGL_float dy);
CGL_void CGL_widgets_add_line(CGL_vec3 start, CGL_vec3 end);
CGL_void CGL_widgets_add_line2f(CGL_float start_x, CGL_float start_y, CGL_float end_x, CGL_float end_y);
CGL_void CGL_widgets_add_rect(CGL_vec3 start, CGL_vec2 size);
CGL_void CGL_widgets_add_rect2f(CGL_float start_x, CGL_float start_y, CGL_float size_x, CGL_float size_y);
CGL_void CGL_widgets_add_rounded_rect2f(CGL_float start_x, CGL_float start_y, CGL_float size_x, CGL_float size_y, CGL_float radius, CGL_int res);
CGL_void CGL_widgets_add_circle(CGL_vec3 position, CGL_float radius);
CGL_void CGL_widgets_add_circle2f(CGL_float pos_x, CGL_float pos_y, CGL_float radius);
CGL_void CGL_widgets_add_circler(CGL_vec3 position, CGL_float radius, CGL_int res);
CGL_void CGL_widgets_add_circle2fr(CGL_float pos_x, CGL_float pos_y, CGL_float radius, CGL_int res);
CGL_void CGL_widgets_add_oval(CGL_vec3 position, CGL_vec2 radius);
CGL_void CGL_widgets_add_oval2f(CGL_float pos_x, CGL_float pos_y, CGL_float radius_x, CGL_float radius_y);
CGL_void CGL_widgets_add_oval2fr(CGL_float pos_x, CGL_float pos_y, CGL_float radiusx, CGL_float radiusy, CGL_int resolution);
CGL_void CGL_widgets_add_arc2f(CGL_float pos_x, CGL_float pos_y, CGL_float radius, CGL_float start_angle, CGL_float end_angle, CGL_int resolution);
CGL_bool CGL_widgets_add_character(char c, CGL_float x, CGL_float y, CGL_float sx, CGL_float sy);
CGL_bool CGL_widgets_add_string(const char* str, CGL_float x, CGL_float y, CGL_float sx, CGL_float sy);
#ifndef CGL_EXCLUDE_TEXT_RENDER
CGL_float CGL_widgets_add_string_with_font(const char* str, CGL_font* font, CGL_float x, CGL_float y, CGL_float sx, CGL_float scale_y);
#endif
CGL_void CGL_widgets_add_shape_out_line(CGL_shape* shape);
CGL_void CGL_widgets_add_cubic_bazier(CGL_vec3 start, CGL_vec3 end, CGL_vec3 control_1, CGL_vec3 control_2, CGL_int resolution);
CGL_void CGL_widgets_add_cubic_bazier2v(CGL_vec2 start, CGL_vec2 end, CGL_vec2 control_1, CGL_vec2 control_2, CGL_int resolution);
CGL_void CGL_widgets_add_cubic_bazier2f(CGL_float start_x, CGL_float start_y, CGL_float end_x, CGL_float end_y, CGL_float control_1_x, CGL_float control_1_y, CGL_float control_2_x, CGL_float control_2_y, CGL_int resolution);
CGL_void CGL_widgets_add_cubic_bazier_points(CGL_vec3 start, CGL_vec3 end, CGL_vec3 control_1, CGL_vec3 control_2, CGL_int resolution);
CGL_void CGL_widgets_add_cubic_bazier_points2v(CGL_vec2 start, CGL_vec2 end, CGL_vec2 control_1, CGL_vec2 control_2, CGL_int resolution);
CGL_void CGL_widgets_add_cubic_bazier_points2f(CGL_float start_x, CGL_float start_y, CGL_float end_x, CGL_float end_y, CGL_float control_1_x, CGL_float control_1_y, CGL_float control_2_x, CGL_float control_2_y, CGL_int resolution);
CGL_void CGL_widgets_add_plot_function(CGL_float start_x, CGL_float start_y, CGL_float size_x, CGL_float size_y, CGL_float(*func_to_plot)(CGL_float), CGL_int num_samples, CGL_float x_min, CGL_float x_max, CGL_float y_min, CGL_float y_max, CGL_float plot_thickness, CGL_vec3 plot_color, CGL_bool draw_axes, CGL_float axes_thickness, CGL_vec3 axes_color);
CGL_void CGL_widgets_add_plot_array(CGL_float start_x, CGL_float start_y, CGL_float size_x, CGL_float size_y, CGL_vec2* values, CGL_sizei count, CGL_float marker_size, CGL_vec3 marker_color, CGL_bool draw_axes, CGL_float axes_thickness, CGL_vec3 axes_color);
CGL_void CGL_widgets_add_plot_pie_chart(CGL_float start_x, CGL_float start_y, CGL_float radius, CGL_float* values, CGL_vec3* colors, CGL_sizei count, CGL_int resolution);
CGL_void CGL_widgets_add_bar_graph(CGL_float start_x, CGL_float start_y, CGL_float size_x, CGL_float size_y, CGL_float* values, CGL_vec3* colors, CGL_sizei count, CGL_bool draw_axes, CGL_float axes_thickness, CGL_vec3 axes_color, CGL_bool vertical);

#endif
#endif

#ifndef CGL_EXCLUDE_NODE_EDITOR

#ifdef CGL_EXCLUDE_WIDGETS
#error "CGL Widgets are required for CGL Node Editor"
#endif

#define CGL_NODE_EDITOR_NODE_MAX_PINS 8

struct CGL_node_editor;
typedef struct CGL_node_editor CGL_node_editor;

struct CGL_node_editor_node;
typedef struct CGL_node_editor_node CGL_node_editor_node;

struct CGL_node_editor_pin
{
	CGL_color color;
	CGL_node_editor_node* parent;
	void* user_data;
	CGL_float pos_x;
	CGL_float pos_y;
	CGL_int index;
	bool left;
	bool is_set;
};
typedef struct CGL_node_editor_pin CGL_node_editor_pin;

struct CGL_node_editor_node
{
	CGL_node_editor_pin left_pins[CGL_NODE_EDITOR_NODE_MAX_PINS];
	CGL_node_editor_pin right_pins[CGL_NODE_EDITOR_NODE_MAX_PINS];
	char title[256];
	CGL_color color;
	CGL_int pins_count[2];
	CGL_node_editor* editor;
	void* user_data;
	CGL_float pos_x;
	CGL_float pos_y;
	CGL_float size_x;
	CGL_float size_y;
	bool selected;
	bool render_title;
};

struct CGL_node_editor_input
{
	CGL_float mouse_pos_x;
	CGL_float mouse_pos_y;
	CGL_float aspect_ratio;
	CGL_float scale;
	bool mouse_button_left;
	bool mouse_button_right;
	bool mouse_button_middle;
	bool shift;
	bool ctrl;
	bool escape;
};
typedef struct CGL_node_editor_input CGL_node_editor_input;

CGL_node_editor* CGL_node_editor_create();
CGL_void CGL_node_editor_destroy(CGL_node_editor* editor);
CGL_void CGL_node_editor_update(CGL_node_editor* editor, CGL_node_editor_input* input);
CGL_void CGL_node_editor_set_on_connect(CGL_node_editor* editor, void(*onconnect)(CGL_node_editor_pin*, CGL_node_editor_pin*));
CGL_void CGL_node_editor_set_on_drop(CGL_node_editor* editor, void(*ondrop)(CGL_float, CGL_float, CGL_node_editor_pin*));
CGL_void CGL_node_editor_render_begin(CGL_node_editor* editor);
CGL_void CGL_node_editor_clear_focused_pins(CGL_node_editor* editor);
CGL_void CGL_node_editor_render_end(CGL_node_editor* editor);
CGL_void CGL_node_editor_set_offset(CGL_node_editor* editor, CGL_float x, CGL_float y);
CGL_void CGL_node_editor_get_offset(CGL_node_editor* editor, CGL_float* x, CGL_float* y);
CGL_void CGL_node_editor_get_linked_pins(CGL_node_editor* editor, CGL_node_editor_pin** x, CGL_node_editor_pin** y);
CGL_void CGL_node_editor_render_link(CGL_node_editor_pin* left, CGL_node_editor_pin* right, CGL_color color, CGL_float midper);
CGL_void CGL_node_editor_render_linkf(CGL_node_editor_pin* left, CGL_node_editor_pin* right, CGL_float cr, CGL_float cg, CGL_float cb, CGL_float ca, CGL_float midper);
CGL_void CGL_node_editor_render_link_curved(CGL_node_editor_pin* left, CGL_node_editor_pin* right, CGL_color color, CGL_float x_dist, CGL_float y_dist, CGL_int resolution);
CGL_void CGL_node_editor_render_link_curvedf(CGL_node_editor_pin* left, CGL_node_editor_pin* right, CGL_float cr, CGL_float cg, CGL_float cb, CGL_float ca, CGL_float x_dist, CGL_float y_dist, CGL_int resolution);

CGL_void CGL_node_editor_node_init(CGL_node_editor* editor, CGL_node_editor_node* node);
CGL_void CGL_node_editor_node_update(CGL_node_editor_node* node);
CGL_void CGL_node_editor_node_render(CGL_node_editor_node* node);
CGL_void CGL_node_editor_node_set_position(CGL_node_editor_node* node, CGL_float x, CGL_float y);
CGL_void CGL_node_editor_node_set_title(CGL_node_editor_node* node, const CGL_byte* title);
CGL_node_editor_pin* CGL_node_editor_node_get_pin(CGL_node_editor_node* node, bool left, CGL_int index);

#endif


#ifndef CGL_EXCLUDE_RAY_CASTER

#define CGL_RAY_CASTER_MAX_TRIANGLES 4096
#define CGL_RAY_CASTER_MAX_WALLS     4096

struct CGL_ray_caster;
typedef struct CGL_ray_caster CGL_ray_caster;

CGL_ray_caster* CGL_ray_caster_create();
CGL_void CGL_ray_caster_destroy(CGL_ray_caster* caster);
CGL_void CGL_ray_caster_add_walls(CGL_ray_caster* caster, CGL_vec4* walls, CGL_int walls_count);
CGL_void CGL_ray_caster_add_wall(CGL_ray_caster* caster, CGL_vec4 wall);
CGL_void CGL_ray_caster_clear_walls(CGL_ray_caster* caster);
float CGL_ray_caster_get_intersection_point_for_wall(CGL_vec2 pos, CGL_vec2 dir, CGL_vec4 wall, CGL_vec2* intersection_point, float* angle, CGL_float max_dist);
float CGL_ray_caster_get_intersection_point_for_walls(CGL_vec2 pos, CGL_vec2 dir, CGL_vec4* walls, CGL_int wall_count, CGL_vec2* intersection_point, float* angle, CGL_float max_dist);
CGL_void CGL_ray_caster_calculate(CGL_ray_caster* caster, CGL_vec2 pos, CGL_float rotation, bool visualise_rays);
bool CGL_ray_caster_is_in_view(CGL_ray_caster* caster, CGL_vec2 point);
CGL_void CGL_ray_caster_set_angle_limits(CGL_ray_caster* caster, CGL_float min_angle, CGL_float max_angle);
CGL_void CGL_ray_caster_set_max_distance(CGL_ray_caster* caster, CGL_float val);
CGL_shape_triangle* CGL_ray_caster_get_triangles(CGL_ray_caster* caster, CGL_int* count);

#endif


#ifndef CGL_EXCLUDE_SQUARE_MARCHER

struct CGL_square_marcher;
typedef struct CGL_square_marcher CGL_square_marcher;

typedef bool(*CGL_square_marcher_distance_function)(CGL_vec2, float*, void*);

CGL_square_marcher* CGL_square_marcher_create();
CGL_void CGL_square_marcher_destroy(CGL_square_marcher* marcher);
CGL_void CGL_square_marcher_set_user_data(CGL_square_marcher* marcher, void* user_data);
CGL_void* CGL_square_marcher_get_user_data(CGL_square_marcher* marcher);
CGL_void CGL_square_marcher_enable_interpolation(CGL_square_marcher* marcher, CGL_bool enable);
CGL_mesh_cpu* CGL_square_marcher_generate_mesh(CGL_square_marcher* marcher, CGL_square_marcher_distance_function sampler, CGL_vec2 start, CGL_vec2 end, CGL_int resolution_x, CGL_int resolution_y);

#endif


#ifndef CGL_EXCLUDE_POST_PROCESSOR

struct CGL_post_processor;
typedef struct CGL_post_processor CGL_post_processor;

CGL_void CGL_post_processor_init();
CGL_void CGL_post_processor_shutdown();
CGL_void CGL_post_processor_process_shades(CGL_texture* output, CGL_texture* scene, CGL_texture* albedo, CGL_int shades);
CGL_void CGL_post_processor_process_outline(CGL_texture* output, CGL_texture* scene, CGL_texture* normal, CGL_texture* depth, CGL_float outline_width);
CGL_void CGL_post_processor_process_hatching(CGL_texture* output, CGL_texture* scene, CGL_texture* uv, CGL_texture** hatch_tex, CGL_int hatch_tex_count);

// for legacy code
#define  CGL_toon_post_processor_init CGL_post_processor_init
#define  CGL_toon_post_processor_shutdown CGL_post_processor_shutdown
#define  CGL_toon_post_processor_process_shades CGL_post_processor_process_shades
#define  CGL_toon_post_processor_process_outline CGL_post_processor_process_outline

#endif


struct CGL_wav_file
{
	CGL_byte* data;
	CGL_int size;
	CGL_int channel_count;
	CGL_int sample_rate;
	CGL_int bits_per_sample;
	CGL_int data_size;
	CGL_float duration;
};
typedef struct CGL_wav_file CGL_wav_file;

CGL_bool CGL_wav_file_load(CGL_wav_file* file, const char* filename);
CGL_void CGL_wav_file_destroy(CGL_wav_file* file);
CGL_int CGL_wav_file_sample(CGL_wav_file* file, CGL_int channel, CGL_int sample_id);
CGL_int CGL_wav_file_sample_at_time(CGL_wav_file* file, CGL_int channel, CGL_float time);


#ifndef CGL_EXCLUDE_AUDIO

#include <AL/al.h>
#include <AL/alc.h>

struct CGL_audio_context;
typedef struct CGL_audio_context CGL_audio_context;

struct CGL_audio_source;
typedef struct CGL_audio_source CGL_audio_source;

struct CGL_audio_buffer;
typedef struct CGL_audio_buffer CGL_audio_buffer;

struct CGL_audio_listener;
typedef struct CGL_audio_listener CGL_audio_listener;

CGL_int CGL_audio_get_last_error();
const CGL_byte* CGL_audio_get_error_string(CGL_int error);
const CGL_byte* CGL_audio_get_device_list();
const CGL_byte* CGL_audio_get_default_device();
CGL_audio_context* CGL_audio_context_create(const CGL_byte* device_name);
CGL_void CGL_audio_context_destroy(CGL_audio_context* context);
CGL_void CGL_audio_make_context_current(CGL_audio_context* context);
CGL_audio_source* CGL_audio_source_create();
CGL_void CGL_audio_source_destroy(CGL_audio_source* source);
CGL_void CGL_audio_source_reset_to_defaults(CGL_audio_source* source);
CGL_void CGL_audio_source_set_buffer(CGL_audio_source* source, CGL_audio_buffer* buffer);
CGL_void CGL_audio_source_set_looping(CGL_audio_source* source, CGL_bool looping);
CGL_void CGL_audio_source_set_pitch(CGL_audio_source* source, CGL_float pitch);
CGL_void CGL_audio_source_set_gain(CGL_audio_source* source, CGL_float gain);
CGL_void CGL_audio_source_set_position(CGL_audio_source* source, CGL_vec3 position);
CGL_void CGL_audio_source_set_velocity(CGL_audio_source* source, CGL_vec3 velocity);
CGL_void CGL_audio_source_set_direction(CGL_audio_source* source, CGL_vec3 direction);
CGL_float CGL_audio_source_get_seconds_offset(CGL_audio_source* source);
CGL_void CGL_audio_source_set_seconds_offset(CGL_audio_source* source, CGL_sizei seconds);
CGL_sizei CGL_audio_source_get_samples_offset(CGL_audio_source* source);
CGL_void CGL_audio_source_set_samples_offset(CGL_audio_source* source, CGL_sizei samples);
CGL_sizei CGL_audio_source_get_bytes_offset(CGL_audio_source* source);
CGL_void CGL_audio_source_set_bytes_offset(CGL_audio_source* source, CGL_sizei bytes);
CGL_void CGL_audio_source_play(CGL_audio_source* source);
CGL_void CGL_audio_source_pause(CGL_audio_source* source);
CGL_void CGL_audio_source_stop(CGL_audio_source* source);
CGL_bool CGL_audio_source_is_playing(CGL_audio_source* source);
CGL_bool CGL_audio_source_is_paused(CGL_audio_source* source);
CGL_bool CGL_audio_source_is_stopped(CGL_audio_source* source);
CGL_audio_buffer* CGL_audio_buffer_create();
CGL_void CGL_audio_buffer_destroy(CGL_audio_buffer* buffer);
CGL_void CGL_audio_buffer_set_data_from_wav_file(CGL_audio_buffer* buffer, CGL_wav_file* file);
CGL_void CGL_audio_buffer_set_data(CGL_audio_buffer* buffer, void* data, ALenum format, ALsizei size, ALsizei freq);
CGL_void CGL_audio_listener_set_position(CGL_vec3 position);
CGL_void CGL_audio_listener_set_velocity(CGL_vec3 velocity);
CGL_void CGL_audio_listener_set_orientation(CGL_vec3 forward, CGL_vec3 up);


#endif


#ifndef CGL_EXCLUDE_TRAIL_RENDERER

struct CGL_trail_point
{
	CGL_vec3 position;
	struct CGL_trail_point* next;
	void* user_data;
	CGL_int index;
	CGL_float lifespan;
	CGL_float thickness;
	CGL_float distance;
};
typedef struct CGL_trail_point CGL_trail_point;

struct CGL_trail;
typedef struct CGL_trail CGL_trail;

typedef CGL_bool(*CGL_trail_point_update_function)(CGL_trail*, CGL_trail_point*);

CGL_trail* CGL_trail_create();
CGL_void CGL_trail_destroy(CGL_trail* trail);
CGL_void CGL_trail_render(CGL_trail* trail, CGL_mat4* view, CGL_mat4* projection, CGL_shader* shader);
CGL_void CGL_trail_add_point(CGL_trail* trail, CGL_vec3 point, CGL_float lifespan, CGL_float thickness);
CGL_void CGL_trail_set_resolution(CGL_trail* trail, CGL_int resolution);
CGL_void CGL_trail_update(CGL_trail* trail, CGL_float delta_time);
CGL_void CGL_trail_bake_mesh(CGL_trail* trail);
CGL_void CGL_trail_clear(CGL_trail* trail);
CGL_void CGL_trail_calculate_distances(CGL_trail* trail);
CGL_void CGL_trail_set_point_update_function(CGL_trail* trail, CGL_trail_point_update_function function);
CGL_void CGL_trail_set_user_data(CGL_trail* trail, void* user_data);
CGL_void* CGL_trail_get_user_data(CGL_trail* trail);
CGL_mesh_gpu* CGL_trail_get_mesh_gpu(CGL_trail* trail);
CGL_trail_point* CGL_trail_get_first_point(CGL_trail* trail);
CGL_float CGL_trail_get_length(CGL_trail* trail);
CGL_void CGL_trail_set_max_length(CGL_trail* trail, CGL_float length);
CGL_void CGL_trail_set_min_points_distance(CGL_trail* trail, CGL_float min_points_distance);

#endif

#ifdef CGL_INCLUDE_PASCAL_CASE_TYPES
typedef CGL_int Integer;
typedef CGL_float Real;
typedef CGL_byte Byte;
typedef CGL_bool Boolean;
typedef CGL_vec2 Vector2;
typedef CGL_vec3 Vector3;
typedef CGL_vec4 Vector4;
typedef CGL_mat2 Matrix2x2;
typedef CGL_mat3 Matrix3x3;
typedef CGL_mat4 Matrix4x4;
typedef CGL_quat Quaternion;
typedef CGL_color Color;
#endif


#ifndef CGL_EXCLUDE_NOISE_API

#ifndef CGL_NOISE_DATA_TYPE
#define CGL_NOISE_DATA_TYPE CGL_float
#endif

typedef CGL_NOISE_DATA_TYPE CGL_noise_data_type;

#define CGL_NOISE_TYPE_PERLIN           0
#define CGL_NOISE_TYPE_OPENSIMPLEX      1
#define CGL_NOISE_TYPE_OPENSIMPLEX2S    2
#define CGL_NOISE_TYPE_VALUE            3
#define CGL_NOISE_TYPE_VALUECUBIC       4
#define CGL_NOISE_TYPE_WORLEY           5
#define CGL_NOISE_TYPE_COUNT            6

#define CGL_NOISE_FRACTAL_TYPE_NONE     0
#define CGL_NOISE_FRACTAL_TYPE_FBM      1
#define CGL_NOISE_FRACTAL_TYPE_BILLOW   2
#define CGL_NOISE_FRACTAL_TYPE_RIGID    3
#define CGL_NOISE_FRACTAL_TYPE_PINGPONG 4
#define CGL_NOISE_FRACTAL_TYPE_COUNT    5



struct CGL_noise_params
{
	CGL_int type;
	CGL_int fractal_type;
	CGL_int octaves;
	CGL_noise_data_type frequency;
	CGL_noise_data_type lacunarity;
	CGL_noise_data_type gain;
	CGL_noise_data_type weighted_strength;
	CGL_noise_data_type ping_pong_strength;
};
typedef struct CGL_noise_params CGL_noise_params;

CGL_void CGL_noise_init();
CGL_void CGL_noise_shutdown();
CGL_noise_data_type CGL_noise_perlin(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z);
CGL_noise_data_type CGL_noise_opensimplex(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z);
CGL_noise_data_type CGL_noise_opensimplex2s(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z);
CGL_noise_data_type CGL_noise_value(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z);
CGL_noise_data_type CGL_noise_valuecubic(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z);
CGL_noise_data_type CGL_noise_worley(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z);
CGL_void CGL_noise_params_default(CGL_noise_params* params);
CGL_noise_data_type CGL_noise_get(CGL_noise_params* params, CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z);


#endif

#ifndef CGL_EXCLUDE_AI_API

// simple neural network

struct CGL_simple_neural_network;
typedef struct CGL_simple_neural_network CGL_simple_neural_network;

struct CGL_simple_neural_network_layer;
typedef struct CGL_simple_neural_network_layer CGL_simple_neural_network_layer;

typedef CGL_float(*CGL_simple_neural_network_activation_function)(CGL_float x);

CGL_simple_neural_network* CGL_simple_neural_network_create(CGL_int* layer_sizes, CGL_int layer_count);
CGL_byte* CGL_simple_neural_network_serialize_weights(CGL_simple_neural_network* network, CGL_sizei* size_out);
CGL_bool CGL_simple_neural_network_deserialize_weights(CGL_simple_neural_network* network, CGL_byte* data);
CGL_void CGL_simple_neural_network_set_layer_activation_function(CGL_simple_neural_network* network, CGL_int layer_index, CGL_simple_neural_network_activation_function activation_function, CGL_simple_neural_network_activation_function activation_function_derivative);
CGL_void CGL_simple_neural_network_destroy(CGL_simple_neural_network* network);
CGL_void CGL_simple_neural_network_evaluate(CGL_simple_neural_network* network, CGL_float* input, CGL_float* output);
CGL_void CGL_simple_neural_network_randomize_weights(CGL_simple_neural_network* network, CGL_float min_v, CGL_float max_v);
CGL_void CGL_simple_neural_network_copy_weights(CGL_simple_neural_network* a, CGL_simple_neural_network* b);
CGL_void CGL_simple_neural_network_mutate(CGL_simple_neural_network* a, CGL_float mutation_ratio);

// multi variable linear regression

struct CGL_linear_regression_context;
typedef struct CGL_linear_regression_context CGL_linear_regression_context;

typedef CGL_float(*CGL_linear_regression_sample_function)(CGL_void* user_data, CGL_float* input, CGL_float* output, CGL_int id);

CGL_linear_regression_context* CGL_linear_regression_context_create(CGL_int input_count);
CGL_void CGL_linear_regression_context_destroy(CGL_linear_regression_context* context);
CGL_void CGL_linear_regression_randomize_coefficents(CGL_linear_regression_context* context, CGL_float min_v, CGL_float max_v);
CGL_float CGL_linear_regression_evaluate(CGL_linear_regression_context* context, CGL_float* input, CGL_float* output);
CGL_bool CGL_linear_regression_train(CGL_linear_regression_context* context, CGL_linear_regression_sample_function sample_function, void* user_data, CGL_int sample_count, CGL_float learning_rate, CGL_int max_iterations);


#endif


#ifndef CGL_EXCLUDE_PATH_FINDING_API

struct CGL_path_finding_node
{
	void* data_ptr;
	CGL_int id;
	CGL_int parent_id;
	CGL_int child_id;
	CGL_float g;
	CGL_float h;
	CGL_float f;
	CGL_bool is_open;
	CGL_bool is_active;
};
typedef struct CGL_path_finding_node CGL_path_finding_node;

#ifndef CGL_PATH_FINDING_A_STAR_MAX_NEIGHBOURS
#define CGL_PATH_FINDING_A_STAR_MAX_NEIGHBOURS 256
#endif

struct CGL_path_finding_a_star_context;
typedef struct CGL_path_finding_a_star_context CGL_path_finding_a_star_context;

typedef CGL_float(*CGL_path_finding_heuristic_function)(void*, CGL_path_finding_node* a);
typedef CGL_float(*CGL_path_finding_cost_function)(void*, CGL_path_finding_node* a, CGL_path_finding_node* b);
typedef CGL_int(*CGL_path_finding_get_neighbors_function)(void*, CGL_path_finding_node* a, CGL_int* neighbors_out);
typedef CGL_bool(*CGL_path_finding_node_equals_function)(void*, CGL_path_finding_node* a, CGL_path_finding_node* b);

CGL_void CGL_path_finding_node_init(CGL_path_finding_node* node, void* data_ptr);

CGL_path_finding_a_star_context* CGL_path_finding_a_star_context_create(CGL_int max_nodes_count, CGL_bool copy_data, CGL_int data_size);
CGL_int CGL_path_finding_a_star_add_node(CGL_path_finding_a_star_context* context, CGL_path_finding_node node, CGL_path_finding_node_equals_function node_equals_function);
CGL_bool CGL_path_finding_a_star_find_path(CGL_path_finding_a_star_context* context, CGL_path_finding_node start_node, CGL_path_finding_node end_node, CGL_path_finding_heuristic_function heuristic_function, CGL_path_finding_cost_function cost_function, CGL_path_finding_get_neighbors_function get_neighbors_function, CGL_path_finding_node_equals_function node_equals_function, void* user_data);
CGL_float CGL_path_finding_a_star_get_path_length(CGL_path_finding_a_star_context* context);
CGL_path_finding_node* CGL_path_finding_a_star_get_path_start_node(CGL_path_finding_a_star_context* context);
CGL_bool CGL_path_finding_a_star_has_path(CGL_path_finding_a_star_context* context);
CGL_void* CGL_path_finding_a_star_next_in_path(CGL_path_finding_a_star_context* context, void* data_out);
CGL_void CGL_path_finding_a_star_reorder_path(CGL_path_finding_a_star_context* context);
CGL_void CGL_path_finding_a_star_clear_path(CGL_path_finding_a_star_context* context);
CGL_void CGL_path_finding_a_star_context_destroy(CGL_path_finding_a_star_context* context);

#endif

#ifndef CGL_EXCLUDE_CSV_API

struct CGL_csv;
typedef struct CGL_csv CGL_csv;

CGL_csv* CGL_csv_create(CGL_sizei item_max_size);
CGL_void CGL_csv_destroy(CGL_csv* csv);
CGL_bool CGL_csv_load(CGL_csv* csv, const CGL_byte* file_path, const CGL_byte* seperator);
CGL_bool CGL_csv_load_from_buffer(CGL_csv* csv, const CGL_byte* buffer, const CGL_byte* seperator);
CGL_bool CGL_csv_save(CGL_csv* csv, const CGL_byte* file_path, const CGL_byte* separator);
CGL_bool CGL_csv_save_to_buffer(CGL_csv* csv, CGL_byte* buffer, const CGL_byte* separator);
CGL_bool CGL_csv_add_column(CGL_csv* csv);
CGL_bool CGL_csv_add_row(CGL_csv* csv);
CGL_byte* CGL_csv_set_item(CGL_csv* csv, CGL_int row, CGL_int column, const CGL_byte* item);
CGL_byte* CGL_csv_get_item(CGL_csv* csv, CGL_int row, CGL_int column, CGL_byte* item_out);
CGL_bool CGL_csv_get_row(CGL_csv* csv, CGL_int row, CGL_byte* row_out);
CGL_bool CGL_csv_get_column(CGL_csv* csv, CGL_int column, CGL_byte* column_out);
CGL_int CGL_csv_get_row_count(CGL_csv* csv);
CGL_int CGL_csv_get_column_count(CGL_csv* csv);
CGL_void CGL_csv_clear(CGL_csv* csv);


#endif

#ifndef CGL_EXCLUDE_IMAGE_FILE_API

#define CGL_IMAGE_FORMAT_UNKNOWN    0x00AB0
#define CGL_IMAGE_FORMAT_PNG        0x00AB1
#define CGL_IMAGE_FORMAT_JPEG       0x00AB2
#define CGL_IMAGE_FORMAT_BMP        0x00AB3
#define CGL_IMAGE_FORMAT_GIF        0x00AB4

CGL_bool CGL_image_file_is_png_f(FILE* file);
CGL_bool CGL_image_file_is_png(const CGL_byte* file_path);
CGL_bool CGL_image_file_is_bmp_f(FILE* file);
CGL_bool CGL_image_file_is_bmp(const CGL_byte* file_path);
CGL_bool CGL_image_file_is_gif_f(FILE* file);
CGL_bool CGL_image_file_is_gif(const CGL_byte* file_path);
CGL_bool CGL_image_file_is_jpeg_f(FILE* file);
CGL_bool CGL_image_file_is_jpeg(const CGL_byte* file_path);
CGL_int CGL_image_file_get_format_f(FILE* file);
CGL_int CGL_image_file_get_format(const CGL_byte* file_path);

#endif

#ifndef CGL_EXCLUDE_ND_TREE_API

#ifndef CGL_ND_TREE_MAX_ITEMS_PER_MEMORY_BANK
#define CGL_ND_TREE_MAX_ITEMS_PER_MEMORY_BANK 8
#endif

#ifndef CGL_ND_TREE_MAX_MEMORY_BANKS_PER_NODE
#define CGL_ND_TREE_MAX_MEMORY_BANKS_PER_NODE 64
#endif

struct CGL_nd_tree;
typedef struct CGL_nd_tree CGL_nd_tree;

struct CGL_nd_tree_node;
typedef struct CGL_nd_tree_node CGL_nd_tree_node;

CGL_nd_tree* CGL_nd_tree_create(CGL_int dimensions, CGL_sizei item_size, CGL_int max_items_per_node, CGL_sizei max_nodes, CGL_sizei max_items, CGL_bool store_positions);
CGL_nd_tree* CGL_quad_tree_create(CGL_sizei item_size, CGL_int max_items_per_node, CGL_sizei max_nodes, CGL_sizei max_items, CGL_bool store_positions);
CGL_nd_tree* CGL_oct_tree_create(CGL_sizei item_size, CGL_int max_items_per_node, CGL_sizei max_nodes, CGL_sizei max_items, CGL_bool store_positions);
CGL_void CGL_nd_tree_destroy(CGL_nd_tree* tree);
CGL_bool CGL_nd_tree_reset(CGL_nd_tree* tree, CGL_float* aabb_min, CGL_float* aabb_max, CGL_int items_per_node, CGL_int max_depth, CGL_bool fast_approx_mode);
CGL_bool CGL_quad_tree_reset(CGL_nd_tree* tree, CGL_float x_min, CGL_float y_min, CGL_float x_max, CGL_float y_max, CGL_int items_per_node, CGL_int max_depth, CGL_bool fast_approx_mode);
CGL_bool CGL_oct_tree_reset(CGL_nd_tree* tree, CGL_float x_min, CGL_float y_min, CGL_float z_min, CGL_float x_max, CGL_float y_max, CGL_float z_max, CGL_int items_per_node, CGL_int max_depth, CGL_bool fast_approx_mode);
CGL_bool CGL_nd_tree_add(CGL_nd_tree* tree, CGL_float* position, CGL_void* item);
CGL_bool CGL_quad_tree_add(CGL_nd_tree* tree, CGL_float px, CGL_float py, CGL_void* item);
CGL_bool CGL_oct_tree_add(CGL_nd_tree* tree, CGL_float px, CGL_float py, CGL_float pz, CGL_void* item);
CGL_int CGL_nd_tree_get_items_in_range(CGL_nd_tree* tree, CGL_float* p_min, CGL_float* p_max, CGL_void* items_out, CGL_int max_items);
CGL_int CGL_quad_tree_get_items_in_range(CGL_nd_tree* tree, CGL_float x_min, CGL_float y_min, CGL_float x_max, CGL_float y_max, CGL_void* items_out, CGL_int max_items);
CGL_int CGL_oct_tree_get_items_in_range(CGL_nd_tree* tree, CGL_float x_min, CGL_float y_min, CGL_float z_min, CGL_float x_max, CGL_float y_max, CGL_float z_max, CGL_void* items_out, CGL_int max_items);

#endif


// ------------------------------------------------------------------------------------------------------------------------------------------------------
// ------------------------------------------------------------------------------------------------------------------------------------------------------
// ------------------------------------------------------ Implementation of CGL -------------------------------------------------------------------------
// ------------------------------------------------------------------------------------------------------------------------------------------------------
// ------------------------------------------------------------------------------------------------------------------------------------------------------

#ifdef CGL_IMPLEMENTATION

// include windows headers for windows builds
#if defined(_WIN32) || defined(_WIN64)
#pragma warning(push, 0)
#define WIN32_LEAN_AND_MEAN
#ifndef  CGL_WASM

#ifdef APIENTRY
#undef APIENTRY
#endif

#include <Windows.h>
#endif
#pragma warning(pop)
#endif

#ifdef __EMSCRIPTEN__
#include <emscripten/emscripten.h>
#endif

// list
#if 1

// data structures
struct CGL_list
{
	size_t size;
	size_t capacity;
	size_t item_size;
	CGL_float increase_factor;
	void* data;
};

CGL_list* CGL_list_create(size_t item_size, size_t initial_capacity)
{
	CGL_list* list = (CGL_list*)malloc(sizeof(CGL_list));
	if (!list) return NULL;
	list->size = 0;
	list->capacity = initial_capacity;
	list->item_size = item_size;
	list->increase_factor = 1.5f;
	list->data = malloc(list->capacity * item_size);
	return list;
}

CGL_void CGL_list_destroy(CGL_list* list)
{
	CGL_free(list->data);
	CGL_free(list);
}

CGL_void CGL_list_set_increase_factor(CGL_list* list, CGL_float increase_factor)
{
	list->increase_factor = increase_factor;
}

CGL_float CGL_list_get_increase_factor(CGL_list* list)
{
	return list->increase_factor;
}

CGL_sizei CGL_list_get_item_size(CGL_list* list)
{
	return list->item_size;
}

CGL_sizei CGL_list_get_size(CGL_list* list)
{
	return list->size;
}

CGL_sizei CGL_list_get_capacity(CGL_list* list)
{
	return list->capacity;
}

CGL_sizei CGL_list_push(CGL_list* list, void* data)
{
	if (list->size == list->capacity)
	{
		size_t new_capacity = (size_t)(list->capacity * list->increase_factor);
		list->data = realloc(list->data, new_capacity * list->item_size);
		list->capacity = new_capacity;
	}
	memcpy(((char*)list->data + list->size * list->item_size), data, list->item_size);
	list->size += 1;
	return list->size - 1;
}

CGL_sizei CGL_list_pop(CGL_list* list, void* data)
{
	if (list->size == 0) return 0;
	list->size -= 1;
	if (data) memcpy(data, ((char*)list->data + list->size * list->item_size), list->item_size);
	return list->size;
}

CGL_void* CGL_list_get(CGL_list* list, size_t index, void* data)
{
	if (index >= list->size /* || index < 0 */) return NULL;
	if (data) memcpy(data, ((char*)list->data + index * list->item_size), list->item_size);
	return ((char*)list->data + index * list->item_size);
}

CGL_void* CGL_list_get_random(CGL_list* list, void* data)
{
	CGL_int index = CGL_utils_random_int(0, list->size - 1);
	return CGL_list_get(list, index, data);
}

CGL_void* CGL_list_set(CGL_list* list, size_t index, void* data)
{
	if (index >= list->size /* || index < 0 */) return NULL;
	if (data) memcpy(((char*)list->data + index * list->item_size), data, list->item_size);
	return ((char*)list->data + index * list->item_size);
}

CGL_bool CGL_list_is_empty(CGL_list* list)
{
	return list->size == 0;
}

CGL_sizei CGL_list_find(CGL_list* list, void* data)
{
	for (CGL_sizei i = 0; i < list->size; i++)
		if (memcmp(((CGL_byte*)list->data + i * list->item_size), data, list->item_size) == 0)
			return i;
	return (CGL_sizei)UINT64_MAX;
}

CGL_void CGL_list_reserve(CGL_list* list, size_t size)
{
	if (list->capacity > size) return;
	size_t new_capacity = size;
	list->data = realloc(list->data, new_capacity * list->item_size);
	list->capacity = new_capacity;
}

CGL_void CGL_list_fill(CGL_list* list, size_t size)
{
	CGL_list_reserve(list, size);
	list->size = CGL_utils_max(size, list->size);
}

CGL_void CGL_list_clear(CGL_list* list)
{
	list->size = 0;
}



#ifndef CGL_EXCLUDES_THREADS

#ifdef _WIN32

#include <process.h>

struct CGL_thread
{
	uintptr_t id;
	HANDLE handle;
	CGL_thread_function function;
	bool running;
};

struct CGL_mutex
{
	HANDLE handle;
};

CGL_thread* CGL_thread_create()
{
	CGL_thread* thread = (CGL_thread*)malloc(sizeof(CGL_thread));
	if (!thread) return NULL;
	thread->function = NULL;
	thread->handle = NULL;
	thread->id = 0;
	thread->running = false;
	return thread;
}


// The function CGL_thread_start() starts a new thread. The function
// argument is the function that the thread will execute. The argument
// argument is passed to the thread function. The return value is true
// if the thread was successfully started, and false otherwise.
bool CGL_thread_start(CGL_thread* thread, CGL_thread_function function, void* argument)
{
	if (thread->running) CGL_thread_join(thread);
	if (thread->handle) CloseHandle(thread->handle);
	thread->function = function;
	thread->handle = (HANDLE)_beginthread(function, 0, argument);
	thread->id = (uintptr_t)GetThreadId(thread->handle);
	thread->running = true;
	return thread->handle != NULL;
}


// This function is called when the thread is destroyed
// It frees the thread structure from memory
CGL_void CGL_thread_destroy(CGL_thread* thread)
{
	if (thread->running) CGL_thread_join(thread);
	if (thread->handle) CloseHandle(thread->handle);
	CGL_free(thread);
}

uintptr_t CGL_thread_get_id(CGL_thread* thread)
{
	return thread->id;
}

// Description: This function checks to see if the thread is running.
// Parameters:
//  thread: The thread to check
// Return value: true if the thread is running, false otherwise
bool CGL_thread_is_running(CGL_thread* thread)
{
	if (!thread->handle) return false;
	DWORD exit_code;
	if (!GetExitCodeThread(thread->handle, &exit_code)) return false;
	if (exit_code == STILL_ACTIVE)
		thread->running = true;
	else
	{
		thread->running = false;
		CloseHandle(thread->handle);
	}
	return thread->running;
}

/*
 * This function joins the thread, which means that the calling thread
 * will wait until the thread represented by the given thread pointer
 * has finished executing. This function returns true if the thread
 * was joined successfully, or false if an error occurred.
 */
bool CGL_thread_join(CGL_thread* thread)
{
	if (!thread->handle) return true;
	bool result = (WaitForSingleObject(thread->handle, INFINITE) != WAIT_FAILED);
	thread->running = false;
	return result;
}

/*
 * Returns true if the thread is joinable, false otherwise.
 *
 * A thread is joinable if it can be waited upon. A thread is not joinable
 * if it has already been joined or detached.
 *
 * When a thread is created, it is joinable by default. It can be made
 * unjoinable by calling pthread_detach. It can be made joinable again by
 * calling pthread_join.
 */
bool CGL_thread_joinable(CGL_thread* thread)
{
	(void)thread;
	return true; // Temporary
}


/*
 * Create a new mutex. If set is true, the mutex is created set. Otherwise, it
 * is created unset.
 */
CGL_mutex* CGL_mutex_create(bool set)
{
	CGL_mutex* mutex = (CGL_mutex*)malloc(sizeof(CGL_mutex));
	mutex->handle = CreateMutex(NULL, (BOOL)set, NULL);
	return mutex;
}

/* Destroy a mutex. */
CGL_void CGL_mutex_destroy(CGL_mutex* mutex)
{
	if (mutex->handle) CloseHandle(mutex->handle);
	CGL_free(mutex);
}

// This function locks a mutex, and returns 1 if it was successful, and 0 otherwise.
// If timeout is 0, it will wait forever for the lock to be acquired.
// If timeout is non-zero, it will wait for at most timeout microseconds for the lock to be acquired.
// If the lock is acquired within the timeout period, this function returns 1. Otherwise, it returns 0.
int CGL_mutex_lock(CGL_mutex* mutex, uint64_t timeout)
{
	return (int)WaitForSingleObject(mutex->handle, (DWORD)timeout);
}

// CGL_mutex_release: Releases a mutex.
//    mutex: The mutex to release.
CGL_void CGL_mutex_release(CGL_mutex* mutex)
{
	ReleaseMutex(mutex->handle);
}

#else // for posix (using pthread)

#include <pthread.h>
#include <signal.h> 

struct CGL_thread
{
	uintptr_t id;
	pthread_t handle;
	CGL_thread_function function;
	bool running;
};

struct CGL_mutex
{
	pthread_mutex_t handle;
};

CGL_thread* CGL_thread_create()
{
	CGL_thread* thread = (CGL_thread*)malloc(sizeof(CGL_thread));
	thread->function = NULL;
	// thread->handle = NULL;
	thread->id = 0;
	thread->running = false;
	return thread;
}

bool CGL_thread_start(CGL_thread* thread, CGL_thread_function function, void* argument)
{
	if (thread->running) CGL_thread_join(thread);
	thread->function = function;
	bool success = pthread_create(&thread->handle, 0, function, argument);
	thread->id = (uintptr_t)thread->handle; // Temporary
	thread->running = true;
	return success;
}

CGL_void CGL_thread_destroy(CGL_thread* thread)
{
	if (thread->running) CGL_thread_join(thread);
	CGL_free(thread);
}

uintptr_t CGL_thread_get_id(CGL_thread* thread)
{
	return thread->id;
}

bool CGL_thread_is_running(CGL_thread* thread)
{
	if (!thread->handle) return false;

	//  thread->running = (pthread_kill(thread->handle, 0) == 0);
	if (pthread_kill(thread->handle, 0) == 0)
		thread->running = true;
	else
		thread->running = false;
	return thread->running;
}

bool CGL_thread_join(CGL_thread* thread)
{
	if (!thread->handle) return true;
	return pthread_join(thread->handle, NULL);
}

bool CGL_thread_joinable(CGL_thread* thread)
{
	(void)thread;
	return true; // Temporary
}


CGL_mutex* CGL_mutex_create(bool set)
{
	(void)set;
	CGL_mutex* mutex = (CGL_mutex*)malloc(sizeof(CGL_mutex));
	pthread_mutex_init(&mutex->handle, NULL);
	return mutex;
}

CGL_void CGL_mutex_destroy(CGL_mutex* mutex)
{
	pthread_mutex_destroy(&mutex->handle);
	CGL_free(mutex);
}

int CGL_mutex_lock(CGL_mutex* mutex, uint64_t timeout)
{
	(void)timeout;
	return pthread_mutex_lock(&mutex->handle);
}

CGL_void CGL_mutex_release(CGL_mutex* mutex)
{
	pthread_mutex_unlock(&mutex->handle);
}


#endif

#endif

#endif

// hashtable
#if 1


struct CGL_hashtable_entry
{
	uint8_t key[CGL_HASHTABLE_MAX_KEY_SIZE];
	uint8_t value_static[CGL_HASHTABLE_ENTRY_STATIC_VALUE_SIZE]; // if value size is less than CGL_HASHTABLE_ENTRY_VALUE_SIZE then place here in static memory rather than allocating
	size_t value_size;
	size_t next_entry; // next entry in the linked list with same hash
	size_t index;
	void* value;
	bool set;
};

struct CGL_hashtable
{
	CGL_hashtable_entry* storage;
	size_t* table;
	CGL_hash_function hash_function;
	size_t capacity;
	size_t table_size;
	size_t key_size;
	size_t count;
	CGL_float growth_rate;
};

struct CGL_hashtable_iterator
{
	CGL_hashtable* hashtable;
	CGL_hashtable_entry* current_entry;
	size_t index;
};

static void __CGL_hashtable_calculate_hashtable_index_key_size(CGL_hashtable* table, size_t* key_size, size_t* hashtable_index, const void* key)
{
	const size_t key_size_raw = (table->key_size == 0) ? strlen((const char*)key) + 1 : table->key_size;
	size_t key_size_l = CGL_utils_clamp(key_size_raw, 1ul, CGL_HASHTABLE_MAX_KEY_SIZE);
	*key_size = key_size_l;
	size_t hashtable_index_l = table->hash_function(key, key_size_l) % table->table_size;
	*hashtable_index = hashtable_index_l;
}

static CGL_hashtable_entry* __CGL_hashtable_get_entry_ptr(CGL_hashtable* table, const void* key, size_t* table_index)
{
	size_t key_size, hashtable_index;
	__CGL_hashtable_calculate_hashtable_index_key_size(table, &key_size, &hashtable_index, key);
	size_t entry_id = table->table[hashtable_index];
	if (entry_id == 0) return NULL;
	CGL_hashtable_entry* entry = &table->storage[entry_id];
	if (table_index)
	{
		if (memcmp(entry->key, key, key_size) == 0) *table_index = hashtable_index;
		else *table_index = (size_t)UINT64_MAX;
	}

	while (entry->index != 0)
	{
		if (memcmp(entry->key, key, key_size) == 0)
			return entry;
		entry = &table->storage[entry->next_entry];
	}

	return NULL;
}

static bool __CGL_hashtable_expand_storage(CGL_hashtable* table)
{
	table->capacity = (size_t)(table->capacity * table->growth_rate);
	table->storage = (CGL_hashtable_entry*)CGL_malloc(table->capacity * sizeof(CGL_hashtable_entry));
	memset(table->storage, 0, table->capacity * sizeof(CGL_hashtable_entry));
	CGL_free(table->storage);
	return table->storage != NULL;
}

static void __CGL_hashtable_reset_hashtable_entry(CGL_hashtable_entry* entry)
{
	memset(entry->key, 0, CGL_HASHTABLE_MAX_KEY_SIZE);
	memset(entry->value_static, 0, CGL_HASHTABLE_ENTRY_STATIC_VALUE_SIZE);
	entry->value_size = 0;
	entry->next_entry = 0;
	if (entry->value) CGL_free(entry->value);
	entry->value = NULL;
	entry->set = false;
	entry->index = 0;
}

static size_t __CGL_hashtable_get_new_entry(CGL_hashtable* table, bool* expanded)
{
	size_t entry = 1;
	for (; entry < table->capacity; entry++)
		if (!table->storage[entry].set)
			break;
	if (entry >= table->capacity)
	{
		entry = table->capacity;
		if (!__CGL_hashtable_expand_storage(table)) return 0;
		if (expanded) *expanded = true;
	}
	table->storage[entry].index = entry;
	return entry;
}

CGL_hashtable* CGL_hashtable_create(size_t table_size, size_t key_size, size_t initial_capacity)
{
	CGL_hashtable* table = (CGL_hashtable*)CGL_malloc(sizeof(CGL_hashtable));
	if (!table) return NULL;
	table->table_size = table_size;
	table->key_size = key_size;
	table->capacity = initial_capacity;
	table->count = 0;
	table->growth_rate = 1.5f;
	table->hash_function = CGL_utils_super_fast_hash;
	table->storage = (CGL_hashtable_entry*)CGL_malloc(sizeof(CGL_hashtable_entry) * initial_capacity);
	if (!table->storage) { CGL_free(table); return NULL; }
	memset(table->storage, 0, (sizeof(CGL_hashtable_entry) * initial_capacity));
	table->table = (size_t*)CGL_malloc(sizeof(size_t) * table_size);
	if (!table->table) { CGL_free(table->storage); CGL_free(table); return NULL; }
	memset(table->table, 0, (sizeof(size_t) * table_size));
	return table;
}

CGL_void CGL_hashtable_destroy(CGL_hashtable* table)
{
	for (size_t i = 0; i < table->capacity; i++)
		if (table->storage[i].set && table->storage[i].value_size > CGL_HASHTABLE_ENTRY_STATIC_VALUE_SIZE)
			CGL_free(table->storage[i].value);
	CGL_free(table->storage);
	CGL_free(table->table);
	CGL_free(table);
}

CGL_void CGL_hashtable_set(CGL_hashtable* table, const void* key, const void* value, size_t value_size)
{
	size_t key_size, hashtable_index;
	__CGL_hashtable_calculate_hashtable_index_key_size(table, &key_size, &hashtable_index, key);


	size_t new_entry_id = 0;
	CGL_hashtable_entry* existing_entry = __CGL_hashtable_get_entry_ptr(table, key, NULL);
	if (existing_entry)
	{
		if (existing_entry->value_size > CGL_HASHTABLE_ENTRY_STATIC_VALUE_SIZE) CGL_free(existing_entry->value);
		new_entry_id = existing_entry->index;
	}
	else
	{
		new_entry_id = __CGL_hashtable_get_new_entry(table, NULL);
		if (table->table[hashtable_index] == 0)
			table->table[hashtable_index] = new_entry_id;
		else
		{
			CGL_hashtable_entry* target_entry_ptr = &table->storage[table->table[hashtable_index]];
			while (target_entry_ptr->next_entry != 0) target_entry_ptr = &table->storage[target_entry_ptr->next_entry];
			target_entry_ptr->next_entry = new_entry_id;
		}
	}


	table->storage[new_entry_id].set = true;
	memcpy(table->storage[new_entry_id].key, key, key_size);
	table->storage[new_entry_id].value_size = value_size;
	table->storage[new_entry_id].next_entry = 0;
	table->storage[new_entry_id].value = NULL;
	void* target_value_ptr = NULL;
	if (value_size <= CGL_HASHTABLE_ENTRY_STATIC_VALUE_SIZE) target_value_ptr = table->storage[new_entry_id].value_static;
	else target_value_ptr = table->storage[new_entry_id].value = CGL_malloc(value_size);
	memcpy(target_value_ptr, value, value_size);

}

size_t CGL_hashtable_get(CGL_hashtable* table, const void* key, void* value)
{
	CGL_hashtable_entry* entry = __CGL_hashtable_get_entry_ptr(table, key, NULL);
	if (!entry) return 0;
	if (value && entry->value_size > 0) memcpy(value, ((entry->value_size > CGL_HASHTABLE_ENTRY_STATIC_VALUE_SIZE) ? entry->value : entry->value_static), entry->value_size);
	return entry->value_size;
}

CGL_void* CGL_hashtable_get_ptr(CGL_hashtable* table, const void* key, size_t* value)
{
	CGL_hashtable_entry* entry = __CGL_hashtable_get_entry_ptr(table, key, NULL);
	if (!entry) return NULL;
	if (value) *value = entry->value_size;
	return (entry->value_size > CGL_HASHTABLE_ENTRY_STATIC_VALUE_SIZE) ? entry->value : entry->value_static;
}

bool CGL_hashtable_exists(CGL_hashtable* table, const void* key)
{
	return __CGL_hashtable_get_entry_ptr(table, key, NULL) != NULL;
}

bool CGL_hashtable_remove(CGL_hashtable* table, const void* key)
{
	if (!CGL_hashtable_exists(table, key)) return false;

	size_t key_size, hashtable_index;
	__CGL_hashtable_calculate_hashtable_index_key_size(table, &key_size, &hashtable_index, key);

	CGL_hashtable_entry* entry_to_clear = &table->storage[table->table[hashtable_index]];
	if (memcmp(entry_to_clear->key, key, key_size) == 0)
		table->table[hashtable_index] = entry_to_clear->next_entry;
	else
	{
		while (table->storage[table->table[hashtable_index]].next_entry != 0)
		{
			if (memcmp(table->storage[table->storage[table->table[hashtable_index]].next_entry].key, key, key_size) == 0)
			{
				entry_to_clear = &table->storage[table->storage[table->table[hashtable_index]].next_entry];
				table->storage[table->table[hashtable_index]].next_entry = table->storage[table->storage[table->table[hashtable_index]].next_entry].next_entry;
			}
		}
	}
	__CGL_hashtable_reset_hashtable_entry(entry_to_clear);
	return true;
}

CGL_void CGL_hashtable_set_growth_rate(CGL_hashtable* table, CGL_float rate)
{
	table->growth_rate = rate;
}

size_t CGL_hashtable_get_size(CGL_hashtable* table)
{
	return table->count;
}

CGL_void CGL_hashtable_set_hash_function(CGL_hashtable* table, CGL_hash_function hash_function)
{
	table->hash_function = hash_function;
}

CGL_hashtable_iterator* CGL_hashtable_iterator_create(CGL_hashtable* table)
{
	CGL_hashtable_iterator* iterator = (CGL_hashtable_iterator*)CGL_malloc(sizeof(CGL_hashtable_iterator));
	if (!iterator) return NULL;
	iterator->hashtable = table;
	iterator->index = 1;
	return iterator;
}

CGL_void CGL_hashtable_iterator_destroy(CGL_hashtable_iterator* iterator)
{
	CGL_free(iterator);
}

CGL_void CGL_hashtable_iterator_reset(CGL_hashtable_iterator* iterator)
{
	iterator->index = 1;
}

bool CGL_hashtable_iterator_next(CGL_hashtable_iterator* iterator, void* key, void* data, size_t* size)
{
	while (iterator->index < iterator->hashtable->capacity)
	{
		if (iterator->hashtable->storage[iterator->index].set) break;
		else iterator->index++;
	}
	if (iterator->index >= iterator->hashtable->capacity) iterator->current_entry = NULL;
	else iterator->current_entry = &iterator->hashtable->storage[iterator->index];
	iterator->index++;
	return CGL_hashtable_iterator_curr(iterator, key, data, size);
}

bool CGL_hashtable_iterator_curr(CGL_hashtable_iterator* iterator, void* key, void* data, size_t* size)
{
	if (iterator->current_entry)
	{
		size_t key_size, hashtable_index;
		__CGL_hashtable_calculate_hashtable_index_key_size(iterator->hashtable, &key_size, &hashtable_index, iterator->current_entry->key);
		if (key) memcpy(key, iterator->current_entry->key, key_size);
		if (data && iterator->current_entry->value_size <= CGL_HASHTABLE_ENTRY_STATIC_VALUE_SIZE) memcpy(data, iterator->current_entry->value_static, iterator->current_entry->value_size);
		else if (data && iterator->current_entry->value_size > CGL_HASHTABLE_ENTRY_STATIC_VALUE_SIZE) memcpy(data, iterator->current_entry->value, iterator->current_entry->value_size);
		if (size) *size = iterator->current_entry->value_size;
	}
	return iterator->current_entry != NULL;;
}

CGL_void* CGL_hashtable_iterator_curr_key(CGL_hashtable_iterator* iterator)
{
	if (!iterator->current_entry) return NULL;
	return iterator->current_entry->key;
}

#endif

// networking
#if 1

#ifndef CGL_EXCLUDE_NETWORKING

#pragma warning(push, 0)

#ifndef CGL_EXCLUDE_SSL_SOCKET

#include <openssl/ssl.h>
#include <openssl/err.h>
#include <openssl/crypto.h>

#endif

#if defined(_WIN32) || defined(_WIN64)

#include <ws2tcpip.h>
#include <stdlib.h>
#include <stdio.h>

#pragma comment (lib, "Ws2_32.lib")
#pragma comment (lib, "Mswsock.lib")
#pragma comment (lib, "AdvApi32.lib")



struct CGL_net_addrinfo
{
	CGL_int ai_flags;
	CGL_int ai_family;
	CGL_int ai_socktype;
	CGL_int ai_protocol;
	size_t ai_addrlen;
	struct sockaddr ai_addr;
};

struct CGL_net_socket
{
	SOCKET socket;
};

bool CGL_net_init()
{
	WSADATA wsa_data;
	bool result = WSAStartup(MAKEWORD(2, 2), &wsa_data) == 0;
#ifndef CGL_EXCLUDE_SSL_SOCKET
	SSL_library_init();
	SSLeay_add_ssl_algorithms();
	SSL_load_error_strings();
#endif
	return result;
}

CGL_void CGL_net_shutdown()
{
#ifndef CGL_EXCLUDE_SSL_SOCKET
	ERR_free_strings();
	EVP_cleanup();
#endif
	WSACleanup();
}

CGL_net_addrinfo* CGL_net_addrinfo_query(const char* name, const char* port, size_t* count)
{
	struct addrinfo* result = NULL;
	struct addrinfo* ptr = NULL;
	struct addrinfo hints;
	ZeroMemory(&hints, sizeof(hints));
	hints.ai_family = AF_INET; // supports both ipv4
	hints.ai_socktype = SOCK_STREAM; // supports only streaming socketss
	hints.ai_protocol = IPPROTO_TCP; // supports only TCP
	CGL_int iresult = getaddrinfo(name, port, &hints, &result);
	if (iresult != 0) return NULL;
	size_t addr_count = 0;
	for (ptr = result; ptr != NULL; ptr = ptr->ai_next) addr_count++;
	if (count) *count = addr_count;
	CGL_net_addrinfo* infos = (CGL_net_addrinfo*)CGL_malloc(sizeof(CGL_net_addrinfo) * addr_count);
	if (!infos) { freeaddrinfo(result); return NULL; }
	size_t index = 0;
	for (ptr = result; ptr != NULL; ptr = ptr->ai_next, index++)
	{
		infos[index].ai_flags = ptr->ai_flags;
		infos[index].ai_family = ptr->ai_family;
		infos[index].ai_socktype = ptr->ai_socktype;
		infos[index].ai_protocol = ptr->ai_protocol;
		infos[index].ai_addrlen = ptr->ai_addrlen;
		infos[index].ai_addr = *ptr->ai_addr;
	}
	freeaddrinfo(result);
	return infos;
}

CGL_void CGL_net_addrinfo_destroy(CGL_net_addrinfo* infos)
{
	CGL_free(infos);
}

CGL_net_socket* CGL_net_socket_create()
{
	CGL_net_socket* soc = (CGL_net_socket*)CGL_malloc(sizeof(CGL_net_socket));
	if (!soc) return NULL;
	soc->socket = socket(AF_INET, SOCK_STREAM, IPPROTO_TCP);
	if (soc->socket == INVALID_SOCKET)
	{
		CGL_free(soc);
		return NULL;
	}
	return soc;
}

bool CGL_net_socket_connect(CGL_net_socket* soc, CGL_net_addrinfo* target)
{
	CGL_int result = connect(soc->socket, &target->ai_addr, (int)target->ai_addrlen);
	return result != SOCKET_ERROR;
}

bool CGL_net_socket_bind(CGL_net_socket* soc, CGL_net_addrinfo* target)
{
	CGL_int result = bind(soc->socket, &target->ai_addr, (int)target->ai_addrlen);
	return result != SOCKET_ERROR;
}

bool CGL_net_socket_listen(CGL_net_socket* soc, size_t max_connections)
{
	CGL_int result = listen(soc->socket, (int_fast16_t)max_connections);
	return result != SOCKET_ERROR;
}

CGL_net_socket* CGL_net_socket_accept(CGL_net_socket* soc, CGL_net_addrinfo* addrinfo)
{
	CGL_net_socket* cli_soc = (CGL_net_socket*)CGL_malloc(sizeof(CGL_net_socket));
	if (!cli_soc) return NULL;
	CGL_int addr_len = 0;
	if (addrinfo)
	{
		cli_soc->socket = accept(soc->socket, &addrinfo->ai_addr, &addr_len);
		addrinfo->ai_addrlen = addr_len;
	}
	else cli_soc->socket = accept(soc->socket, NULL, NULL);
	if (cli_soc->socket == INVALID_SOCKET)
	{
		CGL_free(cli_soc);
		cli_soc = NULL;
	}
	return cli_soc;
}

CGL_void CGL_net_socket_close(CGL_net_socket* soc)
{
	closesocket(soc->socket);
	CGL_free(soc);
}

bool CGL_net_socket_send(CGL_net_socket* soc, void* buffer, size_t size, size_t* size_sent)
{
	CGL_int result = send(soc->socket, (const CGL_byte*)buffer, (int)size, 0);
	if (size_sent) *size_sent = result;
	return result != SOCKET_ERROR;
}

bool CGL_net_socket_recv(CGL_net_socket* soc, void* buffer, size_t size, size_t* size_recieved)
{
	CGL_int result = recv(soc->socket, (CGL_byte*)buffer, (int)size, 0);
	if (result > 0 && size_recieved) *size_recieved = (size_t)result;
	return result > 0;
}

bool CGL_net_socket_shutdown_send(CGL_net_socket* soc)
{
	return shutdown(soc->socket, SD_SEND) == SOCKET_ERROR;
}

bool CGL_net_socket_shutdown_recv(CGL_net_socket* soc)
{
	return shutdown(soc->socket, SD_RECEIVE) == SOCKET_ERROR;
}

#else // for unix based operating systems


#include <netdb.h> 
#include <stdio.h>
#include <stdlib.h>
#include <unistd.h>
#include <error.h>
#include <string.h>
#include <sys/types.h>
#include <sys/socket.h>
#include <netinet/in.h>

struct CGL_net_addrinfo
{
	struct sockaddr_in ai_addr;
};

struct CGL_net_socket
{
	CGL_int socket;
};

bool CGL_net_init()
{
#ifndef CGL_EXCLUDE_SSL_SOCKET
	SSL_library_init();
	SSLeay_add_ssl_algorithms();
	SSL_load_error_strings();
#endif
	return true;
}

CGL_void CGL_net_shutdown()
{
#ifndef CGL_EXCLUDE_SSL_SOCKET
	ERR_free_strings();
	EVP_cleanup();
#endif
}

CGL_net_addrinfo* CGL_net_addrinfo_query(const char* name, const char* port, size_t* count)
{
	struct hostent* server = NULL;
	server = gethostbyname(name);
	if (server == NULL) return NULL;
	CGL_net_addrinfo* addr_info = (CGL_net_addrinfo*)CGL_malloc(sizeof(CGL_net_addrinfo));
	if (!addr_info) return NULL;
	memset(&addr_info->ai_addr, 0, sizeof(addr_info->ai_addr));
	addr_info->ai_addr.sin_family = AF_UNSPEC;
	CGL_int iport = atoi(port);
	addr_info->ai_addr.sin_port = htons(iport);
	addr_info->ai_addr.sin_addr = *((struct in_addr*)server->h_addr_list[0]);
	if (count) *count = 1;
	return addr_info;
}

CGL_void CGL_net_addrinfo_destroy(CGL_net_addrinfo* infos)
{
	CGL_free(infos);
}

CGL_net_socket* CGL_net_socket_create()
{
	CGL_net_socket* soc = (CGL_net_socket*)CGL_malloc(sizeof(CGL_net_socket));
	if (!soc) return NULL;
	soc->socket = socket(AF_INET, SOCK_STREAM, 0);
	if (soc->socket < 0)
	{
		CGL_free(soc);
		return NULL;
	}
	return soc;
}

bool CGL_net_socket_connect(CGL_net_socket* soc, CGL_net_addrinfo* target)
{
	CGL_int result = connect(soc->socket, (struct sockaddr*)&target->ai_addr, sizeof(target->ai_addr));
	return result >= 0;
}

bool CGL_net_socket_bind(CGL_net_socket* soc, CGL_net_addrinfo* target)
{
	CGL_int result = bind(soc->socket, (struct sockaddr*)&target->ai_addr, sizeof(target->ai_addr));
	return result > 0;
}

bool CGL_net_socket_listen(CGL_net_socket* soc, size_t max_connections)
{
	listen(soc->socket, (int)max_connections);
	return true;
}

CGL_net_socket* CGL_net_socket_accept(CGL_net_socket* soc, CGL_net_addrinfo* addrinfo)
{
	CGL_net_socket* cli_soc = (CGL_net_socket*)CGL_malloc(sizeof(CGL_net_socket));
	if (!cli_soc) return NULL;
	CGL_int length = 0;
	if (addrinfo) cli_soc->socket = accept(soc->socket, (struct sockaddr*)&addrinfo->ai_addr, &length);
	else cli_soc->socket = accept(soc->socket, NULL, NULL);
	if (cli_soc->socket < 0)
	{
		CGL_free(cli_soc);
		return NULL;
	}
	return cli_soc;
}

CGL_void CGL_net_socket_close(CGL_net_socket* soc)
{
	close(soc->socket);
}

bool CGL_net_socket_send(CGL_net_socket* soc, void* buffer, size_t size, size_t* size_sent)
{
	CGL_int result = send(soc->socket, buffer, size, 0);
	if (result < 0) return false;
	if (size_sent) *size_sent = result;
	return result;
}

bool CGL_net_socket_recv(CGL_net_socket* soc, void* buffer, size_t size, size_t* size_recieved)
{
	CGL_int result = recv(soc->socket, buffer, size, 0);
	if (result < 0) return false;
	if (size_recieved) *size_recieved = result;
	return result;
}

bool CGL_net_socket_shutdown_send(CGL_net_socket* soc)
{
	shutdown(soc->socket, SHUT_WR);
}

bool CGL_net_socket_shutdown_recv(CGL_net_socket* soc)
{
	shutdown(soc->socket, SHUT_RD);
}



#endif // _WIN32

CGL_void __CGL_net_http_prepare_request(char* buffer, const char* method, const char* host, const char* path, const char* accept, const char* user_agent, const char* body)
{
	const char* path_ = path == NULL ? "/" : path;
	const char* accept_ = accept == NULL ? "text/html,application/xhtml+xml,application/xml;q=0.9,image/avif,image/webp,image/apng,*/*;q=0.8,application/signed-exchange;v=b3;q=0.9" : accept;
	const char* user_agent_ = user_agent == NULL ? "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/105.0.0.0 Safari/537.36" : user_agent;
	const char* body_ = body == NULL ? "" : body;
	const char* method_ = method == NULL ? "GET" : method;
	sprintf(buffer,
		"%s %s HTTP/1.1\r\n"
		"Accept: %s\r\n"
		"Accept-Language: en-US,en;q=0.9,hi;q=0.8,zh-CN;q=0.7,zh;q=0.6\r\n"
		"Host: %s\r\n"
		"User-Agent: %s\r\n"
		"\r\n"
		"%s",
		method_, path_, accept_, host, user_agent_, body_);
}

int __CGL_net_http_parse_response(const char* response, const size_t recieved_length, size_t* body_size, char* body)
{
	CGL_int response_code = atoi(response + 9);
	const char* start_pt = response + 2;
	while (*start_pt != '\0')
	{
		start_pt++;
		if (*start_pt == '\n' && *(start_pt - 1) == '\r' && *(start_pt - 2) == '\n' && *(start_pt - 3) == '\r') break;
	}
	start_pt++;
	size_t body_size_l = (recieved_length - (size_t)(start_pt - response));
	if (body_size) *body_size = body_size_l;;
	if (body)  memcpy(body, start_pt, body_size_l);
	return response_code;
}

int CGL_net_http_request(const char* method, const char* host, const char* path, void* buffer, size_t* size, const char* accept, const char* user_agent, const char* body)
{
	CGL_net_addrinfo* infos = CGL_net_addrinfo_query(host, "80", NULL);
	CGL_net_socket* sock = CGL_net_socket_create();
	if (!CGL_net_socket_connect(sock, infos))
	{
		CGL_net_socket_close(sock);
		CGL_net_addrinfo_destroy(infos);
		return 0;
	}
	static char temp_buffer[1024 * 1024 * 4]; // 4 MB static buffer
	__CGL_net_http_prepare_request(temp_buffer, method, host, path, accept, user_agent, body);
	if (!CGL_net_socket_send(sock, temp_buffer, strlen(temp_buffer), NULL))
	{
		CGL_net_socket_close(sock);
		CGL_net_addrinfo_destroy(infos);
		return 0;
	}
	memset(temp_buffer, 0, sizeof(temp_buffer));
	size_t recieved_length = 0;
	if (!CGL_net_socket_recv(sock, temp_buffer, sizeof(temp_buffer), &recieved_length))
	{
		CGL_net_socket_close(sock);
		CGL_net_addrinfo_destroy(infos);
		return 0;
	}
	CGL_net_socket_close(sock);
	CGL_net_addrinfo_destroy(infos);
	return __CGL_net_http_parse_response(temp_buffer, recieved_length, size, (CGL_byte*)buffer);
}

int CGL_net_http_get(const char* host, const char* path, void* buffer, size_t* size, const char* accept, const char* user_agent)
{
	return CGL_net_http_request("GET", host, path, buffer, size, accept, user_agent, NULL);
}

int CGL_net_http_post(const char* host, const char* path, void* buffer, size_t* size, const char* accept, const char* user_agent, const char* body)
{
	return CGL_net_http_request("POST", host, path, buffer, size, accept, user_agent, body);
}

#ifndef CGL_EXCLUDE_SSL_SOCKET

int CGL_net_https_request(const char* method, const char* host, const char* path, void* response_buffer, size_t* size, const char* accept, const char* user_agent, const char* body)
{
	CGL_log_internal("TO BE IMPLEMENTED!\n");
	return 0;
}

int CGL_net_https_get(const char* host, const char* path, void* buffer, size_t* size, const char* accept, const char* user_agent)
{
	return CGL_net_https_request("GET", host, path, buffer, size, accept, user_agent, NULL);
}

int CGL_net_https_post(const char* host, const char* path, void* buffer, size_t* size, const char* accept, const char* user_agent, const char* body)
{
	return CGL_net_https_request("POST", host, path, buffer, size, accept, user_agent, body);
}

struct CGL_net_ssl_socket
{
	CGL_net_socket* raw_socket;
	SSL* ssl;
	SSL_CTX* ctx;
	const SSL_METHOD* meth;
	CGL_int sock;
};

CGL_net_ssl_socket* CGL_net_ssl_socket_create(CGL_net_socket* soc)
{
	if (!soc) return NULL;
	CGL_net_ssl_socket* sock = (CGL_net_ssl_socket*)CGL_malloc(sizeof(CGL_net_ssl_socket));
	if (!sock) return NULL;
	sock->raw_socket = soc;
	sock->meth = TLSv1_2_client_method();
	sock->ctx = SSL_CTX_new(sock->meth);
	sock->ssl = SSL_new(sock->ctx);
	if (!sock->ssl)
	{
		CGL_log_internal("Error in creating SSL\n");
		CGL_free(sock);
		return NULL;
	}
	sock->sock = SSL_get_fd(sock->ssl);
	SSL_set_fd(sock->ssl, soc->socket);
	CGL_int err = SSL_connect(sock->ssl);
	if (err <= 0)
	{
		CGL_log_internal("Error in creating SSL connection (%d)\n", err);
		CGL_free(sock);
		return NULL;
	}
	CGL_log_internal("SSL connection established using %s\n", SSL_get_cipher(sock->ssl));
	return sock;
}

bool CGL_net_ssl_socket_send(CGL_net_ssl_socket* soc, void* buffer, size_t size, size_t* size_sent)
{
	CGL_int result = SSL_write(soc->ssl, buffer, (int)size);
	if (result < 0) return false;
	if (size_sent) *size_sent = result;
	return true;
}

bool CGL_net_ssl_socket_recv(CGL_net_ssl_socket* soc, void* buffer, size_t size, size_t* size_recieved)
{
	CGL_int result = SSL_read(soc->ssl, buffer, (int)size);
	if (result < 0) return false;
	if (size_recieved) *size_recieved = result;
	return true;
}

CGL_void CGL_net_ssl_socket_destroy(CGL_net_ssl_socket* soc)
{
	SSL_free(soc->ssl);
	SSL_CTX_free(soc->ctx);
	CGL_net_socket_close(soc->raw_socket);
	CGL_free(soc);
}

CGL_void CGL_net_ssl_log_errors()
{
	CGL_int err = 0;
	while (err = ERR_get_error())
	{
		char* str = ERR_error_string(err, 0);
		if (!str) return;
		printf("%s\n", str);
		fflush(stdout);
	}
}

#endif // CGL_EXCLUDE_SSL_SOCKET

#pragma warning(pop)


#endif //  CGL_EXCLUDE_NETWORKING

#endif

#ifndef CGL_DISABLE_LOGGER


struct CGL_logger_context
{
	char log_file_paths[CGL_LOGGER_MAX_LOG_FILES][4096];
	char log_buffer[CGL_LOGGER_LOG_BUFFER_SIZE];
	CGL_int log_buffer_length;
	bool console_logging_enabled;
	bool flush_on_log;
};

static CGL_logger_context* __CGL_CURRENT_LOGGER_CONTEXT = NULL;

CGL_void CGL_logger_init(bool enable_console_logging)
{
	__CGL_CURRENT_LOGGER_CONTEXT = (CGL_logger_context*)CGL_malloc(sizeof(CGL_logger_context));
	__CGL_CURRENT_LOGGER_CONTEXT->log_buffer_length = 0;
	__CGL_CURRENT_LOGGER_CONTEXT->flush_on_log = false;
	__CGL_CURRENT_LOGGER_CONTEXT->console_logging_enabled = enable_console_logging;
	memset(__CGL_CURRENT_LOGGER_CONTEXT->log_buffer, 0, sizeof(char) * CGL_LOGGER_LOG_BUFFER_SIZE);
	for (CGL_int i = 0; i < CGL_LOGGER_MAX_LOG_FILES; i++) __CGL_CURRENT_LOGGER_CONTEXT->log_file_paths[i][0] = '\0';
	CGL_log_internal("Started Logger Session");
}

CGL_void CGL_logger_shutdown()
{
	CGL_log_internal("Ending Logger Session");
	CGL_logger_flush();
	CGL_free(__CGL_CURRENT_LOGGER_CONTEXT);
}

CGL_logger_context* CGL_logger_get_context()
{
	return __CGL_CURRENT_LOGGER_CONTEXT;
}

CGL_void CGL_logger_set_context(CGL_logger_context* context)
{
	__CGL_CURRENT_LOGGER_CONTEXT = context;
}

bool CGL_logger_attach_log_file(const char* path)
{
	for (CGL_int i = 0; i < CGL_LOGGER_MAX_LOG_FILES; i++) if (__CGL_CURRENT_LOGGER_CONTEXT->log_file_paths[i][0] == '\0')
	{
		strcpy(__CGL_CURRENT_LOGGER_CONTEXT->log_file_paths[i], path);
		CGL_log_internal("Attached Log File : %s", path);
		return true;
	}
	return false;
}

bool CGL_logger_detach_log_file(const char* path)
{
	for (CGL_int i = 0; i < CGL_LOGGER_MAX_LOG_FILES; i++) if (strcmp(__CGL_CURRENT_LOGGER_CONTEXT->log_file_paths[i], path) == 0)
	{
		__CGL_CURRENT_LOGGER_CONTEXT->log_file_paths[i][0] = '\0';
		CGL_log_internal("Detached Log File : %s", path);
		return true;
	}
	return false;
}

CGL_void CGL_logger_flush()
{
	for (CGL_int i = 0; i < CGL_LOGGER_MAX_LOG_FILES; i++)
		if (__CGL_CURRENT_LOGGER_CONTEXT->log_file_paths[i][0] != '\0')
			CGL_utils_append_file(__CGL_CURRENT_LOGGER_CONTEXT->log_file_paths[i], __CGL_CURRENT_LOGGER_CONTEXT->log_buffer, __CGL_CURRENT_LOGGER_CONTEXT->log_buffer_length);
	__CGL_CURRENT_LOGGER_CONTEXT->log_buffer_length = 0;
	__CGL_CURRENT_LOGGER_CONTEXT->log_buffer[0] = '\0';
	if (!__CGL_CURRENT_LOGGER_CONTEXT->flush_on_log) { CGL_log_internal("Flushed Log Buffer"); }
}

CGL_void CGL_logger_disable_console_logging()
{
	__CGL_CURRENT_LOGGER_CONTEXT->console_logging_enabled = false;
}

CGL_void CGL_logger_enable_console_logging()
{
	__CGL_CURRENT_LOGGER_CONTEXT->console_logging_enabled = true;
}

CGL_void CGL_logger_log(CGL_int level, const char* log_format, ...)
{
	static char buffer1[1024 * 16];
	static char buffer2[256];
	static char buffer3[1024 * 20];
	static const char* LOG_LEVEL_STR[] = {
		"TRACE",
		"INFO",
		"WARN",
		"ERROR",
		"INTERNAL"
	};
	buffer1[0] = buffer2[0] = buffer3[0] = '\0';
	va_list args;
	va_start(args, log_format);
	vsprintf(buffer1, log_format, args);
	va_end(args);
	CGL_utils_get_timestamp(buffer2);
	sprintf(buffer3, "[%s] [%s] : %s\n", LOG_LEVEL_STR[level], buffer2, buffer1);
	CGL_int log_length = (int)strlen(buffer3);
	if (log_length + __CGL_CURRENT_LOGGER_CONTEXT->log_buffer_length >= CGL_LOGGER_LOG_BUFFER_SIZE) CGL_logger_flush();
	strcat(__CGL_CURRENT_LOGGER_CONTEXT->log_buffer, buffer3);
	__CGL_CURRENT_LOGGER_CONTEXT->log_buffer_length += log_length;
	switch (level)
	{
	case CGL_LOG_LEVEL_TRACE: printf("%s", buffer3); break;
	case CGL_LOG_LEVEL_INFO: CGL_printf_green(buffer3); break;
	case CGL_LOG_LEVEL_WARN: CGL_printf_gray(buffer3); break;
	case CGL_LOG_LEVEL_ERROR: CGL_printf_red(buffer3); break;
	case CGL_LOG_LEVEL_INTERNAL: CGL_printf_blue(buffer3); break;
	}
	if (__CGL_CURRENT_LOGGER_CONTEXT->flush_on_log) CGL_logger_flush();
}

#endif

// utils
#if 1


CGL_void CGL_console_set_color(uint8_t color)
{
#ifdef CGL_WINDOWS
	static WORD saved_attributes;
	HANDLE console = GetStdHandle(STD_OUTPUT_HANDLE);
	if (color == CGL_CONSOLE_COLOR_RESET) SetConsoleTextAttribute(console, saved_attributes);
	CONSOLE_SCREEN_BUFFER_INFO console_info;
	GetConsoleScreenBufferInfo(console, &console_info);
	saved_attributes = console_info.wAttributes;
	switch (color)
	{
	case 1:  SetConsoleTextAttribute(console, FOREGROUND_RED); break;
	case 2:  SetConsoleTextAttribute(console, FOREGROUND_GREEN); break;
	case 3:  SetConsoleTextAttribute(console, FOREGROUND_INTENSITY); break;
	case 4:  SetConsoleTextAttribute(console, FOREGROUND_BLUE); break;
	default: break;
	}
#else
	if (color == CGL_CONSOLE_COLOR_RESET) printf("\x1B[0m");
	else
	{
		switch (color)
		{
		case 1:  printf("\x1B[31m"); break;
		case 2:  printf("\x1B[32m"); break;
		case 3:  printf("\x1B[33m"); break;
		case 4:  printf("\x1B[34m"); break;
		default: break;
		}
	}
#endif   
}

CGL_void CGL_printf_red(const char* format, ...)
{
	CGL_console_set_color(CGL_CONSOLE_COLOR_RED);
	va_list args;
	va_start(args, format);
	vprintf(format, args);
	va_end(args);
	CGL_console_set_color(CGL_CONSOLE_COLOR_RESET);
}

CGL_void CGL_printf_green(const char* format, ...)
{
	CGL_console_set_color(CGL_CONSOLE_COLOR_GREEN);
	va_list args;
	va_start(args, format);
	vprintf(format, args);
	va_end(args);
	CGL_console_set_color(CGL_CONSOLE_COLOR_RESET);
}

CGL_void CGL_printf_gray(const char* format, ...)
{
	CGL_console_set_color(CGL_CONSOLE_COLOR_GRAY);
	va_list args;
	va_start(args, format);
	vprintf(format, args);
	va_end(args);
	CGL_console_set_color(CGL_CONSOLE_COLOR_RESET);
}

CGL_void CGL_printf_blue(const char* format, ...)
{
	CGL_console_set_color(CGL_CONSOLE_COLOR_BLUE);
	va_list args;
	va_start(args, format);
	vprintf(format, args);
	va_end(args);
	CGL_console_set_color(CGL_CONSOLE_COLOR_RESET);
}

CGL_void CGL_console_progress_bar(CGL_float progress, CGL_int width, CGL_byte* prefix, CGL_byte* suffix, CGL_byte complete_char, CGL_byte incomplete_char)
{
	static CGL_byte buffer[1024], buffer2[1024]; // 1024 is enough for a progress bar
	if (prefix) sprintf(buffer2, "%s", prefix); else buffer2[0] = 0; // prefix
	sprintf(buffer, "%c%d%%%c", 32, (CGL_int)(100 * progress), 32); // fill buffer wwith the progress percentage
	CGL_int pos = (CGL_int)strlen(buffer2), i, buffer_length = (CGL_int)strlen(buffer);
	for (i = 0; i < width; i++)
	{
		if (i < (CGL_int)(progress * width)) buffer2[pos + i] = complete_char; // add the progress bar
		else buffer2[pos + i] = incomplete_char; // add the progress bar
		// add contents of buffer2 at the middle of the progress bar
		if (i == (width - buffer_length) / 2 && i + buffer_length <= width) { for (CGL_int j = 0; j < buffer_length; j++) buffer2[pos + i + j] = buffer[j]; i += buffer_length - 1; }
	}
	buffer2[pos + i] = 0; // end of string
	if (suffix) strcat(buffer2, suffix); // suffix
	printf("%s\r", buffer2); // print the progress bar
}

float CGL_utils_get_time()
{
#if defined(_WIN32) || defined(_WIN64)
	static LARGE_INTEGER starting_time;
	LARGE_INTEGER frequency, time;
	if (starting_time.QuadPart == 0) QueryPerformanceCounter(&starting_time);
	QueryPerformanceFrequency(&frequency);
	QueryPerformanceCounter(&time);
	CGL_float ftime = (CGL_float)(time.QuadPart - starting_time.QuadPart) / (CGL_float)frequency.QuadPart;
	return ftime;
#elif defined(CGL_WASM)
	return (float)emscripten_get_now() / 1000.0f;
#else  // for POSIX
	struct timespec spec;
	if (clock_gettime(1, &spec) == -1)
	{
		/* 1 is CLOCK_MONOTONIC */
		return 0.0f;
	}
	return (float)(spec.tv_sec * 1000 + spec.tv_nsec / 1e6) / 1000.0f;
#endif
}

CGL_float CGL_utils_sigmoid(CGL_float x)
{
	return 1.0f / (1.0f + expf(-x));
}


CGL_float CGL_utils_sigmoid_derivative(CGL_float x)
{
	return x * (1.0f - x);
}

CGL_float CGL_utils_relu(CGL_float x)
{
	return x > 0.0f ? x : 0.0f;
}

CGL_float CGL_utils_relu_derivative(CGL_float x)
{
	return x > 0.0f ? 1.0f : 0.0f;
}

CGL_float CGL_utils_tanh(CGL_float x)
{
	return tanhf(x);
}

CGL_float CGL_utils_tanh_derivative(CGL_float x)
{
	return 1.0f - x * x;
}

CGL_float CGL_utils_step(CGL_float x)
{
	return x > 0.0f ? 1.0f : 0.0f;
}

CGL_float CGL_utils_step_derivative(CGL_float x)
{
	(void)x;
	return 0.0f;
}

CGL_float CGL_utils_relu_leaky(CGL_float x)
{
	return x > 0.0f ? x : 0.01f * x;
}

CGL_float CGL_utils_relu_leaky_derivative(CGL_float x)
{
	return x > 0.0f ? 1.0f : 0.01f;
}

CGL_float CGL_utils_relu_smooth(CGL_float x)
{
	return x > 0.0f ? x : 0.01f * x * x;
}

CGL_float CGL_utils_relu_smooth_derivative(CGL_float x)
{
	return x > 0.0f ? 1.0f : 0.02f * x;
}

CGL_vec3 CGL_utils_hsl_to_rgb(CGL_vec3 hsv)
{
	(void)hsv;
	CGL_log_internal("Not implemented yet");
	return CGL_vec3_init(0.0f, 0.0f, 0.0f);
}

CGL_sizei CGL_utils_get_random_with_probability(CGL_float* probabilities, CGL_sizei count)
{
	static CGL_float prefix[CGL_RAND_GEN_WITH_PROBABILITY_MAX_COUNT];
	prefix[0] = probabilities[0];
	for (CGL_sizei i = 1; i < count; i++) prefix[i] = prefix[i - 1] + probabilities[i];
	CGL_float r = CGL_utils_random_float() * prefix[count - 1];
	for (CGL_sizei i = 0; i < count; i++) if (r < prefix[i]) return i;
	return count - 1;
}

CGL_void CGL_utils_get_timestamp(char* buffer)
{
	time_t ltime = time(NULL);
	sprintf(buffer, "%s", asctime(localtime(&ltime)));
	buffer[strlen(buffer) - 2] = '\0';
}

// From : https://stackoverflow.com/a/12792056/14911094
CGL_bool CGL_utils_is_little_endian()
{
	CGL_int i = 0x01234567;
	return (*((CGL_ubyte*)(&i))) == 0x67;
}

CGL_void CGL_utils_reverse_bytes(void* vdata, size_t size)
{
	CGL_byte* data = (CGL_byte*)vdata;
	for (size_t i = 0; i < size / 2; i++)
	{
		CGL_byte temp = data[i];
		data[i] = data[size - i - 1];
		data[size - i - 1] = temp;
	}
}

CGL_void CGL_utils_little_endian_to_current(void* data, size_t size)
{
	if (CGL_utils_is_little_endian()) return;
	CGL_utils_reverse_bytes(data, size);
}

CGL_void CGL_utils_big_endian_to_current(void* data, size_t size)
{
	if (!CGL_utils_is_little_endian()) return;
	CGL_utils_reverse_bytes(data, size);
}

// From: https://stackoverflow.com/a/3747462/14911094
static CGL_int __CGL_UTILS_FAST_RAND_SEED = 42;

CGL_void CGL_utils_fast_srand(CGL_int seed)
{
	__CGL_UTILS_FAST_RAND_SEED = seed;
}

CGL_int CGL_utils_fast_rand()
{
	__CGL_UTILS_FAST_RAND_SEED = (214013 * __CGL_UTILS_FAST_RAND_SEED + 2531011);
	return ((__CGL_UTILS_FAST_RAND_SEED >> 16) & 0x7FFF);
}

// From: https://stackoverflow.com/a/1640399/14911094
CGL_ulong CGL_utils_xorshf96()
{
	static CGL_ulong x = 123456789, y = 362436069, z = 521288629, t;
	x ^= x << 16; x ^= x >> 5; x ^= x << 1;
	t = x; x = y; y = z;
	z = t ^ x ^ y;
	return z;
}

static CGL_uint __CGL_UTILS_RAND31_SEED = 42;

CGL_void CGL_utils_srand31(CGL_uint seed)
{
	__CGL_UTILS_RAND31_SEED = seed;
}

// From https://www.firstpr.com.au/dsp/rand31/
/*
Park-Miller "minimal standard" 31 bit
pseudo-random number generator, implemented
with David G. Carta's optimization : with
32 bit math and without division
*/
CGL_uint CGL_utils_rand31()
{
	CGL_uint hi, lo;
	lo = 16807 * (__CGL_UTILS_RAND31_SEED & 0xFFFF);
	hi = 16807 * (__CGL_UTILS_RAND31_SEED >> 16);
	lo += (hi & 0x7FFF) << 16;
	lo += hi >> 15;
	if (lo > 0x7FFFFFFF) lo -= 0x7FFFFFFF;
	return (__CGL_UTILS_RAND31_SEED = lo);
}

static CGL_byte __CGL_UTILS_QUICK_SORT_SWAP_BUFFER[CGL_QUICK_SORT_SWAP_BUFFER_SIZE];

#define __CGL_QUICK_SORT_SWAP_DATA(a, b) \
{  \
    memcpy(__CGL_UTILS_QUICK_SORT_SWAP_BUFFER, a, item_size); \
    memcpy(a, b, item_size); \
    memcpy(b, __CGL_UTILS_QUICK_SORT_SWAP_BUFFER, item_size); \
}

#define __CGL_QUICK_SORT_SWAP(a, b) \
{  \
    CGL_void* temp = a; \
    a = b; \
    b = temp; \
}

static CGL_void __CGL_utils_quick_sort(CGL_void* begin_ptr, CGL_void* end_ptr, CGL_sizei item_size, CGL_int(*comparator)(const CGL_void*, const CGL_void*))
{
	CGL_byte* pivot = (CGL_byte*)end_ptr - item_size;
	CGL_byte* left_ptr = (CGL_byte*)begin_ptr - item_size;
	CGL_byte* right_ptr = (CGL_byte*)end_ptr - item_size;
	while (left_ptr < right_ptr)
	{
		while (left_ptr < pivot && comparator(left_ptr = (left_ptr + item_size), pivot) < 0);
		while (right_ptr > left_ptr && comparator(right_ptr = (right_ptr - item_size), pivot) > 0);
		if (left_ptr < right_ptr) __CGL_QUICK_SORT_SWAP_DATA(left_ptr, right_ptr) // swap elements to arrange them
		else __CGL_QUICK_SORT_SWAP_DATA(left_ptr, pivot) // swap pivot to the middle
	}
	if ((CGL_sizei)(left_ptr - (CGL_byte*)begin_ptr) > item_size) __CGL_utils_quick_sort(begin_ptr, left_ptr, item_size, comparator);
	if ((CGL_sizei)((CGL_byte*)end_ptr - left_ptr) > item_size) __CGL_utils_quick_sort(left_ptr + item_size, end_ptr, item_size, comparator);
}

CGL_bool CGL_utils_quick_sort(CGL_void* array, CGL_sizei item_count, CGL_sizei item_size, CGL_int(*comparator)(const CGL_void*, const CGL_void*))
{
	__CGL_utils_quick_sort(array, (CGL_byte*)array + item_count * item_size, item_size, comparator);
	return true;
}

CGL_void CGL_shape_init(CGL_shape* shape, size_t vertices_count)
{
	shape->vertices_count = vertices_count;
	shape->vertices = (CGL_vec3*)CGL_malloc(sizeof(CGL_vec3) * vertices_count);
	shape->position = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	shape->rotation = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	shape->scale = CGL_vec3_init(1.0f, 1.0f, 1.0f);
	if (shape->vertices == NULL) return;
}

CGL_void CGL_shape_destroy(CGL_shape* shape)
{
	CGL_free(shape->vertices);
}


CGL_transform CGL_transform_create_empty()
{
	CGL_transform transform = { 0 };
	transform.position = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	transform.rotation = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	transform.scale = CGL_vec4_init(1.0f, 1.0f, 1.0f, 1.0f);
	transform.matrix = CGL_mat4_identity();
	transform.parent = NULL;
	return transform;
}

CGL_transform CGL_transform_create(CGL_vec3 position, CGL_vec3 rotation, CGL_vec3 scale)
{
	CGL_transform transform = { 0 };
	transform.position = CGL_vec4_init(position.x, position.y, position.z, 0.0f);
	transform.rotation = CGL_vec4_init(rotation.x, rotation.y, rotation.z, 0.0f);
	transform.scale = CGL_vec4_init(scale.x, scale.y, scale.z, 1.0f);
	transform.matrix = CGL_mat4_identity();
	transform.parent = NULL;
	CGL_transform_update(&transform);
	return transform;
}

CGL_transform CGL_transform_create_from_matrix(CGL_mat4 matrix)
{
	CGL_transform transform = { 0 };
	transform.position = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	transform.rotation = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	transform.scale = CGL_vec4_init(1.0f, 1.0f, 1.0f, 1.0f);
	(void)matrix;
	// TODO: Implement
	CGL_warn("CGL_transform_create_from_matrix() is not implemented yet!");
	return transform;
}

CGL_transform* CGL_transform_set_position(CGL_transform* transform, CGL_vec3 position)
{
	transform->position = CGL_vec4_init(position.x, position.y, position.z, 0.0f);
	return transform;
}

CGL_transform* CGL_transform_set_rotation(CGL_transform* transform, CGL_vec3 rotation)
{
	transform->rotation = CGL_vec4_init(rotation.x, rotation.y, rotation.z, 0.0f);
	return transform;
}

CGL_transform* CGL_transform_set_scale(CGL_transform* transform, CGL_vec3 scale)
{
	transform->scale = CGL_vec4_init(scale.x, scale.y, scale.z, 1.0f);
	return transform;
}

CGL_transform* CGL_transform_set_parent(CGL_transform* transform, CGL_transform* parent)
{
	transform->parent = parent;
	return transform;
}

CGL_transform* CGL_transform_update(CGL_transform* transform)
{
	CGL_mat4 parent_transform = CGL_mat4_identity();
	if (transform->parent != NULL)
	{
		CGL_transform_update(transform->parent);
		parent_transform = transform->parent->matrix;
	}
	CGL_transform_update_matrix_local(transform);
	transform->matrix = CGL_mat4_mul(parent_transform, transform->matrix);
	return transform;
}

CGL_transform* CGL_transform_update_matrix_local(CGL_transform* transform)
{
	CGL_mat4 translation = CGL_mat4_translate(transform->position.x, transform->position.y, transform->position.z);
	//CGL_mat4 rotation = CGL_mat4_rotation(transform->rotation.x, transform->rotation.y, transform->rotation.z);
	CGL_mat4 rotation_x = CGL_mat4_rotate_x(transform->rotation.x);
	CGL_mat4 rotation_y = CGL_mat4_rotate_y(transform->rotation.y);
	CGL_mat4 rotation_z = CGL_mat4_rotate_z(transform->rotation.z);
	CGL_mat4 rotation = CGL_mat4_mul(rotation_x, rotation_y); rotation = CGL_mat4_mul(rotation, rotation_z);
	CGL_mat4 scale = CGL_mat4_scale(transform->scale.x, transform->scale.y, transform->scale.z);
	transform->matrix = CGL_mat4_mul(translation, rotation);
	transform->matrix = CGL_mat4_mul(transform->matrix, scale);
	return transform;
}

CGL_mat4 CGL_transform_get_matrix(CGL_transform* transform)
{
	return transform->matrix;
}

CGL_mat4* CGL_transform_get_matrix_ptr(CGL_transform* transform)
{
	return &transform->matrix;
}

bool CGL_sat_collision_overlap_on_axis(CGL_shape* a, CGL_shape* b, CGL_vec2 axis, float* overlap_amount)
{
	CGL_float a_max = -FLT_MAX;
	CGL_float a_min = FLT_MAX;

	CGL_float b_max = -FLT_MAX;
	CGL_float b_min = FLT_MAX;

	CGL_vec2_normalize(axis);

	const CGL_vec2 a_translation = CGL_vec2_init(a->position.x, a->position.y);
	const CGL_vec2 a_scale = CGL_vec2_init(a->scale.x, a->scale.y);
	const CGL_float a_rotation = a->rotation.x;

	const CGL_vec2 b_translation = CGL_vec2_init(b->position.x, b->position.y);
	const CGL_vec2 b_scale = CGL_vec2_init(b->scale.x, b->scale.y);
	const CGL_float b_rotation = b->rotation.x;


	for (size_t i = 0; i < a->vertices_count; i++)
	{
		CGL_vec2 vertex = CGL_vec2_init(a->vertices[i].x, a->vertices[i].y);
		vertex = CGL_vec2_apply_transformations(vertex, &a_translation, &a_rotation, &a_scale);
		CGL_float projection = CGL_vec2_dot(vertex, axis);
		a_max = CGL_utils_max(a_max, projection);
		a_min = CGL_utils_min(a_min, projection);
	}

	for (size_t i = 0; i < b->vertices_count; i++)
	{
		CGL_vec2 vertex = CGL_vec2_init(b->vertices[i].x, b->vertices[i].y);
		vertex = CGL_vec2_apply_transformations(vertex, &b_translation, &b_rotation, &b_scale);
		CGL_float projection = CGL_vec2_dot(vertex, axis);
		b_max = CGL_utils_max(b_max, projection);
		b_min = CGL_utils_min(b_min, projection);
	}

	if
		(
			(a_max >= b_min && a_max <= b_max) ||
			(a_min >= b_min && a_min <= b_max) ||
			(b_max >= a_min && b_max <= a_max) ||
			(b_min >= a_min && b_min <= a_max)

			)
	{
		CGL_float overlap = 0.0f;
		if (a_max > b_max && a_min < b_min) overlap = CGL_utils_min(a_max - b_min, b_max - a_min);
		else if (a_max > b_max) overlap = b_max - a_min;
		else if (a_min < b_min) overlap = a_max - b_min;
		else overlap = CGL_utils_min(a_max - b_min, b_max - a_min);
		if (overlap_amount) *overlap_amount = overlap;
		return true;
	}

	return false;
}

bool CGL_sat_collision_detect(CGL_shape* a, CGL_shape* b, CGL_vec2* n_vector)
{
	static CGL_vec2 sat_axes_a[CGL_SAT_COLLISION_MAX_COLLISIONS];
	static CGL_vec2 sat_axes_b[CGL_SAT_COLLISION_MAX_COLLISIONS];
	CGL_sat_collision_calculate_axes(a, sat_axes_a, NULL);
	CGL_sat_collision_calculate_axes(b, sat_axes_b, NULL);
	CGL_float overlap = FLT_MAX, ov = FLT_MAX;
	CGL_vec2 n = CGL_vec2_init(0.0f, 0.0f);
	for (size_t i = 0; i < a->vertices_count; i++) { if (!CGL_sat_collision_overlap_on_axis(a, b, sat_axes_a[i], &ov)) return false; if (ov < overlap) { overlap = ov; n = sat_axes_a[i]; } }
	for (size_t i = 0; i < b->vertices_count; i++) { if (!CGL_sat_collision_overlap_on_axis(a, b, sat_axes_b[i], &ov)) return false; if (ov < overlap) { overlap = ov; n = sat_axes_b[i]; } }
	//if(overlap_amount) *overlap_amount = overlap;
	n = CGL_vec2_scale(n, overlap);
	if (n_vector) *n_vector = n;
	return true;
}

CGL_void CGL_sat_collision_calculate_axes(CGL_shape* shape, CGL_vec2* axes, CGL_int* axes_count)
{
	for (size_t i = 0; i < shape->vertices_count; i++)
	{
		CGL_vec2 a = CGL_vec2_init(shape->vertices[i].x, shape->vertices[i].y);
		CGL_vec2 b = CGL_vec2_init(shape->vertices[(i + 1) % shape->vertices_count].x, shape->vertices[(i + 1) % shape->vertices_count].y);
		CGL_vec2 edge = CGL_vec2_sub(b, a);
		CGL_vec2 normal = CGL_vec2_init(edge.y, -edge.x);
		axes[i] = normal;
	}
	if (axes_count) *axes_count = (int)shape->vertices_count;
}

// algorithm from https://stackoverflow.com/a/23186198/14911094
CGL_bool CGL_utils_is_point_in_triangle(CGL_vec2 p, CGL_vec2 p0, CGL_vec2 p1, CGL_vec2 p2)
{
	CGL_float s = (p0.y * p2.x - p0.x * p2.y + (p2.y - p0.y) * p.x + (p0.x - p2.x) * p.y);
	CGL_float t = (p0.x * p1.y - p0.y * p1.x + (p0.y - p1.y) * p.x + (p1.x - p0.x) * p.y);
	if (s <= 0 || t <= 0) return false;
	CGL_float A = (-p1.y * p2.x + p0.y * (-p1.x + p2.x) + p0.x * (p1.y - p2.y) + p1.x * p2.y);
	return (s + t) < A;
}

CGL_bool CGL_utils_is_point_in_circle(CGL_vec2 p, CGL_float r)
{
	return CGL_vec2_length(p) <= r;
}

CGL_bool CGL_utils_calculate_circumcircle(CGL_vec2 a, CGL_vec2 b, CGL_vec2 c, CGL_vec2* center, CGL_float* radius)
{
	CGL_float d = 2.0f * (a.x * (b.y - c.y) + b.x * (c.y - a.y) + c.x * (a.y - b.y));
	if (d == 0.0f) d = 0.0000000000001f;
	CGL_float x = ((a.x * a.x + a.y * a.y) * (b.y - c.y) + (b.x * b.x + b.y * b.y) * (c.y - a.y) + (c.x * c.x + c.y * c.y) * (a.y - b.y)) / d;
	CGL_float y = ((a.x * a.x + a.y * a.y) * (c.x - b.x) + (b.x * b.x + b.y * b.y) * (a.x - c.x) + (c.x * c.x + c.y * c.y) * (b.x - a.x)) / d;
	if (center) *center = CGL_vec2_init(x, y);
	if (radius) *radius = CGL_vec2_distance(a, CGL_vec2_init(x, y));
	return true;
}

CGL_bool CGL_utils_calculate_bounding_box(CGL_vec2* points, CGL_int points_count, CGL_vec2* a, CGL_vec2* b, CGL_vec2* c, CGL_vec2* d, CGL_float padding)
{
	if (!a || !b || !c || !d) return false;
	CGL_vec4 min_max_val = CGL_vec4_init(FLT_MAX, FLT_MAX, -FLT_MAX, -FLT_MAX);
	for (CGL_int i = 0; i < points_count; i++)
	{
		CGL_vec2 p = points[i];
		if (p.x < min_max_val.x) { min_max_val.x = p.x; }
		if (p.y < min_max_val.y) { min_max_val.y = p.y; }

		if (p.x > min_max_val.z) { min_max_val.z = p.x; }
		if (p.y > min_max_val.w) { min_max_val.w = p.y; }
	}
	min_max_val.x -= 0.1f; min_max_val.y -= 0.1f; min_max_val.z += 0.1f; min_max_val.w += 0.1f;
	*a = CGL_vec2_init(min_max_val.x - padding, min_max_val.y - padding); *b = CGL_vec2_init(min_max_val.z + padding, min_max_val.y - padding);
	*c = CGL_vec2_init(min_max_val.z + padding, min_max_val.w + padding); *d = CGL_vec2_init(min_max_val.x - padding, min_max_val.w + padding);
	return true;
}

CGL_float CGL_utils_random_gaussian(CGL_float mean, CGL_float std_dev)
{
	CGL_float u1 = (CGL_float)rand() / (CGL_float)RAND_MAX;
	CGL_float u2 = (CGL_float)rand() / (CGL_float)RAND_MAX;
	CGL_float rand_std_normal = sqrtf(-2.0f * logf(u1)) * sinf(2.0f * CGL_PI * u2);
	return mean + std_dev * rand_std_normal;
}


CGL_bool CGL_utils_calculate_bounding_square(CGL_vec2* points, CGL_int points_count, CGL_vec2* a, CGL_vec2* b, CGL_vec2* c, CGL_vec2* d, CGL_float padding)
{
	if (!a || !b || !c || !d) return false;
	CGL_vec2 pa, pb, pc, pd;
	if (!CGL_utils_calculate_bounding_box(points, points_count, &pa, &pb, &pc, &pd, padding)) return false;
	CGL_float w = CGL_vec2_distance(pa, pb); CGL_float h = CGL_vec2_distance(pa, pd);
	CGL_float max = w > h ? w : h;
	CGL_vec2 center = CGL_vec2_init((pa.x + pb.x + pc.x + pd.x) / 4.0f, (pa.y + pb.y + pc.y + pd.y) / 4.0f);
	*a = CGL_vec2_init(center.x - max / 2.0f, center.y - max / 2.0f); *b = CGL_vec2_init(center.x + max / 2.0f, center.y - max / 2.0f);
	*c = CGL_vec2_init(center.x + max / 2.0f, center.y + max / 2.0f); *d = CGL_vec2_init(center.x - max / 2.0f, center.y + max / 2.0f);
	return true;
}

/*
*              P
*              *
*             * *
*            *   *
*           *     *
*          *       *
*         *   mcd   *
*      D *###########* C
*       * #         # *
*      *  #         #  *
*     *   #         #   *
*    *    #         #    *
*   *     ###########     *
*  *************************
* Q      A           B       R
*
*
*/
CGL_bool CGL_utils_calculate_super_triangle(CGL_vec2* points, CGL_int points_count, CGL_vec2* a, CGL_vec2* b, CGL_vec2* c, CGL_float padding)
{
	if (!a || !b || !c) return false;
	CGL_vec2 pa, pb, pc, pd; CGL_float edge_size = 0.0f;
	if (!CGL_utils_calculate_bounding_square(points, points_count, &pa, &pb, &pc, &pd, padding)) return false;
	edge_size = CGL_vec2_distance(pa, pb); CGL_vec2 mcd = CGL_vec2_init((pc.x + pd.x) * 0.5f, pc.y);
	*a = CGL_vec2_init(mcd.x, mcd.y + CGL_SQRT3 * 0.5f * edge_size);
	*b = CGL_vec2_init(pa.x - edge_size * 0.5f, pa.y); *c = CGL_vec2_init(pb.x + edge_size * 0.5f, pb.y);
	return true;
}

// GJK & EPA 

CGL_vec3 CGL_gjk_shape_default_support(CGL_shape* a, CGL_vec3 d)
{
	CGL_float max_dp = -FLT_MAX, dp = 0.0f;
	CGL_vec3 support = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	CGL_vec3 vertex_pos = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	for (CGL_sizei i = 0; i < a->vertices_count; i++)
	{
		vertex_pos = CGL_vec3_apply_transformations(a->vertices[i], &a->position, &a->rotation, &a->scale);
		dp = CGL_vec3_dot(vertex_pos, d);
		if (dp > max_dp) { max_dp = dp; support = vertex_pos; }
	}
	return support;
}

// the default support function 
CGL_vec3 CGL_gjk_default_support(CGL_shape* a, CGL_shape* b, CGL_vec3 d)
{
	CGL_vec3 a_support = CGL_gjk_shape_default_support(a, d);
	CGL_vec3 b_support = CGL_gjk_shape_default_support(b, CGL_vec3_scale_(d, -1.0f));
	return CGL_vec3_sub(a_support, b_support);
}

// Implementation inspired from
//
// https://github.com/kroitor/gjk.c/blob/master/gjk.c
// https://observablehq.com/@esperanc/2d-gjk-and-epa-algorithms
CGL_bool CGL_gjk_check_collision_2d(CGL_shape* sa, CGL_shape* sb, CGL_vec3* simplex_out)
{
	CGL_int index = 0;
	CGL_vec3 simplex[3] = { 0 };
	CGL_vec3  a, b, c;
	CGL_vec3 dir, ao, ab, ac, ab_perp, ac_perp;

	// initial direction is from a to b
	dir = CGL_vec3_sub(sa->position, sb->position);

	// if the direction is 0 (which means a and b are at same position), set it to (1, 0, 0) (x-axis)
	if (dir.x == 0 && dir.y == 0) dir = CGL_vec3_init(1.0f, 0.0f, 0.0f);

	// get the first point of the simplex
	a = simplex[0] = CGL_gjk_default_support(sa, sb, dir);

	if (CGL_vec3_dot(a, dir) < 0) return false; // no collision

	// set the direction to the opposite of the first point (towards origin)
	dir = CGL_vec3_scale(dir, -1.0f);

	while (true)
	{
		a = simplex[++index] = CGL_gjk_default_support(sa, sb, dir);

		// origin lies beyond the support point in the direction of the origin
		// thus the minkowski difference does not contain the origin
		if (CGL_vec3_dot(a, dir) < 0) return false; // no collision

		// vector from A to origin
		ao = CGL_vec3_scale(a, -1.0f);

		if (index < 2)
		{
			b = simplex[0];
			ab = CGL_vec3_sub(b, a); // vector from A to B
			dir = CGL_vec3_triple_product(ab, ao, ab); // perpendicular to AB towards origin
			if (CGL_vec3_dot(dir, dir) == 0) dir = CGL_vec3_init(dir.y, -dir.x, 0.0f); // perpendicular to AB
			continue;
		}

		// we reach here when index == 2 (3 points in the simplex)
		b = simplex[1];
		c = simplex[0];
		// a is already the last point added to the simplex
		ab = CGL_vec3_sub(b, a);
		ac = CGL_vec3_sub(c, a);
		ac_perp = CGL_vec3_triple_product(ab, ac, ac);
		if (CGL_vec3_dot(ac_perp, ao) >= 0) dir = ac_perp;
		else
		{
			ab_perp = CGL_vec3_triple_product(ac, ab, ab);
			if (CGL_vec3_dot(ab_perp, ao) < 0)
			{
				if (simplex_out != NULL)
				{
					simplex_out[0] = simplex[0];
					simplex_out[1] = simplex[1];
					simplex_out[2] = simplex[2];
				}
				return true; // collision
			}
			simplex[0] = simplex[1]; // swap
			dir = ab_perp;
		}
		simplex[1] = simplex[2]; // swap
		index -= 1;
	}
	return false; // no collision
}

// TODO: this needs work
// From https://blog.winter.dev/2020/epa-algorithm/
CGL_vec3 CGL_gjk_epa_2d(CGL_shape* a, CGL_shape* b, CGL_vec3* simplex)
{
	CGL_int min_index = -1;
	CGL_float min_dist = FLT_MAX;
	CGL_vec3 min_normal = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	static CGL_vec3 polytope[CGL_GJK_EPA_MAX_POLYTOPE_VERTICES];
	//static CGL_vec3 polytope_copy[CGL_GJK_EPA_MAX_POLYTOPE_VERTICES];
	CGL_int polytope_size = 3;
	CGL_vec3 vti, vtj, vtedge, normal, support;
	CGL_float dist = 0.0f;
	for (CGL_int i = 0; i < 3; i++) polytope[i] = simplex[i];
	while (min_dist >= FLT_MAX)
	{
		for (CGL_int i = 0; i < polytope_size; i++)
		{
			CGL_int j = (i + 1) % polytope_size;
			vti = polytope[i]; vtj = polytope[j];
			vtedge = CGL_vec3_sub(vtj, vti);
			normal = CGL_vec3_init(vtedge.y, -vtedge.x, 0.0f);
			CGL_vec3_normalize(normal);
			dist = CGL_vec3_dot(normal, vti);
			if (dist < 0) { dist *= -1; normal = CGL_vec3_scale(normal, -1.0f); }
			if (dist < min_dist) { min_dist = dist; min_normal = normal; min_index = j; }
		}
		support = CGL_gjk_default_support(a, b, min_normal);
		dist = CGL_vec3_dot(min_normal, support);
		if (polytope_size == CGL_GJK_EPA_MAX_POLYTOPE_VERTICES - 2) break; // max reached
		if (fabsf(dist - min_dist) > CGL_GJK_EPA_TOLERANCE)
		{
			min_dist = FLT_MAX;
			// CGL_int amt_len = polytope_size - min_index;
			// for (CGL_int i = polytope_size - 1; i >= min_index; i--) polytope_copy[i + 1] = polytope[i];
			polytope[min_index] = support; polytope_size += 1;
		}
	}
	min_normal = CGL_vec3_scale(min_normal, min_dist);
	return min_normal;
}

CGL_bool CGL_aabb_contains_point(CGL_vec2 aabb_min, CGL_vec2 aabb_max, CGL_vec2 point)
{
	return point.x >= aabb_min.x && point.x <= aabb_max.x && point.y >= aabb_min.y && point.y <= aabb_max.y;
}

CGL_bool CGL_aabb_intersects_aabb(CGL_vec2 aabb_min, CGL_vec2 aabb_max, CGL_vec2 aabb_min2, CGL_vec2 aabb_max2)
{
	return aabb_min.x <= aabb_max2.x && aabb_max.x >= aabb_min2.x && aabb_min.y <= aabb_max2.y && aabb_max.y >= aabb_min2.y;
}


CGL_bool CGL_aabb_subdivide_nd(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabbs_min_out, CGL_float* aabbs_max_out)
{
	static CGL_float aabb_mid_pos[1024], aabb_axis_deltas[1024]; // I don't think we'll ever need more than 1024 dimensions
	CGL_float nth_dim_val_holder = 0.0f, * pm_a[2];
	CGL_int result_count = 1 << n, nth_dim_val_holder_index = 0;
	for (CGL_int i = 0; i < n; i++)
	{
		aabb_mid_pos[i] = (aabb_min[i] + aabb_max[i]) * 0.5f;
		aabb_axis_deltas[i] = aabb_mid_pos[i] - aabb_min[i];
	}

	for (CGL_int j = 0; j < n; j++)
	{
		pm_a[0] = &aabb_min[n - j - 1]; pm_a[1] = &aabb_mid_pos[n - j - 1];
		nth_dim_val_holder = *pm_a[nth_dim_val_holder_index = 0];
		for (CGL_int i = 0; i < result_count; i++)
		{
			aabbs_min_out[i * n + (n - j - 1)] = nth_dim_val_holder;
			if ((i - 1) % (1 << j) == 0) nth_dim_val_holder = *pm_a[nth_dim_val_holder_index = (nth_dim_val_holder_index + 1) % 2];
		}
	}

	for (CGL_int i = 0; i < result_count; i++)
	{
		for (CGL_int j = 0; j < n; j++)
		{
			aabbs_max_out[i * n + j] = aabbs_min_out[i * n + j] + aabb_axis_deltas[j];
		}
	}

	return CGL_TRUE;
}


// hard coded for 2d
CGL_bool CGL_aabb_subdivide_2d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabbs_min_out, CGL_float* aabbs_max_out)
{
	(void)n;
	CGL_float delta_x = (aabb_max[0] - aabb_min[0]) * 0.5f, delta_y = (aabb_max[1] - aabb_min[1]) * 0.5f;
	aabbs_min_out[0] = aabb_min[0]; aabbs_min_out[1] = aabb_min[1];
	aabbs_max_out[0] = aabb_min[0] + delta_x; aabbs_max_out[1] = aabb_min[1] + delta_y;
	aabbs_min_out[2] = aabb_min[0] + delta_x; aabbs_min_out[3] = aabb_min[1];
	aabbs_max_out[2] = aabb_max[0]; aabbs_max_out[3] = aabb_min[1] + delta_y;
	aabbs_min_out[4] = aabb_min[0]; aabbs_min_out[5] = aabb_min[1] + delta_y;
	aabbs_max_out[4] = aabb_min[0] + delta_x; aabbs_max_out[5] = aabb_max[1];
	aabbs_min_out[6] = aabb_min[0] + delta_x; aabbs_min_out[7] = aabb_min[1] + delta_y;
	aabbs_max_out[6] = aabb_max[0]; aabbs_max_out[7] = aabb_max[1];
	return CGL_TRUE;
}

CGL_bool CGL_aabb_subdivide_3d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabbs_min_out, CGL_float* aabbs_max_out)
{
	// CGL_log_internal("CGL_aabb_subdivide_3d Not implemented yet");
	return CGL_aabb_subdivide_nd(n, aabb_min, aabb_max, aabbs_min_out, aabbs_max_out);
}

CGL_bool CGL_aabb_contains_point_nd(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* point)
{
	for (CGL_int i = 0; i < n; i++) if (point[i] < aabb_min[i] || point[i] > aabb_max[i]) return CGL_FALSE;
	return CGL_TRUE;
}

CGL_bool CGL_aabb_contains_point_2d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* point)
{
	(void)n;
	return (point[0] >= aabb_min[0] && point[0] <= aabb_max[0] && point[1] >= aabb_min[1] && point[1] <= aabb_max[1]);
}

CGL_bool CGL_aabb_contains_point_3d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* point)
{
	(void)n;
	return (point[0] >= aabb_min[0] && point[0] <= aabb_max[0] && point[1] >= aabb_min[1] && point[1] <= aabb_max[1] && point[2] >= aabb_min[2] && point[2] <= aabb_max[2]);
}

CGL_bool CGL_aabb_intersects_aabb_nd(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabb_min2, CGL_float* aabb_max2)
{
	for (CGL_int i = 0; i < n; i++) if (aabb_min[i] > aabb_max2[i] || aabb_max[i] < aabb_min2[i]) return CGL_FALSE;
	return CGL_TRUE;
}

CGL_bool CGL_aabb_intersects_aabb_2d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabb_min2, CGL_float* aabb_max2)
{
	(void)n;
	return (aabb_min[0] <= aabb_max2[0] && aabb_max[0] >= aabb_min2[0] && aabb_min[1] <= aabb_max2[1] && aabb_max[1] >= aabb_min2[1]);
}

CGL_bool CGL_aabb_intersects_aabb_3d(CGL_int n, CGL_float* aabb_min, CGL_float* aabb_max, CGL_float* aabb_min2, CGL_float* aabb_max2)
{
	(void)n;
	return (aabb_min[0] <= aabb_max2[0] && aabb_max[0] >= aabb_min2[0] && aabb_min[1] <= aabb_max2[1] && aabb_max[1] >= aabb_min2[1] && aabb_min[2] <= aabb_max2[2] && aabb_max[2] >= aabb_min2[2]);
}


#define CGL_INCREMENTAL_TRIANGULATOR_SET_TRIANGLE(triangles, index, a, b, c) \
    triangles[index * 3 + 0] = a; \
    triangles[index * 3 + 1] = b; \
    triangles[index * 3 + 2] = c;

static void __CGL_triangulate_points_incremental_remove_triangle_at_index(CGL_int* triangles, CGL_int index)
{
	CGL_INCREMENTAL_TRIANGULATOR_SET_TRIANGLE(triangles, index, -10, -10, -10);
}

static CGL_int __CGL_triangulate_points_incremental_add_triangle_at_index(CGL_int* triangles, CGL_int a, CGL_int b, CGL_int c, CGL_int count)
{
	for (CGL_int i = 0; i < count; )
	{
		if (triangles[i * 3 + 0] == -10) { CGL_INCREMENTAL_TRIANGULATOR_SET_TRIANGLE(triangles, i, a, b, c); return count + 1; }
		else i++;
	}
	CGL_INCREMENTAL_TRIANGULATOR_SET_TRIANGLE(triangles, count, a, b, c);
	return count + 1;
}

// Source: https://en.wikipedia.org/wiki/Bowyer%E2%80%93Watson_algorithm
/*
* The Bowyer–Watson algorithm is an incremental algorithm.
* It works by adding points, one at a time, to a valid
* Delaunay triangulation of a subset of the desired points.
* After every insertion, any triangles whose circumcircles
* contain the new point are deleted, leaving a star-shaped
* polygonal hole which is then re-triangulated using the
* new point. By using the connectivity of the triangulation
* to efficiently locate triangles to remove, the algorithm
* can take O(N log N) operations to triangulate N points,
* although special degenerate cases exist where this
* goes up to O(N2)
*/
CGL_bool CGL_triangulate_points_incremental(CGL_vec2* points, CGL_int points_count, CGL_int* triangles_out, CGL_int* triangles_count_out)
{
	if (!triangles_count_out || !triangles_out) return false;
	if (points_count < 3) return false;
	static CGL_int triangles[CGL_INCREMENTAL_TRIANGULATOR_MAX_TRIANGLES * 3];
	static CGL_int bad_triangles[CGL_INCREMENTAL_TRIANGULATOR_MAX_TRIANGLES * 3];
	static CGL_int polygon[CGL_INCREMENTAL_TRIANGULATOR_MAX_TRIANGLES * 2];
	CGL_int triangles_count = 0, bad_triangles_count = 0, polygon_count = 0;
	CGL_vec2 a, b, c, p, va, vb, vc, centre; CGL_float rad; CGL_int ta, tb, tc, taa, tbb, tcc;
	if (!CGL_utils_calculate_super_triangle(points, points_count, &a, &b, &c, 0.01f)) return false;
	*triangles_count_out = 0;
	triangles_count = __CGL_triangulate_points_incremental_add_triangle_at_index(triangles, -1, -2, -3, triangles_count);
	for (CGL_int i = 0; i < points_count; i++)
	{
		p = points[i]; bad_triangles_count = 0;
		for (CGL_int j = 0, k = 0; j < triangles_count; j++, k++)
		{
			ta = triangles[k * 3 + 0]; tb = triangles[k * 3 + 1]; tc = triangles[k * 3 + 2];
			if (ta < -10) { j--; continue; } // skip empty triangle
			va = (ta < 0) ? ((ta == -1) ? a : ((ta == -2) ? b : c)) : points[ta];
			vb = (tb < 0) ? ((tb == -1) ? a : ((tb == -2) ? b : c)) : points[tb];
			vc = (tc < 0) ? ((tc == -1) ? a : ((tc == -2) ? b : c)) : points[tc];
			if (!CGL_utils_calculate_circumcircle(va, vb, vc, &centre, &rad)) return false;
			if (CGL_vec2_distance(centre, p) < rad)
			{
				bad_triangles_count = __CGL_triangulate_points_incremental_add_triangle_at_index(bad_triangles, ta, tb, tc, bad_triangles_count);
				__CGL_triangulate_points_incremental_remove_triangle_at_index(triangles, k);
			}
		}
		triangles_count -= bad_triangles_count; polygon_count = 0;
		for (CGL_int j = 0; j < bad_triangles_count; j++)
		{
			ta = bad_triangles[j * 3 + 0]; tb = bad_triangles[j * 3 + 1]; tc = bad_triangles[j * 3 + 2];
			CGL_int bd_edges[] = { ta, tb, tb, tc, tc, ta };
			for (CGL_int u = 0; u < 3; u++)
			{
				CGL_bool is_shared = false;
				for (CGL_int k = 0; k < bad_triangles_count; k++)
				{
					if (j == k) continue;
					taa = bad_triangles[k * 3 + 0]; tbb = bad_triangles[k * 3 + 1]; tcc = bad_triangles[k * 3 + 2];
					CGL_int bd_edges2[] = { taa, tbb, tbb, tcc, tcc, taa };
					for (CGL_int v = 0; v < 3; v++) { if ((bd_edges[u * 2 + 0] == bd_edges2[v * 2 + 0] && bd_edges[u * 2 + 1] == bd_edges2[v * 2 + 1]) || (bd_edges[u * 2 + 0] == bd_edges2[v * 2 + 1] && bd_edges[u * 2 + 1] == bd_edges2[v * 2 + 0])) { is_shared = true; break; } }
					if (is_shared) break;
				}
				if (!is_shared) { polygon[polygon_count * 2 + 0] = bd_edges[u * 2 + 0]; polygon[polygon_count * 2 + 1] = bd_edges[u * 2 + 1]; polygon_count++; }
			}
		}
		for (CGL_int j = 0; j < polygon_count; j++)
		{
			ta = polygon[j * 2 + 0]; tb = polygon[j * 2 + 1]; tc = i;
			triangles_count = __CGL_triangulate_points_incremental_add_triangle_at_index(triangles, ta, tb, tc, triangles_count);
		}
	}
	*triangles_count_out = 0;
	for (CGL_int j = 0, k = 0; j < triangles_count; j++, k++)
	{
		ta = triangles[k * 3 + 0]; tb = triangles[k * 3 + 1]; tc = triangles[k * 3 + 2];
		if (ta < 0 || tb < 0 || tc < 0) continue;
		CGL_INCREMENTAL_TRIANGULATOR_SET_TRIANGLE(triangles_out, *triangles_count_out, ta, tb, tc); *triangles_count_out += 1;
	}
	return true;
}

/*
uint32_t CGL_utils_crc32(const void* dat, size_t size)
{
	const uint8_t* data = (const uint8_t*)dat;
	uint32_t crc=0xFFFFFFFF;
	for(size_t i = 0 ; i < size ; i++)
	{
		char ch = data[i];
		for(size_t j=0;j<8;j++) {
			uint32_t b=(ch^crc)&1;
			crc>>=1;
			if(b) crc=crc^0xEDB88320;
			ch>>=1;
		}
	}
	return ~crc;
}
*/

// From : https://chromium.googlesource.com/chromiumos/platform/punybench/+/refs/heads/stabilize-6909.B/libpuny.b/crc32.c
static const uint32_t __CGL_CRC32_TABLE[256] =
{
	0x00000000, 0x77073096, 0xee0e612c, 0x990951ba,
	0x076dc419, 0x706af48f, 0xe963a535, 0x9e6495a3,
	0x0edb8832, 0x79dcb8a4, 0xe0d5e91e, 0x97d2d988,
	0x09b64c2b, 0x7eb17cbd, 0xe7b82d07, 0x90bf1d91,
	0x1db71064, 0x6ab020f2, 0xf3b97148, 0x84be41de,
	0x1adad47d, 0x6ddde4eb, 0xf4d4b551, 0x83d385c7,
	0x136c9856, 0x646ba8c0, 0xfd62f97a, 0x8a65c9ec,
	0x14015c4f, 0x63066cd9, 0xfa0f3d63, 0x8d080df5,
	0x3b6e20c8, 0x4c69105e, 0xd56041e4, 0xa2677172,
	0x3c03e4d1, 0x4b04d447, 0xd20d85fd, 0xa50ab56b,
	0x35b5a8fa, 0x42b2986c, 0xdbbbc9d6, 0xacbcf940,
	0x32d86ce3, 0x45df5c75, 0xdcd60dcf, 0xabd13d59,
	0x26d930ac, 0x51de003a, 0xc8d75180, 0xbfd06116,
	0x21b4f4b5, 0x56b3c423, 0xcfba9599, 0xb8bda50f,
	0x2802b89e, 0x5f058808, 0xc60cd9b2, 0xb10be924,
	0x2f6f7c87, 0x58684c11, 0xc1611dab, 0xb6662d3d,
	0x76dc4190, 0x01db7106, 0x98d220bc, 0xefd5102a,
	0x71b18589, 0x06b6b51f, 0x9fbfe4a5, 0xe8b8d433,
	0x7807c9a2, 0x0f00f934, 0x9609a88e, 0xe10e9818,
	0x7f6a0dbb, 0x086d3d2d, 0x91646c97, 0xe6635c01,
	0x6b6b51f4, 0x1c6c6162, 0x856530d8, 0xf262004e,
	0x6c0695ed, 0x1b01a57b, 0x8208f4c1, 0xf50fc457,
	0x65b0d9c6, 0x12b7e950, 0x8bbeb8ea, 0xfcb9887c,
	0x62dd1ddf, 0x15da2d49, 0x8cd37cf3, 0xfbd44c65,
	0x4db26158, 0x3ab551ce, 0xa3bc0074, 0xd4bb30e2,
	0x4adfa541, 0x3dd895d7, 0xa4d1c46d, 0xd3d6f4fb,
	0x4369e96a, 0x346ed9fc, 0xad678846, 0xda60b8d0,
	0x44042d73, 0x33031de5, 0xaa0a4c5f, 0xdd0d7cc9,
	0x5005713c, 0x270241aa, 0xbe0b1010, 0xc90c2086,
	0x5768b525, 0x206f85b3, 0xb966d409, 0xce61e49f,
	0x5edef90e, 0x29d9c998, 0xb0d09822, 0xc7d7a8b4,
	0x59b33d17, 0x2eb40d81, 0xb7bd5c3b, 0xc0ba6cad,
	0xedb88320, 0x9abfb3b6, 0x03b6e20c, 0x74b1d29a,
	0xead54739, 0x9dd277af, 0x04db2615, 0x73dc1683,
	0xe3630b12, 0x94643b84, 0x0d6d6a3e, 0x7a6a5aa8,
	0xe40ecf0b, 0x9309ff9d, 0x0a00ae27, 0x7d079eb1,
	0xf00f9344, 0x8708a3d2, 0x1e01f268, 0x6906c2fe,
	0xf762575d, 0x806567cb, 0x196c3671, 0x6e6b06e7,
	0xfed41b76, 0x89d32be0, 0x10da7a5a, 0x67dd4acc,
	0xf9b9df6f, 0x8ebeeff9, 0x17b7be43, 0x60b08ed5,
	0xd6d6a3e8, 0xa1d1937e, 0x38d8c2c4, 0x4fdff252,
	0xd1bb67f1, 0xa6bc5767, 0x3fb506dd, 0x48b2364b,
	0xd80d2bda, 0xaf0a1b4c, 0x36034af6, 0x41047a60,
	0xdf60efc3, 0xa867df55, 0x316e8eef, 0x4669be79,
	0xcb61b38c, 0xbc66831a, 0x256fd2a0, 0x5268e236,
	0xcc0c7795, 0xbb0b4703, 0x220216b9, 0x5505262f,
	0xc5ba3bbe, 0xb2bd0b28, 0x2bb45a92, 0x5cb36a04,
	0xc2d7ffa7, 0xb5d0cf31, 0x2cd99e8b, 0x5bdeae1d,
	0x9b64c2b0, 0xec63f226, 0x756aa39c, 0x026d930a,
	0x9c0906a9, 0xeb0e363f, 0x72076785, 0x05005713,
	0x95bf4a82, 0xe2b87a14, 0x7bb12bae, 0x0cb61b38,
	0x92d28e9b, 0xe5d5be0d, 0x7cdcefb7, 0x0bdbdf21,
	0x86d3d2d4, 0xf1d4e242, 0x68ddb3f8, 0x1fda836e,
	0x81be16cd, 0xf6b9265b, 0x6fb077e1, 0x18b74777,
	0x88085ae6, 0xff0f6a70, 0x66063bca, 0x11010b5c,
	0x8f659eff, 0xf862ae69, 0x616bffd3, 0x166ccf45,
	0xa00ae278, 0xd70dd2ee, 0x4e048354, 0x3903b3c2,
	0xa7672661, 0xd06016f7, 0x4969474d, 0x3e6e77db,
	0xaed16a4a, 0xd9d65adc, 0x40df0b66, 0x37d83bf0,
	0xa9bcae53, 0xdebb9ec5, 0x47b2cf7f, 0x30b5ffe9,
	0xbdbdf21c, 0xcabac28a, 0x53b39330, 0x24b4a3a6,
	0xbad03605, 0xcdd70693, 0x54de5729, 0x23d967bf,
	0xb3667a2e, 0xc4614ab8, 0x5d681b02, 0x2a6f2b94,
	0xb40bbe37, 0xc30c8ea1, 0x5a05df1b, 0x2d02ef8d
};

uint32_t CGL_utils_crc32(const void* dat, size_t size)
{
	const uint8_t* b = (const uint8_t*)dat;
	uint32_t crc = 0xFFFFFFFF;
	for (size_t i = 0; i < size; i++)
		crc = __CGL_CRC32_TABLE[(crc ^ *b++) & 0xff] ^ (crc >> 8);
	return ~crc;
}


// From : https://chromium.googlesource.com/chromiumos/platform/punybench/+/refs/heads/stabilize-6909.B/libpuny.b/crc64.c
#define CGL_CONST64(x) x##ull

static const uint64_t __CGL_CRC64_TABLE[256] = {
	CGL_CONST64(0x0000000000000000), CGL_CONST64(0x42f0e1eba9ea3693),
	CGL_CONST64(0x85e1c3d753d46d26), CGL_CONST64(0xc711223cfa3e5bb5),
	CGL_CONST64(0x493366450e42ecdf), CGL_CONST64(0x0bc387aea7a8da4c),
	CGL_CONST64(0xccd2a5925d9681f9), CGL_CONST64(0x8e224479f47cb76a),
	CGL_CONST64(0x9266cc8a1c85d9be), CGL_CONST64(0xd0962d61b56fef2d),
	CGL_CONST64(0x17870f5d4f51b498), CGL_CONST64(0x5577eeb6e6bb820b),
	CGL_CONST64(0xdb55aacf12c73561), CGL_CONST64(0x99a54b24bb2d03f2),
	CGL_CONST64(0x5eb4691841135847), CGL_CONST64(0x1c4488f3e8f96ed4),
	CGL_CONST64(0x663d78ff90e185ef), CGL_CONST64(0x24cd9914390bb37c),
	CGL_CONST64(0xe3dcbb28c335e8c9), CGL_CONST64(0xa12c5ac36adfde5a),
	CGL_CONST64(0x2f0e1eba9ea36930), CGL_CONST64(0x6dfeff5137495fa3),
	CGL_CONST64(0xaaefdd6dcd770416), CGL_CONST64(0xe81f3c86649d3285),
	CGL_CONST64(0xf45bb4758c645c51), CGL_CONST64(0xb6ab559e258e6ac2),
	CGL_CONST64(0x71ba77a2dfb03177), CGL_CONST64(0x334a9649765a07e4),
	CGL_CONST64(0xbd68d2308226b08e), CGL_CONST64(0xff9833db2bcc861d),
	CGL_CONST64(0x388911e7d1f2dda8), CGL_CONST64(0x7a79f00c7818eb3b),
	CGL_CONST64(0xcc7af1ff21c30bde), CGL_CONST64(0x8e8a101488293d4d),
	CGL_CONST64(0x499b3228721766f8), CGL_CONST64(0x0b6bd3c3dbfd506b),
	CGL_CONST64(0x854997ba2f81e701), CGL_CONST64(0xc7b97651866bd192),
	CGL_CONST64(0x00a8546d7c558a27), CGL_CONST64(0x4258b586d5bfbcb4),
	CGL_CONST64(0x5e1c3d753d46d260), CGL_CONST64(0x1cecdc9e94ace4f3),
	CGL_CONST64(0xdbfdfea26e92bf46), CGL_CONST64(0x990d1f49c77889d5),
	CGL_CONST64(0x172f5b3033043ebf), CGL_CONST64(0x55dfbadb9aee082c),
	CGL_CONST64(0x92ce98e760d05399), CGL_CONST64(0xd03e790cc93a650a),
	CGL_CONST64(0xaa478900b1228e31), CGL_CONST64(0xe8b768eb18c8b8a2),
	CGL_CONST64(0x2fa64ad7e2f6e317), CGL_CONST64(0x6d56ab3c4b1cd584),
	CGL_CONST64(0xe374ef45bf6062ee), CGL_CONST64(0xa1840eae168a547d),
	CGL_CONST64(0x66952c92ecb40fc8), CGL_CONST64(0x2465cd79455e395b),
	CGL_CONST64(0x3821458aada7578f), CGL_CONST64(0x7ad1a461044d611c),
	CGL_CONST64(0xbdc0865dfe733aa9), CGL_CONST64(0xff3067b657990c3a),
	CGL_CONST64(0x711223cfa3e5bb50), CGL_CONST64(0x33e2c2240a0f8dc3),
	CGL_CONST64(0xf4f3e018f031d676), CGL_CONST64(0xb60301f359dbe0e5),
	CGL_CONST64(0xda050215ea6c212f), CGL_CONST64(0x98f5e3fe438617bc),
	CGL_CONST64(0x5fe4c1c2b9b84c09), CGL_CONST64(0x1d14202910527a9a),
	CGL_CONST64(0x93366450e42ecdf0), CGL_CONST64(0xd1c685bb4dc4fb63),
	CGL_CONST64(0x16d7a787b7faa0d6), CGL_CONST64(0x5427466c1e109645),
	CGL_CONST64(0x4863ce9ff6e9f891), CGL_CONST64(0x0a932f745f03ce02),
	CGL_CONST64(0xcd820d48a53d95b7), CGL_CONST64(0x8f72eca30cd7a324),
	CGL_CONST64(0x0150a8daf8ab144e), CGL_CONST64(0x43a04931514122dd),
	CGL_CONST64(0x84b16b0dab7f7968), CGL_CONST64(0xc6418ae602954ffb),
	CGL_CONST64(0xbc387aea7a8da4c0), CGL_CONST64(0xfec89b01d3679253),
	CGL_CONST64(0x39d9b93d2959c9e6), CGL_CONST64(0x7b2958d680b3ff75),
	CGL_CONST64(0xf50b1caf74cf481f), CGL_CONST64(0xb7fbfd44dd257e8c),
	CGL_CONST64(0x70eadf78271b2539), CGL_CONST64(0x321a3e938ef113aa),
	CGL_CONST64(0x2e5eb66066087d7e), CGL_CONST64(0x6cae578bcfe24bed),
	CGL_CONST64(0xabbf75b735dc1058), CGL_CONST64(0xe94f945c9c3626cb),
	CGL_CONST64(0x676dd025684a91a1), CGL_CONST64(0x259d31cec1a0a732),
	CGL_CONST64(0xe28c13f23b9efc87), CGL_CONST64(0xa07cf2199274ca14),
	CGL_CONST64(0x167ff3eacbaf2af1), CGL_CONST64(0x548f120162451c62),
	CGL_CONST64(0x939e303d987b47d7), CGL_CONST64(0xd16ed1d631917144),
	CGL_CONST64(0x5f4c95afc5edc62e), CGL_CONST64(0x1dbc74446c07f0bd),
	CGL_CONST64(0xdaad56789639ab08), CGL_CONST64(0x985db7933fd39d9b),
	CGL_CONST64(0x84193f60d72af34f), CGL_CONST64(0xc6e9de8b7ec0c5dc),
	CGL_CONST64(0x01f8fcb784fe9e69), CGL_CONST64(0x43081d5c2d14a8fa),
	CGL_CONST64(0xcd2a5925d9681f90), CGL_CONST64(0x8fdab8ce70822903),
	CGL_CONST64(0x48cb9af28abc72b6), CGL_CONST64(0x0a3b7b1923564425),
	CGL_CONST64(0x70428b155b4eaf1e), CGL_CONST64(0x32b26afef2a4998d),
	CGL_CONST64(0xf5a348c2089ac238), CGL_CONST64(0xb753a929a170f4ab),
	CGL_CONST64(0x3971ed50550c43c1), CGL_CONST64(0x7b810cbbfce67552),
	CGL_CONST64(0xbc902e8706d82ee7), CGL_CONST64(0xfe60cf6caf321874),
	CGL_CONST64(0xe224479f47cb76a0), CGL_CONST64(0xa0d4a674ee214033),
	CGL_CONST64(0x67c58448141f1b86), CGL_CONST64(0x253565a3bdf52d15),
	CGL_CONST64(0xab1721da49899a7f), CGL_CONST64(0xe9e7c031e063acec),
	CGL_CONST64(0x2ef6e20d1a5df759), CGL_CONST64(0x6c0603e6b3b7c1ca),
	CGL_CONST64(0xf6fae5c07d3274cd), CGL_CONST64(0xb40a042bd4d8425e),
	CGL_CONST64(0x731b26172ee619eb), CGL_CONST64(0x31ebc7fc870c2f78),
	CGL_CONST64(0xbfc9838573709812), CGL_CONST64(0xfd39626eda9aae81),
	CGL_CONST64(0x3a28405220a4f534), CGL_CONST64(0x78d8a1b9894ec3a7),
	CGL_CONST64(0x649c294a61b7ad73), CGL_CONST64(0x266cc8a1c85d9be0),
	CGL_CONST64(0xe17dea9d3263c055), CGL_CONST64(0xa38d0b769b89f6c6),
	CGL_CONST64(0x2daf4f0f6ff541ac), CGL_CONST64(0x6f5faee4c61f773f),
	CGL_CONST64(0xa84e8cd83c212c8a), CGL_CONST64(0xeabe6d3395cb1a19),
	CGL_CONST64(0x90c79d3fedd3f122), CGL_CONST64(0xd2377cd44439c7b1),
	CGL_CONST64(0x15265ee8be079c04), CGL_CONST64(0x57d6bf0317edaa97),
	CGL_CONST64(0xd9f4fb7ae3911dfd), CGL_CONST64(0x9b041a914a7b2b6e),
	CGL_CONST64(0x5c1538adb04570db), CGL_CONST64(0x1ee5d94619af4648),
	CGL_CONST64(0x02a151b5f156289c), CGL_CONST64(0x4051b05e58bc1e0f),
	CGL_CONST64(0x87409262a28245ba), CGL_CONST64(0xc5b073890b687329),
	CGL_CONST64(0x4b9237f0ff14c443), CGL_CONST64(0x0962d61b56fef2d0),
	CGL_CONST64(0xce73f427acc0a965), CGL_CONST64(0x8c8315cc052a9ff6),
	CGL_CONST64(0x3a80143f5cf17f13), CGL_CONST64(0x7870f5d4f51b4980),
	CGL_CONST64(0xbf61d7e80f251235), CGL_CONST64(0xfd913603a6cf24a6),
	CGL_CONST64(0x73b3727a52b393cc), CGL_CONST64(0x31439391fb59a55f),
	CGL_CONST64(0xf652b1ad0167feea), CGL_CONST64(0xb4a25046a88dc879),
	CGL_CONST64(0xa8e6d8b54074a6ad), CGL_CONST64(0xea16395ee99e903e),
	CGL_CONST64(0x2d071b6213a0cb8b), CGL_CONST64(0x6ff7fa89ba4afd18),
	CGL_CONST64(0xe1d5bef04e364a72), CGL_CONST64(0xa3255f1be7dc7ce1),
	CGL_CONST64(0x64347d271de22754), CGL_CONST64(0x26c49cccb40811c7),
	CGL_CONST64(0x5cbd6cc0cc10fafc), CGL_CONST64(0x1e4d8d2b65facc6f),
	CGL_CONST64(0xd95caf179fc497da), CGL_CONST64(0x9bac4efc362ea149),
	CGL_CONST64(0x158e0a85c2521623), CGL_CONST64(0x577eeb6e6bb820b0),
	CGL_CONST64(0x906fc95291867b05), CGL_CONST64(0xd29f28b9386c4d96),
	CGL_CONST64(0xcedba04ad0952342), CGL_CONST64(0x8c2b41a1797f15d1),
	CGL_CONST64(0x4b3a639d83414e64), CGL_CONST64(0x09ca82762aab78f7),
	CGL_CONST64(0x87e8c60fded7cf9d), CGL_CONST64(0xc51827e4773df90e),
	CGL_CONST64(0x020905d88d03a2bb), CGL_CONST64(0x40f9e43324e99428),
	CGL_CONST64(0x2cffe7d5975e55e2), CGL_CONST64(0x6e0f063e3eb46371),
	CGL_CONST64(0xa91e2402c48a38c4), CGL_CONST64(0xebeec5e96d600e57),
	CGL_CONST64(0x65cc8190991cb93d), CGL_CONST64(0x273c607b30f68fae),
	CGL_CONST64(0xe02d4247cac8d41b), CGL_CONST64(0xa2dda3ac6322e288),
	CGL_CONST64(0xbe992b5f8bdb8c5c), CGL_CONST64(0xfc69cab42231bacf),
	CGL_CONST64(0x3b78e888d80fe17a), CGL_CONST64(0x7988096371e5d7e9),
	CGL_CONST64(0xf7aa4d1a85996083), CGL_CONST64(0xb55aacf12c735610),
	CGL_CONST64(0x724b8ecdd64d0da5), CGL_CONST64(0x30bb6f267fa73b36),
	CGL_CONST64(0x4ac29f2a07bfd00d), CGL_CONST64(0x08327ec1ae55e69e),
	CGL_CONST64(0xcf235cfd546bbd2b), CGL_CONST64(0x8dd3bd16fd818bb8),
	CGL_CONST64(0x03f1f96f09fd3cd2), CGL_CONST64(0x41011884a0170a41),
	CGL_CONST64(0x86103ab85a2951f4), CGL_CONST64(0xc4e0db53f3c36767),
	CGL_CONST64(0xd8a453a01b3a09b3), CGL_CONST64(0x9a54b24bb2d03f20),
	CGL_CONST64(0x5d45907748ee6495), CGL_CONST64(0x1fb5719ce1045206),
	CGL_CONST64(0x919735e51578e56c), CGL_CONST64(0xd367d40ebc92d3ff),
	CGL_CONST64(0x1476f63246ac884a), CGL_CONST64(0x568617d9ef46bed9),
	CGL_CONST64(0xe085162ab69d5e3c), CGL_CONST64(0xa275f7c11f7768af),
	CGL_CONST64(0x6564d5fde549331a), CGL_CONST64(0x279434164ca30589),
	CGL_CONST64(0xa9b6706fb8dfb2e3), CGL_CONST64(0xeb46918411358470),
	CGL_CONST64(0x2c57b3b8eb0bdfc5), CGL_CONST64(0x6ea7525342e1e956),
	CGL_CONST64(0x72e3daa0aa188782), CGL_CONST64(0x30133b4b03f2b111),
	CGL_CONST64(0xf7021977f9cceaa4), CGL_CONST64(0xb5f2f89c5026dc37),
	CGL_CONST64(0x3bd0bce5a45a6b5d), CGL_CONST64(0x79205d0e0db05dce),
	CGL_CONST64(0xbe317f32f78e067b), CGL_CONST64(0xfcc19ed95e6430e8),
	CGL_CONST64(0x86b86ed5267cdbd3), CGL_CONST64(0xc4488f3e8f96ed40),
	CGL_CONST64(0x0359ad0275a8b6f5), CGL_CONST64(0x41a94ce9dc428066),
	CGL_CONST64(0xcf8b0890283e370c), CGL_CONST64(0x8d7be97b81d4019f),
	CGL_CONST64(0x4a6acb477bea5a2a), CGL_CONST64(0x089a2aacd2006cb9),
	CGL_CONST64(0x14dea25f3af9026d), CGL_CONST64(0x562e43b4931334fe),
	CGL_CONST64(0x913f6188692d6f4b), CGL_CONST64(0xd3cf8063c0c759d8),
	CGL_CONST64(0x5dedc41a34bbeeb2), CGL_CONST64(0x1f1d25f19d51d821),
	CGL_CONST64(0xd80c07cd676f8394), CGL_CONST64(0x9afce626ce85b507)
};

uint64_t CGL_utils_crc64(const void* data, size_t size)
{
	uint64_t crc = 0xffffffffffffffffULL;
	const uint8_t* b = (const uint8_t*)data;
	for (size_t i = 0; i < size; i++)
		crc = __CGL_CRC64_TABLE[(uint8_t)(crc >> 56) ^ *b++] ^ (crc << 8);
	return ~crc;
}


// From : https://github.com/B-Con/crypto-algorithms/blob/master/rot-13.c
CGL_void CGL_utils_rot13(const char* data_in, char* str)
{
	CGL_int case_type, idx, len;
	len = (int)strlen(data_in);
	strcpy(str, data_in);
	for (idx = 0; idx < len; idx++) {
		// Only process alphabetic characters.
		if (str[idx] < 'A' || (str[idx] > 'Z' && str[idx] < 'a') || str[idx] > 'z')
			continue;
		// Determine if the char is upper or lower case.
		if (str[idx] >= 'a')
			case_type = 'a';
		else
			case_type = 'A';
		// Rotate the char's value, ensuring it doesn't accidentally "fall off" the end.
		str[idx] = (str[idx] + 13) % (case_type + 26);
		if (str[idx] < 26)
			str[idx] += (char)case_type;
	}
}


// From : http://www.azillionmonkeys.com/qed/hash.html

#if (defined(__GNUC__) && defined(__i386__)) || defined(__WATCOMC__) \
  || defined(_MSC_VER) || defined (__BORLANDC__) || defined (__TURBOC__)
#define CGL_get16bits(d) (*((const uint16_t *) (d)))
#endif

#if !defined (CGL_get16bits)
#define CGL_get16bits(d) ((((uint32_t)(((const uint8_t *)(d))[1])) << 8)\
                       +(uint32_t)(((const uint8_t *)(d))[0]) )
#endif

uint32_t CGL_utils_super_fast_hash(const void* dat, size_t len)
{
	const uint8_t* data = (const uint8_t*)dat;
	uint32_t hash = (uint32_t)len;
	uint32_t tmp;
	CGL_int rem;

	if (len <= 0 || data == NULL) return 0;

	rem = len & 3;
	len >>= 2;

	/* Main loop */
	for (; len > 0; len--) {
		hash += CGL_get16bits(data);
		tmp = (CGL_get16bits(data + 2) << 11) ^ hash;
		hash = (hash << 16) ^ tmp;
		data += 2 * sizeof(uint16_t);
		hash += hash >> 11;
	}

	/* Handle end cases */
	switch (rem) {
	case 3: hash += CGL_get16bits(data);
		hash ^= hash << 16;
		hash ^= ((signed char)data[sizeof(uint16_t)]) << 18;
		hash += hash >> 11;
		break;
	case 2: hash += CGL_get16bits(data);
		hash ^= hash << 11;
		hash += hash >> 17;
		break;
	case 1: hash += (signed char)*data;
		hash ^= hash << 10;
		hash += hash >> 1;
	}

	/* Force "avalanching" of final 127 bits */
	hash ^= hash << 3;
	hash += hash >> 5;
	hash ^= hash << 4;
	hash += hash >> 17;
	hash ^= hash << 25;
	hash += hash >> 6;

	return hash;
}

#endif

// common lib and mat
#if 1 // Just to use code folding

CGL_float CGL_float_quadratic_lerp(CGL_float a, CGL_float b, CGL_float c, CGL_float t)
{
	CGL_float t2 = t * t;
	CGL_float a0 = c - a;
	CGL_float a1 = a - b * 2.0f + c;
	CGL_float a2 = b - a;
	return (a0 + a1 * t + a2 * t2);
}

CGL_float CGL_float_cubic_lerp(CGL_float a, CGL_float b, CGL_float c, CGL_float d, CGL_float t)
{
	CGL_float p0 = CGL_float_lerp(a, c, t);
	CGL_float p1 = CGL_float_lerp(c, d, t);
	CGL_float p2 = CGL_float_lerp(d, b, t);
	CGL_float q0 = CGL_float_lerp(p0, p1, t);
	CGL_float q1 = CGL_float_lerp(p1, p2, t);
	return CGL_float_lerp(q0, q1, t);
}

// Uses Rodrigues' rotation formula to rotate a vector about an axis
CGL_vec3 CGL_vec3_rotate_about_axis(CGL_vec3 v, CGL_vec3 axis, CGL_float theta)
{
	CGL_float cos_theta = cosf(theta);
	CGL_float sin_theta = sinf(theta);
	CGL_float dot = CGL_vec3_dot(axis, v);
	CGL_vec3 cross = CGL_vec3_cross(axis, v);
	CGL_vec3 result = CGL_vec3_scale(v, cos_theta);
	CGL_vec3 temp = CGL_vec3_scale(axis, dot * (1 - cos_theta));
	result = CGL_vec3_add(result, temp);
	temp = CGL_vec3_scale(cross, sin_theta);
	result = CGL_vec3_add(result, temp);
	return result;
}

// vector triple product
CGL_vec2 CGL_vec2_triple_product(CGL_vec2 a, CGL_vec2 b, CGL_vec2 c)
{
	CGL_vec2 tmp0 = CGL_vec2_scale_(b, CGL_vec2_dot(a, c));
	CGL_vec2 tmp1 = CGL_vec2_scale_(a, CGL_vec2_dot(b, c));
	return CGL_vec2_sub(tmp0, tmp1);
}

CGL_vec3 CGL_vec3_triple_product(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c)
{
	CGL_vec3 tmp0 = CGL_vec3_scale_(b, CGL_vec3_dot(a, c));
	CGL_vec3 tmp1 = CGL_vec3_scale_(a, CGL_vec3_dot(b, c));
	return CGL_vec3_sub(tmp0, tmp1);
}

CGL_vec4 CGL_vec4_triple_product(CGL_vec4 a, CGL_vec4 b, CGL_vec4 c)
{
	CGL_vec4 tmp0 = CGL_vec4_scale_(b, CGL_vec4_dot(a, c));
	CGL_vec4 tmp1 = CGL_vec4_scale_(a, CGL_vec4_dot(b, c));
	return CGL_vec4_sub(tmp0, tmp1);
}


CGL_void CGL_vec3_calculate_orthonormal_basis_from_one_vector(CGL_vec3 a, CGL_vec3* pb, CGL_vec3* pc)
{
	CGL_vec3_normalize(a);
	CGL_vec3 b = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	CGL_vec3 c = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	if (a.x != 0.0f) b = CGL_vec3_init(-a.y / a.x, 1.0f, 0.0f);
	else if (a.y != 0.0f) b = CGL_vec3_init(0.0f, -a.z / a.y, 1.0f);
	else b = CGL_vec3_init(1.0f, 0.0f, -a.x / a.z);
	CGL_vec3_normalize(b);
	c = CGL_vec3_cross(a, b);
	if (pb) *pb = b;
	if (pc) *pc = c;
}

CGL_vec3 CGL_vec3_reflect(CGL_vec3 a, CGL_vec3 n)
{
	CGL_float dot = CGL_vec3_dot(a, n);
	CGL_vec3 result = CGL_vec3_scale(n, 2.0f * dot);
	result = CGL_vec3_sub(a, result);
	return result;
}


CGL_mat4 CGL_mat4_mul(CGL_mat4 b, CGL_mat4 a)
{
	CGL_mat4 result = CGL_mat4_zero();
	for (CGL_int i = 0; i < 4; i++) for (CGL_int j = 0; j < 4; j++)
	{
		for (CGL_int k = 0; k < 4; k++)
			CGL_mat4_elem_set(result, i, j, CGL_mat4_elem_get(result, i, j) + CGL_mat4_elem_get(a, i, k) * CGL_mat4_elem_get(b, k, j));
	}
	return result;
}

// LU decomposition using Kraut's algorithm
CGL_void CGL_mat4_decompose_lu(CGL_mat4 m, CGL_mat4* l, CGL_mat4* u)
{
	CGL_mat4 L = CGL_mat4_identity();
	CGL_mat4 U = CGL_mat4_identity();
	for (CGL_int j = 0; j < 4; j++)
	{
		for (CGL_int i = 0; i <= j; i++)
		{
			CGL_float sum = CGL_mat4_elem_get(m, i, j);
			for (CGL_int k = 0; k < i; k++)
				sum -= CGL_mat4_elem_get(L, i, k) * CGL_mat4_elem_get(U, k, j);
			CGL_mat4_elem_set(U, i, j, sum);
		}
		for (CGL_int i = j + 1; i < 4; i++)
		{
			CGL_float sum = CGL_mat4_elem_get(m, i, j);
			for (CGL_int k = 0; k < j; k++)
				sum -= CGL_mat4_elem_get(L, i, k) * CGL_mat4_elem_get(U, k, j);
			CGL_mat4_elem_set(L, i, j, sum / CGL_mat4_elem_get(U, j, j));
		}
	}
	if (l) *l = L;
	if (u) *u = U;
}

CGL_float CGL_mat4_det(CGL_mat4 m)
{
	return CGL_mat4_det_by_gauss(m);
}

CGL_float CGL_mat4_det_by_lu(CGL_mat4 m)
{
	CGL_mat4 U = CGL_mat4_identity();
	CGL_mat4_decompose_lu(m, NULL, &U);
	CGL_float det = 1.0f;
	for (CGL_int i = 0; i < 4; i++) det *= CGL_mat4_elem_get(U, i, i);
	return det;
}

CGL_float CGL_mat4_det_by_gauss(CGL_mat4 m)
{
	m = CGL_mat4_gauss_elim(m);
	CGL_float det = 1.0f;
	for (CGL_int i = 0; i < 4; i++) det *= CGL_mat4_elem_get(m, i, i);
	return det;
}

CGL_vec4 CGL_mat4_mul_vec4(CGL_mat4 m, CGL_vec4 v)
{
	CGL_vec4 result = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	result.x = CGL_mat4_elem_get(m, 0, 0) * v.x + CGL_mat4_elem_get(m, 0, 1) * v.y + CGL_mat4_elem_get(m, 0, 2) * v.z + CGL_mat4_elem_get(m, 0, 3) * v.w;
	result.y = CGL_mat4_elem_get(m, 1, 0) * v.x + CGL_mat4_elem_get(m, 1, 1) * v.y + CGL_mat4_elem_get(m, 1, 2) * v.z + CGL_mat4_elem_get(m, 1, 3) * v.w;
	result.z = CGL_mat4_elem_get(m, 2, 0) * v.x + CGL_mat4_elem_get(m, 2, 1) * v.y + CGL_mat4_elem_get(m, 2, 2) * v.z + CGL_mat4_elem_get(m, 2, 3) * v.w;
	result.w = CGL_mat4_elem_get(m, 3, 0) * v.x + CGL_mat4_elem_get(m, 3, 1) * v.y + CGL_mat4_elem_get(m, 3, 2) * v.z + CGL_mat4_elem_get(m, 3, 3) * v.w;
	return result;
}

CGL_mat4 CGL_mat4_adjoint(CGL_mat4 m)
{
	CGL_mat4 result = CGL_mat4_zero();
	for (CGL_int i = 0; i < 4; i++) for (CGL_int j = 0; j < 4; j++)
	{
		CGL_mat4 temp = CGL_mat4_zero();
		for (CGL_int k = 0; k < 4; k++) for (CGL_int l = 0; l < 4; l++)
		{
			if (k != i && l != j)
				CGL_mat4_elem_set(temp, k < i ? k : k - 1, l < j ? l : l - 1, CGL_mat4_elem_get(m, k, l));
		}
		CGL_mat4_elem_set(result, i, j, CGL_mat4_det(temp) * ((i + j) % 2 == 0 ? 1.0f : -1.0f));
	}
	return result;
}

CGL_mat4 CGL_mat4_inverse(CGL_mat4 m)
{
	CGL_mat4 result = CGL_mat4_adjoint(m);
	CGL_float det = CGL_mat4_det(m);
	det = 1.0f / det;
	result = CGL_mat4_mul_scalar(result, det);
	return result;
}

CGL_mat4 CGL_mat4_transpose(CGL_mat4 m)
{
	return CGL_mat4_init(
                         CGL_mat4_elem_get(m, 0, 0), CGL_mat4_elem_get(m, 0, 1), CGL_mat4_elem_get(m, 0, 2), CGL_mat4_elem_get(m, 0, 3),
                         CGL_mat4_elem_get(m, 1, 0), CGL_mat4_elem_get(m, 1, 1), CGL_mat4_elem_get(m, 1, 2), CGL_mat4_elem_get(m, 1, 3),
                         CGL_mat4_elem_get(m, 2, 0), CGL_mat4_elem_get(m, 2, 1), CGL_mat4_elem_get(m, 2, 2), CGL_mat4_elem_get(m, 2, 3),
                         CGL_mat4_elem_get(m, 3, 0), CGL_mat4_elem_get(m, 3, 1), CGL_mat4_elem_get(m, 3, 2), CGL_mat4_elem_get(m, 3, 3)
                         );
}

CGL_mat4 CGL_mat4_gauss_elim(CGL_mat4 m)
{
	CGL_float ratio = 0.0f;
	for (CGL_int i = 0; i < 4; i++) for (CGL_int j = 0; j < 4; j++)
	{
		if (j > i)
		{
			// cannot divide by zero
			if (CGL_mat4_elem_get(m, i, i) == 0.0f) CGL_mat4_elem_set(m, i, i, powf(2.2204f, -16));
			ratio = CGL_mat4_elem_get(m, j, i) / CGL_mat4_elem_get(m, i, i);
			for (CGL_int k = 0; k < 4; k++) CGL_mat4_elem_set(m, j, k, CGL_mat4_elem_get(m, j, k) - ratio * CGL_mat4_elem_get(m, i, k));
		}
	}
	return m;
}

CGL_int CGL_mat4_rank(CGL_mat4 m)
{
	m = CGL_mat4_gauss_elim(m);
	CGL_int rank = 0;
	CGL_float eps = powf(2.2204f, -16);
	CGL_float sum = 0.0f;
	for (CGL_int i = 0; i < 4; i++)
	{
		sum = 0.0f;
		for (CGL_int j = 0; j < 4; j++) sum += CGL_mat4_elem_get(m, i, j);
		if (fabsf(sum) > eps) rank++;
		else break;
	}
	return rank;
}

CGL_float CGL_mat4_trace(CGL_mat4 m)
{
	CGL_float trace = 0.0f;
	for (CGL_int i = 0; i < 4; i++) trace += CGL_mat4_elem_get(m, i, i);
	return trace;
}

CGL_mat3 CGL_mat4_to_mat3(CGL_mat4 m)
{
	return CGL_mat3_init(
		CGL_mat4_elem_get(m, 0, 0), CGL_mat4_elem_get(m, 0, 1), CGL_mat4_elem_get(m, 0, 2),
		CGL_mat4_elem_get(m, 1, 0), CGL_mat4_elem_get(m, 1, 1), CGL_mat4_elem_get(m, 1, 2),
		CGL_mat4_elem_get(m, 2, 0), CGL_mat4_elem_get(m, 2, 1), CGL_mat4_elem_get(m, 2, 2)
	);
}

CGL_mat4 CGL_mat4_from_mat3(CGL_mat3 m)
{
	return CGL_mat4_init(
		CGL_mat3_elem_get(m, 0, 0), CGL_mat3_elem_get(m, 0, 1), CGL_mat3_elem_get(m, 0, 2), 0.0f,
		CGL_mat3_elem_get(m, 1, 0), CGL_mat3_elem_get(m, 1, 1), CGL_mat3_elem_get(m, 1, 2), 0.0f,
		CGL_mat3_elem_get(m, 2, 0), CGL_mat3_elem_get(m, 2, 1), CGL_mat3_elem_get(m, 2, 2), 0.0f,
		0.0f, 0.0f, 0.0f, 1.0f
	);
}

// Golfman's method for matrix rotation
CGL_mat4 CGL_mat4_rotate_about_axis(CGL_vec3 axis, CGL_float angle)
{
	CGL_float cos_theta = cosf(angle);
	CGL_float sin_theta = sinf(angle);
	CGL_float one_minus_cos_theta = 1.0f - cos_theta;
	CGL_float x = axis.x;
	CGL_float y = axis.y;
	CGL_float z = axis.z;
	return CGL_mat4_init(
		cos_theta + x * x * one_minus_cos_theta, x * y * one_minus_cos_theta - z * sin_theta, x * z * one_minus_cos_theta + y * sin_theta, 0.0f,
		y * x * one_minus_cos_theta + z * sin_theta, cos_theta + y * y * one_minus_cos_theta, y * z * one_minus_cos_theta - x * sin_theta, 0.0f,
		z * x * one_minus_cos_theta - y * sin_theta, z * y * one_minus_cos_theta + x * sin_theta, cos_theta + z * z * one_minus_cos_theta, 0.0f,
		0.0f, 0.0f, 0.0f, 1.0f
	);
}

CGL_float CGL_mat3_det(CGL_mat3 a)
{
	CGL_float result = 0.0f;
	result += CGL_mat3_elem_get(a, 0, 0) * (CGL_mat3_elem_get(a, 1, 1) * CGL_mat3_elem_get(a, 2, 2) - CGL_mat3_elem_get(a, 1, 2) * CGL_mat3_elem_get(a, 2, 1));
	result -= CGL_mat3_elem_get(a, 0, 1) * (CGL_mat3_elem_get(a, 1, 0) * CGL_mat3_elem_get(a, 2, 2) - CGL_mat3_elem_get(a, 1, 2) * CGL_mat3_elem_get(a, 2, 0));
	result += CGL_mat3_elem_get(a, 0, 2) * (CGL_mat3_elem_get(a, 1, 0) * CGL_mat3_elem_get(a, 2, 1) - CGL_mat3_elem_get(a, 1, 1) * CGL_mat3_elem_get(a, 2, 0));
	return result;
}

CGL_float CGL_mat3_trace(CGL_mat3 a)
{
	CGL_float result = 0.0f;
	for (CGL_int i = 0; i < 3; i++) result += CGL_mat3_elem_get(a, i, i);
	return result;
}

CGL_mat3 CGL_mat3_transpose(CGL_mat3 a)
{
	return CGL_mat3_init(
		CGL_mat3_elem_get(a, 0, 0), CGL_mat3_elem_get(a, 1, 0), CGL_mat3_elem_get(a, 2, 0),
		CGL_mat3_elem_get(a, 0, 1), CGL_mat3_elem_get(a, 1, 1), CGL_mat3_elem_get(a, 2, 1),
		CGL_mat3_elem_get(a, 0, 2), CGL_mat3_elem_get(a, 1, 2), CGL_mat3_elem_get(a, 2, 2)
	);
}


float CGL_quat_to_axis_angle(CGL_quat quat, float* x, float* y, float* z)
{
	CGL_float angle = 2.0f * acosf(quat.w);
	// CGL_float divider = sqrtf(1.0f - quat.w * quat.w);
	CGL_float divider = sinf(angle / 2.0f);
	if (divider == 0.0f) return angle;
	if (x) *x = quat.vec.x / divider;
	if (y) *y = quat.vec.y / divider;
	if (z) *z = quat.vec.z / divider;
	return angle;
}

CGL_void CGL_quat_to_euler_zyx(CGL_quat q, float* z, float* y, float* x)
{
	// roll (x-axis rotation)
	if (x)
	{
		CGL_float sinr_cosp = 2.0f * (q.w * q.vec.x + q.vec.y * q.vec.z);
		CGL_float cosr_cosp = 1.0f - 2.0f * (q.vec.x * q.vec.x + q.vec.y * q.vec.y);
		*x = atan2f(sinr_cosp, cosr_cosp);
	}
	// pitch (y-axis rotation)
	if (y)
	{
		CGL_float sinp = 2.0f * (q.w * q.vec.y - q.vec.z * q.vec.x);
		if (fabs(sinp) >= 1) *y = copysignf(3.141f / 2.0f, sinp); // use 90 deg if out of range
		else *y = asinf(sinp);
	}
	// yaw (z-axis rotation)
	if (z)
	{
		CGL_float siny_cosp = 2.0f * (q.w * q.vec.z + q.vec.x * q.vec.y);
		CGL_float cosy_cosp = 1.0f - 2.0f * (q.vec.y * q.vec.y - q.vec.z * q.vec.z);
		*z = atan2f(siny_cosp, cosy_cosp);
	}
}

CGL_quat CGL_quat_mul(CGL_quat a, CGL_quat b)
{
	CGL_quat result = { 0 };
	CGL_vec3 temp1, temp2, temp3;
	temp1 = CGL_vec3_scale(a.vec, b.w);
	temp2 = CGL_vec3_scale(b.vec, a.w);
	temp3 = CGL_vec3_cross(a.vec, b.vec);
	result.w = a.w * b.w - CGL_vec3_dot(a.vec, b.vec);
	result.vec = CGL_vec3_add(temp1, temp2);
	result.vec = CGL_vec3_add(result.vec, temp3);
	return result;
}

CGL_void CGL_quat_rotate(CGL_quat q, CGL_float x, CGL_float y, CGL_float z, float* ox, float* oy, float* oz)
{
	CGL_float ww = q.w * q.w;
	CGL_float xx = q.vec.x * q.vec.x;
	CGL_float yy = q.vec.y * q.vec.y;
	CGL_float zz = q.vec.z * q.vec.z;
	CGL_float wx = q.w * q.vec.x;
	CGL_float wy = q.w * q.vec.y;
	CGL_float wz = q.w * q.vec.z;
	CGL_float xy = q.vec.x * q.vec.y;
	CGL_float xz = q.vec.x * q.vec.z;
	CGL_float yz = q.vec.y * q.vec.z;

	if (ox) *ox = ww * x + 2.0f * wy * z - 2.0f * wz * y + xx * x + 2.0f * xy * y + 2.0f * xz * z - zz * x - yy * x;
	if (oy) *oy = 2.0f * xy * x + yy * y + 2.0f * yz * z + 2.0f * wz * x - zz * y + ww * y - 2.0f * wx * z - xx * y;
	if (oz) *oz = 2.0f * xz * x + 2.0f * yz * y + zz * z - 2.0f * wy * x - yy * z + 2.0f * wx * y - xx * z + ww * z;
}

CGL_quat CGL_quat_inverse(CGL_quat quat)
{
	CGL_float normal = CGL_quat_norm(quat);
	normal = 1.0f / normal * normal;
	quat = CGL_quat_conjugate(quat);
	quat = CGL_quat_mul_scalar(quat, normal);
	return quat;
}

CGL_mat4 CGL_quat_to_mat4(CGL_quat quat)
{
	CGL_float s = CGL_quat_norm(quat);
	s = 2.0f / s * s;
	return CGL_mat4_init(
		1.0f - s * (quat.vec.y * quat.vec.y + quat.vec.z * quat.vec.z), s * (quat.vec.x * quat.vec.y - quat.vec.z * quat.w), s * (quat.vec.x * quat.vec.z + quat.vec.y * quat.w), 0.0f,
		s * (quat.vec.x * quat.vec.y + quat.vec.z * quat.w), 1.0f - s * (quat.vec.x * quat.vec.x + quat.vec.z * quat.vec.z), s * (quat.vec.y * quat.vec.z - quat.vec.x * quat.w), 0.0f,
		s * (quat.vec.x * quat.vec.z - quat.vec.y * quat.w), s * (quat.vec.y * quat.vec.z + quat.vec.x * quat.w), 1.0f - s * (quat.vec.x * quat.vec.x + quat.vec.y * quat.vec.y), 0.0f,
		0.0f, 0.0f, 0.0f, 1.0f
	);
}

CGL_quat CGL_quat_slerp(CGL_quat q, CGL_quat r, CGL_float t)
{
	CGL_float cos_theta = q.w * r.w + q.vec.x * r.vec.x + q.vec.y * r.vec.y + q.vec.z * r.vec.z;
	CGL_float theta = acosf(cos_theta);
	CGL_float sin_theta = sinf(theta);
	CGL_float s0 = sinf((1.0f - t) * theta) / sin_theta;
	CGL_float s1 = sinf(t * theta) / sin_theta;
	CGL_quat result = CGL_quat_mul_scalar(q, s0);
	CGL_quat temp = CGL_quat_mul_scalar(r, s1);
	result = CGL_quat_add(result, temp);
	return result;
}

CGL_quat CGL_quat_squad(CGL_quat q0, CGL_quat q1, CGL_quat a0, CGL_quat a1, CGL_float t)
{
	CGL_quat qr0 = CGL_quat_slerp(q0, q1, t);
	CGL_quat qr1 = CGL_quat_slerp(a0, a1, t);
	return CGL_quat_slerp(qr0, qr1, 2.0f * t * (1.0f - t));
}

CGL_mat4 CGL_mat4_look_at(CGL_vec3 eye, CGL_vec3 target, CGL_vec3 up)
{
	CGL_vec3 z = CGL_vec3_sub(eye, target);
	CGL_vec3_normalize(z);
	CGL_vec3 x = CGL_vec3_cross(up, z);
	CGL_vec3_normalize(x);
	CGL_vec3 y = CGL_vec3_cross(z, x);
	CGL_vec3_normalize(y);
	CGL_mat4 mt = CGL_mat4_init(
		x.x, x.y, x.z, -CGL_vec3_dot(x, eye),
		y.x, y.y, y.z, -CGL_vec3_dot(y, eye),
		z.x, z.y, z.z, -CGL_vec3_dot(z, eye),
		0.0f, 0.0f, 0.0f, 1.0f
	);
	return (mt);
}

CGL_mat4 CGL_mat4_lerp(CGL_mat4 a, CGL_mat4 b, CGL_float t)
{
	CGL_mat4 result = CGL_mat4_identity();
	for (int i = 0; i < 16; i++) result.m[i] = a.m[i] * (1.0f - t) + b.m[i] * t;
	return result;
}

CGL_vec3 CGL_vec3_apply_transformations(CGL_vec3 original, const CGL_vec3* translation, const CGL_vec3* rotation, const CGL_vec3* scale)
{
	if (rotation)
	{
		original = CGL_vec3_rotate_x(original, rotation->x);
		original = CGL_vec3_rotate_y(original, rotation->y);
		original = CGL_vec3_rotate_z(original, rotation->z);
	}
	if (scale) original = CGL_vec3_mul(original, (*scale));
	if (translation) original = CGL_vec3_add(original, (*translation));
	return original;
}

CGL_vec2 CGL_vec2_apply_transformations(CGL_vec2 original, const CGL_vec2* translation, const CGL_float* rotation, const CGL_vec2* scale)
{
	CGL_vec2 zero = CGL_vec2_init(0.0f, 0.0f);
	if (rotation) original = CGL_vec2_rotate_about_point(original, zero, (*rotation));
	if (scale) original = CGL_vec2_mul(original, (*scale));
	if (translation) original = CGL_vec2_add(original, (*translation));
	return original;
}


CGL_vec4 CGL_quat_mul_vec4(CGL_quat q, CGL_vec4 v)
{
	(void)q;
	CGL_warn("CGL_quat_mul_vec4 is not implemented yet");
	return v;
}



#ifndef CGL_EXCLUDE_MATRIX_API

struct CGL_matrix
{
	CGL_MATRIX_DATA_TYPE* data;
	CGL_int m;
	CGL_int n;
};

CGL_matrix* CGL_matrix_create(CGL_int m, CGL_int n)
{
	if (m <= 0 || n <= 0) return NULL; // return null if the dimensions are invalid
	CGL_matrix* result = (CGL_matrix*)malloc(sizeof(CGL_matrix)); // allocate memory for the matrix
	if (!result) return NULL; // return null if the memory could not be allocated
	result->data = (CGL_MATRIX_DATA_TYPE*)malloc(sizeof(CGL_MATRIX_DATA_TYPE) * m * n); // allocate memory for the data
	if (!result->data) { CGL_free(result); return NULL; } // free the matrix and return null if the memory could not be allocated
	result->m = m; result->n = n; // set the dimensions
	return result; // return the matrix
}

CGL_void CGL_matrix_destroy(CGL_matrix* m)
{
	if (!m) return; // return if the matrix is null
	CGL_free(m->data); // free the data
	CGL_free(m); // free the matrix
}

CGL_matrix* CGL_matrix_create_from_array(CGL_MATRIX_DATA_TYPE* array, CGL_int m, CGL_int n)
{
	CGL_matrix* result = CGL_matrix_create(m, n); // create the matrix
	if (!result) return NULL; // return null if the matrix could not be created
	memcpy(result->data, array, sizeof(CGL_MATRIX_DATA_TYPE) * m * n); // copy the array into the matrix
	return result; // return the matrix
}

CGL_matrix* CGL_matrix_add_to(CGL_matrix* a, CGL_matrix* b, CGL_matrix* out)
{
	if (!a || !b || !out) return NULL; // return null if any of the matrices are null
	if (a->m != b->m || a->n != b->n || a->m != out->m || a->n != out->n) return NULL; // return null if the matrices are not the same size
	for (int i = 0; i < a->m * a->n; i++) out->data[i] = a->data[i] + b->data[i]; // add the matrices
	return out; // return the result matrix
}

CGL_matrix* CGL_matrix_add(CGL_matrix* a, CGL_matrix* b)
{
	if (!a || !b) return NULL; // return null if any of the matrices are null
	if (a->m != b->m || a->n != b->n) return NULL; // return null if the matrices are not the same size
	CGL_matrix* result = CGL_matrix_create(a->m, a->n); // create the result matrix
	if (!result) return NULL; // return null if the matrix could not be created
	for (int i = 0; i < a->m * a->n; i++) result->data[i] = a->data[i] + b->data[i]; // add the matrices
	// CGL_matrix_add_to(a, b, result); // add the matrices
	return result; // return the result matrix
}

CGL_matrix* CGL_matrix_sub_to(CGL_matrix* a, CGL_matrix* b, CGL_matrix* out)
{
	if (!a || !b || !out) return NULL; // return null if any of the matrices are null
	if (a->m != b->m || a->n != b->n || a->m != out->m || a->n != out->n) return NULL; // return null if the matrices are not the same size
	for (int i = 0; i < a->m * a->n; i++) out->data[i] = a->data[i] - b->data[i]; // subtract the matrices
	return out; // return the result matrix
}

CGL_matrix* CGL_matrix_sub(CGL_matrix* a, CGL_matrix* b)
{
	if (!a || !b) return NULL; // return null if any of the matrices are null
	if (a->m != b->m || a->n != b->n) return NULL; // return null if the matrices are not the same size
	CGL_matrix* result = CGL_matrix_create(a->m, a->n); // create the result matrix
	if (!result) return NULL; // return null if the matrix could not be created
	for (int i = 0; i < a->m * a->n; i++) result->data[i] = a->data[i] - b->data[i]; // subtract the matrices
	// CGL_matrix_sub_to(a, b, result); // subtract the matrices
	return result; // return the result matrix
}

CGL_matrix* CGL_matrix_elem_mul_to(CGL_matrix* a, CGL_matrix* b, CGL_matrix* out)
{
	if (!a || !b || !out) return NULL; // return null if any of the matrices are null
	if (a->m != b->m || a->n != b->n || a->m != out->m || a->n != out->n) return NULL; // return null if the matrices are not the same size
	for (int i = 0; i < a->m * a->n; i++) out->data[i] = a->data[i] * b->data[i]; // multiply the matrices
	return out; // return the result matrix
}

CGL_matrix* CGL_matrix_elem_mul(CGL_matrix* a, CGL_matrix* b)
{
	if (!a || !b) return NULL; // return null if any of the matrices are null
	if (a->m != b->m || a->n != b->n) return NULL; // return null if the matrices are not the same size
	CGL_matrix* result = CGL_matrix_create(a->m, a->n); // create the result matrix
	if (!result) return NULL; // return null if the matrix could not be created
	for (int i = 0; i < a->m * a->n; i++) result->data[i] = a->data[i] * b->data[i]; // multiply the matrices
	// CGL_matrix_elem_mul_to(a, b, result); // multiply the matrices
	return result; // return the result matrix
}

CGL_matrix* CGL_matrix_mul_to(CGL_matrix* a, CGL_matrix* b, CGL_matrix* out)
{
	if (!a || !b || !out) return NULL; // return null if any of the matrices are null
	if (a->n != b->m || a->m != out->m || b->n != out->n) return NULL; // return null if the matrices are not the correct size
	for (int i = 0; i < a->m; i++) // for each row in a
	{
		for (int j = 0; j < b->n; j++) // for each column in b
		{
			CGL_MATRIX_DATA_TYPE sum = 0; // set the sum to 0
			for (int k = 0; k < a->n; k++) // for each element in the row of a and column of b
				sum += a->data[i * a->n + k] * b->data[k * b->n + j]; // add the product of the elements to the sum
			out->data[i * out->n + j] = sum; // set the element in the result matrix to the sum
		}
	}
	return out; // return the result matrix
}

CGL_matrix* CGL_matrix_mul(CGL_matrix* a, CGL_matrix* b)
{
	if (!a || !b) return NULL; // return null if any of the matrices are null
	if (a->n != b->m) return NULL; // return null if the matrices are not the correct size
	CGL_matrix* result = CGL_matrix_create(a->m, b->n); // create the result matrix
	if (!result) return NULL; // return null if the matrix could not be created
	CGL_matrix_mul_to(a, b, result); // multiply the matrices
	return result; // return the result matrix
}

CGL_matrix* CGL_matrix_transpose_to(CGL_matrix* m, CGL_matrix* out)
{
	if (!m || !out) return NULL; // return null if any of the matrices are null
	if (m->m != out->n || m->n != out->m) return NULL; // return null if the matrices are not the correct size
	for (int i = 0; i < m->m; i++) // for each row in m
		for (int j = 0; j < m->n; j++) // for each column in m
			out->data[j * out->n + i] = m->data[i * m->n + j]; // set the element in the result matrix to the element in m transposed
	return out; // return the result matrix
}

CGL_matrix* CGL_matrix_transpose(CGL_matrix* m)
{
	if (!m) return NULL; // return null if the matrix is null
	CGL_matrix* result = CGL_matrix_create(m->n, m->m); // create the result matrix
	if (!result) return NULL; // return null if the matrix could not be created
	CGL_matrix_transpose_to(m, result); // transpose the matrix
	return result; // return the result matrix
}

CGL_matrix* CGL_matrix_identity_to(CGL_int m, CGL_int n, CGL_matrix* out)
{
	if (!out) return NULL; // return null if the matrix is null
	if (m != out->m || n != out->n) return NULL; // return null if the matrix is not the correct size
	for (int i = 0; i < m; i++) // for each row in the matrix
		for (int j = 0; j < n; j++) // for each column in the matrix
			out->data[i * out->n + j] = (i == j) ? 1.0f : 0.0f; // set the element to 1 if it is on the diagonal and 0 otherwise
	return out; // return the result matrix
}

CGL_matrix* CGL_matrix_identity(CGL_int m, CGL_int n)
{
	CGL_matrix* result = CGL_matrix_create(m, n); // create the result matrix
	if (!result) return NULL; // return null if the matrix could not be created
	CGL_matrix_identity_to(m, n, result); // set the matrix to the identity matrix
	return result; // return the result matrix
}

CGL_matrix* CGL_matrix_scale_to(CGL_matrix* m, CGL_MATRIX_DATA_TYPE s)
{
	if (!m) return NULL; // return null if the matrix is null
	for (int i = 0; i < m->m * m->n; i++) m->data[i] *= s; // scale the matrix
	return m; // return the result matrix
}

CGL_matrix* CGL_matrix_scale(CGL_matrix* m, CGL_MATRIX_DATA_TYPE s)
{
	if (!m) return NULL; // return null if the matrix is null
	CGL_matrix* result = CGL_matrix_create(m->m, m->n); // create the result matrix
	if (!result) return NULL; // return null if the matrix could not be created
	for (int i = 0; i < m->m * m->n; i++) result->data[i] = m->data[i] * s; // scale the matrix
	return result; // return the result matrix
}

CGL_MATRIX_DATA_TYPE CGL_matrix_get_elem(CGL_matrix* m, CGL_int i, CGL_int j)
{
	if (!m) return 0; // return 0 if the matrix is null
	if (i < 0 || i >= m->m || j < 0 || j >= m->n) return 0; // return 0 if the indices are out of bounds
	return m->data[i * m->n + j]; // return the element
}

CGL_bool CGL_matrix_set_elem(CGL_matrix* m, CGL_int i, CGL_int j, CGL_MATRIX_DATA_TYPE value)
{
	if (!m) return CGL_FALSE; // return false if the matrix is null
	if (i < 0 || i >= m->m || j < 0 || j >= m->n) return CGL_FALSE; // return false if the indices are out of bounds
	m->data[i * m->n + j] = value; // set the element
	return CGL_TRUE; // return true
}

CGL_bool CGL_matrix_set_row(CGL_matrix* m, CGL_int i, CGL_MATRIX_DATA_TYPE* row)
{
	if (!m || !row) return CGL_FALSE; // return false if any of the matrices are null
	if (i < 0 || i >= m->m) return CGL_FALSE; // return false if the index is out of bounds
	for (int j = 0; j < m->n; j++) m->data[i * m->n + j] = row[j]; // set the row
	return CGL_TRUE; // return true
}

CGL_bool CGL_matrix_set_col(CGL_matrix* m, CGL_int j, CGL_MATRIX_DATA_TYPE* col)
{
	if (!m || !col) return CGL_FALSE; // return false if any of the matrices are null
	if (j < 0 || j >= m->n) return CGL_FALSE; // return false if the index is out of bounds
	for (int i = 0; i < m->m; i++) m->data[i * m->n + j] = col[i]; // set the column
	return CGL_TRUE; // return true
}

CGL_bool CGL_matrix_get_row(CGL_matrix* m, CGL_int i, CGL_MATRIX_DATA_TYPE* out)
{
	if (!m || !out) return CGL_FALSE; // return false if any of the matrices are null
	if (i < 0 || i >= m->m) return CGL_FALSE; // return false if the index is out of bounds
	for (int j = 0; j < m->n; j++) out[j] = m->data[i * m->n + j]; // get the row
	return CGL_TRUE; // return true
}

CGL_bool CGL_matrix_get_col(CGL_matrix* m, CGL_int j, CGL_MATRIX_DATA_TYPE* out)
{
	if (!m || !out) return CGL_FALSE; // return false if any of the matrices are null
	if (j < 0 || j >= m->n) return CGL_FALSE; // return false if the index is out of bounds
	for (int i = 0; i < m->m; i++) out[i] = m->data[i * m->n + j]; // get the column
	return CGL_TRUE; // return true
}

CGL_matrix* CGL_matrix_row_to_matrix_to(CGL_MATRIX_DATA_TYPE* row, CGL_int n, CGL_matrix* out)
{
	if (!row || !out) return NULL; // return null if any of the matrices are null
	if (out->m != 1 || out->n != n) return NULL; // return null if the output matrix is not a row vector
	for (int i = 0; i < n; i++) out->data[i] = row[i]; // set the row
	return out; // return the result matrix
}

CGL_matrix* CGL_matrix_row_to_matrix(CGL_MATRIX_DATA_TYPE* row, CGL_int n)
{
	if (!row) return NULL; // return null if the matrix is null
	CGL_matrix* result = CGL_matrix_create(1, n); // create the result matrix
	if (!result) return NULL; // return null if the matrix could not be created
	for (int i = 0; i < n; i++) result->data[i] = row[i]; // set the row
	return result; // return the result matrix

}

CGL_matrix* CGL_matrix_col_to_matrix_to(CGL_MATRIX_DATA_TYPE* col, CGL_int n, CGL_matrix* out)
{
	if (!col || !out) return NULL; // return null if any of the matrices are null
	if (out->m != n || out->n != 1) return NULL; // return null if the output matrix is not a column vector
	for (int i = 0; i < n; i++) out->data[i] = col[i]; // set the column
	return out; // return the result matrix
}

CGL_matrix* CGL_matrix_col_to_matrix(CGL_MATRIX_DATA_TYPE* col, CGL_int n)
{
	if (!col) return NULL; // return null if the matrix is null
	CGL_matrix* result = CGL_matrix_create(n, 1); // create the result matrix
	if (!result) return NULL; // return null if the matrix could not be created
	for (int i = 0; i < n; i++) result->data[i] = col[i]; // set the column
	return result; // return the result matrix
}

CGL_bool CGL_matrix_is_square(CGL_matrix* m)
{
	if (!m) return CGL_FALSE; // return false if the matrix is null
	return m->m == m->n; // return true if the matrix is square
}

CGL_bool CGL_matrix_is_symmetric(CGL_matrix* m)
{
	if (!m) return CGL_FALSE; // return false if the matrix is null
	if (!CGL_matrix_is_square(m)) return CGL_FALSE; // return false if the matrix is not square
	for (int i = 0; i < m->m; i++) // iterate over the rows
		for (int j = 0; j < m->n; j++) // iterate over the columns
			if (m->data[i * m->n + j] != m->data[j * m->n + i]) return CGL_FALSE; // return false if the element is not symmetric
	return CGL_TRUE; // return true if the matrix is symmetric
}

CGL_bool CGL_matrix_is_orthogonal(CGL_matrix* m)
{
	if (!m) return CGL_FALSE; // return false if the matrix is null
	if (!CGL_matrix_is_square(m)) return CGL_FALSE; // return false if the matrix is not square
	CGL_matrix* mt = CGL_matrix_transpose(m); // get the transpose of the matrix
	if (!mt) return CGL_FALSE; // return false if the transpose could not be computed
	CGL_matrix* mt_m = CGL_matrix_mul(mt, m); // get the product of the transpose and the matrix
	if (!mt_m) return CGL_FALSE; // return false if the product could not be computed
	CGL_matrix* m_mt = CGL_matrix_mul(m, mt); // get the product of the matrix and the transpose
	if (!m_mt) return CGL_FALSE; // return false if the product could not be computed
	CGL_bool result = CGL_matrix_is_identity(mt_m) && CGL_matrix_is_identity(m_mt); // check if the products are the identity matrix
	CGL_matrix_destroy(mt); // destroy the transpose
	CGL_matrix_destroy(mt_m); // destroy the product of the transpose and the matrix
	CGL_matrix_destroy(m_mt); // destroy the product of the matrix and the transpose
	return result; // return the result
}

CGL_bool CGL_matrix_is_diagonal(CGL_matrix* m)
{
	if (!m) return CGL_FALSE; // return false if the matrix is null
	if (!CGL_matrix_is_square(m)) return CGL_FALSE; // return false if the matrix is not square
	for (int i = 0; i < m->m; i++) // iterate over the rows
		for (int j = 0; j < m->n; j++) // iterate over the columns
			if (i != j && m->data[i * m->n + j] != 0) return CGL_FALSE; // return false if the element is not on the diagonal
	return CGL_TRUE; // return true if the matrix is diagonal
}

CGL_bool CGL_matrix_is_identity(CGL_matrix* m)
{
	if (!m) return CGL_FALSE; // return false if the matrix is null
	if (!CGL_matrix_is_square(m)) return CGL_FALSE; // return false if the matrix is not square
	for (int i = 0; i < m->m; i++) // iterate over the rows
		for (int j = 0; j < m->n; j++) // iterate over the columns
			if (i == j && m->data[i * m->n + j] != 1) return CGL_FALSE; // return false if the element is not on the diagonal
			else if (i != j && m->data[i * m->n + j] != 0) return CGL_FALSE; // return false if the element is not on the diagonal
	return CGL_TRUE; // return true if the matrix is the identity matrix
}

CGL_bool CGL_matrix_is_zero(CGL_matrix* m)
{
	if (!m) return CGL_FALSE; // return false if the matrix is null
	for (int i = 0; i < m->m * m->n; i++) // iterate over the elements
		if (m->data[i] != 0) return CGL_FALSE; // return false if the element is not zero
	return CGL_TRUE; // return true if the matrix is zero
}

CGL_bool CGL_matrix_is_equal(CGL_matrix* a, CGL_matrix* b)
{
	if (!a || !b) return CGL_FALSE; // return false if either matrix is null
	if (a->m != b->m || a->n != b->n) return CGL_FALSE; // return false if the matrices are not the same size
	for (int i = 0; i < a->m * a->n; i++) // iterate over the elements
		if (a->data[i] != b->data[i]) return CGL_FALSE; // return false if the elements are not equal
	return CGL_TRUE; // return true if the matrices are equal
}

CGL_MATRIX_DATA_TYPE CGL_matrix_trace(CGL_matrix* m)
{
	if (!m) return 0; // return 0 if the matrix is null
	if (!CGL_matrix_is_square(m)) return 0; // return 0 if the matrix is not square
	CGL_MATRIX_DATA_TYPE trace = 0; // initialize the trace to 0
	for (int i = 0; i < m->m; i++) // iterate over the rows
		trace += m->data[i * m->n + i]; // add the element to the trace
	return trace; // return the trace
}

CGL_MATRIX_DATA_TYPE CGL_matrix_determinant(CGL_matrix* m)
{
	if (!m) return 0; // return 0 if the matrix is null
	if (!CGL_matrix_is_square(m)) return 0; // return 0 if the matrix is not square
	if (m->m == 1) return m->data[0]; // return the element if the matrix is 1x1
	if (m->m == 2) return m->data[0] * m->data[3] - m->data[1] * m->data[2]; // return the determinant if the matrix is 2x2
	CGL_MATRIX_DATA_TYPE det = 0; // initialize the determinant to 0
	for (int i = 0; i < m->n; i++) // iterate over the columns
	{
		CGL_matrix* sub = CGL_matrix_minor(m, 0, i); // get the submatrix
		if (!sub) return 0; // return 0 if the submatrix could not be computed
		det += m->data[i] * CGL_matrix_determinant(sub) * (i % 2 == 0 ? 1 : -1); // add the element to the determinant
		CGL_matrix_destroy(sub); // destroy the submatrix
	}
	return det; // return the determinant
}

CGL_matrix* CGL_matrix_inverse_to(CGL_matrix* m, CGL_matrix* out)
{
	if (!m || !out) return NULL; // return null if either matrix is null
	if (m->m != out->m || m->n != out->n) return NULL; // return null if the matrices are not the same size
	if (!CGL_matrix_is_square(m)) return NULL; // return null if the matrix is not square
	CGL_MATRIX_DATA_TYPE det = CGL_matrix_determinant(m); // get the determinant
	if (det == 0) return NULL; // return null if the determinant is 0
	CGL_matrix* adj = CGL_matrix_adjugate_to(m, out); // get the adjugate
	if (!adj) return NULL; // return null if the adjugate could not be computed
	return CGL_matrix_scale_to(adj, 1.0f / det); // scale the adjugate by the determinant
}

CGL_matrix* CGL_matrix_inverse(CGL_matrix* m)
{
	if (!m) return NULL; // return null if the matrix is null
	if (!CGL_matrix_is_square(m)) return NULL; // return null if the matrix is not square
	CGL_matrix* out = CGL_matrix_create(m->m, m->n); // initialize the output matrix
	if (!out) return NULL; // return null if the output matrix could not be initialized
	return CGL_matrix_inverse_to(m, out); // return the inverse of the matrix
}

CGL_matrix* CGL_matrix_copy_to(CGL_matrix* m, CGL_matrix* out)
{
	if (!m || !out) return CGL_FALSE; // return false if either matrix is null
	if (m->m != out->m || m->n != out->n) return CGL_FALSE; // return false if the matrices are not the same size
	for (int i = 0; i < m->m * m->n; i++) // iterate over the elements
		out->data[i] = m->data[i]; // copy the element
	return out; // return true if the copy was successful
}

CGL_matrix* CGL_matrix_copy(CGL_matrix* m)
{
	if (!m) return NULL; // return null if the matrix is null
	CGL_matrix* out = CGL_matrix_create(m->m, m->n); // initialize the output matrix
	if (!out) return NULL; // return null if the output matrix could not be initialized
	return (CGL_matrix_copy_to(m, out)); // return null if the copy was not successful
}

CGL_bool CGL_matrix_print(CGL_matrix* m)
{
	if (!m) return CGL_FALSE; // return false if the matrix is null
	for (int i = 0; i < m->m; i++) // iterate over the rows
	{
		for (int j = 0; j < m->n; j++) // iterate over the columns
			printf("%f ", m->data[i * m->n + j]); // print the element
		printf("\n"); // print a new line
	}
	return CGL_TRUE; // return true if the print was successful
}

CGL_matrix* CGL_matrix_gauss_jordan_to(CGL_matrix* m, CGL_matrix* out)
{
	if (!m || !out) return NULL; // return null if either matrix is null
	if (m->m != out->m || m->n != out->n) return NULL; // return null if the matrices are not the same size
	if (!CGL_matrix_copy_to(m, out)) return NULL; // return null if the copy was not successful
	for (int i = 0; i < out->m; i++) // iterate over the rows
	{
		CGL_MATRIX_DATA_TYPE pivot = out->data[i * out->n + i]; // get the pivot element
		if (pivot == 0) return NULL; // return null if the pivot element is zero
		for (int j = 0; j < out->n; j++) // iterate over the columns
			out->data[i * out->n + j] /= pivot; // divide the element by the pivot
		for (int j = 0; j < out->m; j++) // iterate over the rows
		{
			if (j == i) continue; // skip the pivot row
			CGL_MATRIX_DATA_TYPE factor = out->data[j * out->n + i]; // get the factor
			for (int k = 0; k < out->n; k++) // iterate over the columns
				out->data[j * out->n + k] -= factor * out->data[i * out->n + k]; // subtract the factor times the pivot row from the row
		}
	}
	return out; // return the output matrix
}

CGL_matrix* CGL_matrix_gauss_jordan(CGL_matrix* m)
{
	if (!m) return NULL; // return null if the matrix is null
	CGL_matrix* out = CGL_matrix_create(m->m, m->n); // initialize the output matrix
	if (!out) return NULL; // return null if the output matrix could not be initialized
	if (!CGL_matrix_gauss_jordan_to(m, out)) return NULL; // return null if the gauss-jordan elimination was not successful
	return out; // return the output matrix
}

CGL_matrix* CGL_matrix_submatrix_to(CGL_matrix* mat, CGL_int i, CGL_int j, CGL_int m, CGL_int n, CGL_matrix* out)
{
	if (!mat || !out) return NULL; // return null if either matrix is null
	if (i < 0 || j < 0 || i + m > mat->m || j + n > mat->n) return NULL; // return null if the submatrix is out of bounds
	if (m != out->m || n != out->n) return NULL; // return null if the matrices are not the same size
	for (int k = 0; k < m; k++) // iterate over the rows
		for (int l = 0; l < n; l++) // iterate over the columns
			out->data[k * out->n + l] = mat->data[(i + k) * mat->n + j + l]; // copy the element
	return out; // return the output matrix
}

CGL_matrix* CGL_matrix_submatrix(CGL_matrix* mat, CGL_int i, CGL_int j, CGL_int m, CGL_int n)
{
	if (!m) return NULL; // return null if the matrix is null
	CGL_matrix* out = CGL_matrix_create(m, n); // initialize the output matrix
	if (!out) return NULL; // return null if the output matrix could not be initialized
	return (CGL_matrix_submatrix_to(mat, i, j, m, n, out)); // return null if the submatrix was not successful
}

CGL_matrix* CGL_matrix_minor_to(CGL_matrix* m, CGL_int a, CGL_int b, CGL_matrix* out)
{
	if (!m || !out) return NULL; // return null if either matrix is null
	// if(m->m != m->n || out->m != out->n) return NULL; // return null if the matrices are not square
	if (a < 0 || b < 0 || a >= m->m || b >= m->n) return NULL; // return null if the minor is out of bounds
	if (m->m != out->m + 1 && m->n != out->n + 1) return NULL; // return null if the matrices are not the correct size
	for (int i = 0, k = 0; i < m->m; i++) // iterate over the rows
	{
		if (i == a) continue; // skip the element
		for (int j = 0, l = 0; j < m->n; j++) // iterate over the columns
		{
			if (j == b) continue; // skip the element
			out->data[k * out->n + l] = m->data[i * m->n + j]; // copy the element
			l++; // increment the column
		}
		k++; // increment the row
	}
	return out; // return the output matrix
}

CGL_matrix* CGL_matrix_minor(CGL_matrix* m, CGL_int i, CGL_int j)
{
	if (!m) return NULL; // return null if the matrix is null
	CGL_matrix* out = CGL_matrix_create(m->m - 1, m->n - 1); // initialize the output matrix
	if (!out) return NULL; // return null if the output matrix could not be initialized
	return (CGL_matrix_minor_to(m, i, j, out)); // return null if the minor was not successful
}

CGL_matrix* CGL_matrix_adjugate_to(CGL_matrix* m, CGL_matrix* out)
{
	if (!m || !out) return NULL; // return null if either matrix is null
	if (m->m != m->n || out->m != out->n) return NULL; // return null if the matrices are not square
	if (m->m != out->m) return NULL; // return null if the matrices are not the same size
	for (int i = 0; i < m->m; i++) // iterate over the rows
		for (int j = 0; j < m->n; j++) // iterate over the columns
		{
			CGL_matrix* minor = CGL_matrix_minor(m, i, j); // get the minor
			if (!minor) return NULL; // return null if the minor could not be created
			CGL_MATRIX_DATA_TYPE det = CGL_matrix_determinant(minor); // get the determinant of the minor
			CGL_matrix_destroy(minor); // free the minor
			out->data[j * out->n + i] = ((i + j) % 2 == 0 ? det : -det); // set the element
		}
	return out; // return the output matrix
}

CGL_matrix* CGL_matrix_adjugate(CGL_matrix* m)
{
	if (!m) return NULL; // return null if the matrix is null
	CGL_matrix* out = CGL_matrix_create(m->m, m->n); // initialize the output matrix
	if (!out) return NULL; // return null if the output matrix could not be initialized
	return (CGL_matrix_adjugate_to(m, out)); // return null if the adjugate was not successful
}

CGL_matrix* CGL_matrix_transpose_inplace(CGL_matrix* m)
{
	if (!m) return NULL; // return null if the matrix is null
	for (int i = 0; i < m->m; i++) // iterate over the rows
		for (int j = 0; j < m->n; j++) // iterate over the columns
		{
			if (i >= j) continue; // skip the element
			CGL_MATRIX_DATA_TYPE temp = m->data[i * m->n + j]; // store the element
			m->data[i * m->n + j] = m->data[j * m->n + i]; // swap the elements
			m->data[j * m->n + i] = temp; // swap the elements
		}
	return m; // return the matrix
}

CGL_float CGL_matrix_sum_of_row(CGL_matrix* m, CGL_int i)
{
	if (!m) return 0; // return 0 if the matrix is null
	if (i < 0 || i >= m->m) return 0; // return 0 if the row is out of bounds
	CGL_float sum = 0; // initialize the sum
	for (int j = 0; j < m->n; j++) // iterate over the columns
		sum += m->data[i * m->n + j]; // add the element
	return sum; // return the sum
}

CGL_float CGL_matrix_sum_of_col(CGL_matrix* m, CGL_int j)
{
	if (!m) return 0; // return 0 if the matrix is null
	if (j < 0 || j >= m->n) return 0; // return 0 if the column is out of bounds
	CGL_float sum = 0; // initialize the sum
	for (int i = 0; i < m->m; i++) // iterate over the rows
		sum += m->data[i * m->n + j]; // add the element
	return sum; // return the sum
}

CGL_float CGL_matrix_product_of_row(CGL_matrix* m, CGL_int i)
{
	if (!m) return 0; // return 0 if the matrix is null
	if (i < 0 || i >= m->m) return 0; // return 0 if the row is out of bounds
	CGL_float product = 1; // initialize the product
	for (int j = 0; j < m->n; j++) // iterate over the columns
		product *= m->data[i * m->n + j]; // multiply the element
	return product; // return the product
}

CGL_float CGL_matrix_product_of_col(CGL_matrix* m, CGL_int j)
{
	if (!m) return 0; // return 0 if the matrix is null
	if (j < 0 || j >= m->n) return 0; // return 0 if the column is out of bounds
	CGL_float product = 1; // initialize the product
	for (int i = 0; i < m->m; i++) // iterate over the rows
		product *= m->data[i * m->n + j]; // multiply the element
	return product; // return the product
}

CGL_matrix* CGL_matrix_make_zero(CGL_matrix* m)
{
	if (!m) return NULL; // return null if the matrix is null
	for (int i = 0; i < m->m * m->n; i++) m->data[i] = 0; // set the element to 0
	return m; // return the matrix
}

#endif


#ifndef CGL_EXCLUDE_MATH_FUNCTIONS
// vec2 
CGL_vec2 CGL_vec2_add_(CGL_vec2 a, CGL_vec2 b)
{
	return CGL_vec2_init(a.x + b.x, a.y + b.y);
}

CGL_vec2 CGL_vec2_sub_(CGL_vec2 a, CGL_vec2 b)
{
	return CGL_vec2_init(a.x - b.x, a.y - b.y);
}

CGL_vec2 CGL_vec2_mul_(CGL_vec2 a, CGL_vec2 b)
{
	return CGL_vec2_init(a.x * b.x, a.y * b.y);
}

CGL_vec2 CGL_vec2_div_(CGL_vec2 a, CGL_vec2 b)
{
	return CGL_vec2_init(a.x / b.x, a.y / b.y);
}

CGL_vec2 CGL_vec2_add_scalar_(CGL_vec2 a, CGL_float b)
{
	return CGL_vec2_init(a.x + b, a.y + b);
}

CGL_vec2 CGL_vec2_sub_scalar_(CGL_vec2 a, CGL_float b)
{
	return CGL_vec2_init(a.x - b, a.y - b);
}

CGL_vec2 CGL_vec2_scale_(CGL_vec2 a, CGL_float b)
{
	return CGL_vec2_init(a.x * b, a.y * b);
}

CGL_vec2 CGL_vec2_normalize_(CGL_vec2 a)
{
	CGL_float length = CGL_vec2_length_(a);
	return CGL_vec2_init(a.x / length, a.y / length);
}

CGL_float CGL_vec2_dot_(CGL_vec2 a, CGL_vec2 b)
{
	return a.x * b.x + a.y * b.y;
}

CGL_float CGL_vec2_length_(CGL_vec2 a)
{
	return sqrtf(CGL_vec2_dot_(a, a));
}

CGL_float CGL_vec2_cross_(CGL_vec2 a, CGL_vec2 b)
{
	return a.x * b.y - a.y * b.x;
}

CGL_vec2 CGL_vec2_reflect_(CGL_vec2 a, CGL_vec2 b)
{
	CGL_float dot = CGL_vec2_dot_(a, b);
	return CGL_vec2_init(a.x - 2.0f * dot * b.x, a.y - 2.0f * dot * b.y);
}

CGL_vec2 CGL_vec2_refract_(CGL_vec2 a, CGL_vec2 b, CGL_float eta)
{
	CGL_float dot = CGL_vec2_dot_(a, b);
	CGL_float k = 1.0f - eta * eta * (1.0f - dot * dot);
	if (k < 0.0f) return CGL_vec2_init(0.0f, 0.0f);
	return CGL_vec2_init(eta * a.x - (eta * dot + sqrtf(k)) * b.x, eta * a.y - (eta * dot + sqrtf(k)) * b.y);
}

CGL_vec2 CGL_vec2_rotate_(CGL_vec2 a, CGL_float angle)
{
	CGL_float s = sinf(angle);
	CGL_float c = cosf(angle);
	return CGL_vec2_init(a.x * c - a.y * s, a.x * s + a.y * c);
}

CGL_vec2 CGL_vec2_lerp_(CGL_vec2 a, CGL_vec2 b, CGL_float t)
{
	return CGL_vec2_init(a.x + t * (b.x - a.x), a.y + t * (b.y - a.y));
}

// vec3
CGL_vec3 CGL_vec3_add_(CGL_vec3 a, CGL_vec3 b)
{
	return CGL_vec3_init(a.x + b.x, a.y + b.y, a.z + b.z);
}

CGL_vec3 CGL_vec3_add3_(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c)
{
	return CGL_vec3_init(a.x + b.x + c.x, a.y + b.y + c.y, a.z + b.z + c.z);
}

CGL_vec3 CGL_vec3_sub_(CGL_vec3 a, CGL_vec3 b)
{
	return CGL_vec3_init(a.x - b.x, a.y - b.y, a.z - b.z);
}

CGL_vec3 CGL_vec3_mul_(CGL_vec3 a, CGL_vec3 b)
{
	return CGL_vec3_init(a.x * b.x, a.y * b.y, a.z * b.z);
}

CGL_vec3 CGL_vec3_div_(CGL_vec3 a, CGL_vec3 b)
{
	return CGL_vec3_init(a.x / b.x, a.y / b.y, a.z / b.z);
}

CGL_vec3 CGL_vec3_add_scalar_(CGL_vec3 a, CGL_float b)
{
	return CGL_vec3_init(a.x + b, a.y + b, a.z + b);
}

CGL_vec3 CGL_vec3_sub_scalar_(CGL_vec3 a, CGL_float b)
{
	return CGL_vec3_init(a.x - b, a.y - b, a.z - b);
}

CGL_vec3 CGL_vec3_scale_(CGL_vec3 a, CGL_float b)
{
	return CGL_vec3_init(a.x * b, a.y * b, a.z * b);
}

CGL_vec3 CGL_vec3_normalize_(CGL_vec3 a)
{
	CGL_float length = CGL_vec3_length_(a);
	return CGL_vec3_init(a.x / length, a.y / length, a.z / length);
}

CGL_float CGL_vec3_dot_(CGL_vec3 a, CGL_vec3 b)
{
	return a.x * b.x + a.y * b.y + a.z * b.z;
}

CGL_float CGL_vec3_length_(CGL_vec3 a)
{
	return sqrtf(CGL_vec3_dot_(a, a));
}

CGL_vec3 CGL_vec3_cross_(CGL_vec3 a, CGL_vec3 b)
{
	return CGL_vec3_init(a.y * b.z - a.z * b.y, a.z * b.x - a.x * b.z, a.x * b.y - a.y * b.x);
}

CGL_vec3 CGL_vec3_reflect_(CGL_vec3 a, CGL_vec3 b)
{
	CGL_float dot = CGL_vec3_dot_(a, b);
	return CGL_vec3_init(a.x - 2.0f * dot * b.x, a.y - 2.0f * dot * b.y, a.z - 2.0f * dot * b.z);
}

CGL_vec3 CGL_vec3_refract_(CGL_vec3 a, CGL_vec3 b, CGL_float eta)
{
	CGL_float dot = CGL_vec3_dot_(a, b);
	CGL_float k = 1.0f - eta * eta * (1.0f - dot * dot);
	if (k < 0.0f) return CGL_vec3_init(0.0f, 0.0f, 0.0f);
	return CGL_vec3_init(eta * a.x - (eta * dot + sqrtf(k)) * b.x, eta * a.y - (eta * dot + sqrtf(k)) * b.y, eta * a.z - (eta * dot + sqrtf(k)) * b.z);
}

CGL_vec3 CGL_vec3_lerp_(CGL_vec3 a, CGL_vec3 b, CGL_float t)
{
	return CGL_vec3_init(a.x + t * (b.x - a.x), a.y + t * (b.y - a.y), a.z + t * (b.z - a.z));
}

// vec4
CGL_vec4 CGL_vec4_add_(CGL_vec4 a, CGL_vec4 b)
{
	return CGL_vec4_init(a.x + b.x, a.y + b.y, a.z + b.z, a.w + b.w);
}

CGL_vec4 CGL_vec4_sub_(CGL_vec4 a, CGL_vec4 b)
{
	return CGL_vec4_init(a.x - b.x, a.y - b.y, a.z - b.z, a.w - b.w);
}

CGL_vec4 CGL_vec4_mul_(CGL_vec4 a, CGL_vec4 b)
{
	return CGL_vec4_init(a.x * b.x, a.y * b.y, a.z * b.z, a.w * b.w);
}

CGL_vec4 CGL_vec4_div_(CGL_vec4 a, CGL_vec4 b)
{
	return CGL_vec4_init(a.x / b.x, a.y / b.y, a.z / b.z, a.w / b.w);
}

CGL_vec4 CGL_vec4_add_scalar_(CGL_vec4 a, CGL_float b)
{
	return CGL_vec4_init(a.x + b, a.y + b, a.z + b, a.w + b);
}

CGL_vec4 CGL_vec4_sub_scalar_(CGL_vec4 a, CGL_float b)
{
	return CGL_vec4_init(a.x - b, a.y - b, a.z - b, a.w - b);
}

CGL_vec4 CGL_vec4_scale_(CGL_vec4 a, CGL_float b)
{
	return CGL_vec4_init(a.x * b, a.y * b, a.z * b, a.w * b);
}

CGL_vec4 CGL_vec4_normalize_(CGL_vec4 a)
{
	CGL_float length = CGL_vec4_length_(a);
	return CGL_vec4_init(a.x / length, a.y / length, a.z / length, a.w / length);
}

CGL_float CGL_vec4_dot_(CGL_vec4 a, CGL_vec4 b)
{
	return a.x * b.x + a.y * b.y + a.z * b.z + a.w * b.w;
}

CGL_float CGL_vec4_length_(CGL_vec4 a)
{
	return sqrtf(CGL_vec4_dot_(a, a));
}

CGL_vec4 CGL_vec4_lerp_(CGL_vec4 a, CGL_vec4 b, CGL_float t)
{
	return CGL_vec4_init(a.x + t * (b.x - a.x), a.y + t * (b.y - a.y), a.z + t * (b.z - a.z), a.w + t * (b.w - a.w));
}

#endif


struct CGL_context
{
	bool is_initialized;
	CGL_int window_count;
#ifndef CGL_EXCLUDE_WINDOW_API 
	CGL_window* window_table[CGL_WINDOW_TABLE_SIZE];
#endif
};

CGL_context* __CGL_context = NULL;

bool CGL_init()
{
	if (__CGL_context != NULL) return true;
	__CGL_context = (CGL_context*)malloc(sizeof(CGL_context));
	if (__CGL_context == NULL) return false;
	__CGL_context->is_initialized = true;
	__CGL_context->window_count = 0;
	CGL_logger_init(CGL_ENABLE_CONSOLE_LOGGING);
	return true;
}

CGL_void CGL_shutdown()
{
	if (__CGL_context == NULL) return;
	free(__CGL_context);
	__CGL_context = NULL;
	CGL_logger_shutdown();
}

#endif


#if 1 // just to use code folding in ide

#if defined(_WIN32) || defined(_WIN64)
#else
#include <sys/stat.h>
#include <sys/types.h>
#endif


CGL_sizei CGL_utils_get_file_size(const CGL_byte* path)
{
#if defined(_WIN32) || defined(_WIN64)
	HANDLE file = CreateFile(path, GENERIC_READ, FILE_SHARE_READ, NULL, OPEN_EXISTING, FILE_ATTRIBUTE_NORMAL, NULL);
	if (file == INVALID_HANDLE_VALUE) return 0;
	LARGE_INTEGER size;
	if (GetFileSizeEx(file, &size) == 0) return 0;
	CloseHandle(file);
	return size.QuadPart;
#else
	struct stat st;
	if (stat(path, &st) == 0) return st.st_size;
	return -1;
#endif
}

CGL_void CGL_utils_sleep(const CGL_sizei milis)
{
#if defined(_WIN32) || defined(_WIN64)
	Sleep((DWORD)milis);
#else
	usleep(milis * 1000);
#endif
}

// read file into memory
CGL_byte* CGL_utils_read_file(const CGL_byte* path, size_t* size_ptr)
{
#if defined(_WIN32) || defined(_WIN64)
	HANDLE file = CreateFile(path, GENERIC_READ, FILE_SHARE_READ, NULL, OPEN_EXISTING, FILE_ATTRIBUTE_NORMAL, NULL);
	if (file == INVALID_HANDLE_VALUE) return NULL;
	LARGE_INTEGER size;
	if (GetFileSizeEx(file, &size) == 0) return NULL;
	CGL_byte* data = (CGL_byte*)malloc(size.QuadPart + 1);
	if (data == NULL) return NULL;
	DWORD read = 0;
	if (ReadFile(file, data, (DWORD)size.QuadPart, &read, NULL) == 0) return NULL;
	CloseHandle(file);
	data[size.QuadPart] = 0;
	if (size_ptr != NULL) *size_ptr = size.QuadPart;
	return data;
#else
	struct stat st;
	if (stat(path, &st) != 0) return NULL;
	if (size_ptr != NULL) *size_ptr = st.st_size;
	CGL_byte* data = (CGL_byte*)malloc(st.st_size + 1);
	data[st.st_size] = 0;
	if (data == NULL) return NULL;
	FILE* file = fopen(path, "r");
	if (file == NULL) return NULL;
	if ((CGL_sizei)fread(data, 1, st.st_size, file) != (CGL_sizei)st.st_size)
	{
		CGL_log_internal("failed to read file: %s", path);
	}
	fclose(file);
	return data;
#endif
}

const CGL_byte* CGL_utils_get_executable_path()
{
	static CGL_byte buffer[2048];
#if defined(_WIN32) || defined(_WIN64)
	GetModuleFileName(NULL, buffer, 2048);
#else
	ssize_t len = readlink("/proc/self/exe", buffer, 2048);
	if (len == -1) return NULL;
	buffer[len] = 0;
#endif
	return buffer;
}

const CGL_byte* CGL_utils_get_executable_directory()
{
	static CGL_byte buffer[2048];

	const CGL_byte* path = CGL_utils_get_executable_path();

	if (path == NULL) return NULL;

	CGL_int i = (CGL_int)(strlen(path) - 1);
	while (i >= 0 && path[i] != '/' && path[i] != '\\') i--;

	if (i < 0) return NULL;

	memcpy(buffer, path, i + 1);
	buffer[i + 1] = 0;

	return buffer;
}



// write data to file
bool CGL_utils_write_file(const char* path, const char* data, size_t size)
{
	FILE* file = fopen(path, "w");
	if (file == NULL)
		return false;
	fwrite(data, 1, size, file);
	fclose(file);
	return true;
}

bool CGL_utils_append_file(const char* path, const char* data, size_t size)
{
	FILE* file = fopen(path, "a");
	if (file == NULL)
		return false;
	fwrite(data, 1, size, file);
	fclose(file);
	return true;
}


#ifndef CGL_EXCLUDE_WINDOW_API

#ifndef CGL_EXPOSE_GLFW_API
#include <GLFW/glfw3.h> // GLFW
#endif

struct CGL_window
{
	GLFWwindow* handle;
	bool is_hidden;
	void* user_data;
	// callbacks
	CGL_window_key_callback key_callback;
	CGL_window_mouse_button_callback mouse_button_callback;
	CGL_window_mouse_position_callback mouse_position_callback;
	CGL_window_mouse_scroll_callback mouse_scroll_callback;
	CGL_window_framebuffer_size_callback framebuffer_size_callback;
	CGL_window_close_callback close_callback;
	CGL_window_drag_n_drop_callback drag_n_drop_callback;

	GLFWkeyfun previous_key_callback;
	GLFWmousebuttonfun previous_mouse_button_callback;
	GLFWcursorposfun previous_mouse_position_callback;
	GLFWscrollfun previous_mouse_scroll_callback;
	GLFWframebuffersizefun previous_framebuffer_size_callback;
	GLFWwindowclosefun previous_close_callback;
	GLFWdropfun previous_drag_n_drop_callback;
};

// callbacks
CGL_void __CGL_window_key_callback(GLFWwindow* window, CGL_int key, CGL_int scancode, CGL_int action, CGL_int mods)
{
	// CGL_window* cgl_window = (CGL_window*)glfwGetWindowUserPointer(window);
	CGL_window* cgl_window = __CGL_context->window_table[(uintptr_t)window % CGL_WINDOW_TABLE_SIZE];
	if (cgl_window->key_callback != NULL)
		cgl_window->key_callback(cgl_window, key, scancode, action, mods);
	if (cgl_window->previous_key_callback)
		cgl_window->previous_key_callback(window, key, scancode, action, mods);
}

CGL_void __CGL_window_mouse_button_callback(GLFWwindow* window, CGL_int button, CGL_int action, CGL_int mods)
{
	// CGL_window* cgl_window = (CGL_window*)glfwGetWindowUserPointer(window);
	CGL_window* cgl_window = __CGL_context->window_table[(uintptr_t)window % CGL_WINDOW_TABLE_SIZE];
	if (cgl_window->mouse_button_callback != NULL)
		cgl_window->mouse_button_callback(cgl_window, button, action, mods);
	if (cgl_window->previous_mouse_button_callback)
		cgl_window->previous_mouse_button_callback(window, button, action, mods);
}

CGL_void __CGL_window_mouse_position_callback(GLFWwindow* window, double xpos, double ypos)
{
	// CGL_window* cgl_window = (CGL_window*)glfwGetWindowUserPointer(window);
	CGL_window* cgl_window = __CGL_context->window_table[(uintptr_t)window % CGL_WINDOW_TABLE_SIZE];
	if (cgl_window->mouse_position_callback != NULL)
		cgl_window->mouse_position_callback(cgl_window, xpos, ypos);
	if (cgl_window->previous_mouse_position_callback)
		cgl_window->previous_mouse_position_callback(window, xpos, ypos);
}

CGL_void __CGL_window_mouse_scroll_callback(GLFWwindow* window, double xoffset, double yoffset)
{
	// CGL_window* cgl_window = (CGL_window*)glfwGetWindowUserPointer(window);
	CGL_window* cgl_window = __CGL_context->window_table[(uintptr_t)window % CGL_WINDOW_TABLE_SIZE];
	if (cgl_window->mouse_scroll_callback != NULL)
		cgl_window->mouse_scroll_callback(cgl_window, xoffset, yoffset);
	if (cgl_window->previous_mouse_scroll_callback)
		cgl_window->previous_mouse_scroll_callback(window, xoffset, yoffset);
}

CGL_void __CGL_window_framebuffer_size_callback(GLFWwindow* window, CGL_int width, CGL_int height)
{
	// CGL_window* cgl_window = (CGL_window*)glfwGetWindowUserPointer(window);
	CGL_window* cgl_window = __CGL_context->window_table[(uintptr_t)window % CGL_WINDOW_TABLE_SIZE];
	if (cgl_window->framebuffer_size_callback != NULL)
		cgl_window->framebuffer_size_callback(cgl_window, width, height);
	if (cgl_window->previous_framebuffer_size_callback)
		cgl_window->previous_framebuffer_size_callback(window, width, height);
}

CGL_void __CGL_window_close_callback(GLFWwindow* window)
{
	// CGL_window* cgl_window = (CGL_window*)glfwGetWindowUserPointer(window);
	CGL_window* cgl_window = __CGL_context->window_table[(uintptr_t)window % CGL_WINDOW_TABLE_SIZE];
	if (cgl_window->close_callback)
		cgl_window->close_callback(cgl_window);
	if (cgl_window->previous_close_callback)
		cgl_window->previous_close_callback(window);
}

CGL_void  __CGL_window_drag_n_drop_callback(GLFWwindow* window, CGL_int count, const char** paths)
{
	CGL_window* cgl_window = __CGL_context->window_table[(uintptr_t)window % CGL_WINDOW_TABLE_SIZE];
	if (cgl_window->drag_n_drop_callback)
		cgl_window->drag_n_drop_callback(cgl_window, paths, count);
	if (cgl_window->previous_drag_n_drop_callback)
		cgl_window->previous_drag_n_drop_callback(window, count, paths);
}

// create window
static CGL_window* __CGL_window_create(CGL_int width, CGL_int height, const char* title, bool undecorated)
{
	if (__CGL_context->window_count == 0)
	{
		if (!glfwInit())
		{
			CGL_log_internal("Failed to initialize GLFW\n");
			return false;
		}
	}
#ifdef CGL_WASM
	glfwWindowHint(GLFW_CLIENT_API, GLFW_OPENGL_ES_API);
	glfwWindowHint(GLFW_CONTEXT_VERSION_MAJOR, 3);
	glfwWindowHint(GLFW_CONTEXT_VERSION_MINOR, 0);

	//    glfwWindowHint(GLFW_CONTEXT_CREATION_API, GLFW_CONTEXT_API);
#else
	// tell glfw we are going to use opengl api
	glfwWindowHint(GLFW_CLIENT_API, GLFW_OPENGL_API);
	// tell glfw to initialize opengl context for opengl version 4.3 (latest)
	glfwWindowHint(GLFW_CONTEXT_VERSION_MAJOR, 4);
	glfwWindowHint(GLFW_CONTEXT_VERSION_MINOR, 3);
#endif
	glfwWindowHint(GLFW_DECORATED, undecorated);
	// tell glfw to use the opengl core profile and not the compatibility profile
	glfwWindowHint(GLFW_OPENGL_PROFILE, GLFW_OPENGL_CORE_PROFILE);
	glfwWindowHint(GLFW_OPENGL_FORWARD_COMPAT, GL_TRUE);
	// disabling resinfg gets rid of managing things like aspect ration and stuff
	glfwWindowHint(GLFW_RESIZABLE, GLFW_TRUE);
	CGL_window* window = (CGL_window*)malloc(sizeof(CGL_window));
	if (window == NULL)
	{
		CGL_log_internal("Failed to allocate memory for window\n");
		return NULL;
	}
	window->handle = glfwCreateWindow(width, height, title, NULL, NULL);
	if (window->handle == NULL)
	{
		CGL_log_internal("Failed to create GLFW window\n");
		return false;
	}
	glfwSwapInterval(1); // vsync
	window->is_hidden = true;
	window->key_callback = NULL;
	window->mouse_button_callback = NULL;
	window->mouse_position_callback = NULL;
	window->mouse_scroll_callback = NULL;
	window->framebuffer_size_callback = NULL;
	window->close_callback = NULL;
	window->drag_n_drop_callback = NULL;
	window->user_data = NULL;
	window->previous_close_callback = NULL;
	window->previous_framebuffer_size_callback = NULL;
	window->previous_key_callback = NULL;
	window->previous_mouse_button_callback = NULL;
	window->previous_mouse_position_callback = NULL;
	window->previous_mouse_scroll_callback = NULL;
	window->previous_drag_n_drop_callback = NULL;
	__CGL_context->window_table[(uintptr_t)window->handle % CGL_WINDOW_TABLE_SIZE] = window; // Temporary
	__CGL_context->window_count++;
	return window;
}

CGL_window* CGL_window_create(CGL_int width, CGL_int height, const char* title)
{
	return __CGL_window_create(width, height, title, true);
}

CGL_window* CGL_window_create_undecorated(CGL_int width, CGL_int height, const char* title)
{
	return __CGL_window_create(width, height, title, false);
}


// destroy window
CGL_void CGL_window_destroy(CGL_window* window)
{
	glfwDestroyWindow(window->handle);
	free(window);
	__CGL_context->window_count--;
	if (__CGL_context->window_count == 0)
	{
		glfwTerminate();
	}
}

// poll events
CGL_void CGL_window_poll_events(CGL_window* window)
{
	(void)window;
	glfwPollEvents();
}

// swap buffers
CGL_void CGL_window_swap_buffers(CGL_window* window)
{
	glfwSwapBuffers(window->handle);
}

// check if window should close
bool CGL_window_should_close(CGL_window* window)
{
	return glfwWindowShouldClose(window->handle);
}

// set window title
CGL_void CGL_window_set_title(CGL_window* window, const char* title)
{
	glfwSetWindowTitle(window->handle, title);
}

// set window size
CGL_void CGL_window_set_size(CGL_window* window, CGL_int width, CGL_int height)
{
	glfwSetWindowSize(window->handle, width, height);
}

// set window position
CGL_void CGL_window_set_position(CGL_window* window, CGL_int x, CGL_int y)
{
	glfwSetWindowPos(window->handle, x, y);
}

// set window hidden
CGL_void CGL_window_set_hidden(CGL_window* window, bool hidden)
{
	if (hidden)
		glfwHideWindow(window->handle);
	else
		glfwShowWindow(window->handle);
	window->is_hidden = hidden;
}

// set window user data
CGL_void CGL_window_set_user_data(CGL_window* window, void* user_data)
{
	window->user_data = user_data;
}

// get window user data
CGL_void* CGL_window_get_user_data(CGL_window* window)
{
	return window->user_data;
}

// get window size
CGL_void CGL_window_get_size(CGL_window* window, CGL_int* width, CGL_int* height)
{
	glfwGetWindowSize(window->handle, width, height);
}

// get window position
CGL_void CGL_window_get_position(CGL_window* window, CGL_int* x, CGL_int* y)
{
	glfwGetWindowPos(window->handle, x, y);
}

// get window framebuffer size
CGL_void CGL_window_get_framebuffer_size(CGL_window* window, CGL_int* width, CGL_int* height)
{
	glfwGetFramebufferSize(window->handle, width, height);
}

// set key callback
CGL_void CGL_window_set_key_callback(CGL_window* window, CGL_window_key_callback callback)
{
	if (window->key_callback == NULL)
		window->previous_key_callback = glfwSetKeyCallback(window->handle, __CGL_window_key_callback);
	window->key_callback = callback;
}

// set mouse button callback
CGL_void CGL_window_set_mouse_button_callback(CGL_window* window, CGL_window_mouse_button_callback callback)
{
	if (window->mouse_button_callback == NULL)
		window->previous_mouse_button_callback = glfwSetMouseButtonCallback(window->handle, __CGL_window_mouse_button_callback);
	window->mouse_button_callback = callback;
}

// set mouse position callback
CGL_void CGL_window_set_mouse_position_callback(CGL_window* window, CGL_window_mouse_position_callback callback)
{
	if (window->mouse_position_callback == NULL)
		window->previous_mouse_position_callback = glfwSetCursorPosCallback(window->handle, __CGL_window_mouse_position_callback);
	window->mouse_position_callback = callback;
}

// set mouse scroll callback
CGL_void CGL_window_set_mouse_scroll_callback(CGL_window* window, CGL_window_mouse_scroll_callback callback)
{
	if (window->mouse_scroll_callback == NULL)
		window->previous_mouse_scroll_callback = glfwSetScrollCallback(window->handle, __CGL_window_mouse_scroll_callback);
	window->mouse_scroll_callback = callback;
}

// set framebuffer size callback
CGL_void CGL_window_set_framebuffer_size_callback(CGL_window* window, CGL_window_framebuffer_size_callback callback)
{
	if (window->framebuffer_size_callback == NULL)
		window->previous_framebuffer_size_callback = glfwSetFramebufferSizeCallback(window->handle, __CGL_window_framebuffer_size_callback);
	window->framebuffer_size_callback = callback;
}

// set close callback
CGL_void CGL_window_set_close_callback(CGL_window* window, CGL_window_close_callback callback)
{
	if (window->close_callback == NULL)
		window->previous_close_callback = glfwSetWindowCloseCallback(window->handle, __CGL_window_close_callback);
	window->close_callback = callback;
}

CGL_void CGL_window_set_drag_n_drop_callback(CGL_window* window, CGL_window_drag_n_drop_callback callback) // set drag and drop callback
{
	if (window->drag_n_drop_callback == NULL)
		window->previous_drag_n_drop_callback = glfwSetDropCallback(window->handle, __CGL_window_drag_n_drop_callback);
	window->drag_n_drop_callback = callback;
}


CGL_void CGL_window_resecure_callbacks(CGL_window* window)
{
	if (window->key_callback != NULL)
	{
		window->previous_key_callback = glfwSetKeyCallback(window->handle, __CGL_window_key_callback);
		if (window->previous_key_callback == __CGL_window_key_callback) window->previous_key_callback = NULL;
	}

	if (window->mouse_button_callback != NULL)
	{
		window->previous_mouse_button_callback = glfwSetMouseButtonCallback(window->handle, __CGL_window_mouse_button_callback);
		if (window->previous_mouse_button_callback == __CGL_window_mouse_button_callback) window->previous_mouse_button_callback = NULL;
	}

	if (window->mouse_position_callback != NULL)
	{
		window->previous_mouse_position_callback = glfwSetCursorPosCallback(window->handle, __CGL_window_mouse_position_callback);
		if (window->previous_mouse_position_callback == __CGL_window_mouse_position_callback) window->previous_mouse_position_callback = NULL;
	}

	if (window->mouse_scroll_callback != NULL)
	{
		window->previous_mouse_scroll_callback = glfwSetScrollCallback(window->handle, __CGL_window_mouse_scroll_callback);
		if (window->previous_mouse_scroll_callback == __CGL_window_mouse_scroll_callback) window->previous_mouse_scroll_callback = NULL;
	}

	if (window->framebuffer_size_callback != NULL)
	{
		window->previous_framebuffer_size_callback = glfwSetFramebufferSizeCallback(window->handle, __CGL_window_framebuffer_size_callback);
		if (window->previous_framebuffer_size_callback == __CGL_window_framebuffer_size_callback) window->previous_framebuffer_size_callback = NULL;
	}

	if (window->close_callback != NULL)
	{
		window->previous_close_callback = glfwSetWindowCloseCallback(window->handle, __CGL_window_close_callback);
		if (window->previous_close_callback == __CGL_window_close_callback) window->previous_close_callback = NULL;
	}

	if (window->drag_n_drop_callback != NULL)
	{
		window->previous_drag_n_drop_callback = glfwSetDropCallback(window->handle, __CGL_window_drag_n_drop_callback);
		if (window->previous_drag_n_drop_callback == __CGL_window_drag_n_drop_callback) window->previous_drag_n_drop_callback = NULL;
	}
}

// get key state
CGL_int CGL_window_get_key(CGL_window* window, CGL_int key)
{
	return glfwGetKey(window->handle, key);
}

// check if key is pressed
CGL_bool CGL_window_is_key_pressed(CGL_window* window, CGL_int key)
{
	return glfwGetKey(window->handle, key) == GLFW_PRESS;
}

// get mouse button state
CGL_int CGL_window_get_mouse_button(CGL_window* window, CGL_int button)
{
	return glfwGetMouseButton(window->handle, button);
}

// get mouse position
CGL_void CGL_window_get_mouse_position(CGL_window* window, double* xpos, double* ypos)
{
	glfwGetCursorPos(window->handle, xpos, ypos);
}

// make opengl context current
CGL_void CGL_window_make_context_current(CGL_window* window)
{
	glfwMakeContextCurrent(window->handle);
}

struct GLFWwindow* CGL_window_get_glfw_handle(CGL_window* window)
{
	return window->handle;
}

#endif

#endif

// opengl 
#if 1 // Just to use code folding

#ifndef CGL_EXCLUDE_GRAPHICS_API

// texture

struct CGL_texture
{
	GLuint handle;
	CGL_int width;
	CGL_int height;
	CGL_int depth;
	GLenum format;
	GLenum internal_format;
	GLenum type;
	GLenum target;
	void* user_data;
};

// create texture
CGL_texture* CGL_texture_create(CGL_image* image)
{
	GLenum format, internal_format, type;
	if (image->channels == 3)
		format = GL_RGB;
	else if (image->channels == 4)
		format = GL_RGBA;
	else
	{
		CGL_error("Invalid channel count for image\n"); return NULL;
	}
	if (image->bytes_per_channel == 8)
		type = GL_UNSIGNED_BYTE;
	else if (image->bytes_per_channel == 16)
		type = GL_UNSIGNED_SHORT;
	else if (image->bytes_per_channel == 32)
		type = GL_FLOAT;
	else
	{
		CGL_error("Invalid bit depth for image\n"); return NULL;
	}
	// determine internal format
	if (format == GL_RGB && type == GL_UNSIGNED_BYTE) internal_format = GL_RGB8;
	else if (format == GL_RGB && type == GL_UNSIGNED_SHORT) internal_format = GL_RGB16;
	else if (format == GL_RGB && type == GL_FLOAT) internal_format = GL_RGB32F;
	else if (format == GL_RGBA && type == GL_UNSIGNED_BYTE) internal_format = GL_RGBA8;
	else if (format == GL_RGBA && type == GL_UNSIGNED_SHORT) internal_format = GL_RGBA16;
	else if (format == GL_RGBA && type == GL_FLOAT) internal_format = GL_RGBA32F;
	else { CGL_error("Invalid format for image\n"); return NULL; }
	CGL_texture* texture = (CGL_texture*)CGL_malloc(sizeof(CGL_texture));
	texture->width = image->width;
	texture->height = image->height;
	texture->depth = 0;
	texture->format = format;
	texture->internal_format = internal_format;
	texture->type = type;
	texture->target = GL_TEXTURE_2D;
	texture->user_data = NULL;
	glGenTextures(1, &texture->handle);
	glBindTexture(texture->target, texture->handle);
	glPixelStorei(GL_UNPACK_ALIGNMENT, 1);
	glTexImage2D(texture->target, 0, internal_format, image->width, image->height, 0, format, type, image->data);
	glTexParameteri(texture->target, GL_TEXTURE_MIN_FILTER, GL_LINEAR);
	glTexParameteri(texture->target, GL_TEXTURE_MAG_FILTER, GL_LINEAR);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_S, GL_REPEAT);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_T, GL_REPEAT);
	glBindTexture(texture->target, 0);
	return texture;
}

// create texture
CGL_texture* CGL_texture_create_blank(CGL_int width, CGL_int height, GLenum format, GLenum internal_format, GLenum type)
{
	CGL_texture* texture = (CGL_texture*)CGL_malloc(sizeof(CGL_texture));
	texture->width = width;
	texture->height = height;
	texture->depth = 0;
	texture->format = format;
	texture->internal_format = internal_format;
	texture->type = type;
	texture->target = GL_TEXTURE_2D;
	texture->user_data = NULL;
	glGenTextures(1, &texture->handle);
	glBindTexture(texture->target, texture->handle);
	glTexImage2D(texture->target, 0, internal_format, width, height, 0, format, type, NULL);
	glTexParameteri(texture->target, GL_TEXTURE_MIN_FILTER, GL_LINEAR);
	glTexParameteri(texture->target, GL_TEXTURE_MAG_FILTER, GL_LINEAR);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_S, GL_REPEAT);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_T, GL_REPEAT);
#ifndef CGL_WASM
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_R, GL_REPEAT);
#endif
	glBindTexture(texture->target, 0);
	return texture;
}

CGL_texture* CGL_texture_create_cubemap()
{
	CGL_texture* texture = (CGL_texture*)CGL_malloc(sizeof(CGL_texture));
	texture->width = 0;
	texture->height = 0;
	texture->depth = 0;
	texture->target = GL_TEXTURE_CUBE_MAP;
	texture->user_data = NULL;
	glGenTextures(1, &texture->handle);
	glBindTexture(texture->target, texture->handle);
	glPixelStorei(GL_PACK_ALIGNMENT, 1);
	glPixelStorei(GL_UNPACK_ALIGNMENT, 1);
	glTexParameteri(texture->target, GL_TEXTURE_MIN_FILTER, GL_LINEAR);
	glTexParameteri(texture->target, GL_TEXTURE_MAG_FILTER, GL_LINEAR);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE);
#ifndef CGL_WASM
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_R, GL_CLAMP_TO_EDGE);
#endif
	glBindTexture(texture->target, 0);
	return texture;
}

CGL_texture* CGL_texture_create_3d(CGL_int width, CGL_int height, CGL_int depth, GLenum format, GLenum internal_format, GLenum type)
{
	CGL_texture* texture = (CGL_texture*)CGL_malloc(sizeof(CGL_texture));
	texture->width = width;
	texture->height = height;
	texture->depth = depth;
	texture->format = format;
	texture->internal_format = internal_format;
	texture->type = type;
	texture->target = GL_TEXTURE_3D;
	texture->user_data = NULL;
	glGenTextures(1, &texture->handle);
	glBindTexture(texture->target, texture->handle);
	glTexImage3D(texture->target, 0, texture->internal_format, width, height, depth, 0, texture->format, texture->type, NULL);
	glTexParameteri(texture->target, GL_TEXTURE_MIN_FILTER, GL_LINEAR);
	glTexParameteri(texture->target, GL_TEXTURE_MAG_FILTER, GL_LINEAR);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_S, GL_REPEAT);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_T, GL_REPEAT);
#ifndef CGL_WASM
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_R, GL_REPEAT);
#endif
	glBindTexture(texture->target, 0);
	return texture;
}

CGL_texture* CGL_texture_create_array(CGL_int width, CGL_int height, CGL_int layers, GLenum format, GLenum internal_format, GLenum type)
{
	CGL_texture* texture = (CGL_texture*)CGL_malloc(sizeof(CGL_texture));
	texture->width = width;
	texture->height = height;
	texture->depth = layers;
	texture->format = format;
	texture->internal_format = internal_format;
	texture->type = type;
	texture->target = GL_TEXTURE_2D_ARRAY;
	texture->user_data = NULL;
	glGenTextures(1, &texture->handle);
	glBindTexture(texture->target, texture->handle);
	glTexImage3D(texture->target, 0, texture->internal_format, width, height, layers, 0, texture->format, texture->type, NULL);
	glTexParameteri(texture->target, GL_TEXTURE_MIN_FILTER, GL_LINEAR);
	glTexParameteri(texture->target, GL_TEXTURE_MAG_FILTER, GL_LINEAR);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_S, GL_REPEAT);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_T, GL_REPEAT);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_R, GL_REPEAT);
	glBindTexture(texture->target, 0);
	return texture;
}

CGL_void CGL_texture_cubemap_set_face(CGL_texture* texture, CGL_int face, CGL_image* image)
{
	GLenum format, internal_format, type;
	if (image->channels == 3)
		format = internal_format = GL_RGB;
	else if (image->channels == 4)
		format = internal_format = GL_RGBA;
	else
	{
		printf("Invalid channel count for image\n"); return;
	}
	if (image->bytes_per_channel == 8)
		type = GL_UNSIGNED_BYTE;
	else if (image->bytes_per_channel == 16)
		type = GL_UNSIGNED_SHORT;
	else if (image->bytes_per_channel == 32)
		type = GL_FLOAT;
	else
	{
		printf("Invalid bit depth for image\n"); return;
	}
	glBindTexture(texture->target, texture->handle);
	glPixelStorei(GL_PACK_ALIGNMENT, 1);
	glPixelStorei(GL_UNPACK_ALIGNMENT, 1);
	glTexImage2D(face, 0, internal_format, image->width, image->height, 0, format, type, image->data);
	glBindTexture(texture->target, 0);
}

CGL_void CGL_texture_array_set_layer_data(CGL_texture* texture, CGL_int layer, void* data)
{
	glBindTexture(texture->target, texture->handle);
	glPixelStorei(GL_PACK_ALIGNMENT, 1);
	glPixelStorei(GL_UNPACK_ALIGNMENT, 1);
	glTexSubImage3D(texture->target, 0, 0, 0, layer, texture->width, texture->height, 1, texture->format, texture->type, data);
	glBindTexture(texture->target, 0);
}

CGL_void CGL_texture_set_scaling_method(CGL_texture* texture, GLint method)
{
	glBindTexture(texture->target, texture->handle);
	glTexParameteri(texture->target, GL_TEXTURE_MIN_FILTER, method);
	glTexParameteri(texture->target, GL_TEXTURE_MAG_FILTER, method);
}

CGL_void CGL_texture_set_wrapping_method(CGL_texture* texture, GLint method)
{
	glBindTexture(texture->target, texture->handle);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_S, method);
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_T, method);
#ifndef CGL_WASM
	glTexParameteri(texture->target, GL_TEXTURE_WRAP_R, method);
#endif
}

// destroy texture
CGL_void CGL_texture_destroy(CGL_texture* texture)
{
	glDeleteTextures(1, &texture->handle);
	CGL_free(texture);
}

// bind texture to unit
CGL_int CGL_texture_bind(CGL_texture* texture, CGL_int unit)
{
	glActiveTexture(GL_TEXTURE0 + unit);
	glBindTexture(texture->target, texture->handle);
	return unit;
}

// set texture data
CGL_void CGL_texture_set_data(CGL_texture* texture, void* data)
{
	glBindTexture(texture->target, texture->handle);
	glPixelStorei(GL_PACK_ALIGNMENT, 1);
	glPixelStorei(GL_UNPACK_ALIGNMENT, 1);
	glTexImage2D(texture->target, 0, texture->internal_format, texture->width, texture->height, 0, texture->format, texture->type, data);
	glBindTexture(texture->target, 0);
}

CGL_void CGL_texture_set_sub_data(CGL_texture* texture, size_t offset_x, size_t offset_y, size_t size_x, size_t size_y, void* data) // set texture sub data
{
	glBindTexture(texture->target, texture->handle);
	glPixelStorei(GL_PACK_ALIGNMENT, 1);
	glPixelStorei(GL_UNPACK_ALIGNMENT, 1);
	glTexSubImage2D(texture->target, 0, (GLint)offset_x, (GLint)offset_y, (GLsizei)size_x, (GLsizei)size_y, texture->format, texture->type, data);
	glBindTexture(texture->target, 0);
}

CGL_void CGL_texture_set_pixel_data(CGL_texture* texture, int x, int y, void* data)
{
	glBindTexture(texture->target, texture->handle);
	glPixelStorei(GL_PACK_ALIGNMENT, 1);
	glPixelStorei(GL_UNPACK_ALIGNMENT, 1);
	glTexSubImage2D(texture->target, 0, (GLint)x, (GLint)y, (GLsizei)1, (GLsizei)1, texture->format, texture->type, data);
	glBindTexture(texture->target, 0);
}

// set texture user data
CGL_void CGL_texture_set_user_data(CGL_texture* texture, void* user_data)
{
	texture->user_data = user_data;
}

// get texture user data
CGL_void* CGL_texture_get_user_data(CGL_texture* texture)
{
	return texture->user_data;
}

CGL_uint CGL_texture_get_internal_handle(CGL_texture* texture)
{
	return (CGL_uint)texture->handle;
}

// get texture size
CGL_void CGL_texture_get_size(CGL_texture* texture, CGL_int* width, CGL_int* height)
{
	if (width)   *width = texture->width;
	if (height)  *height = texture->height;
}

// framebuffer
struct CGL_framebuffer
{
	CGL_texture* mousepick_texture[3];
	CGL_texture* color_attachments[4];
	CGL_texture* color_texture;
	CGL_texture* depth_texture;
	void* user_data;
	GLuint handle;
	CGL_int width;
	CGL_int height;
	CGL_int color_attachment_count;
	bool is_default;
};

// create framebuffer (32 bit)
CGL_framebuffer* CGL_framebuffer_create(CGL_int width, CGL_int height)
{
	CGL_framebuffer* framebuffer = (CGL_framebuffer*)CGL_malloc(sizeof(CGL_framebuffer));
	if (framebuffer == NULL) return NULL;

	framebuffer->color_attachment_count = 0;

	glGenFramebuffers(1, &framebuffer->handle);
	glBindFramebuffer(GL_FRAMEBUFFER, framebuffer->handle);

	// create the textures
	framebuffer->color_texture = CGL_texture_create_blank(width, height, GL_RGBA, GL_RGBA32F, GL_FLOAT);
	if (!framebuffer->color_texture)
	{
		free(framebuffer);
		return NULL;
	}


#ifdef CGL_WASM
	framebuffer->depth_texture = CGL_texture_create_blank(width, height, GL_DEPTH_COMPONENT, GL_DEPTH_COMPONENT24, GL_UNSIGNED_INT);
#else
	framebuffer->depth_texture = CGL_texture_create_blank(width, height, GL_DEPTH_COMPONENT, GL_DEPTH24_STENCIL8, GL_FLOAT);
#endif
	if (!framebuffer->depth_texture)
	{
		CGL_texture_destroy(framebuffer->color_texture);
		free(framebuffer);
		return NULL;
	}

	for (CGL_int i = 0; i < 3; i++)
	{
		framebuffer->mousepick_texture[i] = CGL_texture_create_blank(width, height, GL_RED_INTEGER, GL_R32I, GL_INT);
		if (!framebuffer->mousepick_texture[i])
		{
			CGL_texture_destroy(framebuffer->color_texture);
			CGL_texture_destroy(framebuffer->depth_texture);
			for (CGL_int j = 0; j < i; j++)
				CGL_texture_destroy(framebuffer->mousepick_texture[j]);
			free(framebuffer);
			return NULL;
		}
	}

	// attach the textures
	glFramebufferTexture2D(GL_FRAMEBUFFER, GL_COLOR_ATTACHMENT0, GL_TEXTURE_2D, framebuffer->color_texture->handle, 0);
	glFramebufferTexture2D(GL_FRAMEBUFFER, GL_DEPTH_ATTACHMENT, GL_TEXTURE_2D, framebuffer->depth_texture->handle, 0);
	glFramebufferTexture2D(GL_FRAMEBUFFER, GL_COLOR_ATTACHMENT1, GL_TEXTURE_2D, framebuffer->mousepick_texture[0]->handle, 0);
	glFramebufferTexture2D(GL_FRAMEBUFFER, GL_COLOR_ATTACHMENT2, GL_TEXTURE_2D, framebuffer->mousepick_texture[1]->handle, 0);
	glFramebufferTexture2D(GL_FRAMEBUFFER, GL_COLOR_ATTACHMENT3, GL_TEXTURE_2D, framebuffer->mousepick_texture[2]->handle, 0);

	GLenum buffers[4] = { GL_COLOR_ATTACHMENT0, GL_COLOR_ATTACHMENT1, GL_COLOR_ATTACHMENT2, GL_COLOR_ATTACHMENT3 };
	glDrawBuffers(4, buffers);


	// check if framebuffer is complete
	CGL_int res = 0;
	if ((res = glCheckFramebufferStatus(GL_FRAMEBUFFER)) != GL_FRAMEBUFFER_COMPLETE)
	{
		CGL_texture_destroy(framebuffer->color_texture);
		CGL_texture_destroy(framebuffer->depth_texture);
		for (CGL_int i = 0; i < 3; i++)
			CGL_texture_destroy(framebuffer->mousepick_texture[i]);
		free(framebuffer);
		CGL_log_internal("Framebuffer is not complete: %d\n", res);
		// get and print opengl error
		GLenum error = glGetError();
		if (error != GL_NO_ERROR)
			CGL_log_internal("OpenGL error: %d\n", (error));
		return NULL;
	}

	glBindFramebuffer(GL_FRAMEBUFFER, 0);

	framebuffer->width = width;
	framebuffer->height = height;
	framebuffer->is_default = false;
	framebuffer->user_data = NULL;

	return framebuffer;
}

CGL_framebuffer* CGL_framebuffer_create_basic(CGL_int width, CGL_int height)
{
	CGL_framebuffer* framebuffer = (CGL_framebuffer*)CGL_malloc(sizeof(CGL_framebuffer));
	if (framebuffer == NULL) return NULL;
	framebuffer->color_attachment_count = 1;
	glGenFramebuffers(1, &framebuffer->handle);
	glBindFramebuffer(GL_FRAMEBUFFER, framebuffer->handle);
	// create the textures
	framebuffer->color_texture = CGL_texture_create_blank(width, height, GL_RGBA, GL_RGBA32F, GL_FLOAT);
	if (!framebuffer->color_texture)
	{
		CGL_free(framebuffer);
		return NULL;
	}
	framebuffer->color_attachments[0] = framebuffer->color_texture;

#ifdef CGL_WASM
	framebuffer->depth_texture = CGL_texture_create_blank(width, height, GL_DEPTH_COMPONENT, GL_DEPTH_COMPONENT24, GL_UNSIGNED_INT);
#else
	framebuffer->depth_texture = CGL_texture_create_blank(width, height, GL_DEPTH_COMPONENT, GL_DEPTH24_STENCIL8, GL_FLOAT);
#endif
	if (!framebuffer->depth_texture)
	{
		CGL_texture_destroy(framebuffer->color_texture);
		CGL_free(framebuffer);
		return NULL;
	}

	// attach the textures
	glFramebufferTexture2D(GL_FRAMEBUFFER, GL_COLOR_ATTACHMENT0, GL_TEXTURE_2D, framebuffer->color_texture->handle, 0);
	glFramebufferTexture2D(GL_FRAMEBUFFER, GL_DEPTH_ATTACHMENT, GL_TEXTURE_2D, framebuffer->depth_texture->handle, 0);

	GLenum buffers[1] = { GL_COLOR_ATTACHMENT0 };
	glDrawBuffers(1, buffers);


	// check if framebuffer is complete
	CGL_int res = 0;
	if ((res = glCheckFramebufferStatus(GL_FRAMEBUFFER)) != GL_FRAMEBUFFER_COMPLETE)
	{
		CGL_texture_destroy(framebuffer->color_texture);
		CGL_texture_destroy(framebuffer->depth_texture);
		free(framebuffer);
		CGL_log_internal("Framebuffer is not complete: %d\n", res);
		// get and print opengl error
		GLenum error = glGetError();
		if (error != GL_NO_ERROR) CGL_log_internal("OpenGL error: %d\n", (error));
		return NULL;
	}

	glBindFramebuffer(GL_FRAMEBUFFER, 0);

	framebuffer->width = width;
	framebuffer->height = height;
	framebuffer->is_default = false;
	framebuffer->user_data = NULL;

	return framebuffer;

}

CGL_void CGL_framebuffer_add_color_attachment(CGL_framebuffer* framebuffer, CGL_texture* texture)
{
	if (framebuffer->is_default)
	{
		CGL_log_internal("Cannot add color attachment to default framebuffer\n");
		return;
	}

	if (framebuffer->color_attachment_count >= 8)
	{
		CGL_log_internal("Framebuffer already has 4 color attachments\n");
		return;
	}

	if (framebuffer->color_attachment_count == 0)
	{
		CGL_log_internal("This type of framebuffer cannot have a custom color attachment");
		return;
	}

	framebuffer->color_attachments[framebuffer->color_attachment_count++] = texture;

	glBindFramebuffer(GL_FRAMEBUFFER, framebuffer->handle);
	glFramebufferTexture2D(GL_FRAMEBUFFER, GL_COLOR_ATTACHMENT0 + framebuffer->color_attachment_count - 1, GL_TEXTURE_2D, texture->handle, 0);
	glBindFramebuffer(GL_FRAMEBUFFER, 0);

	GLenum buffers[8] = { GL_COLOR_ATTACHMENT0, GL_COLOR_ATTACHMENT1, GL_COLOR_ATTACHMENT2, GL_COLOR_ATTACHMENT3, GL_COLOR_ATTACHMENT4, GL_COLOR_ATTACHMENT5, GL_COLOR_ATTACHMENT6, GL_COLOR_ATTACHMENT7 };
	glDrawBuffers(framebuffer->color_attachment_count, buffers);

	// check if framebuffer is complete
	if (glCheckFramebufferStatus(GL_FRAMEBUFFER) != GL_FRAMEBUFFER_COMPLETE)
	{
		CGL_texture_destroy(framebuffer->color_texture);
		CGL_texture_destroy(framebuffer->depth_texture);
		for (CGL_int i = 0; i < 3; i++)
			CGL_texture_destroy(framebuffer->mousepick_texture[i]);
		free(framebuffer);
		CGL_log_internal("Framebuffer is not complete\n");
		// get and print opengl error
		GLenum error = glGetError();
		if (error != GL_NO_ERROR)
			CGL_log_internal("OpenGL error: %d\n", (error));
		return;
	}
}

CGL_texture* CGL_framebuffer_get_color_attachment(CGL_framebuffer* framebuffer, CGL_int index)
{
	if (index >= framebuffer->color_attachment_count)
	{
		CGL_log_internal("Framebuffer does not have a color attachment at index %d\n", index);
		return NULL;
	}
	return framebuffer->color_attachments[index];
}

#ifndef CGL_EXCLUDE_WINDOW_API
// create framebuffer from default framebuffer
CGL_framebuffer* CGL_framebuffer_create_from_default(CGL_window* window)
{
	CGL_framebuffer* framebuffer = (CGL_framebuffer*)malloc(sizeof(CGL_framebuffer));
	if (framebuffer == NULL) return NULL;
	framebuffer->handle = 0;
	framebuffer->color_attachment_count = 0;
	framebuffer->is_default = true;
	framebuffer->user_data = window;
	return framebuffer;
}
#endif

// destroy framebuffer
CGL_void CGL_framebuffer_destroy(CGL_framebuffer* framebuffer)
{
	if (!framebuffer->is_default)
	{
		if (framebuffer->color_attachment_count == 0)
		{
			CGL_texture_destroy(framebuffer->color_texture);
			for (CGL_int i = 0; i < 3; i++) CGL_texture_destroy(framebuffer->mousepick_texture[i]);
		}
		else for (CGL_int i = 0; i < framebuffer->color_attachment_count; i++) CGL_texture_destroy(framebuffer->color_attachments[i]);
		CGL_texture_destroy(framebuffer->depth_texture);
		glDeleteFramebuffers(1, &framebuffer->handle);
	}
	free(framebuffer);
}

// bind framebuffer
CGL_void CGL_framebuffer_bind(CGL_framebuffer* framebuffer)
{
	if (framebuffer->is_default)
	{
		CGL_int width = 512, height = 512;
		CGL_window_get_size((CGL_window*)framebuffer->user_data, &width, &height);
		glViewport(0, 0, width, height);
		glBindFramebuffer(GL_FRAMEBUFFER, 0);
	}
	else
	{
		glBindFramebuffer(GL_FRAMEBUFFER, framebuffer->handle);
		glViewport(0, 0, framebuffer->width, framebuffer->height);
		if (framebuffer->color_attachment_count > 0)
		{
			GLenum buffers[8] = { GL_COLOR_ATTACHMENT0, GL_COLOR_ATTACHMENT1, GL_COLOR_ATTACHMENT2, GL_COLOR_ATTACHMENT3, GL_COLOR_ATTACHMENT4, GL_COLOR_ATTACHMENT5, GL_COLOR_ATTACHMENT6, GL_COLOR_ATTACHMENT7 };
			glDrawBuffers(framebuffer->color_attachment_count, buffers);
		}
	}
}

// get framebuffer size
CGL_void CGL_framebuffer_get_size(CGL_framebuffer* framebuffer, CGL_int* width, CGL_int* height)
{
	if (framebuffer->is_default)
	{
		CGL_int w = 0, h = 0;
#ifdef CGL_WASM
		// TODO
#else
		CGL_window_get_framebuffer_size((CGL_window*)framebuffer->user_data, &w, &h);
#endif
		if (width)   *width = w;
		if (height)  *height = h;
	}
	else
	{
		if (width)   *width = framebuffer->width;
		if (height)  *height = framebuffer->height;
	}
}

// set framebuffer user data
CGL_void CGL_framebuffer_set_user_data(CGL_framebuffer* framebuffer, void* user_data)
{
	if (!framebuffer->is_default) framebuffer->user_data = user_data;
}

// get framebuffer user data
CGL_void* CGL_framebuffer_get_user_data(CGL_framebuffer* framebuffer)
{
	if (!framebuffer->is_default) return framebuffer->user_data;
	return NULL;
}

// read pixels from framebuffer
CGL_void CGL_framebuffer_read_pixels(CGL_framebuffer* framebuffer, CGL_int x, CGL_int y, CGL_int width, CGL_int height, void* pixels)
{
	if (framebuffer->color_attachment_count != 0) return;
	if (framebuffer->is_default) return;
	glBindFramebuffer(GL_FRAMEBUFFER, framebuffer->handle);
	glReadPixels(x, y, width, height, framebuffer->color_texture->format, framebuffer->color_texture->type, pixels);
	glBindFramebuffer(GL_FRAMEBUFFER, 0);
}

// get mouse pick id
CGL_int CGL_framebuffer_get_mouse_pick_id(CGL_framebuffer* framebuffer, CGL_int x, CGL_int y, CGL_int index)
{
	if (framebuffer->color_attachment_count != 0) return 0;
	if (index >= 3) return -1;
	if (framebuffer->is_default) return 0;
	CGL_int id = 0;
	glBindFramebuffer(GL_FRAMEBUFFER, framebuffer->handle);
	glReadBuffer(GL_COLOR_ATTACHMENT0 + 1 + index);
	glReadPixels(x, framebuffer->height - y, 1, 1, GL_RED_INTEGER, GL_INT, &id);
	glBindFramebuffer(GL_FRAMEBUFFER, 0);
	return id;
}

// get color texture
CGL_texture* CGL_framebuffer_get_color_texture(CGL_framebuffer* framebuffer)
{
	if (framebuffer->is_default) return NULL;
	return framebuffer->color_texture;
}

// get depth texture
CGL_texture* CGL_framebuffer_get_depth_texture(CGL_framebuffer* framebuffer)
{
	if (framebuffer->is_default)
		return NULL;
	return framebuffer->depth_texture;
}

// ssbo
struct CGL_ssbo
{
	GLuint handle;
	size_t size;
	CGL_int binding;
	void* user_data;
};

// create ssbo
CGL_ssbo* CGL_ssbo_create(uint32_t binding)
{
	CGL_ssbo* ssbo = (CGL_ssbo*)malloc(sizeof(CGL_ssbo));
	if (ssbo == NULL)
		return NULL;
	glGenBuffers(1, &ssbo->handle);
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, ssbo->handle);
	glBindBufferBase(GL_SHADER_STORAGE_BUFFER, binding, ssbo->handle);
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, 0);
	ssbo->binding = binding;
	ssbo->user_data = NULL;
	ssbo->size = 0;
	return ssbo;
}

// destroy ssbo
CGL_void CGL_ssbo_destroy(CGL_ssbo* ssbo)
{
	glDeleteBuffers(1, &ssbo->handle);
	free(ssbo);
}

// bind ssbo
CGL_void CGL_ssbo_bind(CGL_ssbo* ssbo)
{
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, ssbo->handle);
}

CGL_void CGL_ssbo_bind2(CGL_ssbo* ssbo, uint32_t binding)
{
	glBindBufferBase(GL_SHADER_STORAGE_BUFFER, binding, ssbo->handle);
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, ssbo->handle);
}

// set ssbo data
CGL_void CGL_ssbo_set_data(CGL_ssbo* ssbo, size_t size, void* data, bool static_draw)
{
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, ssbo->handle);
	glBufferData(GL_SHADER_STORAGE_BUFFER, size, data, static_draw ? GL_STATIC_DRAW : GL_DYNAMIC_DRAW);
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, 0);
	ssbo->size = size;
}

// set ssbo sub data
CGL_void CGL_ssbo_set_sub_data(CGL_ssbo* ssbo, size_t offset, size_t size, void* data, bool static_draw)
{
	(void)static_draw;
	if (offset + size > ssbo->size)
	{
		CGL_log_internal("CGL_ssbo_set_sub_data: offset + size > ssbo->size");
		return;
	}
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, ssbo->handle);
	glBufferSubData(GL_SHADER_STORAGE_BUFFER, offset, size, data);
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, 0);
}

// get ssbo data
CGL_void CGL_ssbo_get_data(CGL_ssbo* ssbo, size_t* size, void* data)
{
	if (size)
		*size = ssbo->size;
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, ssbo->handle);
	glGetBufferSubData(GL_SHADER_STORAGE_BUFFER, 0, ssbo->size, data);
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, 0);
}

// get ssbo sub data
CGL_void CGL_ssbo_get_sub_data(CGL_ssbo* ssbo, size_t offset, size_t size, void* data)
{
	if (offset + size > ssbo->size)
	{
		CGL_log_internal("CGL_ssbo_get_sub_data: offset + size > ssbo->size");
		return;
	}
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, ssbo->handle);
	glGetBufferSubData(GL_SHADER_STORAGE_BUFFER, offset, size, data);
	glBindBuffer(GL_SHADER_STORAGE_BUFFER, 0);
}

// set ssbo user data
CGL_void CGL_ssbo_set_user_data(CGL_ssbo* ssbo, void* user_data)
{
	ssbo->user_data = user_data;
}

// get ssbo user data
CGL_void* CGL_ssbo_get_user_data(CGL_ssbo* ssbo)
{
	return ssbo->user_data;
}

// get ssbo size
size_t CGL_ssbo_get_size(CGL_ssbo* ssbo)
{
	return ssbo->size;
}

// copy ssbo
CGL_void CGL_ssbo_copy(CGL_ssbo* dst, CGL_ssbo* src, size_t src_offset, size_t dst_offset, size_t size)
{
	if (dst_offset + size > dst->size)
	{
		CGL_log_internal("CGL_ssbo_copy: dst_offset + size > dst->size");
		return;
	}
	if (src_offset + size > src->size)
	{
		CGL_log_internal("CGL_ssbo_copy: src_offset + size > src->size");
		return;
	}

	// NOT Supported!
	// glBindBuffer(GL_SHADER_STORAGE_BUFFER, dst->handle);
	// glCopyNamedBufferSubData(src->handle, dst->handle, src_offset, dst_offset, size);
	// glBindBuffer(GL_SHADER_STORAGE_BUFFER, 0);

	// Copying data via glCopyBufferSubData 
	glBindBuffer(GL_COPY_READ_BUFFER, src->handle);
	glBindBuffer(GL_COPY_WRITE_BUFFER, dst->handle);
	glCopyBufferSubData(GL_COPY_READ_BUFFER, GL_COPY_WRITE_BUFFER, src_offset, dst_offset, size);
	glBindBuffer(GL_COPY_READ_BUFFER, 0);
	glBindBuffer(GL_COPY_WRITE_BUFFER, 0);

}



struct CGL_shader
{
	GLuint handle;
	void* user_data;
};

struct CGL_ubo
{
	CGL_sizei size;
	CGL_uint handle;
	CGL_uint binding;
	void* user_data;
};

CGL_ubo* CGL_ubo_create()
{
	CGL_ubo* ubo = (CGL_ubo*)CGL_malloc(sizeof(CGL_ubo));
	if (ubo == NULL) return NULL;
	glGenBuffers(1, &ubo->handle);
	ubo->size = 0;
	return ubo;
}

CGL_void CGL_ubo_destroy(CGL_ubo* ubo)
{
	glDeleteBuffers(1, &ubo->handle);
	CGL_free(ubo);
}

CGL_void CGL_ubo_bind(CGL_ubo* ubo, CGL_shader* shader, const CGL_byte* name, uint32_t binding)
{
	CGL_uint index = glGetUniformBlockIndex(shader->handle, name);
	if (index == GL_INVALID_INDEX) { CGL_log_internal("CGL_ubo_bind: glGetUniformBlockIndex failed"); return; }
	glUniformBlockBinding(shader->handle, index, binding);
	glBindBufferBase(GL_UNIFORM_BUFFER, binding, ubo->handle);
	ubo->binding = binding;
}

CGL_void CGL_ubo_set_data(CGL_ubo* ubo, size_t size, void* data, bool static_draw)
{
	glBindBuffer(GL_UNIFORM_BUFFER, ubo->handle);
	glBufferData(GL_UNIFORM_BUFFER, size, data, static_draw ? GL_STATIC_DRAW : GL_DYNAMIC_DRAW);
	glBindBuffer(GL_UNIFORM_BUFFER, 0);
	ubo->size = size;
}

CGL_void CGL_ubo_set_sub_data(CGL_ubo* ubo, size_t offset, size_t size, void* data, bool static_draw)
{
	(void)static_draw;
	if (offset + size > ubo->size) { CGL_log_internal("CGL_ubo_set_sub_data: offset + size > ubo->size"); return; }
	glBindBuffer(GL_UNIFORM_BUFFER, ubo->handle);
	glBufferSubData(GL_UNIFORM_BUFFER, offset, size, data);
	glBindBuffer(GL_UNIFORM_BUFFER, 0);
	ubo->size = CGL_utils_max(ubo->size, offset + size);
}

CGL_void CGL_ubo_get_data(CGL_ubo* ubo, size_t* size, void* data)
{
	if (size) *size = ubo->size;
	glBindBuffer(GL_UNIFORM_BUFFER, ubo->handle);
	glGetBufferSubData(GL_UNIFORM_BUFFER, 0, ubo->size, data);
	glBindBuffer(GL_UNIFORM_BUFFER, 0);
}

CGL_void CGL_ubo_get_sub_data(CGL_ubo* ubo, size_t offset, size_t size, void* data)
{
	if (offset + size > ubo->size) { CGL_log_internal("CGL_ubo_get_sub_data: offset + size > ubo->size"); return; }
	glBindBuffer(GL_UNIFORM_BUFFER, ubo->handle);
	glGetBufferSubData(GL_UNIFORM_BUFFER, offset, size, data);
	glBindBuffer(GL_UNIFORM_BUFFER, 0);
}

CGL_void CGL_ubo_set_user_data(CGL_ubo* ubo, void* user_data)
{
	ubo->user_data = user_data;
}

CGL_void* CGL_ubo_get_user_data(CGL_ubo* ubo)
{
	return ubo->user_data;
}

size_t CGL_ubo_get_size(CGL_ubo* ubo)
{
	return ubo->size;
}


// gl
// clear 
CGL_void CGL_gl_clear(CGL_float r, CGL_float g, CGL_float b, CGL_float a)
{
	glClearColor(r, g, b, a);
	glClear(GL_COLOR_BUFFER_BIT | GL_DEPTH_BUFFER_BIT);
}

static CGL_mesh_gpu* __CGL_GL_SCREEN_QUAD_MESH = NULL;

// load opengl functions
bool CGL_gl_init()
{
#ifdef CGL_WASM
	CGL_int gles_version = gladLoadGLES2Loader((GLADloadproc)glfwGetProcAddress);
	CGL_log_internal("OpenGL ES %d\n", gles_version);
	CGL_bool result = true;
#else
	CGL_bool result = gladLoadGL();
	if (!result) CGL_log_internal("Failed to load OpenGL functions");
#endif
	CGL_mesh_cpu* mesh_cpu = CGL_mesh_cpu_quad(
		CGL_vec3_init(-1.0f, -1.0f, 0.0f),
		CGL_vec3_init(1.0f, -1.0f, 0.0f),
		CGL_vec3_init(1.0f, 1.0f, 0.0f),
		CGL_vec3_init(-1.0f, 1.0f, 0.0f)
	);
	__CGL_GL_SCREEN_QUAD_MESH = CGL_mesh_gpu_create();
	CGL_mesh_gpu_upload(__CGL_GL_SCREEN_QUAD_MESH, mesh_cpu, true);
	CGL_mesh_cpu_destroy(mesh_cpu);
	return result;
}

// clean up
CGL_void CGL_gl_shutdown()
{
	CGL_mesh_gpu_destroy(__CGL_GL_SCREEN_QUAD_MESH);
}

CGL_void CGL_gl_render_screen_quad()
{
	CGL_mesh_gpu_render(__CGL_GL_SCREEN_QUAD_MESH);
}

// mesh
struct CGL_mesh_gpu
{
	GLuint vertex_array;
	GLuint vertex_buffer;
	GLuint index_buffer;
	size_t index_count;
	size_t vertex_count;
	void* user_data;
};

// create mesh (gpu)
CGL_mesh_gpu* CGL_mesh_gpu_create()
{
	CGL_mesh_gpu* mesh = (CGL_mesh_gpu*)malloc(sizeof(CGL_mesh_gpu));
	if (mesh == NULL)
		return NULL;
	glGenVertexArrays(1, &mesh->vertex_array);
	glBindVertexArray(mesh->vertex_array);
	glGenBuffers(1, &mesh->vertex_buffer);
	glBindBuffer(GL_ARRAY_BUFFER, mesh->vertex_buffer);
	glGenBuffers(1, &mesh->index_buffer);
	glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, mesh->index_buffer);
	mesh->index_count = 0;
	mesh->vertex_count = 0;
	glVertexAttribPointer(0, 4, GL_FLOAT, GL_FALSE, sizeof(CGL_mesh_vertex), (void*)offsetof(CGL_mesh_vertex, position));
	glEnableVertexAttribArray(0);
	glVertexAttribPointer(1, 4, GL_FLOAT, GL_FALSE, sizeof(CGL_mesh_vertex), (void*)offsetof(CGL_mesh_vertex, normal));
	glEnableVertexAttribArray(1);
	glVertexAttribPointer(2, 4, GL_FLOAT, GL_FALSE, sizeof(CGL_mesh_vertex), (void*)offsetof(CGL_mesh_vertex, texture_coordinates));
	glEnableVertexAttribArray(2);
	glVertexAttribPointer(3, 4, GL_FLOAT, GL_FALSE, sizeof(CGL_mesh_vertex), (void*)offsetof(CGL_mesh_vertex, bone_wieghts));
	glEnableVertexAttribArray(3);
	glVertexAttribIPointer(4, 4, GL_INT, sizeof(CGL_mesh_vertex), (void*)offsetof(CGL_mesh_vertex, bone_ids));
	glEnableVertexAttribArray(4);
	mesh->user_data = NULL;
	return mesh;
}

// destroy mesh (gpu)
CGL_void CGL_mesh_gpu_destroy(CGL_mesh_gpu* mesh)
{
	glDeleteBuffers(1, &mesh->index_buffer);
	glDeleteBuffers(1, &mesh->vertex_buffer);
	glDeleteVertexArrays(1, &mesh->vertex_array);
	free(mesh);
}

// bind mesh (gpu)
CGL_void CGL_mesh_gpu_render(CGL_mesh_gpu* mesh)
{
	if (mesh->index_count <= 0) return;
	glBindVertexArray(mesh->vertex_array);
	glDrawElements(GL_TRIANGLES, (GLsizei)mesh->index_count, GL_UNSIGNED_INT, 0);
	glBindVertexArray(0);
}

// render mesh instanfced (gpu)
CGL_void CGL_mesh_gpu_render_instanced(CGL_mesh_gpu* mesh, uint32_t count)
{
	if (mesh->index_count <= 0) return;
	glBindVertexArray(mesh->vertex_array);
	glDrawElementsInstanced(GL_TRIANGLES, (GLsizei)mesh->index_count, GL_UNSIGNED_INT, 0, count);
	glBindVertexArray(0);
}

// upload mesh from (cpu) to (gpu)
CGL_void CGL_mesh_gpu_upload(CGL_mesh_gpu* mesh, CGL_mesh_cpu* mesh_cpu, bool static_draw)
{
	if (mesh_cpu->index_count <= 0) return;
	mesh->index_count = mesh_cpu->index_count_used;
	mesh->vertex_count = mesh_cpu->vertex_count_used;
	glBindBuffer(GL_ARRAY_BUFFER, mesh->vertex_buffer);
	glBufferData(GL_ARRAY_BUFFER, mesh_cpu->vertex_count_used * sizeof(CGL_mesh_vertex), mesh_cpu->vertices, static_draw ? GL_STATIC_DRAW : GL_DYNAMIC_DRAW);
	glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, mesh->index_buffer);
	glBufferData(GL_ELEMENT_ARRAY_BUFFER, mesh_cpu->index_count_used * sizeof(unsigned int), mesh_cpu->indices, static_draw ? GL_STATIC_DRAW : GL_DYNAMIC_DRAW);
}

// set mesh user data
CGL_void CGL_mesh_gpu_set_user_data(CGL_mesh_gpu* mesh, void* user_data)
{
	mesh->user_data = user_data;
}

// get mesh user data
CGL_void* CGL_mesh_gpu_get_user_data(CGL_mesh_gpu* mesh)
{
	return mesh->user_data;
}

// destroy mesh (cpu)
CGL_void CGL_mesh_cpu_destroy(CGL_mesh_cpu* mesh)
{
	if (mesh->vertices) CGL_free(mesh->vertices);
	if (mesh->indices) CGL_free(mesh->indices);
	CGL_free(mesh);
}

// create mesh (cpu)
CGL_mesh_cpu* CGL_mesh_cpu_create(size_t vertex_count, size_t index_count)
{
	CGL_mesh_cpu* mesh = (CGL_mesh_cpu*)malloc(sizeof(CGL_mesh_cpu));
	if (mesh == NULL) return NULL;
	mesh->vertex_count = vertex_count;
	mesh->index_count = index_count;
	mesh->vertex_count_used = 0;
	mesh->index_count_used = 0;
	mesh->vertices = (CGL_mesh_vertex*)malloc(mesh->vertex_count * sizeof(CGL_mesh_vertex));
	if (mesh->vertices == NULL)
	{
		CGL_free(mesh);
		return NULL;
	}
	mesh->indices = (uint32_t*)malloc(mesh->index_count * sizeof(uint32_t));
	if (mesh->indices == NULL)
	{
		CGL_free(mesh->vertices);
		CGL_free(mesh);
		return NULL;
	}
	for (CGL_sizei i = 0; i < index_count; i++) mesh->indices[i] = (CGL_uint)i;
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_recalculate_normals(CGL_mesh_cpu* mesh)
{
	// clear normals
	for (size_t i = 0; i < mesh->vertex_count; i++) mesh->vertices[i].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	// calculate un normalized normals
	for (size_t i = 0; i < mesh->index_count; i += 3)
	{
		CGL_vec4 a = mesh->vertices[mesh->indices[i + 0]].position;
		CGL_vec4 b = mesh->vertices[mesh->indices[i + 1]].position;
		CGL_vec4 c = mesh->vertices[mesh->indices[i + 2]].position;
		CGL_vec3 ab = CGL_vec3_sub(b, a);
		CGL_vec3 ac = CGL_vec3_sub(c, a);
		CGL_vec3 normal_3 = CGL_vec3_cross(ac, ab);
		CGL_vec4 normal = CGL_vec4_init(normal_3.x, normal_3.y, normal_3.z, 0.0f);
		mesh->vertices[mesh->indices[i + 0]].normal = CGL_vec4_add(mesh->vertices[mesh->indices[i + 0]].normal, normal);
		mesh->vertices[mesh->indices[i + 1]].normal = CGL_vec4_add(mesh->vertices[mesh->indices[i + 1]].normal, normal);
		mesh->vertices[mesh->indices[i + 2]].normal = CGL_vec4_add(mesh->vertices[mesh->indices[i + 2]].normal, normal);
	}
	// normalize normals
	for (size_t i = 0; i < mesh->vertex_count; i++)
	{
		CGL_vec4_normalize_vec3(mesh->vertices[i].normal);
	}
    
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_flip_normals(CGL_mesh_cpu* mesh)
{
    for (size_t i = 0; i < mesh->vertex_count; i++)
	{
		mesh->vertices[i].normal = CGL_vec4_init(- mesh->vertices[i].normal.x, -mesh->vertices[i].normal.y, -mesh->vertices[i].normal.z, 0.0f);
	}
    
	return mesh;
}


CGL_void __CGL_mesh_cpu_load_obj_helper_parse_obj_line(char* line, float* items, CGL_int count)
{
	char* begin = line;
	char* end = line + strlen(line);
	CGL_int i = 0, j = 0;
	while ((begin < end) && (i < count))
	{
		if (line[j++] == ' ')
		{
			line[j - 1] = '\0';
			items[i++] = (float)atof(begin);
			begin = line + j;
		}
	}
}

CGL_mesh_cpu* CGL_mesh_cpu_load_obj(const char* path)
{
	char temp_buffer[1024];
	CGL_list* vertex_positions = CGL_list_create(sizeof(float) * 4, 1000);
	CGL_list* vertex_normals = CGL_list_create(sizeof(float) * 4, 1000);
	CGL_list* vertex_texture_coordinates = CGL_list_create(sizeof(float) * 4, 1000);
	CGL_list* vertices = CGL_list_create(sizeof(CGL_mesh_vertex), 1000);
	CGL_list* indices = CGL_list_create(sizeof(uint32_t), 1000);
	size_t file_size = 0;
	char* file_data = CGL_utils_read_file(path, &file_size);
	if (file_size == 0) return NULL;
	char* line = strtok(file_data, "\n");
	CGL_int object_count = 0;
	CGL_float item_data[4] = { 0.0f, 0.0f, 0.0f, 1.0f };
	uint32_t index = 0;
	while (line != NULL)
	{
		if (line[0] == 'v' && line[1] == ' ')
		{
			sprintf(temp_buffer, "%s ", (line + 2));
			__CGL_mesh_cpu_load_obj_helper_parse_obj_line(temp_buffer, item_data, 3);
			CGL_list_push(vertex_positions, item_data);
		}
		else if (line[0] == 'v' && line[1] == 'n')
		{
			sprintf(temp_buffer, "%s ", (line + 3));
			__CGL_mesh_cpu_load_obj_helper_parse_obj_line(temp_buffer, item_data, 3);
			CGL_list_push(vertex_normals, item_data);
		}
		else if (line[0] == 'v' && line[1] == 't')
		{
			sprintf(temp_buffer, "%s ", (line + 3));
			__CGL_mesh_cpu_load_obj_helper_parse_obj_line(temp_buffer, item_data, 2);
			CGL_list_push(vertex_texture_coordinates, item_data);
		}
		else if (line[0] == 'f' && line[1] == ' ')
		{
			sprintf(temp_buffer, "%s ", (line + 2));
			uint32_t index_v_vt_vn[4][3];
			memset(index_v_vt_vn, 0, sizeof(index_v_vt_vn));
			char* begin = temp_buffer;
			char* end = temp_buffer + strlen(temp_buffer);
			CGL_int i = 0, j = 0, k = 0;
			while ((begin < end) && (i < 3))
			{
				if (temp_buffer[j] == '/' || temp_buffer[j] == ' ')
				{
					char c = temp_buffer[j];
					temp_buffer[j] = '\0';
					index_v_vt_vn[i][k++] = (uint32_t)atoll(begin);
					begin = temp_buffer + j + 1;
					if (c == ' ') { k = 0; i++; }
				}
				j++;
			}
			CGL_mesh_vertex current_vertex = { 0 };
			for (i = 0; i < 3; i++)
			{
				if (!CGL_list_get(vertex_positions, index_v_vt_vn[i][0] - 1, &current_vertex.position))
					current_vertex.position = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
				if (!CGL_list_get(vertex_texture_coordinates, index_v_vt_vn[i][1] - 1, &current_vertex.texture_coordinates))
					current_vertex.texture_coordinates = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
				if (!CGL_list_get(vertex_normals, index_v_vt_vn[i][2] - 1, &current_vertex.normal))
					current_vertex.normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
				CGL_list_push(vertices, &current_vertex);
			}

			CGL_list_push(indices, &index); index++;
			CGL_list_push(indices, &index); index++;
			CGL_list_push(indices, &index); index++;
		}
		else if (line[0] == 'o' && line[1] == ' ')
			object_count++;
		line = strtok(NULL, "\n");
		if (object_count == 2) break; // only one object is parsed as of now
	}

	size_t index_count = CGL_list_get_size(indices);
	size_t vertex_count = CGL_list_get_size(vertices);
	CGL_mesh_cpu* mesh = CGL_mesh_cpu_create(vertex_count, index_count);
	memcpy(mesh->indices, CGL_list_get(indices, 0, NULL), sizeof(uint32_t) * index_count);
	memcpy(mesh->vertices, CGL_list_get(vertices, 0, NULL), sizeof(CGL_mesh_vertex) * vertex_count);
	CGL_free(file_data);
	CGL_list_destroy(vertices);
	CGL_list_destroy(indices);
	CGL_list_destroy(vertex_positions);
	CGL_list_destroy(vertex_normals);
	CGL_list_destroy(vertex_texture_coordinates);
	mesh->vertex_count_used = mesh->vertex_count;
	mesh->index_count_used = mesh->index_count;
	return mesh;
}

// generate plane mesh
CGL_mesh_cpu* CGL_mesh_cpu_plane(CGL_vec3 front, CGL_vec3 right, CGL_int resolution, CGL_float scale)
{
	CGL_vec3_normalize(front);
	CGL_vec3_normalize(right);
	CGL_vec3 up = CGL_vec3_cross(front, right); // up is perpendicular to front and right
	CGL_mesh_cpu* mesh = CGL_mesh_cpu_create(resolution * resolution, (resolution - 1) * (resolution - 1) * 6);
	CGL_int index = 0, tri_index = 0;
	CGL_float temp0 = 0.0f, temp1 = 0.0f;
	CGL_vec3 tempv0, tempv1, point_on_plane;
	for (CGL_int y = 0; y < resolution; y++)
	{
		for (CGL_int x = 0; x < resolution; x++)
		{
			index = x + y * resolution;
			CGL_vec2 percent = CGL_vec2_init((float)x / ((float)resolution - 1), (float)y / ((float)resolution - 1));
			temp0 = (percent.x - 0.5f) * 2.0f;
			temp1 = (percent.y - 0.5f) * 2.0f;
			tempv0 = CGL_vec3_scale(right, temp0);
			tempv1 = CGL_vec3_scale(front, temp1);
			point_on_plane = CGL_vec3_add(tempv0, tempv1);
			point_on_plane = CGL_vec3_scale(point_on_plane, scale);
			mesh->vertices[index].position = CGL_vec4_init(point_on_plane.x, point_on_plane.y, point_on_plane.z, 1.0f);
			mesh->vertices[index].texture_coordinates = CGL_vec4_init(percent.x, percent.y, 0.0f, 0.0f);
			mesh->vertices[index].normal = CGL_vec4_init(up.x, up.y, up.z, 0.0f);
			if (x != resolution - 1 && y != resolution - 1)
			{
				mesh->indices[tri_index + 0] = index;
				mesh->indices[tri_index + 1] = index + resolution + 1;
				mesh->indices[tri_index + 2] = index + resolution;
				mesh->indices[tri_index + 3] = index;
				mesh->indices[tri_index + 4] = index + 1;
				mesh->indices[tri_index + 5] = index + resolution + 1;
				tri_index += 6;
			}
		}
	}
	mesh->vertex_count_used = mesh->vertex_count;
	mesh->index_count_used = mesh->index_count;
	return mesh;
}

// generate triangle mesh
CGL_mesh_cpu* CGL_mesh_cpu_triangle(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c)
{
	CGL_mesh_cpu* mesh = CGL_mesh_cpu_create(3, 3);
	return CGL_mesh_cpu_add_triangle(mesh, a, b, c);
}

// generate quad mesh
CGL_mesh_cpu* CGL_mesh_cpu_quad(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c, CGL_vec3 d)
{
	CGL_mesh_cpu* mesh = CGL_mesh_cpu_create(6, 6);
	return CGL_mesh_cpu_add_quad(mesh, a, b, c, d);
}

// Algorithm from https://stackoverflow.com/a/31326534/14911094
CGL_mesh_cpu* CGL_mesh_cpu_create_from_parametric_function(CGL_int res_u, CGL_int res_v, CGL_float start_u, CGL_float start_v, CGL_float end_u, CGL_float end_v, CGL_parametric_function function)
{
	CGL_mesh_cpu* mesh = CGL_mesh_cpu_create(res_u * res_v * 4, res_u * res_v * 6);
	return CGL_mesh_cpu_add_from_parametric_function(mesh, res_u, res_v, start_u, start_v, end_u, end_v, function);
}

CGL_mesh_cpu* CGL_mesh_cpu_add_triangle(CGL_mesh_cpu* mesh, CGL_vec3 a, CGL_vec3 b, CGL_vec3 c)
{
	if (mesh == NULL) return NULL;
	CGL_vec3 ab = CGL_vec3_sub(b, a);
	CGL_vec3 ac = CGL_vec3_sub(c, a);
	CGL_vec3 normal = CGL_vec3_cross(ab, ac);
	CGL_vec4 normal_4 = CGL_vec4_init(normal.x, normal.y, normal.z, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 0].position = CGL_vec4_init(a.x, a.y, a.z, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 0].normal = normal_4;
	mesh->vertices[mesh->vertex_count_used + 0].texture_coordinates = CGL_vec4_init(0.0f, 0.0f, 0.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 1].position = CGL_vec4_init(b.x, b.y, b.z, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 1].normal = normal_4;
	mesh->vertices[mesh->vertex_count_used + 1].texture_coordinates = CGL_vec4_init(0.0f, 0.0f, 0.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 2].position = CGL_vec4_init(c.x, c.y, c.z, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 2].normal = normal_4;
	mesh->vertices[mesh->vertex_count_used + 2].texture_coordinates = CGL_vec4_init(0.0f, 0.0f, 0.0f, 1.0f);
	mesh->vertex_count_used += 3;
	mesh->indices[mesh->index_count_used + 0] = 0;
	mesh->indices[mesh->index_count_used + 1] = 1;
	mesh->indices[mesh->index_count_used + 2] = 2;
	mesh->index_count_used += 3;
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_add_quad(CGL_mesh_cpu* mesh, CGL_vec3 a, CGL_vec3 b, CGL_vec3 c, CGL_vec3 d)
{
	if (mesh == NULL) return NULL;
	CGL_vec3 ab = CGL_vec3_sub(b, a);
	CGL_vec3 ac = CGL_vec3_sub(c, a);
	// CGL_vec3 ad = CGL_vec3_sub(d, a);
	CGL_vec3 normal_abc = CGL_vec3_cross(ab, ac);
	CGL_vec4 normal_abc_4 = CGL_vec4_init(normal_abc.x, normal_abc.y, normal_abc.z, 0.0f);

	mesh->vertices[mesh->vertex_count_used + 0].position = CGL_vec4_init(a.x, a.y, a.z, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 0].normal = normal_abc_4;
	mesh->vertices[mesh->vertex_count_used + 0].texture_coordinates = CGL_vec4_init(1.0f, 1.0f, 0.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 1].position = CGL_vec4_init(b.x, b.y, b.z, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 1].normal = normal_abc_4;
	mesh->vertices[mesh->vertex_count_used + 1].texture_coordinates = CGL_vec4_init(1.0f, 0.0f, 0.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 2].position = CGL_vec4_init(c.x, c.y, c.z, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 2].normal = normal_abc_4;
	mesh->vertices[mesh->vertex_count_used + 2].texture_coordinates = CGL_vec4_init(0.0f, 0.0f, 0.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 3].position = CGL_vec4_init(a.x, a.y, a.z, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 3].normal = normal_abc_4;
	mesh->vertices[mesh->vertex_count_used + 3].texture_coordinates = CGL_vec4_init(1.0f, 1.0f, 0.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 4].position = CGL_vec4_init(c.x, c.y, c.z, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 4].normal = normal_abc_4;
	mesh->vertices[mesh->vertex_count_used + 4].texture_coordinates = CGL_vec4_init(0.0f, 0.0f, 0.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 5].position = CGL_vec4_init(d.x, d.y, d.z, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 5].normal = normal_abc_4;
	mesh->vertices[mesh->vertex_count_used + 5].texture_coordinates = CGL_vec4_init(0.0f, 1.0f, 0.0f, 1.0f);
	mesh->vertex_count_used += 6;
	for (CGL_int i = 0; i < 6; i++) mesh->indices[mesh->index_count_used + i] = (CGL_uint)mesh->index_count_used + (CGL_uint)i;
	mesh->index_count_used += 6;
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_add_from_parametric_function(CGL_mesh_cpu* mesh, CGL_int res_u, CGL_int res_v, CGL_float start_u, CGL_float start_v, CGL_float end_u, CGL_float end_v, CGL_parametric_function function)
{
	if (mesh == NULL) return NULL;
	CGL_float step_u = (end_u - start_u) / res_u;
	CGL_float step_v = (end_v - start_v) / res_v;
	size_t vertex_index = 0;
	size_t index_index = 0;
	for (CGL_int i = 0; i < res_u; i++)
	{
		for (CGL_int j = 0; j < res_v; j++)
		{
			CGL_float u = i * step_u + start_u;
			CGL_float v = j * step_v + start_v;
			CGL_float un = ((i + 1) == res_u) ? end_u : ((i + 1) * step_u + start_u);
			CGL_float vn = ((j + 1) == res_v) ? end_v : ((j + 1) * step_v + start_v);
			// find the four points of the grid square
			// by evaluating the paramatric surface function
			CGL_vec3 p0 = function(u, v);
			CGL_vec3 p1 = function(u, vn);
			CGL_vec3 p2 = function(un, v);
			CGL_vec3 p3 = function(un, vn);
			mesh->vertices[mesh->vertex_count_used + vertex_index].position = CGL_vec4_init(p0.x, p0.y, p0.z, 1.0f);
			mesh->vertices[mesh->vertex_count_used + vertex_index].texture_coordinates = CGL_vec4_init(u, v, 0.0f, 0.0f);
			vertex_index += 1;
			mesh->vertices[mesh->vertex_count_used + vertex_index].position = CGL_vec4_init(p1.x, p1.y, p1.z, 1.0f);
			mesh->vertices[mesh->vertex_count_used + vertex_index].texture_coordinates = CGL_vec4_init(u, vn, 0.0f, 0.0f);
			vertex_index += 1;
			mesh->vertices[mesh->vertex_count_used + vertex_index].position = CGL_vec4_init(p2.x, p2.y, p2.z, 1.0f);
			mesh->vertices[mesh->vertex_count_used + vertex_index].texture_coordinates = CGL_vec4_init(un, v, 0.0f, 0.0f);
			vertex_index += 1;
			mesh->vertices[mesh->vertex_count_used + vertex_index].position = CGL_vec4_init(p3.x, p3.y, p3.z, 1.0f);
			mesh->vertices[mesh->vertex_count_used + vertex_index].texture_coordinates = CGL_vec4_init(un, vn, 0.0f, 0.0f);
			vertex_index += 1;
			// Output the first triangle of this grid square
			// triangle(p0, p2, p1)
			mesh->indices[mesh->index_count_used + index_index++] = (uint32_t)(mesh->vertex_count_used + vertex_index) - 4; // p0
			mesh->indices[mesh->index_count_used + index_index++] = (uint32_t)(mesh->vertex_count_used + vertex_index) - 2; // p2
			mesh->indices[mesh->index_count_used + index_index++] = (uint32_t)(mesh->vertex_count_used + vertex_index) - 3; // p1
			// Output the other triangle of this grid square
			// triangle(p3, p1, p2) 
			mesh->indices[mesh->index_count_used + index_index++] = (uint32_t)(mesh->vertex_count_used + vertex_index) - 1; // p3
			mesh->indices[mesh->index_count_used + index_index++] = (uint32_t)(mesh->vertex_count_used + vertex_index) - 3; // p1
			mesh->indices[mesh->index_count_used + index_index++] = (uint32_t)(mesh->vertex_count_used + vertex_index) - 2; // p2
		}
	}
	mesh->vertex_count_used += res_u * res_v * 4;
	mesh->index_count_used += res_u * res_v * 6;
	return mesh;
}


static CGL_vec3 __CGL_mesh_cpu_sphere_parametric_function(CGL_float u, CGL_float v)
{
	return CGL_vec3_init(cosf(u) * sinf(v), cosf(v), sinf(u) * sinf(v));
}

CGL_mesh_cpu* CGL_mesh_cpu_add_sphere(CGL_mesh_cpu* mesh, CGL_int res_u, CGL_int res_v)
{
	return CGL_mesh_cpu_add_from_parametric_function(mesh, res_u, res_v, 0.0f, 0.0f, 3.14f * 2.0f, 3.14f, __CGL_mesh_cpu_sphere_parametric_function);
}

CGL_mesh_cpu* CGL_mesh_cpu_create_cylinder(CGL_vec3 start, CGL_vec3 end, CGL_float radius0, CGL_float radius1, CGL_int resolution)
{
	CGL_mesh_cpu* mesh = CGL_mesh_cpu_create(resolution * 2 * 3, resolution * 2 * 3);
	CGL_mesh_cpu_add_cylinder2(mesh, start, end, radius0, radius1, resolution, 1);
	CGL_mesh_cpu_recalculate_normals(mesh);
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_create_cylinder2(CGL_vec3 start, CGL_vec3 end, CGL_float radius0, CGL_float radius1, CGL_int resolution_x, CGL_int resolution_y)
{
	CGL_int resolution = resolution_x * resolution_y;	
	CGL_mesh_cpu* mesh = CGL_mesh_cpu_create(resolution * 2 * 3, resolution * 2 * 3);
	CGL_mesh_cpu_add_cylinder2(mesh, start, end, radius0, radius1, resolution_x, resolution_y);
	CGL_mesh_cpu_recalculate_normals(mesh);
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_add_cylinder(CGL_mesh_cpu* mesh, CGL_vec3 start, CGL_vec3 end, CGL_float radius0, CGL_float radius1, CGL_int resolution)
{
	if (mesh == NULL) return NULL;
	if (resolution < 3) return NULL;

	CGL_vec3 direction = CGL_vec3_sub(end, start);
	CGL_vec3_normalize(direction);
	CGL_vec3 right = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	CGL_vec3 top = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	CGL_vec3_calculate_orthonormal_basis_from_one_vector(direction, &right, &top);
	CGL_float angle = 0.0f;
	CGL_float angle_step = 3.14f * 2.0f / (CGL_float)resolution;
	CGL_int vertex_index = 0;
	CGL_int index_index = 0;
	for (CGL_int i = 0; i < resolution; i++)
	{
        // prevent lerp interpolation floating-point inaccuracy on last step
        CGL_float angle_plus_step = angle + angle_step;
        
        if(i +1 == resolution)
            angle_plus_step = 0.0f;
        
		CGL_vec3 p0 = CGL_vec3_add3_(start, CGL_vec3_scale_(right, cosf(angle) * radius0), CGL_vec3_scale_(top, sinf(angle) * radius0));
		CGL_vec3 p1 = CGL_vec3_add3_(start, CGL_vec3_scale_(right, cosf(angle_plus_step) * radius0), CGL_vec3_scale_(top, sinf(angle_plus_step) * radius0));
		CGL_vec3 p2 = CGL_vec3_add3_(end, CGL_vec3_scale_(right, cosf(angle) * radius1), CGL_vec3_scale_(top, sinf(angle) * radius1));
		CGL_vec3 p3 = CGL_vec3_add3_(end, CGL_vec3_scale_(right, cosf(angle_plus_step) * radius1), CGL_vec3_scale_(top, sinf(angle_plus_step) * radius1));
		angle += angle_step;
        
		// Output the first triangle of this grid square
		// triangle(p0, p2, p1)
		mesh->vertices[mesh->vertex_count_used + vertex_index].position = CGL_vec4_init(p0.x, p0.y, p0.z, 1.0f);
		mesh->vertices[mesh->vertex_count_used + vertex_index].texture_coordinates = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
		vertex_index += 1;
		mesh->vertices[mesh->vertex_count_used + vertex_index].position = CGL_vec4_init(p2.x, p2.y, p2.z, 1.0f);
		mesh->vertices[mesh->vertex_count_used + vertex_index].texture_coordinates = CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f);
		vertex_index += 1;
		mesh->vertices[mesh->vertex_count_used + vertex_index].position = CGL_vec4_init(p1.x, p1.y, p1.z, 1.0f);
		mesh->vertices[mesh->vertex_count_used + vertex_index].texture_coordinates = CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f);
		vertex_index += 1;
		// Output the second triangle of this grid square
		// triangle(p1, p2, p3)
		mesh->vertices[mesh->vertex_count_used + vertex_index].position = CGL_vec4_init(p1.x, p1.y, p1.z, 1.0f);
		mesh->vertices[mesh->vertex_count_used + vertex_index].texture_coordinates = CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f);
		vertex_index += 1;
		mesh->vertices[mesh->vertex_count_used + vertex_index].position = CGL_vec4_init(p2.x, p2.y, p2.z, 1.0f);
		mesh->vertices[mesh->vertex_count_used + vertex_index].texture_coordinates = CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f);
		vertex_index += 1;
		mesh->vertices[mesh->vertex_count_used + vertex_index].position = CGL_vec4_init(p3.x, p3.y, p3.z, 1.0f);
		mesh->vertices[mesh->vertex_count_used + vertex_index].texture_coordinates = CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f);
		vertex_index += 1;
		// Output the indices for this grid square
		mesh->indices[mesh->index_count_used + index_index] = (CGL_uint)mesh->vertex_count_used + vertex_index - 6; index_index += 1;
		mesh->indices[mesh->index_count_used + index_index] = (CGL_uint)mesh->vertex_count_used + vertex_index - 5; index_index += 1;
		mesh->indices[mesh->index_count_used + index_index] = (CGL_uint)mesh->vertex_count_used + vertex_index - 4; index_index += 1;
		mesh->indices[mesh->index_count_used + index_index] = (CGL_uint)mesh->vertex_count_used + vertex_index - 3; index_index += 1;
		mesh->indices[mesh->index_count_used + index_index] = (CGL_uint)mesh->vertex_count_used + vertex_index - 2; index_index += 1;
		mesh->indices[mesh->index_count_used + index_index] = (CGL_uint)mesh->vertex_count_used + vertex_index - 1; index_index += 1;
	}
	mesh->vertex_count_used += vertex_index;
	mesh->index_count_used += index_index;
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_add_cylinder2(CGL_mesh_cpu* mesh, CGL_vec3 start, CGL_vec3 end, CGL_float radius0, CGL_float radius1, CGL_int resolution_x, CGL_int resolution_y)
{
	if (mesh == NULL) return NULL;
	if (resolution_x < 3 || resolution_y < 1) return NULL;

	CGL_vec3 prev = start;
	CGL_vec3 curr = start;
	CGL_float rad_prev = radius0;
	CGL_float rad_curr = 0.0f;

	for (CGL_int i = 1; i <= resolution_y; i++) 
	{
		CGL_float u0 = (CGL_float)i / (CGL_float)resolution_y;
		curr = CGL_vec3_add(start, CGL_vec3_scale(CGL_vec3_sub(end, start), u0));
		rad_curr = radius0 + (radius1 - radius0) * u0;
		CGL_mesh_cpu_add_cylinder(mesh, prev, curr, rad_prev, rad_curr, resolution_x);

		prev = curr;
		rad_prev = rad_curr;
	}

	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_create_torus_elbow(CGL_vec3 center, CGL_float radius0, CGL_float radius1, CGL_int resolution0, CGL_int resolution1, CGL_float elbow_angle)
{
	CGL_mesh_cpu* mesh = CGL_mesh_cpu_create(resolution0*resolution1 * 2 * 3, resolution0*resolution1 * 2 * 3);
	CGL_mesh_cpu_add_torus(mesh, center, radius0, radius1, resolution0, resolution1, elbow_angle);
    
    CGL_mesh_cpu_offset_vertices(mesh, center);
	CGL_mesh_cpu_recalculate_normals(mesh);
	return mesh;
}


// placeholder
static float m_r = 1.0f;
static float M_r = 2.0f;

static CGL_vec3 __CGL_mesh_cpu_torus_parametric_function(CGL_float u, CGL_float v)
{
	return CGL_vec3_init(cosf(u)* (M_r +  m_r * cosf(v)), m_r * sinf(v), sinf(u) * (M_r + m_r * cosf(v)));
}

CGL_mesh_cpu* CGL_mesh_cpu_add_torus(CGL_mesh_cpu* mesh, CGL_vec3 center, CGL_float radius0, CGL_float radius1, CGL_int resolution0, CGL_int resolution1, CGL_float elbow_angle)
{
	(void)center;

    m_r = radius1;
    M_r = radius0;
    
	CGL_mesh_cpu* res = CGL_mesh_cpu_add_from_parametric_function(mesh, resolution0, resolution1, 0.0f, 0.0f, elbow_angle, CGL_2PI, __CGL_mesh_cpu_torus_parametric_function); 
    m_r = 1.0f; M_r = 2.0f;
	return res;
}


CGL_mesh_cpu* CGL_mesh_cpu_offset_vertices(CGL_mesh_cpu* mesh, CGL_vec3 offset)
{
	for (CGL_sizei i = 0; i < mesh->vertex_count_used; i++)
	{
		mesh->vertices[i].position.x += offset.x;
		mesh->vertices[i].position.y += offset.y;
		mesh->vertices[i].position.z += offset.z;
		mesh->vertices[i].position.w = 1.0f;
	}
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_scale_vertices(CGL_mesh_cpu* mesh, CGL_float scale)
{
	for (CGL_sizei i = 0; i < mesh->vertex_count_used; i++)
	{
		mesh->vertices[i].position.x *= scale;
		mesh->vertices[i].position.y *= scale;
		mesh->vertices[i].position.z *= scale;
		mesh->vertices[i].position.w = 1.0f;
	}
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_rotate_vertices(CGL_mesh_cpu* mesh, CGL_quat rotation)
{
	for (CGL_sizei i = 0; i < mesh->vertex_count_used; i++)
	{
		mesh->vertices[i].position.w = 1.0f;
		mesh->vertices[i].position = CGL_quat_mul_vec4(rotation, mesh->vertices[i].position);
	}
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_transform_vertices(CGL_mesh_cpu* mesh, CGL_mat4 transform)
{
	for (CGL_sizei i = 0; i < mesh->vertex_count_used; i++)
	{
		mesh->vertices[i].position.w = 1.0f;
		mesh->vertices[i].position = CGL_mat4_mul_vec4(transform, mesh->vertices[i].position);
	}
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_sphere(CGL_int res_u, CGL_int res_v)
{
	return CGL_mesh_cpu_create_from_parametric_function(res_u, res_v, 0.0f, 0.0f, CGL_2PI, CGL_PI, __CGL_mesh_cpu_sphere_parametric_function);
}

CGL_mesh_cpu* CGL_mesh_cpu_add_mesh(CGL_mesh_cpu* mesh, CGL_mesh_cpu* mesh_other)
{
	for (CGL_sizei i = 0; i < mesh_other->vertex_count_used; i++) mesh->vertices[mesh->vertex_count_used + i] = mesh_other->vertices[i];
	for (CGL_sizei i = 0; i < mesh_other->index_count_used; i++) mesh->indices[mesh->index_count_used + i] = mesh_other->indices[i] + (CGL_uint)mesh->vertex_count_used;
	mesh->vertex_count_used += mesh_other->vertex_count_used; mesh->index_count_used += mesh_other->index_count_used;
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_add_cube(CGL_mesh_cpu* mesh, CGL_bool use_3d_tex_coords)
{
	mesh->vertices[mesh->vertex_count_used + 0].position = CGL_vec4_init(-1.0f, 1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 0].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, 1.0f, -1.0f, 0.0f) : CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 0].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 1].position = CGL_vec4_init(-1.0f, -1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 1].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, -1.0f, -1.0f, 0.0f) : CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 1].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 2].position = CGL_vec4_init(1.0f, -1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 2].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, -1.0f, -1.0f, 0.0f) : CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 2].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 3].position = CGL_vec4_init(1.0f, -1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 3].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, -1.0f, -1.0f, 0.0f) : CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 3].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 4].position = CGL_vec4_init(1.0f, 1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 4].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, 1.0f, -1.0f, 0.0f) : CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 4].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 5].position = CGL_vec4_init(-1.0f, 1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 5].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, 1.0f, -1.0f, 0.0f) : CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 5].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 6].position = CGL_vec4_init(-1.0f, -1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 6].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, -1.0f, 1.0f, 0.0f) : CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 6].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 7].position = CGL_vec4_init(-1.0f, -1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 7].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, -1.0f, -1.0f, 0.0f) : CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 7].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 8].position = CGL_vec4_init(-1.0f, 1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 8].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, 1.0f, -1.0f, 0.0f) : CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 8].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 9].position = CGL_vec4_init(-1.0f, 1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 9].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, 1.0f, -1.0f, 0.0f) : CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 9].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 10].position = CGL_vec4_init(-1.0f, 1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 10].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, 1.0f, 1.0f, 0.0f) : CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 10].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 11].position = CGL_vec4_init(-1.0f, -1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 11].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, -1.0f, 1.0f, 0.0f) : CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 11].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 12].position = CGL_vec4_init(1.0f, -1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 12].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, -1.0f, -1.0f, 0.0f) : CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 12].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 13].position = CGL_vec4_init(1.0f, -1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 13].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, -1.0f, 1.0f, 0.0f) : CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 13].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 14].position = CGL_vec4_init(1.0f, 1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 14].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, 1.0f, 1.0f, 0.0f) : CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 14].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 15].position = CGL_vec4_init(1.0f, 1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 15].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, 1.0f, 1.0f, 0.0f) : CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 15].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 16].position = CGL_vec4_init(1.0f, 1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 16].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, 1.0f, -1.0f, 0.0f) : CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 16].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 17].position = CGL_vec4_init(1.0f, -1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 17].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, -1.0f, -1.0f, 0.0f) : CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 17].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 18].position = CGL_vec4_init(-1.0f, -1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 18].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, -1.0f, 1.0f, 0.0f) : CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 18].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 19].position = CGL_vec4_init(-1.0f, 1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 19].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, 1.0f, 1.0f, 0.0f) : CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 19].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 20].position = CGL_vec4_init(1.0f, 1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 20].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, 1.0f, 1.0f, 0.0f) : CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 20].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 21].position = CGL_vec4_init(1.0f, 1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 21].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, 1.0f, 1.0f, 0.0f) : CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 21].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 22].position = CGL_vec4_init(1.0f, -1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 22].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, -1.0f, 1.0f, 0.0f) : CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 22].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 23].position = CGL_vec4_init(-1.0f, -1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 23].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, -1.0f, 1.0f, 0.0f) : CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 23].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 24].position = CGL_vec4_init(-1.0f, 1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 24].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, 1.0f, -1.0f, 0.0f) : CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 24].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 25].position = CGL_vec4_init(1.0f, 1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 25].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, 1.0f, -1.0f, 0.0f) : CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 25].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 26].position = CGL_vec4_init(1.0f, 1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 26].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, 1.0f, 1.0f, 0.0f) : CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 26].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 27].position = CGL_vec4_init(1.0f, 1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 27].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, 1.0f, 1.0f, 0.0f) : CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 27].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 28].position = CGL_vec4_init(-1.0f, 1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 28].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, 1.0f, 1.0f, 0.0f) : CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 28].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 29].position = CGL_vec4_init(-1.0f, 1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 29].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, 1.0f, -1.0f, 0.0f) : CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 29].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 30].position = CGL_vec4_init(-1.0f, -1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 30].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, -1.0f, -1.0f, 0.0f) : CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 30].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 31].position = CGL_vec4_init(-1.0f, -1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 31].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, -1.0f, 1.0f, 0.0f) : CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 31].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 32].position = CGL_vec4_init(1.0f, -1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 32].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, -1.0f, -1.0f, 0.0f) : CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 32].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 33].position = CGL_vec4_init(1.0f, -1.0f, -1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 33].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, -1.0f, -1.0f, 0.0f) : CGL_vec4_init(1.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 33].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 34].position = CGL_vec4_init(-1.0f, -1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 34].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(-1.0f, -1.0f, 1.0f, 0.0f) : CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 34].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	mesh->vertices[mesh->vertex_count_used + 35].position = CGL_vec4_init(1.0f, -1.0f, 1.0f, 1.0f);
	mesh->vertices[mesh->vertex_count_used + 35].texture_coordinates = (use_3d_tex_coords ? CGL_vec4_init(1.0f, -1.0f, 1.0f, 0.0f) : CGL_vec4_init(0.0f, 1.0f, 0.0f, 0.0f));
	mesh->vertices[mesh->vertex_count_used + 35].normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	for (CGL_sizei i = mesh->index_count_used; i < mesh->index_count_used + 36; i++) mesh->indices[i] = (CGL_int)i;
	mesh->vertex_count_used += 36;
	mesh->index_count_used += 36;
	return mesh;
}

CGL_mesh_cpu* CGL_mesh_cpu_cube(bool use_3d_tex_coords)
{
	CGL_mesh_cpu* mesh = CGL_mesh_cpu_create(36, 36);
	if (mesh == NULL) return NULL;
	return CGL_mesh_cpu_add_cube(mesh, use_3d_tex_coords);
}

CGL_void CGL_mesh_cpu_generate_c_initialization_code(CGL_mesh_cpu* mesh, char* buffer, const char* function_name)
{
	static char temp_buffer[1024];
	buffer[0] = '\0';
	if (!function_name) function_name = "generate_mesh";
	sprintf(temp_buffer,
		"CGL_mesh_cpu* %s()\n{\n"
		"\tCGL_mesh_cpu* mesh = CGL_mesh_cpu_create(%zu, %zu);\n"
		"\tif(mesh == NULL)\n"
		"\t\treturn NULL;\n\n",
		function_name,
		mesh->vertex_count, mesh->index_count);
	strcat(buffer, temp_buffer);
	for (CGL_sizei i = 0; i < mesh->vertex_count; i++)
	{
		sprintf(temp_buffer,
			"\tmesh->vertices[%d].position = CGL_vec4_init(%f, %f, %f, %f);\n"
			"\tmesh->vertices[%d].normal =  CGL_vec4_init(%f, %f, %f, %f);\n"
			"\tmesh->vertices[%d].texture_coordinates = CGL_vec4_init(%f, %f, %f, %f);\n"
			"\tmesh->vertices[%d].bone_wieghts = CGL_vec4_init(%f, %f, %f, %f);\n"
			"\tmesh->vertices[%d].bone_ids = CGL_ivec4_init(%d, %d, %d, %d);\n",
			(CGL_int)i, mesh->vertices[i].position.x, mesh->vertices[i].position.y, mesh->vertices[i].position.z, mesh->vertices[i].position.w,
			(CGL_int)i, mesh->vertices[i].normal.x, mesh->vertices[i].normal.y, mesh->vertices[i].normal.z, mesh->vertices[i].normal.w,
			(CGL_int)i, mesh->vertices[i].texture_coordinates.x, mesh->vertices[i].texture_coordinates.y, mesh->vertices[i].texture_coordinates.z, mesh->vertices[i].texture_coordinates.w,
			(CGL_int)i, mesh->vertices[i].bone_wieghts.x, mesh->vertices[i].bone_wieghts.y, mesh->vertices[i].bone_wieghts.z, mesh->vertices[i].bone_wieghts.w,
			(CGL_int)i, mesh->vertices[i].bone_ids.x, mesh->vertices[i].bone_ids.y, mesh->vertices[i].bone_ids.z, mesh->vertices[i].bone_ids.w
		);
		strcat(buffer, temp_buffer);
	}
	strcat(buffer, "\n\tmesh->indices = (CGL_int []){ ");
	for (CGL_sizei i = 0; i < mesh->index_count; i++)
	{
		sprintf(temp_buffer, ((i == mesh->index_count - 1) ? "%d " : "%d, "), mesh->indices[i]);
		strcat(buffer, temp_buffer);
	}
	strcat(buffer, "};\n\n\treturn mesh;");
}

// shader

bool __CGL_shader_compile(const char* source, GLenum type, GLuint* handle, char** error)
{
	GLuint shader = glCreateShader(type);
	glShaderSource(shader, 1, (const GLchar**)(&source), NULL);
	glCompileShader(shader);
	GLint status = 0;
	glGetShaderiv(shader, GL_COMPILE_STATUS, &status);
	if (status == GL_FALSE)
	{
		GLint log_length = 0;
		glGetShaderiv(shader, GL_INFO_LOG_LENGTH, &log_length);
		char* log = (char*)malloc(log_length);
		glGetShaderInfoLog(shader, log_length, NULL, log);
		CGL_log_internal("%s\n", log);
		if (error) *error = log;
		else CGL_free(log);
		glDeleteShader(shader);
		return false;
	}
	*handle = shader;
	return true;
}

// create compute shader
CGL_shader* CGL_shader_compute_create(const char* compute_shader_source, char** error)
{
	if (error)
		*error = NULL;

	CGL_shader* shader = (CGL_shader*)malloc(sizeof(CGL_shader));
	if (shader == NULL)
		return NULL;
	shader->user_data = NULL;
	GLuint compute_shader = 0;
	if (!__CGL_shader_compile(compute_shader_source, GL_COMPUTE_SHADER, &compute_shader, error))
	{
		CGL_free(shader);
		return NULL;
	}

	GLuint program = glCreateProgram();
	glAttachShader(program, compute_shader);
	glLinkProgram(program);
	GLint status = 0;
	glGetProgramiv(program, GL_LINK_STATUS, &status);
	if (status == GL_FALSE)
	{
		GLint log_length = 0;
		glGetProgramiv(program, GL_INFO_LOG_LENGTH, &log_length);
		char* log = (char*)malloc(log_length);
		glGetProgramInfoLog(program, log_length, NULL, log);
		CGL_log_internal("%s\n", log);
		if (error) *error = log;
		else CGL_free(log);
		glDeleteProgram(program);
		glDeleteShader(compute_shader);
		CGL_free(shader);
		return NULL;
	}
	glDetachShader(program, compute_shader);
	glDeleteShader(compute_shader);
	shader->handle = program;
	return shader;
}

// create compute shader from files
CGL_shader* CGL_shader_compute_create_from_files(const char* compute_shader_file, char** error)
{
	char* compute_shader_source = CGL_utils_read_file(compute_shader_file, NULL);
	if (compute_shader_source == NULL)
	{
		CGL_log_internal("Failed to read compute shader file %s\n", compute_shader_file);
		return NULL;
	}
	CGL_shader* shader = CGL_shader_compute_create(compute_shader_source, error);
	CGL_free(compute_shader_source);
	return shader;
}

// create shader
CGL_shader* CGL_shader_create(const char* vertex_shader_source, const char* fragment_shader_source, char** error)
{
	if (error)
		*error = NULL;
	CGL_shader* shader = (CGL_shader*)malloc(sizeof(CGL_shader));
	if (shader == NULL)
		return NULL;
	shader->user_data = NULL;

	GLuint vertex_shader = 0;
	GLuint fragment_shader = 0;
	if (!__CGL_shader_compile(vertex_shader_source, GL_VERTEX_SHADER, &vertex_shader, error))
	{
		CGL_free(shader);
		return NULL;
	}

	if (!__CGL_shader_compile(fragment_shader_source, GL_FRAGMENT_SHADER, &fragment_shader, error))
	{
		glDeleteShader(vertex_shader);
		CGL_free(shader);
		return NULL;
	}

	GLuint program = glCreateProgram();
	glAttachShader(program, vertex_shader);
	glAttachShader(program, fragment_shader);
	glLinkProgram(program);
	GLint status = 0;
	glGetProgramiv(program, GL_LINK_STATUS, &status);
	if (status == GL_FALSE)
	{
		GLint log_length = 0;
		glGetProgramiv(program, GL_INFO_LOG_LENGTH, &log_length);
		char* log = (char*)malloc(log_length);
		glGetProgramInfoLog(program, log_length, NULL, log);
		CGL_log_internal("%s\n", log);
		if (error)  *error = log;
		else CGL_free(log);
		glDeleteProgram(program);
		glDeleteShader(vertex_shader);
		glDeleteShader(fragment_shader);
		CGL_free(shader);
		return NULL;
	}

	glDetachShader(program, vertex_shader);
	glDetachShader(program, fragment_shader);
	glDeleteShader(vertex_shader);
	glDeleteShader(fragment_shader);

	shader->handle = program;

	if (error)
		*error = NULL;
	return shader;
}

// create shader from files
CGL_shader* CGL_shader_create_from_files(const char* vertex_shader_file, const char* fragment_shader_file, char** error)
{
	char* vertex_shader_source = CGL_utils_read_file(vertex_shader_file, NULL);
	if (vertex_shader_source == NULL)
	{
		CGL_log_internal("Failed to read vertex shader file %s\n", vertex_shader_file);
		return NULL;
	}
	char* fragment_shader_source = CGL_utils_read_file(fragment_shader_file, NULL);
	if (fragment_shader_source == NULL)
	{
		CGL_log_internal("Failed to read fragment shader file %s\n", fragment_shader_file);
		CGL_free(vertex_shader_source);
		return NULL;
	}
	CGL_shader* shader = CGL_shader_create(vertex_shader_source, fragment_shader_source, error);
	CGL_free(vertex_shader_source);
	CGL_free(fragment_shader_source);
	return shader;
}

// destroy shader
CGL_void CGL_shader_destroy(CGL_shader* shader)
{
	glDeleteProgram(shader->handle);
	CGL_free(shader);
}

// dispatch compute shader
CGL_void CGL_shader_compute_dispatch(CGL_shader* shader, CGL_int x, CGL_int y, CGL_int z)
{
	glUseProgram(shader->handle);
	glDispatchCompute(x, y, z);
	glMemoryBarrier(GL_SHADER_STORAGE_BARRIER_BIT);
}

// bind shader
CGL_void CGL_shader_bind(CGL_shader* shader)
{
	glUseProgram(shader->handle);
}

// get uniform location
int CGL_shader_get_uniform_location(CGL_shader* shader, const char* name)
{
	(void)shader;
	return glGetUniformLocation(shader->handle, name);
}

// set uniform bool
CGL_void CGL_shader_set_uniform_bool(CGL_shader* shader, CGL_int location, bool value)
{
	(void)shader;
	glUniform1i(location, value);
}

// set uniform matrix
CGL_void CGL_shader_set_uniform_mat4(CGL_shader* shader, CGL_int location, CGL_mat4* matrix)
{
	(void)shader;
	glUniformMatrix4fv(location, 1, GL_FALSE, (GLfloat*)matrix->m);
	//glUniformMatrix4fv(location, 1, GL_TRUE, (GLfloat*)matrix);
}

// set uniform vector
CGL_void CGL_shader_set_uniform_vec4(CGL_shader* shader, CGL_int location, CGL_vec4* vector)
{
	(void)shader;
	glUniform4fv(location, 1, (GLfloat*)vector);
}

// set uniform vector
CGL_void CGL_shader_set_uniform_vec3(CGL_shader* shader, CGL_int location, CGL_vec3* vector)
{
	(void)shader;
	glUniform3fv(location, 1, (GLfloat*)vector);
}

// set uniform vector
CGL_void CGL_shader_set_uniform_vec2(CGL_shader* shader, CGL_int location, CGL_vec2* vector)
{
	(void)shader;
	glUniform2fv(location, 1, (GLfloat*)vector);
}

// set uniform int
CGL_void CGL_shader_set_uniform_int(CGL_shader* shader, CGL_int location, CGL_int value)
{
	(void)shader;
	glUniform1i(location, value);
}

// set uniform float
CGL_void CGL_shader_set_uniform_float(CGL_shader* shader, CGL_int location, CGL_float value)
{
	(void)shader;
	glUniform1f(location, value);
}

// set uniform double
CGL_void CGL_shader_set_uniform_double(CGL_shader* shader, CGL_int location, CGL_double value)
{
	(void)shader;
	glUniform1d(location, value);
}

// set uniform vector
CGL_void CGL_shader_set_uniform_vec2v(CGL_shader* shader, CGL_int location, CGL_float x, CGL_float y)
{
	(void)shader;
	glUniform2f(location, x, y);
}

// set uniform vector
CGL_void CGL_shader_set_uniform_vec3v(CGL_shader* shader, CGL_int location, CGL_float x, CGL_float y, CGL_float z)
{
	(void)shader;
	glUniform3f(location, x, y, z);
}

// set uniform vector
CGL_void CGL_shader_set_uniform_vec4v(CGL_shader* shader, CGL_int location, CGL_float x, CGL_float y, CGL_float z, CGL_float w)
{
	(void)shader;
	glUniform4f(location, x, y, z, w);
}

CGL_void CGL_shader_set_uniform_ivec2v(CGL_shader* shader, CGL_int location, CGL_int x, CGL_int y)
{
	(void)shader;
	glUniform2i(location, x, y);
}

// set uniform vector
CGL_void CGL_shader_set_uniform_ivec3v(CGL_shader* shader, CGL_int location, CGL_int x, CGL_int y, CGL_int z)
{
	(void)shader;
	glUniform3i(location, x, y, z);
}

// set uniform vector
CGL_void CGL_shader_set_uniform_ivec4v(CGL_shader* shader, CGL_int location, CGL_int x, CGL_int y, CGL_int z, CGL_int w)
{
	(void)shader;
	glUniform4i(location, x, y, z, w);
}

// set shader user data
CGL_void CGL_shader_set_user_data(CGL_shader* shader, void* user_data)
{
	shader->user_data = user_data;
}

// get shader user data
CGL_void* CGL_shader_get_user_data(CGL_shader* shader)
{
	return shader->user_data;
}


// BLOOM
#ifndef CGL_EXCLUDE_BLOOM

struct CGL_bloom
{
	CGL_texture* tex_lod[CGL_BLOOM_MAX_ITERATIONS * 2];
	CGL_texture* prefiltered;
	CGL_shader* compute;
	CGL_float offset_x;
	CGL_float offset_y;
	CGL_int width;
	CGL_int height;
	CGL_int iterations;
	CGL_float threshold;
	CGL_float knee;
	CGL_int cs_u_mode;
	CGL_int cs_u_src_size;
	CGL_int cs_u_dst_size;
	CGL_int cs_u_prefilter_threshold;
	CGL_int cs_u_offset;
};

const char* __CGL_BLOOM_SHADER_SOURCE = "#version 430 core\n"
"layout(local_size_x = 16, local_size_y = 16) in;\n"
"layout(rgba32f, binding = 0) uniform image2D tex_src;\n"
"layout(rgba32f, binding = 1) uniform image2D tex_dst;\n"
"\n"
"#define MODE_PREFILTER      0\n"
"#define MODE_DOWNSAMPLE     1\n"
"#define MODE_UPSAMPLE       2\n"
"#define MODE_COMPOSITE      3\n"
"\n"
"uniform int u_mode;\n"
"uniform vec2 u_src_size;\n"
"uniform ivec2 u_offset;\n"
"uniform vec2 u_dst_size;\n"
"uniform vec4 u_prefilter_threshold;\n"
"\n"
"vec4 prefilter(vec4 color)\n"
"{\n"
"    // pixel brightness\n"
"    float br = max(color.x, max(color.y, color.z));\n"
"\n"
"    // under-threshold part : quadratic curve\n"
"    vec3 curve = u_prefilter_threshold.yzw; // curve = (threshold - knee, knee * 2, 0.25 / knee)\n"
"    float rq = clamp(br - curve.x, 0.0f, curve.y);\n"
"    rq = curve.z * rq * rq;\n"
"\n"
"    //  combine and apply the brightness response curve\n"
"    float threshold = u_prefilter_threshold.x;\n"
"    color *= max(rq, br - threshold) / max(br, 0.00001f);\n"
"    //color *= (br - threshold) / max(br, 0.00001f);\n"
"\n"
"    return color;\n"
"}\n"
"\n"
"vec4 downsample_box_13_tap(ivec2 src_coord)\n"
"{\n"
"    vec4 A = imageLoad(tex_src, src_coord + ivec2(-2, -2));\n"
"    vec4 B = imageLoad(tex_src, src_coord + ivec2( 0, -2));\n"
"    vec4 C = imageLoad(tex_src, src_coord + ivec2( 2, -2));\n"
"    vec4 D = imageLoad(tex_src, src_coord + ivec2(-1, -1));\n"
"    vec4 E = imageLoad(tex_src, src_coord + ivec2( 1, -1));\n"
"    vec4 F = imageLoad(tex_src, src_coord + ivec2(-2,  0));\n"
"    vec4 G = imageLoad(tex_src, src_coord                );\n"
"    vec4 H = imageLoad(tex_src, src_coord + ivec2( 2,  0));\n"
"    vec4 I = imageLoad(tex_src, src_coord + ivec2(-1,  1));\n"
"    vec4 J = imageLoad(tex_src, src_coord + ivec2( 1,  1));\n"
"    vec4 K = imageLoad(tex_src, src_coord + ivec2(-2,  2));\n"
"    vec4 L = imageLoad(tex_src, src_coord + ivec2( 0,  2));\n"
"    vec4 M = imageLoad(tex_src, src_coord + ivec2( 2,  2));\n"
"\n"
"    vec2 div = (1.0f / 4.0f) * vec2(0.5f, 0.125f);\n"
"\n"
"    vec4 o = (D + E + I + J) * div.x;\n"
"    o += (A + B + G + F) * div.y;\n"
"    o += (B + C + H + G) * div.y;\n"
"    o += (F + G + L + K) * div.y;\n"
"    o += (G + H + M + L) * div.y;\n"
"\n"
"        //pixel = imageLoad(tex_src, pixel_coords);\n"
"    return o;\n"
"}\n"
"\n"
"vec4 upsample_tent(ivec2 src_coord)\n"
"{\n"
"    ivec4 d = ivec4(1, 1, -1, 0);\n"
"\n"
"    vec4 s;\n"
"    s =  imageLoad(tex_src, src_coord - d.xy);\n"
"    s += imageLoad(tex_src, src_coord - d.wy) * 2.0f;\n"
"    s += imageLoad(tex_src, src_coord - d.zy);\n"
"    s += imageLoad(tex_src, src_coord + d.zw) * 2.0f;\n"
"    s += imageLoad(tex_src, src_coord       ) * 4.0f;\n"
"    s += imageLoad(tex_src, src_coord + d.xw) * 2.0f;\n"
"    s += imageLoad(tex_src, src_coord + d.zy);\n"
"    s += imageLoad(tex_src, src_coord + d.wy) * 2.0f;\n"
"    s += imageLoad(tex_src, src_coord + d.xy);\n"
"\n"
"    return s * (1.0f / 16.0f);\n"
"}\n"
"\n"
"vec3 aces_tonemap(vec3 x){	\n"
"	const float a = 2.51f;\n"
"    const float b = 0.03f;\n"
"    const float c = 2.43f;\n"
"    const float d = 0.59f;\n"
"    const float e = 0.14f;\n"
"    return clamp((x * (a * x + b)) / (x * (c * x + d ) + e), 0.0f, 1.0f);\n"
"}\n"
"\n"
"void main() {\n"
"    if(u_mode == MODE_PREFILTER)\n"
"    {\n"
"        vec4 pixel = vec4(1.0f, 1.0f, 0.0f, 1.0f);    \n"
"        ivec2 pixel_coords = ivec2(gl_GlobalInvocationID.xy);    \n"
"        pixel = imageLoad(tex_src, pixel_coords);\n"
"        imageStore(tex_dst, pixel_coords, prefilter(pixel));\n"
"    }\n"
"    else if(u_mode == MODE_DOWNSAMPLE)\n"
"    {\n"
"        vec4 pixel = vec4(1.0f, 0.0f, 1.0f, 1.0f);    \n"
"        ivec2 dst_pixel_coords = ivec2(gl_GlobalInvocationID.xy);    \n"
"        vec2 uv = vec2(dst_pixel_coords) / u_dst_size;\n"
"        ivec2 src_pixel_coords = ivec2(uv * u_src_size);\n"
"        imageStore(tex_dst, dst_pixel_coords, downsample_box_13_tap(src_pixel_coords));\n"
"    }\n"
"    else if(u_mode == MODE_UPSAMPLE)\n"
"    {\n"
"        vec4 pixel = vec4(1.0f, 0.0f, 1.0f, 1.0f);    \n"
"        ivec2 dst_pixel_coords = ivec2(gl_GlobalInvocationID.xy);    \n"
"        vec2 uv = vec2(dst_pixel_coords) / u_dst_size;\n"
"        ivec2 src_pixel_coords = ivec2(uv * u_src_size);\n"
"        imageStore(tex_dst, dst_pixel_coords, upsample_tent(src_pixel_coords));\n"
"    }\n"
"    else if(u_mode == MODE_COMPOSITE)\n"
"    {\n"
"        vec4 pixel = vec4(0.0f, 0.0f, 0.0f, 0.0f);    \n"
"        ivec2 pixel_coords = ivec2(gl_GlobalInvocationID.xy);\n"
"        ivec2 pixel_coords2 = ivec2(gl_GlobalInvocationID.xy) + u_offset;\n"
"        pixel += imageLoad(tex_dst, pixel_coords); \n"
"        pixel += imageLoad(tex_src, pixel_coords2); \n"
"        pixel = vec4(pixel.xyz, clamp(pixel.w, 0.0f, 1.0f));\n"
"        imageStore(tex_dst, pixel_coords, pixel); \n"
"    }\n"
"    else\n"
"    {\n"
"        vec4 pixel = vec4(1.0f, 0.0f, 0.0f, 1.0f);    \n"
"        ivec2 pixel_coords = ivec2(gl_GlobalInvocationID.xy);\n"
"        imageStore(tex_dst, pixel_coords, pixel);\n"
"    }\n"
"}";

CGL_bloom* CGL_bloom_create(CGL_int width, CGL_int height, CGL_int iterations)
{
	CGL_bloom* bloom = (CGL_bloom*)CGL_malloc(sizeof(CGL_bloom));
	if (bloom == NULL) return NULL;
	bloom->threshold = 0.5f;
	bloom->knee = 0.5f;
	bloom->iterations = 0;
	bloom->width = width;
	bloom->height = height;
	bloom->offset_x = 0.0f;
	bloom->offset_y = 0.0f;
	iterations = CGL_utils_min(CGL_utils_max(1, iterations), CGL_BLOOM_MAX_ITERATIONS);
	bloom->prefiltered = CGL_texture_create_blank(width, height, GL_RGBA, GL_RGBA32F, GL_FLOAT);
	CGL_int i = 0;
	for (i = 0; i < iterations; i++)
	{
		width /= 2; height /= 2;
		if (width < 10 || height < 10)
		{
			width *= 2; height *= 2;
			iterations = i;
			break;
		}
		bloom->tex_lod[i] = CGL_texture_create_blank(width, height, GL_RGBA, GL_RGBA32F, GL_FLOAT);
	}
	for (; i < 2 * iterations; i++)
	{
		width *= 2; height *= 2;
		if (i == 2 * iterations - 1) { width = bloom->width; height = bloom->height; }
		bloom->tex_lod[i] = CGL_texture_create_blank(width, height, GL_RGBA, GL_RGBA32F, GL_FLOAT);
	}
	bloom->iterations = iterations;
	bloom->compute = CGL_shader_compute_create(__CGL_BLOOM_SHADER_SOURCE, NULL);
	bloom->cs_u_mode = CGL_shader_get_uniform_location(bloom->compute, "u_mode");
	bloom->cs_u_src_size = CGL_shader_get_uniform_location(bloom->compute, "u_src_size");
	bloom->cs_u_dst_size = CGL_shader_get_uniform_location(bloom->compute, "u_dst_size");
	bloom->cs_u_prefilter_threshold = CGL_shader_get_uniform_location(bloom->compute, "u_prefilter_threshold");
	bloom->cs_u_offset = CGL_shader_get_uniform_location(bloom->compute, "u_offset");
	return bloom;
}

CGL_void CGL_bloom_destroy(CGL_bloom* bloom)
{
	CGL_texture_destroy(bloom->prefiltered);
	for (CGL_int i = 0; i < bloom->iterations * 2; i++)
		CGL_texture_destroy(bloom->tex_lod[i]);
	CGL_shader_destroy(bloom->compute);
	CGL_free(bloom);
}

CGL_void CGL_bloom_apply2(CGL_bloom* bloom, CGL_texture* tex_src, CGL_texture* tex_dst)
{
	CGL_shader_bind(bloom->compute);

	// prefilter
	glBindImageTexture(0, tex_src->handle, 0, GL_FALSE, 0, GL_READ_ONLY, GL_RGBA32F);
	glBindImageTexture(1, bloom->prefiltered->handle, 0, GL_FALSE, 0, GL_WRITE_ONLY, GL_RGBA32F);
	CGL_shader_set_uniform_int(bloom->compute, bloom->cs_u_mode, CGL_BLOOM_SHADER_MODE_PREFILTER);
	CGL_shader_set_uniform_vec2v(bloom->compute, bloom->cs_u_src_size, (float)bloom->width, (float)bloom->height);
	CGL_shader_set_uniform_vec2v(bloom->compute, bloom->cs_u_dst_size, (float)bloom->width, (float)bloom->height);
	CGL_shader_set_uniform_vec4v(bloom->compute, bloom->cs_u_prefilter_threshold, bloom->threshold, bloom->threshold - bloom->knee, bloom->knee * 2.0f, 0.25f / bloom->knee);
	CGL_shader_compute_dispatch(bloom->compute, bloom->width / 16 + 1, bloom->height / 16 + 1, 1);
	glMemoryBarrier(GL_SHADER_IMAGE_ACCESS_BARRIER_BIT);

	// downsample
	glBindImageTexture(0, bloom->prefiltered->handle, 0, GL_FALSE, 0, GL_READ_ONLY, GL_RGBA32F);
	glBindImageTexture(1, bloom->tex_lod[0]->handle, 0, GL_FALSE, 0, GL_WRITE_ONLY, GL_RGBA32F);
	CGL_shader_set_uniform_int(bloom->compute, bloom->cs_u_mode, CGL_BLOOM_SHADER_MODE_DOWNSAMPLE);
	CGL_shader_set_uniform_vec2v(bloom->compute, bloom->cs_u_src_size, (float)bloom->width, (float)bloom->height);
	CGL_shader_set_uniform_vec2v(bloom->compute, bloom->cs_u_dst_size, (float)bloom->tex_lod[0]->width, (float)bloom->tex_lod[0]->height);
	CGL_shader_compute_dispatch(bloom->compute, bloom->tex_lod[0]->width / 16 + 1, bloom->tex_lod[0]->height / 16 + 1, 1);
	glMemoryBarrier(GL_SHADER_IMAGE_ACCESS_BARRIER_BIT);

	CGL_int i = 0;
	for (i = 0; i < bloom->iterations - 1; i++)
	{
		glBindImageTexture(0, bloom->tex_lod[i]->handle, 0, GL_FALSE, 0, GL_READ_ONLY, GL_RGBA32F);
		glBindImageTexture(1, bloom->tex_lod[i + 1]->handle, 0, GL_FALSE, 0, GL_WRITE_ONLY, GL_RGBA32F);
		CGL_shader_set_uniform_int(bloom->compute, bloom->cs_u_mode, CGL_BLOOM_SHADER_MODE_DOWNSAMPLE);
		CGL_shader_set_uniform_vec2v(bloom->compute, bloom->cs_u_src_size, (float)bloom->tex_lod[i]->width, (float)bloom->tex_lod[i]->height);
		CGL_shader_set_uniform_vec2v(bloom->compute, bloom->cs_u_dst_size, (float)bloom->tex_lod[i + 1]->width, (float)bloom->tex_lod[i + 1]->height);
		CGL_shader_compute_dispatch(bloom->compute, bloom->tex_lod[i + 1]->width / 16 + 1, bloom->tex_lod[i + 1]->height / 16 + 1, 1);
		glMemoryBarrier(GL_SHADER_IMAGE_ACCESS_BARRIER_BIT);
	}

	// upsample
	for (; i < 2 * bloom->iterations - 1; i++)
	{
		glBindImageTexture(0, bloom->tex_lod[i]->handle, 0, GL_FALSE, 0, GL_READ_ONLY, GL_RGBA32F);
		glBindImageTexture(1, bloom->tex_lod[i + 1]->handle, 0, GL_FALSE, 0, GL_WRITE_ONLY, GL_RGBA32F);
		CGL_shader_set_uniform_int(bloom->compute, bloom->cs_u_mode, CGL_BLOOM_SHADER_MODE_UPSAMPLE);
		CGL_shader_set_uniform_vec2v(bloom->compute, bloom->cs_u_src_size, (float)bloom->tex_lod[i]->width, (float)bloom->tex_lod[i]->height);
		CGL_shader_set_uniform_vec2v(bloom->compute, bloom->cs_u_dst_size, (float)bloom->tex_lod[i + 1]->width, (float)bloom->tex_lod[i + 1]->height);
		CGL_shader_compute_dispatch(bloom->compute, bloom->tex_lod[i + 1]->width / 16 + 1, bloom->tex_lod[i + 1]->height / 16 + 1, 1);
		glMemoryBarrier(GL_SHADER_IMAGE_ACCESS_BARRIER_BIT);
	}

	// composite
	glBindImageTexture(0, bloom->tex_lod[bloom->iterations * 2 - 1]->handle, 0, GL_FALSE, 0, GL_READ_WRITE, GL_RGBA32F);
	glBindImageTexture(1, tex_dst->handle, 0, GL_FALSE, 0, GL_READ_WRITE, GL_RGBA32F);
	CGL_shader_set_uniform_int(bloom->compute, bloom->cs_u_mode, CGL_BLOOM_SHADER_MODE_COMPOSITE);
	CGL_shader_set_uniform_vec2v(bloom->compute, bloom->cs_u_src_size, (float)bloom->width, (float)bloom->height);
	CGL_shader_set_uniform_vec2v(bloom->compute, bloom->cs_u_dst_size, (float)bloom->width, (float)bloom->height);
	CGL_shader_set_uniform_ivec2v(bloom->compute, bloom->cs_u_offset, (int)bloom->offset_x, (int)bloom->offset_y);
	CGL_shader_compute_dispatch(bloom->compute, bloom->width / 16 + 1, bloom->height / 16 + 1, 1);
	glMemoryBarrier(GL_SHADER_IMAGE_ACCESS_BARRIER_BIT);
}

CGL_void CGL_bloom_apply(CGL_bloom* bloom, CGL_texture* tex)
{
	CGL_bloom_apply2(bloom, tex, tex);
}

CGL_texture* CGL_bloom_get_lod_texture(CGL_bloom* bloom, CGL_int index)
{
	return bloom->tex_lod[index];
}

CGL_texture* CGL_bloom_get_prefiltered_texture(CGL_bloom* bloom)
{
	return bloom->prefiltered;
}

CGL_void CGL_bloom_set_knee(CGL_bloom* bloom, CGL_float val)
{
	bloom->knee = val;
}

float CGL_bloom_get_knee(CGL_bloom* bloom)
{
	return bloom->knee;
}

CGL_void CGL_bloom_set_threshold(CGL_bloom* bloom, CGL_float val)
{
	bloom->threshold = val;
}

float CGL_bloom_get_threshold(CGL_bloom* bloom)
{
	return bloom->threshold;
}

int CGL_bloom_get_iterations(CGL_bloom* bloom)
{
	return bloom->iterations;
}

CGL_void CGL_bloom_set_offset(CGL_bloom* bloom, CGL_float x, CGL_float y)
{
	bloom->offset_x = x;
	bloom->offset_y = y;
}

#endif

#endif

#endif

// camera
#if 1

struct CGL_camera
{
	bool is_perspective;
	CGL_vec4 ortho_limits;
	CGL_vec3 position;
	CGL_vec3 rotation;
	CGL_vec3 front;
	CGL_vec3 right;
	CGL_vec3 up;
	CGL_float fov;
	CGL_float aspect;
	CGL_float z_near;
	CGL_float z_far;
	CGL_mat4 projection;
	CGL_mat4 view;
	CGL_mat4 pv;
};

CGL_camera* CGL_camera_create()
{
	CGL_camera* camera = (CGL_camera*)malloc(sizeof(CGL_camera));
	if (!camera) return NULL;
	camera->is_perspective = true;
	camera->ortho_limits = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	camera->position = CGL_vec3_init(0.0f, 0.0f, -1.0f);
	camera->rotation = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	camera->fov = 45.0f;
	camera->aspect = 1.0f;
	camera->z_near = 0.001f;
	camera->z_far = 1000.0f;
	return camera;
}

CGL_void CGL_camera_destroy(CGL_camera* camera)
{
	CGL_free(camera);
}

bool CGL_camera_is_perspective(CGL_camera* camera)
{
	return camera->is_perspective;
}

bool CGL_camera_is_orthographic(CGL_camera* camera)
{
	return !camera->is_perspective;
}

float CGL_camera_get_fov(CGL_camera* camera)
{
	return camera->fov;
}

float CGL_camera_get_aspect_ratio(CGL_camera* camera)
{
	return camera->aspect;
}

float CGL_camera_get_z_near(CGL_camera* camera)
{
	return camera->z_near;
}

float CGL_camera_get_z_far(CGL_camera* camera)
{
	return camera->z_far;
}

CGL_vec4 CGL_camera_get_orthographic_limits(CGL_camera* camera)
{
	return camera->ortho_limits;
}

CGL_void CGL_camera_set_fov(CGL_camera* camera, CGL_float fov)
{
	camera->fov = fov;
}

CGL_void CGL_camera_set_aspect_ratio(CGL_camera* camera, CGL_float aspect_ratio)
{
	if (fabs(aspect_ratio) < 0.001f || fabs(aspect_ratio) > 100.0f)aspect_ratio = 1.0f;
	camera->aspect = aspect_ratio;
}

CGL_void CGL_camera_set_z_near(CGL_camera* camera, CGL_float z_near)
{
	camera->z_near = z_near;
}

CGL_void CGL_camera_set_z_far(CGL_camera* camera, CGL_float z_far)
{
	camera->z_far = z_far;
}

CGL_void CGL_camera_set_orthographic_limits(CGL_camera* camera, CGL_vec4 ortho_limits)
{
	camera->ortho_limits = ortho_limits;
}

CGL_void CGL_camera_set_perspective(CGL_camera* camera)
{
	camera->is_perspective = true;
}

CGL_void CGL_camera_set_orthographic(CGL_camera* camera)
{
	camera->is_perspective = false;
}

CGL_mat4 CGL_camera_get_projection_mat(CGL_camera* camera)
{
	return camera->projection;
}

CGL_mat4* CGL_camera_get_projection_mat_ptr(CGL_camera* camera)
{
	return &camera->projection;
}

CGL_mat4 CGL_camera_get_view_mat(CGL_camera* camera)
{
	return camera->view;
}

CGL_mat4* CGL_camera_get_view_mat_ptr(CGL_camera* camera)
{
	return &camera->view;
}

CGL_mat4 CGL_camera_get_pv_mat(CGL_camera* camera)
{
	return camera->pv;
}

CGL_mat4* CGL_camera_get_pv_mat_ptr(CGL_camera* camera)
{
	return &camera->pv;
}

CGL_void CGL_camera_set_position(CGL_camera* camera, CGL_vec3 position)
{
	camera->position = position;
}

CGL_void CGL_camera_set_rotation(CGL_camera* camera, CGL_vec3 rotation)
{
	camera->rotation = rotation;
}

CGL_vec3 CGL_camera_get_position(CGL_camera* camera)
{
	return camera->position;
}

CGL_vec3 CGL_camera_get_rotation(CGL_camera* camera)
{
	return camera->rotation;
}

CGL_vec3* CGL_camera_get_position_ptr(CGL_camera* camera)
{
	return &camera->position;
}

CGL_vec3* CGL_camera_get_rotation_ptr(CGL_camera* camera)
{
	return &camera->rotation;
}

CGL_vec3 CGL_camera_get_front(CGL_camera* camera)
{
	return camera->front;
}

CGL_vec3 CGL_camera_get_right(CGL_camera* camera)
{
	return camera->right;
}

CGL_vec3 CGL_camera_get_up(CGL_camera* camera)
{
	return camera->up;
}

CGL_void CGL_camera_recalculate_mat(CGL_camera* camera)
{
	if (camera->is_perspective)
		camera->projection = CGL_mat4_perspective(camera->aspect, camera->fov, camera->z_near, camera->z_far);
	else
	{
		printf("Ortho graphic projections not yet supported!\n"); CGL_exit(EXIT_FAILURE);
	}

	CGL_vec3 z_axis = CGL_vec3_init(0.0f, 0.0f, 1.0f);
	z_axis = CGL_vec3_rotate_x(z_axis, camera->rotation.x);
	z_axis = CGL_vec3_rotate_y(z_axis, camera->rotation.y);
	z_axis = CGL_vec3_rotate_z(z_axis, camera->rotation.z);
	camera->front = z_axis;

	CGL_vec3 x_axis = CGL_vec3_init(1.0f, 0.0f, 0.0f);
	x_axis = CGL_vec3_rotate_x(x_axis, camera->rotation.x);
	x_axis = CGL_vec3_rotate_y(x_axis, camera->rotation.y);
	x_axis = CGL_vec3_rotate_z(x_axis, camera->rotation.z);
	camera->right = x_axis;

	CGL_vec3 y_axis = CGL_vec3_cross(z_axis, x_axis);
	camera->up = y_axis;

	camera->view.m[0] = x_axis.x;
	camera->view.m[1] = x_axis.y;
	camera->view.m[2] = x_axis.z;
	camera->view.m[3] = -1.0f * CGL_vec3_dot(camera->position, x_axis);
	camera->view.m[4] = y_axis.x;
	camera->view.m[5] = y_axis.y;
	camera->view.m[6] = y_axis.z;
	camera->view.m[7] = -1.0f * CGL_vec3_dot(camera->position, y_axis);
	camera->view.m[8] = z_axis.x;
	camera->view.m[9] = z_axis.y;
	camera->view.m[10] = z_axis.z;
	camera->view.m[11] = -1.0f * CGL_vec3_dot(camera->position, z_axis);
	camera->view.m[12] = 0.0f;
	camera->view.m[13] = 0.0f;
	camera->view.m[14] = 0.0f;
	camera->view.m[15] = 1.0f;

	camera->pv = CGL_mat4_mul(camera->projection, camera->view);
}

#endif

// phong renderer
#ifndef CGL_EXCLUDE_GRAPHICS_API // cannot have PHONG RENDERER without Graphics API

// The phong renderer
#if 1
#ifndef CGL_EXCLUDE_PHONG_RENDERER


struct CGL_phong_mat
{
	bool use_diffuse_texture;
	CGL_vec3 diffuse_color;
	CGL_texture* diffuse_texture;
	CGL_image* diffuse_image;
	bool use_specular_texture;
	CGL_vec3 specular_color;
	CGL_texture* specular_texture;
	CGL_image* specular_image;
	bool use_normal_map;
	CGL_texture* normal_map_texture;
	CGL_image* normal_map_image;
	CGL_float shininess;
	bool wireframe;
	void* user_data;
};

struct CGL_phong_pipeline
{
	bool use_blinn;
	CGL_shader* shader;
	CGL_phong_light* lights[CGL_PHONG_MAX_LIGHTS];
	CGL_vec3 ambient_light_color;
	CGL_float ambient_light_strength;
	uint32_t light_count;
	bool use_gamma_correction;
	bool depth_testing;
	void* user_data;
	// uniform locations
	CGL_int u_lights_v4[4][CGL_PHONG_MAX_LIGHTS];
	CGL_int u_projection;
	CGL_int u_view;
	CGL_int u_pv;
	CGL_int u_model_matrix;
	CGL_int u_light_count;
	CGL_int u_use_diffuse_texture;
	CGL_int u_diffuse_color;
	CGL_int u_diffuse_texture;
	CGL_int u_use_specular_texture;
	CGL_int u_specular_color;
	CGL_int u_specular_texture;
	CGL_int u_use_normal_map;
	CGL_int u_normal_map_texture;
	CGL_int u_shininess;
	CGL_int u_camera_position;
	CGL_int u_use_blinn;
	CGL_int u_ambient_light_color;
	CGL_int u_ambient_light_strength;
	CGL_int u_use_gamma_correction;
};

struct CGL_phong_light
{
	uint32_t light_type;
	CGL_vec3 vector;
	CGL_vec3 color;
	CGL_float intensity;
	CGL_float constant;
	CGL_float linear;
	CGL_float quadratic;
	void* user_data;
};

static const char* __CGL_PHONG_VERTEX_SHADER =
#ifdef CGL_WASM
"#version 300 es\n"
"precision highp float;\n"
"precision highp int;\n"
"\n"
"in vec4 position;\n"
"in vec4 normal;\n"
"in vec4 texcoord;\n"
#else
"#version 430 core\n"
"\n"
"layout (location = 0) in vec4 position;\n"
"layout (location = 1) in vec4 normal;\n"
"layout (location = 2) in vec4 texcoord;\n"
#endif
"\n"
"out vec3 Position;\n"
"out vec3 Normal;\n"
"out vec2 TexCoord; \n"
"\n"
"uniform mat4 u_projection;\n"
"uniform mat4 u_view;\n"
"uniform mat4 u_pv;\n"
"uniform mat4 u_model_matrix;\n"
"\n"
"void main()\n"
"{\n"
"	gl_Position = u_projection * u_view * transpose(u_model_matrix) * vec4(position.xyz, 1.0f);\n"
"	Position = (transpose(u_model_matrix) * position).xyz;\n"
"	Normal = normal.xyz;\n"
"	TexCoord = texcoord.xy;		\n"
"}";


static const char* __CGL_PHONG_FRAGMENT_SHADER =
#ifdef CGL_WASM
"#version 300 es\n"
"precision highp float;\n"
"precision highp int;\n"
#else
"#version 430 core\n"
#endif
"\n"
"#define MAX_LIGHTS             16\n"
"\n"
"#define LIGHT_TYPE_DIRECTIONAL      0.5f\n"
"#define LIGHT_TYPE_POINT            1.5f\n"
"#define LIGHT_TYPE_SPOT             2.5f\n"
"#define LIGHT_TYPE(index)      u_lights_data_1[index].x\n"
"#define LIGHT_CONSTANT(index ) u_lights_data_1[index].y\n"
"#define LIGHT_LINEAR(index)    u_lights_data_1[index].z\n"
"#define LIGHT_QUADRATIC(index) u_lights_data_1[index].w\n"
"#define LIGHT_COLOR(index)     vec4(u_lights_data_0[index].xyz, 1.0f)\n"
"#define LIGHT_INTENSITY(index) u_lights_data_0[index].w\n"
"#define LIGHT_VECTOR(index)    u_lights_data_2[index].xyz\n"
"\n"
"out vec4 FragColor;\n"
"//out CGL_int MousePick0;\n"
"//out CGL_int MousePick1;\n"
"//out CGL_int MousePick2;\n"
"in vec3 Position;\n"
"in vec3 Normal;\n"
"in vec2 TexCoord;\n"
"\n"
"\n"
"// unifroms\n"
"uniform vec4 u_lights_data_0[MAX_LIGHTS];\n"
"uniform vec4 u_lights_data_1[MAX_LIGHTS];\n"
"uniform vec4 u_lights_data_2[MAX_LIGHTS];\n"
"uniform vec4 u_lights_data_3[MAX_LIGHTS];\n"
"\n"
"uniform mat4 u_projection;\n"
"uniform mat4 u_view;\n"
"uniform mat4 u_pv;\n"
"uniform mat4 u_model_matrix;\n"
"uniform int u_light_count;\n"
"uniform bool u_use_diffuse_texture;\n"
"uniform vec3 u_diffuse_color;\n"
"uniform sampler2D u_diffuse_texture;\n"
"uniform bool u_use_specular_texture;\n"
"uniform vec3 u_specular_color;\n"
"uniform sampler2D u_specular_texture;\n"
"uniform bool u_use_normal_map;\n"
"uniform sampler2D u_normal_map_texture;\n"
"uniform float u_shininess;\n"
"uniform vec3 u_camera_position;\n"
"uniform bool u_use_blinn;\n"
"uniform vec3 u_ambient_light_color;\n"
"uniform float u_ambient_light_strength;\n"
"uniform bool u_use_gamma_correction;\n"
"\n"
"vec4 get_material_diffuse_color()\n"
"{\n"
"    if(u_use_diffuse_texture)\n"
"        return vec4(pow(texture(u_diffuse_texture, TexCoord).xyz, vec3(2.2f)), 1.0f);\n"
"    return vec4(u_diffuse_color, 1.0f);\n"
"}\n"
"\n"
"vec4 get_material_specular_color()\n"
"{\n"
"    if(u_use_specular_texture)\n"
"        return vec4(pow(texture(u_specular_texture, TexCoord).xyz, vec3(2.2f)), 1.0f);\n"
"    return vec4(u_specular_color, 1.0f);\n"
"}\n"
"\n"
"\n"
"vec3 aces_tonemap(vec3 x){	\n"
"	const float a = 2.51f;\n"
"    const float b = 0.03f;\n"
"    const float c = 2.43f;\n"
"    const float d = 0.59f;\n"
"    const float e = 0.14f;\n"
"    return clamp((x * (a * x + b)) / (x * (c * x + d ) + e), 0.0f, 1.0f);\n"
"}\n"
"\n"
"vec4 calculate_directional_light(int index)\n"
"{\n"
"    vec3 light_direcion = normalize(-LIGHT_VECTOR(index));\n"
"    // diffuse shading\n"
"    float diff = max(dot(Normal, light_direcion), 0.0f);\n"
"    // specular shading\n"
"    vec3 view_dir = normalize(u_camera_position - Position);\n"
"    float spec = 0.0f;\n"
"    if(u_use_blinn)\n"
"    {\n"
"        vec3 halfway_direction = normalize(light_direcion + view_dir);\n"
"        spec = pow(max(dot(view_dir, halfway_direction), 0.0f), u_shininess);\n"
"    }\n"
"    else\n"
"    {\n"
"        vec3 reflect_direction = reflect(-light_direcion, Normal);\n"
"        spec = pow(max(dot(view_dir, reflect_direction), 0.0f), u_shininess);\n"
"    }\n"
"    vec4 material_diffuse = get_material_diffuse_color();\n"
"    vec4 material_specular = get_material_specular_color();\n"
"    vec4 ambient_lighting = vec4(u_ambient_light_color * u_ambient_light_strength, 1.0f);\n"
"    vec4 diffuse_lighting = LIGHT_COLOR(index) * diff * material_diffuse;\n"
"    vec4 specular_lighting = LIGHT_COLOR(index) * spec * material_specular;\n"
"    return (ambient_lighting + diffuse_lighting + specular_lighting) * LIGHT_INTENSITY(index);\n"
"}\n"
"\n"
"vec4 calculate_point_light(int index)\n"
"{\n"
"    vec3 light_direcion = normalize(LIGHT_VECTOR(index) - Position);\n"
"    // diffuse shading\n"
"    float diff = max(dot(Normal, light_direcion), 0.0f);\n"
"    // specular shading\n"
"    vec3 view_dir = normalize(u_camera_position - Position);\n"
"    float spec = 0.0f;\n"
"    if(u_use_blinn)\n"
"    {\n"
"        vec3 halfway_direction = normalize(light_direcion + view_dir);\n"
"        spec = pow(max(dot(view_dir, halfway_direction), 0.0f), u_shininess);\n"
"    }\n"
"    else\n"
"    {\n"
"        vec3 reflect_direction = reflect(-light_direcion, Normal);\n"
"        spec = pow(max(dot(view_dir, reflect_direction), 0.0f), u_shininess);\n"
"    }\n"
"\n"
"    vec4 material_diffuse = get_material_diffuse_color();\n"
"    vec4 material_specular = get_material_specular_color();\n"
"    // attrnuation\n"
"    float distance = length(LIGHT_VECTOR(index) - Position);\n"
"    float attenuation = 1.0f / ( LIGHT_CONSTANT(index) + LIGHT_LINEAR(index) * distance + LIGHT_QUADRATIC(index) * (distance * distance));\n"
"    vec4 ambient_lighting = vec4(u_ambient_light_color * u_ambient_light_strength, 1.0f);\n"
"    vec4 diffuse_lighting = LIGHT_COLOR(index) * diff * material_diffuse;\n"
"    vec4 specular_lighting = LIGHT_COLOR(index) * spec * material_specular;\n"
"    return (ambient_lighting + diffuse_lighting + specular_lighting) * attenuation * LIGHT_INTENSITY(index);\n"
"}\n"
"\n"
"vec4 calculate_spot_light(int index)\n"
"{\n"
"    return vec4(0.0f);\n"
"}\n"
"\n"
"\n"
"void main()\n"
"{\n"
"    vec4 color = vec4(0.0f, 1.0f, 0.0f, 1.0f);\n"
"    vec4 light_output = vec4(0.0f);\n"
"    for ( int i = 0 ; i < u_light_count ; i++)\n"
"    {\n"
"        if(LIGHT_TYPE(i) < LIGHT_TYPE_DIRECTIONAL)\n"
"            light_output += calculate_directional_light(i);\n"
"        else if(LIGHT_TYPE(i) < LIGHT_TYPE_POINT)\n"
"            light_output += calculate_point_light(i);\n"
"        else if(LIGHT_TYPE(i) < LIGHT_TYPE_SPOT)        \n"
"            light_output += calculate_spot_light(i);\n"
"    }\n"
"\n"
"    light_output.xyz = aces_tonemap(light_output.xyz);\n"
"    if(u_use_gamma_correction)\n"
"        color = vec4(pow(light_output.xyz, vec3(0.4545f)), light_output.w);\n"
"    else\n"
"        color = light_output;\n"
"\n"
"    FragColor = color;\n"
"    //MousePick0 = InstanceID;\n"
"    //MousePick1 = 0;\n"
"    //MousePick2 = 1;\n"
"}";

// pipeline_create
CGL_phong_pipeline* CGL_phong_pipeline_create()
{
	CGL_phong_pipeline* pipeline = (CGL_phong_pipeline*)malloc(sizeof(CGL_phong_pipeline));
	pipeline->use_blinn = false;
	memset(pipeline->lights, 0, sizeof(pipeline->lights));
	pipeline->light_count = 0;
	pipeline->ambient_light_color = CGL_vec3_init(0.18f, 0.18f, 0.18f);
	pipeline->ambient_light_strength = 1.0f;
	pipeline->use_gamma_correction = true;
	pipeline->depth_testing = true;
	pipeline->user_data = NULL;
	pipeline->shader = CGL_shader_create(__CGL_PHONG_VERTEX_SHADER, __CGL_PHONG_FRAGMENT_SHADER, NULL);
	// Load uniforms
	pipeline->u_projection = CGL_shader_get_uniform_location(pipeline->shader, "u_projection");
	pipeline->u_view = CGL_shader_get_uniform_location(pipeline->shader, "u_view");
	pipeline->u_pv = CGL_shader_get_uniform_location(pipeline->shader, "u_pv");
	pipeline->u_light_count = CGL_shader_get_uniform_location(pipeline->shader, "u_light_count");
	pipeline->u_use_diffuse_texture = CGL_shader_get_uniform_location(pipeline->shader, "u_use_diffuse_texture");
	pipeline->u_diffuse_color = CGL_shader_get_uniform_location(pipeline->shader, "u_diffuse_color");
	pipeline->u_diffuse_texture = CGL_shader_get_uniform_location(pipeline->shader, "u_diffuse_texture");
	pipeline->u_use_specular_texture = CGL_shader_get_uniform_location(pipeline->shader, "u_use_specular_texture");
	pipeline->u_specular_color = CGL_shader_get_uniform_location(pipeline->shader, "u_specular_color");
	pipeline->u_specular_texture = CGL_shader_get_uniform_location(pipeline->shader, "u_specular_texture");
	pipeline->u_use_normal_map = CGL_shader_get_uniform_location(pipeline->shader, "u_use_normal_map");
	pipeline->u_normal_map_texture = CGL_shader_get_uniform_location(pipeline->shader, "u_normal_map_texture");
	pipeline->u_shininess = CGL_shader_get_uniform_location(pipeline->shader, "u_shininess");
	pipeline->u_camera_position = CGL_shader_get_uniform_location(pipeline->shader, "u_camera_position");
	pipeline->u_use_blinn = CGL_shader_get_uniform_location(pipeline->shader, "u_use_blinn");
	pipeline->u_model_matrix = CGL_shader_get_uniform_location(pipeline->shader, "u_model_matrix");
	pipeline->u_ambient_light_color = CGL_shader_get_uniform_location(pipeline->shader, "u_ambient_light_color");
	pipeline->u_ambient_light_strength = CGL_shader_get_uniform_location(pipeline->shader, "u_ambient_light_strength");
	pipeline->u_use_gamma_correction = CGL_shader_get_uniform_location(pipeline->shader, "u_use_gamma_correction");
	static char temp_buffer[256];
	for (CGL_int i = 0; i < 4; i++)
	{
		for (CGL_int j = 0; j < CGL_PHONG_MAX_LIGHTS; j++)
		{
			sprintf(temp_buffer, "u_lights_data_%d[%d]", i, j);
			pipeline->u_lights_v4[i][j] = CGL_shader_get_uniform_location(pipeline->shader, temp_buffer);
		}
	}
	return pipeline;
}

// pipeline_destroy
CGL_void CGL_phong_pipeline_destroy(CGL_phong_pipeline* pipeline)
{
	CGL_shader_destroy(pipeline->shader);
	for (CGL_sizei i = 0; i < CGL_utils_array_size(pipeline->lights); i++)
		if (pipeline->lights[i])
			CGL_phong_light_destroy(pipeline->lights[i]);
	CGL_free(pipeline);
}

CGL_void CGL_phong_pipeline_set_ambient_light_color(CGL_phong_pipeline* pipeline, CGL_vec3 color)
{
	pipeline->ambient_light_color = color;
}

CGL_vec3 CGL_phong_pipeline_get_ambient_light_color(CGL_phong_pipeline* pipeline)
{
	return pipeline->ambient_light_color;
}

CGL_void CGL_phong_pipeline_enable_gamma_correction(CGL_phong_pipeline* pipeline)
{
	pipeline->use_gamma_correction = true;
}

CGL_void CGL_phong_pipeline_disable_gamma_correction(CGL_phong_pipeline* pipeline)
{
	pipeline->use_gamma_correction = false;
}

CGL_void CGL_phong_pipeline_set_ambient_light_strength(CGL_phong_pipeline* pipeline, CGL_float strength)
{
	pipeline->ambient_light_strength = CGL_utils_clamp(strength, 0.0f, 1000.0f);
}

float CGL_phong_pipeline_get_ambient_light_strength(CGL_phong_pipeline* pipeline)
{
	return pipeline->ambient_light_strength;
}

// pipeline_set_user_data
CGL_void CGL_phong_pipeline_set_user_data(CGL_phong_pipeline* pipeline, void* data)
{
	pipeline->user_data = data;
}

// pipeline_get_user_data
CGL_void* CGL_phong_pipeline_get_user_data(CGL_phong_pipeline* pipeline)
{
	return pipeline->user_data;
}

// pipeline_is_using_blinn
bool CGL_phong_pipeline_is_using_blinn(CGL_phong_pipeline* pipeline)
{
	return pipeline->use_blinn;
}

// pipeline_enable_blinn
CGL_void CGL_phong_pipeline_enable_blinn(CGL_phong_pipeline* pipeline)
{
	pipeline->use_blinn = true;
}

// pipeline_disable_blinn
CGL_void CGL_phong_pipeline_disable_blinn(CGL_phong_pipeline* pipeline)
{
	pipeline->use_blinn = false;
}

// pipeline_add_light
uint32_t CGL_phong_pipeline_add_light(CGL_phong_pipeline* pipeline, CGL_phong_light* light)
{
	for (CGL_sizei i = 0; i < CGL_utils_array_size(pipeline->lights); i++)
	{
		if (pipeline->lights[i] == NULL)
		{
			pipeline->light_count += 1;
			pipeline->lights[i] = light;
			return (uint32_t)i;
		}
	}
	return UINT32_MAX;
}

// pipeline_remove_light
CGL_phong_light* CGL_phong_pipeline_remove_light(CGL_phong_pipeline* pipeline, uint32_t light_id)
{
	if (/* light_id < 0 || */ light_id >= CGL_utils_array_size(pipeline->lights))
		return NULL;
	pipeline->light_count -= 1;
	CGL_phong_light* light = pipeline->lights[light_id];
	pipeline->lights[light_id] = NULL;
	return light;
}

// mat_create
CGL_phong_mat* CGL_phong_mat_create()
{
	CGL_phong_mat* mat = (CGL_phong_mat*)malloc(sizeof(CGL_phong_mat));
	mat->use_diffuse_texture = false;
	mat->diffuse_color = CGL_vec3_init(0.8f, 0.8f, 0.8f);
	mat->diffuse_image = NULL;
	mat->diffuse_texture = NULL;
	mat->use_specular_texture = false;
	mat->specular_color = CGL_vec3_init(0.8f, 0.8f, 0.8f);
	mat->specular_image = NULL;
	mat->specular_texture = NULL;
	mat->use_normal_map = false;
	mat->normal_map_image = NULL;
	mat->normal_map_texture = NULL;
	mat->shininess = 64.0f;
	mat->wireframe = false;
	mat->user_data = NULL;
	return mat;
}

// mat_destroy
CGL_void CGL_phong_mat_destroy(CGL_phong_mat* mat)
{
	if (mat->use_diffuse_texture)
		CGL_texture_destroy(mat->diffuse_texture);
	if (mat->use_specular_texture)
		CGL_texture_destroy(mat->specular_texture);
	if (mat->use_normal_map)
		CGL_texture_destroy(mat->normal_map_texture);
	CGL_free(mat);
}

// mat_set_diffuse_color
CGL_void CGL_phong_mat_set_diffuse_color(CGL_phong_mat* mat, CGL_vec3 color)
{
	if (mat->use_diffuse_texture)
		CGL_texture_destroy(mat->diffuse_texture);
	mat->diffuse_image = NULL;
	mat->diffuse_texture = NULL;
	mat->use_diffuse_texture = false;
	mat->diffuse_color = color;
}

// mat_set_diffuse_texture
CGL_void CGL_phong_mat_set_diffuse_texture(CGL_phong_mat* mat, CGL_image* image)
{
	if (mat->use_diffuse_texture)
		CGL_texture_destroy(mat->diffuse_texture);
	mat->use_diffuse_texture = true;
	mat->diffuse_image = image;
	mat->diffuse_texture = CGL_texture_create(image);
}

// mat_set_specular_color
CGL_void CGL_phong_mat_set_specular_color(CGL_phong_mat* mat, CGL_vec3 color)
{
	if (mat->use_specular_texture)
		CGL_texture_destroy(mat->specular_texture);
	mat->specular_image = NULL;
	mat->specular_texture = NULL;
	mat->use_specular_texture = false;
	mat->specular_color = color;
}

// mat_set_specular_texture
CGL_void CGL_phong_mat_set_specular_texture(CGL_phong_mat* mat, CGL_image* image)
{
	if (mat->use_specular_texture)
		CGL_texture_destroy(mat->specular_texture);
	mat->use_specular_texture = true;
	mat->specular_image = image;
	mat->specular_texture = CGL_texture_create(image);
}

// mat_set_normal_texture
CGL_void CGL_phong_mat_set_normal_texture(CGL_phong_mat* mat, CGL_image* image)
{
	if (mat->use_normal_map)
		CGL_texture_destroy(mat->normal_map_texture);
	mat->use_normal_map = true;
	mat->normal_map_image = image;
	mat->normal_map_texture = CGL_texture_create(image);
}

// mat_set_shininess
CGL_void CGL_phong_mat_set_shininess(CGL_phong_mat* mat, CGL_float shininess)
{
	mat->shininess = shininess;
}

// mat_set_user_data
CGL_void CGL_phong_mat_set_user_data(CGL_phong_mat* mat, void* data)
{
	mat->user_data = data;
}

// mat_get_user_data
CGL_void* CGL_phong_mat_get_user_data(CGL_phong_mat* mat)
{
	return mat->user_data;
}

// mat_disable_normal_map
CGL_void CGL_phong_mat_disable_normal_map(CGL_phong_mat* mat)
{
	if (mat->use_normal_map)
		CGL_texture_destroy(mat->normal_map_texture);
	mat->normal_map_image = NULL;
	mat->normal_map_texture = NULL;
	mat->use_normal_map = false;
}

// mat_enable_wireframe
CGL_void CGL_phong_mat_enable_wireframe(CGL_phong_mat* mat)
{
	mat->wireframe = true;
}

// mat_disable_wireframe
CGL_void CGL_phong_mat_disable_wireframe(CGL_phong_mat* mat)
{
	mat->wireframe = false;
}

// mat_get_shininess
float CGL_phong_mat_get_shininess(CGL_phong_mat* mat)
{
	return mat->shininess;
}

// light_directional
CGL_phong_light* CGL_phong_light_directional(CGL_vec3 direction, CGL_vec3 color, CGL_float intensity)
{
	CGL_phong_light* light = (CGL_phong_light*)malloc(sizeof(CGL_phong_light));
	light->light_type = CGL_PHONG_LIGHT_DIRECTIONAL;
	light->color = color;
	light->intensity = intensity;
	light->vector = direction;
	return light;
}

// light_point
CGL_phong_light* CGL_phong_light_point(CGL_vec3 position, CGL_vec3 color, CGL_float intensity, CGL_float constant, CGL_float linear, CGL_float quadratic)
{
	CGL_phong_light* light = (CGL_phong_light*)malloc(sizeof(CGL_phong_light));
	light->light_type = CGL_PHONG_LIGHT_POINT;
	light->color = color;
	light->intensity = intensity;
	light->vector = position;
	light->constant = constant;
	light->linear = linear;
	light->quadratic = quadratic;
	return light;
}

// light_destroy
CGL_void CGL_phong_light_destroy(CGL_phong_light* light)
{
	CGL_free(light);
}

// light_set_intensity
CGL_void CGL_phong_light_set_intensity(CGL_phong_light* light, CGL_float intensity)
{
	light->intensity = intensity;
}

// light_set_color
CGL_void CGL_phong_light_set_color(CGL_phong_light* light, CGL_vec3 color)
{
	light->color = color;
}

// light_get_intensity
float CGL_phong_light_get_intensity(CGL_phong_light* light)
{
	return light->intensity;
}

// light_get_color
CGL_vec3 CGL_phong_light_get_color(CGL_phong_light* light)
{
	return light->color;
}

// light_get_type
uint32_t CGL_phong_light_get_type(CGL_phong_light* light)
{
	return light->light_type;
}


CGL_void CGL_phong_render_begin(CGL_phong_pipeline* pipeline, CGL_camera* camera)
{
	if (pipeline->depth_testing) glEnable(GL_DEPTH_TEST);
	else glDisable(GL_DEPTH_TEST);

	CGL_shader_bind(pipeline->shader);
	// set uniforms
	CGL_shader_set_uniform_mat4(pipeline->shader, pipeline->u_projection, CGL_camera_get_projection_mat_ptr(camera));// camera
	CGL_shader_set_uniform_mat4(pipeline->shader, pipeline->u_view, CGL_camera_get_view_mat_ptr(camera));// camera
	CGL_shader_set_uniform_mat4(pipeline->shader, pipeline->u_pv, CGL_camera_get_pv_mat_ptr(camera));// camera
	CGL_vec3 camera_position = CGL_camera_get_position(camera);
	CGL_shader_set_uniform_vec3v(pipeline->shader, pipeline->u_camera_position, camera_position.x, camera_position.y, camera_position.z);
	CGL_shader_set_uniform_bool(pipeline->shader, pipeline->u_use_blinn, pipeline->use_blinn);
	CGL_shader_set_uniform_float(pipeline->shader, pipeline->u_ambient_light_strength, pipeline->ambient_light_strength);
	CGL_shader_set_uniform_vec3v(pipeline->shader, pipeline->u_ambient_light_color, pipeline->ambient_light_color.x, pipeline->ambient_light_color.y, pipeline->ambient_light_color.z);
	CGL_shader_set_uniform_bool(pipeline->shader, pipeline->u_use_gamma_correction, pipeline->use_gamma_correction);
	// set lights
	CGL_shader_set_uniform_int(pipeline->shader, pipeline->u_light_count, pipeline->light_count);
	for (uint32_t i = 0, j = 0; i < pipeline->light_count; i++)
	{
		CGL_phong_light* light = pipeline->lights[i];
		if (light == NULL) continue;
		// data_0 is color and strength
		CGL_shader_set_uniform_vec4v(pipeline->shader, pipeline->u_lights_v4[0][j], light->color.x, light->color.y, light->color.z, light->intensity);
		// data_1 is type, constant, linear, quadratic
		CGL_shader_set_uniform_vec4v(pipeline->shader, pipeline->u_lights_v4[1][j], (float)light->light_type, light->constant, light->linear, light->quadratic);
		// data_2 is vector
		CGL_shader_set_uniform_vec4v(pipeline->shader, pipeline->u_lights_v4[2][j], light->vector.x, light->vector.y, light->vector.z, 0.0f);
		// data_3 is reserved for future use
		j++;
	}
}

CGL_void CGL_phong_render(CGL_mesh_gpu* mesh, CGL_mat4* model_matrix, CGL_phong_mat* material, CGL_phong_pipeline* pipeline, CGL_camera* camera)
{
	(void)camera;
	CGL_shader_set_uniform_mat4(pipeline->shader, pipeline->u_model_matrix, model_matrix);
	CGL_shader_set_uniform_bool(pipeline->shader, pipeline->u_use_diffuse_texture, material->use_diffuse_texture);
	CGL_shader_set_uniform_vec3v(pipeline->shader, pipeline->u_diffuse_color, material->diffuse_color.x, material->diffuse_color.y, material->diffuse_color.z);
	if (material->use_diffuse_texture)
	{
		CGL_texture_bind(material->diffuse_texture, 4);
		CGL_shader_set_uniform_int(pipeline->shader, pipeline->u_diffuse_texture, 4);
	}
	CGL_shader_set_uniform_bool(pipeline->shader, pipeline->u_use_specular_texture, material->use_specular_texture);
	CGL_shader_set_uniform_vec3v(pipeline->shader, pipeline->u_specular_color, material->specular_color.x, material->specular_color.y, material->specular_color.z);
	if (material->use_specular_texture)
	{
		CGL_texture_bind(material->specular_texture, 1);
		CGL_shader_set_uniform_int(pipeline->shader, pipeline->u_specular_texture, 1);
	}
	CGL_shader_set_uniform_bool(pipeline->shader, pipeline->u_use_normal_map, material->use_normal_map);
	if (material->use_normal_map)
	{
		CGL_texture_bind(material->normal_map_texture, 3);
		CGL_shader_set_uniform_int(pipeline->shader, pipeline->u_use_normal_map, 3);
	}
	CGL_shader_set_uniform_float(pipeline->shader, pipeline->u_shininess, material->shininess);
	if (material->wireframe)
		glPolygonMode(GL_FRONT_AND_BACK, GL_LINE);
	CGL_mesh_gpu_render(mesh);
	if (material->wireframe)
		glPolygonMode(GL_FRONT_AND_BACK, GL_FILL);
}

CGL_void CGL_phong_render_end(CGL_phong_pipeline* pipeline, CGL_camera* camera)
{
	(void)pipeline;
	(void)camera;
}


#endif

#endif

#endif

// tilemap renderer
#ifndef CGL_EXCLUDE_GRAPHICS_API // cannot have TILE RENDERER without Graphics API

// tilemap renderer
#if 1

#ifndef CGL_EXCLUDE_TILEMAP_RENDERER

static const char* __CGL_TILEMAP_VERTEX_SHADER =
#ifdef CGL_WASM
"#version 300 es\n"
"precision highp float;\n"
"precision highp int;\n"
"in vec4 position;\n"
"in vec4 normal;\n"
"in vec4 texcoord;\n"
#else
"#version 430 core\n"
"\n"
"layout (location = 0) in vec4 position;\n"
"layout (location = 1) in vec4 normal;\n"
"layout (location = 2) in vec4 texcoord;\n"
#endif
"\n"
"void main()\n"
"{\n"
"	gl_Position = vec4(position.xyz, 1.0f);\n"
"}";

static const char* __CGL_TILEMAP_FRAGENT_SHADER =
#ifdef CGL_WASM
"#version 300 es\n"
"precision highp float;\n"
"precision highp int;\n"
#else
"#version 430 core\n"
#endif
"\n"
"out vec4 FragColor;\n"
"//out CGL_int MousePick0;\n"
"//out CGL_int MousePick1;\n"
"//out CGL_int MousePick2;\n"
"in vec3 Position;\n"
"in vec3 Normal;\n"
"in vec2 TexCoord;\n"
"\n"
"\n"
"// unifroms\n"
"uniform vec2 u_offset;\n"
"uniform vec2 u_scale;\n"
"uniform vec2 u_tile_count;\n"
"uniform vec2 u_tile_size;\n"
"\n"
"uniform sampler2D u_texture_tileset;\n"
"uniform sampler2DArray u_texture_array;\n"
"\n"
"struct cglTile\n"
"{\n"
"    vec4 color;\n"
"};\n"
"\n"
"layout (std430, binding = %d)  buffer tiles_buffer\n"
"{\n"
"    cglTile tiles[];\n"
"};\n"
"\n"
"void main()\n"
"{\n"
"    vec4 color = vec4(0.0f, 1.0f, 0.0f, 1.0f);\n"
"    vec2 frag_coord = gl_FragCoord.xy;\n"
"    vec2 coord = vec2(\n"
"        (frag_coord.x + u_offset.x) * u_scale.x,\n"
"        (frag_coord.y + u_offset.y) * u_scale.y\n"
"    );\n"
"    \n"
"    vec2 tile_index_f = vec2(\n"
"        coord.x / u_tile_size.x,\n"
"        coord.y / u_tile_size.y\n"
"    );\n"
"    ivec2 tile_index = ivec2(tile_index_f);\n"
"\n"
"    vec2 tile_tex_coord = vec2(\n"
"        mod(coord.x, u_tile_size.x) / u_tile_size.x,\n"
"        mod(coord.y, u_tile_size.y) / u_tile_size.y\n"
"    );\n"
"\n"
"\n"
"    if(tile_index_f.x < 0 || tile_index_f.x >= u_tile_count.x\n"
"    || tile_index_f.y < 0 || tile_index_f.y >= u_tile_count.y)\n"
"    {\n"
"        // discard; // Using discard might not be the best idea\n"
"        FragColor = vec4(0.0f);\n"
"        return;\n"
"    }\n"
"\n"
"    cglTile current_tile = tiles[tile_index.y * int(u_tile_count.x) + tile_index.x];\n"
"\n"
"    if (current_tile.color.w > 3.0f)  // case where tile is empty\n"
"    {\n"
"        // discard; // Using discard might not be the best idea\n"
"        FragColor = vec4(0.0f);\n"
"        return;\n"
"    }\n"
"    else if(current_tile.color.w > 2.0f ) // case where tile is a solid color\n"
"    {\n"
"        FragColor = vec4(current_tile.color.xyz, 1.0f);\n"
"        return;\n"
"    }\n"
"    else if(current_tile.color.w > 1.0f ) // case where tile is a texture from texture array\n"
"    {\n"
"        FragColor = texture(u_texture_array, vec3(tile_tex_coord, current_tile.color.x));\n"
"        return;\n"
"    }\n"
"    else // case where tile is a texture from tileset \n"
"    {\n"
"        vec2 final_tex_scale = current_tile.color.zw;\n"
"        vec2 final_tex_coord = vec2(\n"
"            (tile_tex_coord.x) * final_tex_scale.x + current_tile.color.x,\n"
"            (tile_tex_coord.y) * final_tex_scale.y + current_tile.color.y\n"
"        );\n"
"        FragColor = texture(u_texture_tileset, final_tex_coord);\n"
"        return;\n"
"    }\n"
"\n"
"    FragColor = vec4(tile_tex_coord, 0.0f, 1.0f);\n"
"    //MousePick0 = InstanceID;\n"
"    //MousePick1 = 0;\n"
"    //MousePick2 = 1;\n"
"}";

struct CGL_tile
{
	CGL_vec4 color;
};

struct CGL_tilemap
{
	// tiles data
	CGL_tile* tile_data;
	uint32_t tile_count_x;
	uint32_t tile_count_y;
	uint32_t tile_size_x;
	uint32_t tile_size_y;
	bool auto_update;
	// renderer data
	CGL_mesh_gpu* mesh;
	CGL_shader* shader;
	CGL_ssbo* ssbo;
	// unifrom locations
	CGL_int u_tile_count;
	CGL_int u_tile_size;
	CGL_int u_offset;
	CGL_int u_scale;
	CGL_int u_texture_tileset;
	CGL_int u_texture_array;
};


CGL_tilemap* CGL_tilemap_create(uint32_t tile_count_x, uint32_t tile_count_y, uint32_t tile_size_x, uint32_t tile_size_y, uint32_t ssbo_binding)
{
	/*
	assert(tile_count_x > 0);
	assert(tile_count_y > 0);
	assert(tile_size_x > 0);
	assert(tile_size_y > 0);
	*/
	CGL_tilemap* tilemap = (CGL_tilemap*)malloc(sizeof(CGL_tilemap));
	tilemap->tile_data = (CGL_tile*)malloc(sizeof(CGL_tile) * tile_count_x * tile_count_y);
	memset(tilemap->tile_data, 0, (sizeof(CGL_tile) * tile_count_x * tile_count_y));
	tilemap->tile_count_x = tile_count_x;
	tilemap->tile_count_y = tile_count_y;
	tilemap->tile_size_x = tile_size_x;
	tilemap->tile_size_y = tile_size_y;

	tilemap->ssbo = CGL_ssbo_create(ssbo_binding);

	CGL_mesh_cpu* screen_quad_mesh_cpu = CGL_mesh_cpu_quad(CGL_vec3_init(1.0, 1.0, 0.0),
		CGL_vec3_init(1.0, -1.0, 0.0),
		CGL_vec3_init(-1.0, -1.0, 0.0),
		CGL_vec3_init(-1.0, 1.0, 0.0));
	CGL_mesh_gpu* screen_quad_mesh_gpu = CGL_mesh_gpu_create();
	CGL_mesh_gpu_upload(screen_quad_mesh_gpu, screen_quad_mesh_cpu, true);
	CGL_mesh_cpu_destroy(screen_quad_mesh_cpu);
	tilemap->mesh = screen_quad_mesh_gpu;
	static char shader_source_buffer[1024 * 64];
	sprintf(shader_source_buffer, __CGL_TILEMAP_FRAGENT_SHADER, ssbo_binding);
	tilemap->shader = CGL_shader_create(__CGL_TILEMAP_VERTEX_SHADER, shader_source_buffer, NULL);
	tilemap->u_offset = CGL_shader_get_uniform_location(tilemap->shader, "u_offset");
	tilemap->u_scale = CGL_shader_get_uniform_location(tilemap->shader, "u_scale");
	tilemap->u_tile_count = CGL_shader_get_uniform_location(tilemap->shader, "u_tile_count");
	tilemap->u_tile_size = CGL_shader_get_uniform_location(tilemap->shader, "u_tile_size");
	tilemap->u_texture_tileset = CGL_shader_get_uniform_location(tilemap->shader, "u_texture_tileset");
	tilemap->u_texture_array = CGL_shader_get_uniform_location(tilemap->shader, "u_texture_array");
	tilemap->auto_update = true;
	CGL_tilemap_reset(tilemap);
	return tilemap;
}

CGL_void CGL_tilemap_destroy(CGL_tilemap* tilemap)
{
	CGL_ssbo_destroy(tilemap->ssbo);
	CGL_shader_destroy(tilemap->shader);
	CGL_mesh_gpu_destroy(tilemap->mesh);
	CGL_free(tilemap->tile_data);
	CGL_free(tilemap);
}

CGL_void CGL_tilemap_set_auto_upload(CGL_tilemap* tilemap, bool value)
{
	tilemap->auto_update = value;
}

bool CGL_tilemap_get_auto_upload(CGL_tilemap* tilemap)
{
	return tilemap->auto_update;
}

bool CGL_tilemap_upload(CGL_tilemap* tilemap)
{
	CGL_ssbo_set_data(tilemap->ssbo, (sizeof(CGL_tile) * tilemap->tile_count_x * tilemap->tile_count_y), tilemap->tile_data, false);
	return true;
}

CGL_void CGL_tilemap_set_tile_color(CGL_tilemap* tilemap, uint32_t tile_x, uint32_t tile_y, CGL_float r, CGL_float g, CGL_float b)
{
	CGL_tile* tile = &tilemap->tile_data[tile_y * tilemap->tile_count_x + tile_x];
	tile->color = CGL_vec4_init(r, g, b, 2.5f);
	if (tilemap->auto_update) CGL_ssbo_set_sub_data(tilemap->ssbo, (tile_y * tilemap->tile_count_x + tile_x) * sizeof(CGL_tile), sizeof(CGL_tile), tile, false);
}

CGL_void CGL_tilemap_set_tile_texture_from_array(CGL_tilemap* tilemap, uint32_t tile_x, uint32_t tile_y, uint32_t texture_index)
{
	CGL_tile* tile = &tilemap->tile_data[tile_y * tilemap->tile_count_x + tile_x];
	tile->color = CGL_vec4_init((float)texture_index, 0.0f, 0.0f, 1.5f);
	if (tilemap->auto_update) CGL_ssbo_set_sub_data(tilemap->ssbo, (tile_y * tilemap->tile_count_x + tile_x) * sizeof(CGL_tile), sizeof(CGL_tile), tile, false);
}

CGL_void CGL_tilemap_set_tile_texture_from_tileset(CGL_tilemap* tilemap, uint32_t tile_x, uint32_t tile_y, CGL_float texture_x_min, CGL_float texture_y_min, CGL_float texture_x_max, CGL_float texture_y_max)
{
	CGL_tile* tile = &tilemap->tile_data[tile_y * tilemap->tile_count_x + tile_x];
	tile->color = CGL_vec4_init(texture_x_min, texture_y_min, texture_x_max, texture_y_max);
	if (tilemap->auto_update) CGL_ssbo_set_sub_data(tilemap->ssbo, (tile_y * tilemap->tile_count_x + tile_x) * sizeof(CGL_tile), sizeof(CGL_tile), tile, false);
}

CGL_void CGL_tilemap_set_all_tile_color(CGL_tilemap* tilemap, CGL_float r, CGL_float g, CGL_float b)
{
	CGL_bool auto_update = tilemap->auto_update;
	tilemap->auto_update = false;
	for (uint32_t y = 0; y < tilemap->tile_count_y; y++)
		for (uint32_t x = 0; x < tilemap->tile_count_x; x++)
			CGL_tilemap_set_tile_color(tilemap, x, y, r, g, b);
	tilemap->auto_update = auto_update;
	CGL_tilemap_upload(tilemap);
}

CGL_void CGL_tilemap_set_all_tile_texture_from_array(CGL_tilemap* tilemap, uint32_t texture_index)
{
	CGL_bool auto_update = tilemap->auto_update;
	tilemap->auto_update = false;
	for (uint32_t y = 0; y < tilemap->tile_count_y; y++)
		for (uint32_t x = 0; x < tilemap->tile_count_x; x++)
			CGL_tilemap_set_tile_texture_from_array(tilemap, x, y, texture_index);
	tilemap->auto_update = auto_update;
	CGL_tilemap_upload(tilemap);
}

CGL_void CGL_tilemap_set_all_tile_texture_from_tileset(CGL_tilemap* tilemap, CGL_float texture_x_min, CGL_float texture_y_min, CGL_float texture_x_max, CGL_float texture_y_max)
{
	CGL_bool auto_update = tilemap->auto_update;
	tilemap->auto_update = false;
	for (uint32_t y = 0; y < tilemap->tile_count_y; y++)
		for (uint32_t x = 0; x < tilemap->tile_count_x; x++)
			CGL_tilemap_set_tile_texture_from_tileset(tilemap, x, y, texture_x_min, texture_y_min, texture_x_max, texture_y_max);
	tilemap->auto_update = auto_update;
	CGL_tilemap_upload(tilemap);
}

CGL_void CGL_tilemap_clear_all_tile(CGL_tilemap* tilemap)
{
	CGL_bool auto_update = tilemap->auto_update;
	tilemap->auto_update = false;
	for (uint32_t y = 0; y < tilemap->tile_count_y; y++)
		for (uint32_t x = 0; x < tilemap->tile_count_x; x++)
			CGL_tilemap_clear_tile(tilemap, x, y);
	tilemap->auto_update = auto_update;
	CGL_tilemap_upload(tilemap);
}

CGL_void CGL_tilemap_clear_tile(CGL_tilemap* tilemap, uint32_t tile_x, uint32_t tile_y)
{
	CGL_tile* tile = &tilemap->tile_data[tile_y * tilemap->tile_count_x + tile_x];
	tile->color = CGL_vec4_init(0.0f, 0.0f, 0.0f, 3.5f);
	if (tilemap->auto_update) CGL_ssbo_set_sub_data(tilemap->ssbo, (tile_y * tilemap->tile_count_x + tile_x) * sizeof(CGL_tile), sizeof(CGL_tile), tile, false);
}

CGL_void CGL_tilemap_reset(CGL_tilemap* tilemap)
{
	for (uint32_t tile_x = 0; tile_x < tilemap->tile_count_x; tile_x++)
	{
		for (uint32_t tile_y = 0; tile_y < tilemap->tile_count_y; tile_y++)
		{
			CGL_tile* tile = &tilemap->tile_data[tile_y * tilemap->tile_count_x + tile_x];
			tile->color = CGL_vec4_init(0.0f, 0.0f, 0.0f, 3.5f);
		}
	}
	CGL_ssbo_set_data(tilemap->ssbo, (sizeof(CGL_tile) * tilemap->tile_count_x * tilemap->tile_count_y), tilemap->tile_data, false);
}

CGL_void CGL_tilemap_render(CGL_tilemap* tilemap, CGL_float scale_x, CGL_float scale_y, CGL_float offset_x, CGL_float offset_y, CGL_texture* texture)
{
	CGL_shader_bind(tilemap->shader);
	if (texture) CGL_texture_bind(texture, 0);
	CGL_shader_set_uniform_vec2v(tilemap->shader, tilemap->u_offset, -offset_x, -offset_y);
	CGL_shader_set_uniform_vec2v(tilemap->shader, tilemap->u_scale, 1.0f / scale_x, 1.0f / scale_y);
	CGL_shader_set_uniform_vec2v(tilemap->shader, tilemap->u_tile_count, (float)tilemap->tile_count_x, (float)tilemap->tile_count_y);
	CGL_shader_set_uniform_vec2v(tilemap->shader, tilemap->u_tile_size, (float)tilemap->tile_size_x, (float)tilemap->tile_size_y);
	CGL_shader_set_uniform_int(tilemap->shader, tilemap->u_texture_tileset, 0);
	CGL_shader_set_uniform_int(tilemap->shader, tilemap->u_texture_array, 0);
	CGL_mesh_gpu_render(tilemap->mesh);
}

#endif

#endif


#endif

// sky renderer
#ifndef CGL_EXCLUDE_GRAPHICS_API
#ifndef CGL_EXCLUDE_SKY_RENDERER

struct CGL_sky
{
	CGL_vec3 sun_pos;
	CGL_texture* cubemap;
	CGL_shader* cubemap_shader;
	CGL_shader* procedural_shader;
	CGL_mesh_gpu* skybox_mesh;
	CGL_mesh_gpu* skysphere_mesh;
	CGL_mesh_gpu* active_mesh;
	CGL_float cirrus;
	CGL_float cumulus;
	CGL_float upf;
	CGL_float time;
	bool is_procedural;
	// unifroms
	CGL_int cs_u_projection;
	CGL_int cs_u_view;
	CGL_int cs_u_texture;
	CGL_int ps_u_projection;
	CGL_int ps_u_view;
	CGL_int ps_u_cirrus;
	CGL_int ps_u_cumulus;
	CGL_int ps_u_upf;
	CGL_int ps_u_time;
	CGL_int ps_u_fsun;

};

static const char* __CGL_SKY_VERTEX_SHADER =
#ifdef CGL_WASM
"#version 300 es\n"
"precision highp float;\n"
"precision highp int;\n"
"in vec4 position;\n"
"in vec4 normal;\n"
"in vec4 texcoord;\n"
#else
"#version 430 core\n"
"\n"
"layout (location = 0) in vec4 position;\n"
"layout (location = 1) in vec4 normal;\n"
"layout (location = 2) in vec4 texcoord;\n"
#endif
"\n"
"out vec3 Position;\n"
"\n"
"\n"
"uniform mat4 u_projection;\n"
"uniform mat4 u_view;\n"
"\n"
"void main()\n"
"{\n"
"	gl_Position = u_projection * transpose(u_view) * vec4(position.xyz, 1.0f);\n"
"	Position = position.xyz;\n"
"}";

static const char* __CGL_SKY_CUBEMAP_FRAGMENT_SHADER =
#ifdef CGL_WASM
"#version 300 es\n"
"precision highp float;\n"
"precision highp int;\n"
#else
"#version 430 core\n"
#endif
"\n"
"out vec4 FragColor;\n"
"\n"
"in vec3 Position;\n"
"\n"
"uniform samplerCube u_texture;\n"
"\n"
"void main()\n"
"{\n"
"	vec4 color = texture(u_texture, Position);\n"
"	FragColor = color;\n"
"}";

static const char* __CGL_SKY_PROCEDURAL_FRAGMENT_SHADER =
#ifdef CGL_WASM
"#version 300 es\n"
"precision highp float;\n"
"precision highp int;\n"
#else
"#version 430 core\n"
#endif
"uniform vec3 fsun;\n"
"uniform float time;\n"
"uniform float cirrus;\n"
"uniform float cumulus;\n"
"uniform float upf;\n"
"\n"
"in vec3 Position;"
"\n"
"out vec4 FragColor;\n"
"\n"
"const float Br = 0.0025;\n"
"const float Bm = 0.0003;\n"
"const float g = 0.9800;\n"
"const vec3 nitrogen = vec3(0.650, 0.570, 0.475);\n"
"const vec3 Kr = Br / pow(nitrogen, vec3(4.0));\n"
"const vec3 Km = Bm / pow(nitrogen, vec3(0.84));\n"
"\n"
"float hash(float n) {\n"
"  return fract(sin(n) * 43758.5453123);\n"
"}\n"
"\n"
"float noise(vec3 x) {\n"
"  vec3 f = fract(x);\n"
"  float n = dot(floor(x), vec3(1.0, 157.0, 113.0));\n"
"  return mix(mix(mix(hash(n + 0.0), hash(n + 1.0), f.x),\n"
"      mix(hash(n + 157.0), hash(n + 158.0), f.x), f.y),\n"
"    mix(mix(hash(n + 113.0), hash(n + 114.0), f.x),\n"
"      mix(hash(n + 270.0), hash(n + 271.0), f.x), f.y), f.z);\n"
"}\n"
"\n"
"const mat3 m = mat3(0.0, 1.60, 1.20, -1.6, 0.72, -0.96, -1.2, -0.96, 1.28);\n"
"float fbm(vec3 p) {\n"
"  float f = 0.0;\n"
"  f += noise(p) / 2;\n"
"  p = m * p * 1.1;\n"
"  f += noise(p) / 4;\n"
"  p = m * p * 1.2;\n"
"  f += noise(p) / 6;\n"
"  p = m * p * 1.3;\n"
"  f += noise(p) / 12;\n"
"  p = m * p * 1.4;\n"
"  f += noise(p) / 24;\n"
"  return f;\n"
"}\n"
"\n"
"void main() {\n"
"  vec3 pos = vec3(Position.x, Position.y+upf, Position.z);\n"
"\n"
"  // Atmosphere Scattering\n"
"  float mu = dot(normalize(pos), normalize(fsun));\n"
"  float rayleigh = 3.0 / (8.0 * 3.14) * (1.0 + mu * mu);\n"
"  vec3 mie = (Kr + Km * (1.0 - g * g) / (2.0 + g * g) / pow(1.0 + g * g - 2.0 * g * mu, 1.5)) / (Br + Bm);\n"
"\n"
"  vec3 day_extinction = exp(-exp(-((pos.y + fsun.y * 4.0) * (exp(-pos.y * 16.0) + 0.1) / 80.0) / Br) * (exp(-pos.y * 16.0) + 0.1) * Kr / Br) * exp(-pos.y * exp(-pos.y * 8.0) * 4.0) * exp(-pos.y * 2.0) * 4.0;\n"
"  vec3 night_extinction = vec3(1.0 - exp(fsun.y)) * 0.2;\n"
"  vec3 extinction = mix(day_extinction, night_extinction, -fsun.y * 0.2 + 0.5);\n"
"  FragColor.rgb = rayleigh * mie * extinction;\n"
"\n"
"  // Cirrus Clouds\n"
"  float density = smoothstep(1.0 - cirrus, 1.0, fbm(pos.xyz / pos.y * 2.0 + time * 0.05)) * 0.3;\n"
"  FragColor.rgb = mix(FragColor.rgb, extinction * 4.0, density * max(pos.y, 0.0));\n"
"\n"
"  // Cumulus Clouds\n"
"  for (int i = 0; i < 3; i++) {\n"
"    float density = smoothstep(1.0 - cumulus, 1.0, fbm((0.7 + float(i) * 0.01) * pos.xyz / pos.y + time * 0.3));\n"
"    FragColor.rgb = mix(FragColor.rgb, extinction * density * 5.0, min(density, 1.0) * max(pos.y, 0.0));\n"
"  }\n"
"\n"
"  // Dithering Noise\n"
"  FragColor.rgb += noise(pos * 1000) * 0.01;\n"
"}";

CGL_sky* CGL_sky_create()
{
	CGL_sky* sky = (CGL_sky*)CGL_malloc(sizeof(CGL_sky));
	if (!sky) return NULL;
	sky->sun_pos = CGL_vec3_init(0.0f, 0.2f, 0.1f);
	sky->time = 0.0f;
	sky->cirrus = 0.4f;
	sky->cumulus = 0.8f;
	sky->upf = 0.35f;
	sky->is_procedural = true;
	sky->cubemap = CGL_texture_create_cubemap();

	CGL_mesh_cpu* skybox_cpu = CGL_mesh_cpu_cube(true);
	sky->skybox_mesh = CGL_mesh_gpu_create();
	CGL_mesh_gpu_upload(sky->skybox_mesh, skybox_cpu, true);
	CGL_free(skybox_cpu);

	CGL_mesh_cpu* skysphere_cpu = CGL_mesh_cpu_sphere(16, 16);
	sky->skysphere_mesh = CGL_mesh_gpu_create();
	CGL_mesh_gpu_upload(sky->skysphere_mesh, skysphere_cpu, true);
	CGL_free(skysphere_cpu);

	sky->active_mesh = sky->skybox_mesh;

	sky->cubemap_shader = CGL_shader_create(__CGL_SKY_VERTEX_SHADER, __CGL_SKY_CUBEMAP_FRAGMENT_SHADER, NULL);
	sky->cs_u_projection = CGL_shader_get_uniform_location(sky->cubemap_shader, "u_projection");
	sky->cs_u_view = CGL_shader_get_uniform_location(sky->cubemap_shader, "u_view");
	sky->cs_u_texture = CGL_shader_get_uniform_location(sky->cubemap_shader, "u_texture");

	sky->procedural_shader = CGL_shader_create(__CGL_SKY_VERTEX_SHADER, __CGL_SKY_PROCEDURAL_FRAGMENT_SHADER, NULL);
	sky->ps_u_projection = CGL_shader_get_uniform_location(sky->procedural_shader, "u_projection");
	sky->ps_u_view = CGL_shader_get_uniform_location(sky->procedural_shader, "u_view");
	sky->ps_u_cirrus = CGL_shader_get_uniform_location(sky->procedural_shader, "cirrus");
	sky->ps_u_cumulus = CGL_shader_get_uniform_location(sky->procedural_shader, "cumulus");
	sky->ps_u_upf = CGL_shader_get_uniform_location(sky->procedural_shader, "upf");
	sky->ps_u_time = CGL_shader_get_uniform_location(sky->procedural_shader, "time");
	sky->ps_u_fsun = CGL_shader_get_uniform_location(sky->procedural_shader, "fsun");

	return sky;
}

CGL_void CGL_sky_destroy(CGL_sky* sky)
{
	CGL_texture_destroy(sky->cubemap);
	CGL_mesh_gpu_destroy(sky->skybox_mesh);
	CGL_mesh_gpu_destroy(sky->skysphere_mesh);
	CGL_shader_destroy(sky->cubemap_shader);
	CGL_shader_destroy(sky->procedural_shader);
	CGL_free(sky);
}

CGL_void CGL_sky_use_skybox(CGL_sky* sky)
{
	sky->active_mesh = sky->skybox_mesh;
}

CGL_void CGL_sky_use_skysphere(CGL_sky* sky)
{
	sky->active_mesh = sky->skysphere_mesh;
}

CGL_void CGL_sky_use_cubemap(CGL_sky* sky)
{
	sky->is_procedural = false;
}

CGL_void CGL_sky_use_procedural(CGL_sky* sky)
{
	sky->is_procedural = true;
}

CGL_void CGL_sky_cubemap_set_face(CGL_sky* sky, CGL_int face, CGL_image* image)
{
	CGL_texture_cubemap_set_face(sky->cubemap, face, image);
}

CGL_void CGL_sky_procedural_set_options(CGL_sky* sky, CGL_float cirrus, CGL_float cumulus, CGL_float upf)
{
	sky->cirrus = cirrus;
	sky->cumulus = cumulus;
	sky->upf = upf;
}

CGL_void CGL_sky_procedural_set_time(CGL_sky* sky, CGL_float time)
{
	sky->time = time;
}

CGL_void CGL_sky_procedural_set_sun_position(CGL_sky* sky, CGL_vec3 position)
{
	sky->sun_pos = position;
}

CGL_void CGL_sky_render(CGL_sky* sky, CGL_camera* camera)
{
	glDisable(GL_DEPTH_TEST);
	glDepthMask(GL_FALSE);
	if (sky->is_procedural)
	{
		CGL_shader_bind(sky->procedural_shader);
		CGL_shader_set_uniform_mat4(sky->procedural_shader, sky->ps_u_projection, &camera->projection);
		CGL_mat4 view_matrix = camera->view;
		view_matrix.m[3] = view_matrix.m[7] = view_matrix.m[11] = 0.0f; // removing the translation
		CGL_shader_set_uniform_mat4(sky->procedural_shader, sky->ps_u_view, &view_matrix);
		CGL_shader_set_uniform_float(sky->procedural_shader, sky->ps_u_cirrus, sky->cirrus);
		CGL_shader_set_uniform_float(sky->procedural_shader, sky->ps_u_cumulus, sky->cumulus);
		CGL_shader_set_uniform_float(sky->procedural_shader, sky->ps_u_upf, sky->upf);
		CGL_shader_set_uniform_float(sky->procedural_shader, sky->ps_u_time, sky->time);
		CGL_shader_set_uniform_vec3v(sky->procedural_shader, sky->ps_u_fsun, sky->sun_pos.x, sky->sun_pos.y, sky->sun_pos.z);
	}
	else
	{
		CGL_shader_bind(sky->cubemap_shader);
		CGL_shader_set_uniform_mat4(sky->cubemap_shader, sky->cs_u_projection, &camera->projection);
		CGL_mat4 view_matrix = camera->view;
		view_matrix.m[3] = view_matrix.m[7] = view_matrix.m[11] = 0.0f; // removing the translation
		CGL_shader_set_uniform_mat4(sky->cubemap_shader, sky->cs_u_view, &view_matrix);
		CGL_texture_bind(sky->cubemap, 0);
		CGL_shader_set_uniform_int(sky->cubemap_shader, sky->cs_u_texture, 0);
	}
	CGL_mesh_gpu_render(sky->active_mesh);
	glDepthMask(GL_TRUE);
	glEnable(GL_DEPTH_TEST);
}

#endif // CGL_EXCLUDE_SKY_RENDERER
#endif // CGL_EXCLUDE_GRAPHICS_API

// markov chains
#ifndef CGL_EXCLUDE_MARKOV_API

struct CGL_markov
{
	CGL_hashtable* hashtable;
	size_t key_size;
	size_t value_size;
	void* temp_key;
	void* temp_value;
};

struct CGL_markov_token_function_ngram_text_context
{
	size_t index;
	size_t n;
};

CGL_markov_token_function_ngram_text_context* CGL_markov_token_function_ngram_text_context_create(size_t n)
{
	CGL_markov_token_function_ngram_text_context* ctx = (CGL_markov_token_function_ngram_text_context*)CGL_malloc(sizeof(CGL_markov_token_function_ngram_text_context));
	if (!ctx) return NULL;
	ctx->index = 0;
	ctx->n = n;
	return ctx;
}

CGL_void CGL_markov_token_function_ngram_text_context_destroy(CGL_markov_token_function_ngram_text_context* context)
{
	CGL_free(context);
}


bool CGL_markov_token_function_ngram_text(void* context, const void* dat, const size_t data_size, void* key, void* value)
{
	CGL_markov_token_function_ngram_text_context* ctx = (CGL_markov_token_function_ngram_text_context*)context;
	const char* data = (const char*)dat;
	if (ctx->index >= data_size - ctx->n - 1) return false;
	if (key) memcpy(key, data + ctx->index, ctx->n);
	if (value) *((char*)value) = *(data + ctx->index + ctx->n);
	ctx->index++;
	return true;
}

CGL_markov* CGL_markov_create(const size_t key_size, const size_t value_size)
{
	CGL_markov* mk = (CGL_markov*)CGL_malloc(sizeof(CGL_markov));
	if (!mk) return NULL;
	mk->key_size = key_size;
	mk->value_size = value_size;
	mk->hashtable = CGL_hashtable_create(10000, key_size, 100000);
	mk->temp_key = CGL_malloc(key_size);
	mk->temp_value = CGL_malloc(value_size);
	return mk;
}

bool CGL_markov_train(CGL_markov* markov, void* context, const void* data, const size_t data_size, const CGL_markov_token_function function)
{
	memset(markov->temp_key, 0, markov->key_size);
	memset(markov->temp_value, 0, markov->value_size);
	while (function(context, data, data_size, markov->temp_key, markov->temp_value))
	{
		if (!CGL_hashtable_exists(markov->hashtable, markov->temp_key))
		{
			CGL_list* list = CGL_list_create(markov->value_size, 10);

			CGL_hashtable_set(markov->hashtable, markov->temp_key, &list, sizeof(CGL_list*));
		}
		CGL_list* list = NULL;
		CGL_hashtable_get(markov->hashtable, markov->temp_key, &list);
		CGL_list_push(list, markov->temp_value);
		memset(markov->temp_key, 0, markov->key_size);
		memset(markov->temp_value, 0, markov->value_size);
	}
	return true;
}


bool CGL_markov_generate(const CGL_markov* markov, const void* key, void* value)
{
	if (!CGL_hashtable_exists(markov->hashtable, key)) return false;
	CGL_list* list = NULL;
	CGL_hashtable_get(markov->hashtable, key, &list);
	CGL_list_get_random(list, value);
	return true;
}

CGL_void CGL_markov_destroy(CGL_markov* markov)
{
	CGL_hashtable_iterator* iterator = CGL_hashtable_iterator_create(markov->hashtable);
	CGL_list* lst = NULL;
	while (CGL_hashtable_iterator_next(iterator, NULL, &lst, NULL)) CGL_list_destroy(lst);
	CGL_hashtable_iterator_destroy(iterator);
	CGL_hashtable_destroy(markov->hashtable);
	CGL_free(markov->temp_key);
	CGL_free(markov->temp_value);
	CGL_free(markov);
}

#endif

// text rendering
#ifndef CGL_EXCLUDE_TEXT_RENDER

#ifndef CGL_EXCLUDE_GRAPHICS_API

#include <ft2build.h>
#include FT_FREETYPE_H  

struct CGL_font
{
	CGL_font_character characters[128];
	CGL_texture* atlas;
	size_t atlas_width;
	size_t atlas_height;
	FT_Face face;
};

static FT_Library __CGL_free_type_library;

CGL_bool CGL_text_init()
{
	bool result = FT_Init_FreeType(&__CGL_free_type_library);
	if (result) { CGL_log_internal("Could not Initialize FreeType\n"); }
	return !result;
}

CGL_void CGL_text_shutdown()
{
	FT_Done_FreeType(__CGL_free_type_library);
}

static CGL_font* __CGL_font_create()
{
	CGL_font* font = (CGL_font*)CGL_malloc(sizeof(CGL_font));
	if (!font) return NULL;
	memset(font->characters, 0, sizeof(CGL_font_character) * 128);
	font->atlas_width = 0;
	font->atlas_height = 0;
	font->atlas = NULL;
	return font;
}

CGL_font* CGL_font_load_from_memory(const char* data, CGL_sizei size)
{
	CGL_font* font = __CGL_font_create();
	if (!font) return NULL;
	if (FT_New_Memory_Face(__CGL_free_type_library, (const FT_Byte*)data, (FT_Long)size, 0, &font->face)) { CGL_log_internal("Could not Load Font\n"); }
	return font;
}

CGL_font* CGL_font_load(const char* path)
{
	CGL_font* font = __CGL_font_create();
	if (!font) return NULL;
	if (FT_New_Face(__CGL_free_type_library, path, 0, &font->face)) { CGL_log_internal("Could not Load Font\n"); }
	return font;
}

CGL_void CGL_font_destory(CGL_font* font)
{
	FT_Done_Face(font->face);
	if (font->atlas) CGL_texture_destroy(font->atlas);
	for (size_t i = 0; i < 127; i++)
		if (font->characters[i].bitmap)
			CGL_free(font->characters[i].bitmap);
	CGL_free(font);
}

CGL_texture* CGL_font_get_atlas(CGL_font* font)
{
	return font->atlas;
}

CGL_bool CGL_font_build_atlas(CGL_font* font, size_t width, size_t height, size_t font_size)
{
	if (font->atlas) CGL_texture_destroy(font->atlas);
	FT_Set_Pixel_Sizes(font->face, 0, (FT_UInt)font_size);
	int64_t offset_x = 0;
	int64_t offset_y = 0;
	int64_t max_size_y = 0;
	font->atlas_width = width;
	font->atlas_height = height;
	font->atlas = CGL_texture_create_blank((int)width, (int)height, GL_RED, GL_RED, GL_UNSIGNED_BYTE);
	for (char ch = 0; ch < 127; ch++)
	{
		if (FT_Load_Char(font->face, (FT_ULong)ch, FT_LOAD_RENDER))
		{
			CGL_log_internal("Could not Font Load Character %c\n", ch);
			return false;
		}
		int64_t size_x = font->face->glyph->bitmap.width;
		int64_t size_y = font->face->glyph->bitmap.rows;

		if (font->characters[ch].bitmap) CGL_free(font->characters[ch].bitmap);
		font->characters[ch].size = CGL_vec2_init((float)size_x, (float)size_y);
		font->characters[ch].normalized_size = CGL_vec2_init((float)size_x / font->atlas_width, (float)size_y / font->atlas_height);
		font->characters[ch].offset = CGL_vec2_init((float)offset_x, (float)offset_y);
		font->characters[ch].normalized_offset = CGL_vec2_init((float)offset_x / font->atlas_width, (float)offset_y / font->atlas_height);
		font->characters[ch].bearing = CGL_vec2_init((float)font->face->glyph->bitmap_left, (float)font->face->glyph->bitmap_top);
		font->characters[ch].bearing_normalized = CGL_vec2_init((CGL_float)font->characters[ch].bearing.x / font->atlas_width, (CGL_float)font->characters[ch].bearing.y / font->atlas_height);
		font->characters[ch].advance = CGL_vec2_init((float)(font->face->glyph->advance.x >> 6), (float)0.0f);
		font->characters[ch].advance_normalized = CGL_vec2_init((CGL_float)font->characters[ch].advance.x / font->atlas_width, (CGL_float)font->characters[ch].advance.y / font->atlas_height);
		font->characters[ch].ch = ch;
		font->characters[ch].bitmap = (unsigned char*)CGL_malloc(sizeof(unsigned char) * size_x * size_y);
		if (!font->characters[ch].bitmap) return false;
		memcpy(font->characters[ch].bitmap, font->face->glyph->bitmap.buffer, (sizeof(unsigned char) * size_x * size_y));

		CGL_texture_set_sub_data(font->atlas, offset_x, offset_y, size_x, size_y, font->characters[ch].bitmap);

		offset_x += size_x + 5;
		max_size_y = max(max_size_y, size_y);
		if (((int64_t)width - offset_x) <= 10)
		{
			offset_x = 0;
			offset_y += max_size_y + 10;
			max_size_y = 0;
		}
	}
	return true;
}

CGL_font_character* CGL_font_get_characters(CGL_font* font)
{
	return font->characters;
}

CGL_texture* CGL_text_bake_to_texture(const char* string, size_t string_length, CGL_font* font, size_t* width, size_t* height)
{
	size_t tex_width = 0;
	size_t tex_height = 0;
	size_t max_bottom_pad = 0;
	for (CGL_int i = 0; i < string_length; i++)
	{
		char ch = string[i];
		tex_width += (((int)font->characters[ch].advance.x) >> 6);
		max_bottom_pad = max(max_bottom_pad, (size_t)(font->characters[ch].size.y - font->characters[ch].bearing.y));
		tex_height = max(tex_height, (size_t)font->characters[ch].size.y + max_bottom_pad);
	}
	if (width) *width = tex_width;
	if (height) *height = tex_height;
	CGL_texture* tex = CGL_texture_create_blank((int)tex_width, (int)tex_height, GL_RED, GL_RED, GL_UNSIGNED_BYTE);
	if (!tex) return NULL;
	size_t offset_x = 0;
	size_t offset_y = 0;
	for (CGL_int i = 0; i < string_length; i++)
	{
		char ch = string[i];
		size_t offset_x_local = offset_x + (size_t)font->characters[ch].bearing.x;
		size_t offset_y_local = offset_y + (size_t)(font->characters[ch].size.y - font->characters[ch].bearing.y) - max_bottom_pad;
		offset_y_local += ((tex_height)-(size_t)font->characters[ch].size.y);
		CGL_texture_set_sub_data(tex, offset_x_local, offset_y_local, (int)font->characters[ch].size.x, (int)font->characters[ch].size.y, font->characters[ch].bitmap);
		offset_x += (((int)font->characters[ch].advance.x) >> 6);
	}
	return tex;
}

#endif

#endif


// widgets
#ifndef CGL_EXCLUDE_WIDGETS
#ifndef CGL_GRAPHICS_API

struct CGL_widgets_context
{
	CGL_texture* active_textures[CGL_WIDGETS_MAX_TEXTURES];
	CGL_mat4 projection_matrix;
	CGL_mat4 view_matrix;
	CGL_mat4 model_matrix;
	CGL_mat4 view_proj_matrix;
	CGL_vec4 stroke_color;
	CGL_vec4 fill_color;
	CGL_vec4 mask;
	CGL_vec4 scale;
	CGL_vec4 offset;
	CGL_vec4 tex_coord_scale_offset;
	CGL_vec3 light_color;
	CGL_vec3 light_position;
	CGL_mesh_vertex* vertices;
	CGL_shader* shader;
	CGL_texture* texture;
	uint32_t* indices;
	size_t max_vertices;
	size_t vertices_count;
	size_t max_indices;
	size_t indices_count;
	CGL_float stroke_thickness;
	CGL_float aspect_ratio;
	GLuint vertex_array;
	GLuint vertex_buffer;
	GLuint index_buffer;
	CGL_int max_active_textures_supported;
	CGL_int active_texture_count;
	CGL_int active_texture_id;
	CGL_bool flushed;
	CGL_bool is_fill;
	CGL_bool adjust_for_aspect_ratio;
	CGL_bool transform_points_on_cpu;
	CGL_bool diffuse_shading_enabled;
	CGL_bool is_font_texture;
};

static const char* __CGL_WIDGETS_VERTEX_SHADER_SOURCE = 
#ifdef CGL_WASM	
"#version 300 es\n"
"precision highp float;\n"
"precision highp int;\n"
"in vec4 position;\n"
"in vec4 normal;\n"
"in vec4 texcoord;\n"
"in vec4 texcoordscaleoffset;\n"
"in ivec4 texids;\n"
#else
"#version 430 core\n"
"\n"
"layout (location = 0) in vec4 position;\n"
"layout (location = 1) in vec4 normal;\n"
"layout (location = 2) in vec4 texcoord;\n"
"layout (location = 3) in vec4 texcoordscaleoffset;\n"
"layout (location = 4) in ivec4 texids;\n"
#endif
"\n"
"out vec3 Position;\n"
"out vec3 Normal;\n"
"out vec2 TexCoord; \n"
"out vec4 Color;\n"
"out vec4 TexCoordScaleOffset;\n"
"flat out int TexID;\n"
"flat out int UsingFontTexture;\n"
"\n"
"uniform bool u_TransformPointsOnCPU;\n"
"uniform mat4 u_ViewProjMatrix;\n"
"uniform mat4 u_ModelMatrix;\n"
"\n"
"void main()\n"
"{\n"
"   if(u_TransformPointsOnCPU)\n"
"   {\n"
"       gl_Position = vec4(position.xyz, 1.0f);\n"
"       Position = position.xyz;\n"
"       Normal = normal.xyz;\n"
"   }\n"
"	else\n"
"   {\n"
"       gl_Position = u_ViewProjMatrix * u_ModelMatrix * vec4(position.xyz, 1.0f);\n"
"	    Position = (u_ModelMatrix * vec4(position.xyz, 1.0f)).xyz;\n"
"       mat3 normal_matrix = transpose(inverse(mat3(u_ModelMatrix)));\n"
"	    Normal = normal_matrix * normal.xyz;\n"
"   }\n"
"	TexCoord = texcoord.xy;\n"
"	TexID = texids.x;\n"
"	UsingFontTexture = texids.y;\n"
"	TexCoordScaleOffset = texcoordscaleoffset;\n"
"	Color = vec4(position.w, texcoord.zw, 1.0);\n"
"}";

static const char* __CGL_WIDGETS_FRAGMENT_SHADER_SOURCE = 
#ifdef CGL_WASM
"#version 300 es\n"
"precision highp float;\n"
"precision highp int;\n"
#else
"#version 430 core\n"
#endif
"\n"
"out vec4 FragColor;\n"
"\n"
"in vec3 Position;\n"
"in vec3 Normal;\n"
"in vec2 TexCoord;\n"
"in vec4 Color;\n"
"in vec4 TexCoordScaleOffset;\n"
"flat in int TexID;\n"
"flat in int UsingFontTexture;\n"
"\n"
"uniform bool u_DiffuseShadingEnabled;\n"
"uniform vec3 u_LightColor;\n"
"uniform vec3 u_LightPosition;\n"
"uniform sampler2D u_Texture[16];\n"
"uniform vec4 u_Mask;\n"
"\n"
"// It has to be done this way as some WebGL implementations do not support indexing into u_Textures with TexID\n"
"vec4 sampleTexture()\n"
"{\n"
"    vec2 adjustedTexCoord = TexCoord * TexCoordScaleOffset.xy + TexCoordScaleOffset.zw;\n"
"\n"
"    switch (TexID)\n"
"    {\n"
"        case 0: return texture(u_Texture[0], adjustedTexCoord);\n"
"        case 1: return texture(u_Texture[1], adjustedTexCoord);\n"
"        case 2: return texture(u_Texture[2], adjustedTexCoord);\n"
"        case 3: return texture(u_Texture[3], adjustedTexCoord);\n"
"        case 4: return texture(u_Texture[4], adjustedTexCoord);\n"
"        case 5: return texture(u_Texture[5], adjustedTexCoord);\n"
"        case 6: return texture(u_Texture[6], adjustedTexCoord);\n"
"        case 7: return texture(u_Texture[7], adjustedTexCoord);\n"
"        case 8: return texture(u_Texture[8], adjustedTexCoord);\n"
"        case 9: return texture(u_Texture[9], adjustedTexCoord);\n"
"        case 10: return texture(u_Texture[10], adjustedTexCoord);\n"
"        case 11: return texture(u_Texture[11], adjustedTexCoord);\n"
"        case 12: return texture(u_Texture[12], adjustedTexCoord);\n"
"        case 13: return texture(u_Texture[13], adjustedTexCoord);\n"
"        case 14: return texture(u_Texture[14], adjustedTexCoord);\n"
"        case 15: return texture(u_Texture[15], adjustedTexCoord);\n"
"        default: return vec4(1.0); // Return white color if TexID is invalid\n"
"    }\n"
"}\n"
"\n"
"void main()\n"
"{\n"
"	vec4 color = Color;\n"
"	if(TexID > -1)\n"
"	{\n"
"		color = sampleTexture();\n"
"       if(UsingFontTexture == 1)\n"
"       {\n"
"           color = color.r * Color;\n"
"           if(color.r < 0.1f) discard;\n"
"       }\n"
"	}\n"
"	if(u_DiffuseShadingEnabled)\n"
"	{\n"
"		float ambient_strength = 0.1f;\n"
"		vec3 ambient = ambient_strength * u_LightColor;\n"
"		vec3 norm = normalize(Normal);\n"
"		vec3 light_dir = normalize(u_LightPosition - Position);\n"
"		float diff = max(dot(norm, light_dir), 0.0);\n"
"		vec3 diffuse = diff * u_LightColor;\n"
"		color.rgb = (diffuse + ambient) * color.rgb;\n"
"	}\n"
"   else\n"
"   {\n"
"       if (Position.x < u_Mask.x || Position.y < u_Mask.y || Position.x > u_Mask.z || Position.y > u_Mask.w)\n"
"           discard;\n"
"   }\n"
"	FragColor = color;\n"
"}";

static CGL_widgets_context* __CGL_WIDGETS_CURRENT_CONTEXT = NULL;

CGL_widgets_context* CGL_widgets_context_create(size_t max_vertices, size_t max_indices)
{
	CGL_widgets_context* context = (CGL_widgets_context*)CGL_malloc(sizeof(CGL_widgets_context));
	if (!context) return NULL;
	context->max_indices = max_indices;
	context->max_vertices = max_vertices;
	context->vertices = (CGL_mesh_vertex*)CGL_malloc(sizeof(CGL_mesh_vertex) * max_vertices);
	context->indices = (uint32_t*)CGL_malloc(sizeof(uint32_t) * max_indices);
	context->vertices_count = 0;
	context->indices_count = 0;
	context->flushed = true;
	context->adjust_for_aspect_ratio = false;
	context->transform_points_on_cpu = false;
	context->aspect_ratio = 1.0f;
	context->texture = NULL;
	context->is_font_texture = false;
	context->tex_coord_scale_offset = CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f);
	context->offset = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	context->scale = CGL_vec4_init(1.0f, 1.0f, 1.0f, 1.0f);
	context->projection_matrix = CGL_mat4_identity();
	context->view_matrix = CGL_mat4_identity();
	context->model_matrix = CGL_mat4_identity();
	context->view_proj_matrix = CGL_mat4_identity();
	context->diffuse_shading_enabled = false;
	context->light_color = CGL_vec3_init(1.0f, 1.0f, 1.0f);
	context->light_position = CGL_vec3_init(100.0f, 100.0f, 100.0f);
	context->active_texture_count = 0;
	glGetIntegerv(GL_MAX_TEXTURE_IMAGE_UNITS, &context->max_active_textures_supported);
	context->max_active_textures_supported = CGL_utils_max(context->max_active_textures_supported, 1);
	context->max_active_textures_supported = CGL_utils_min(context->max_active_textures_supported, CGL_WIDGETS_MAX_TEXTURES);
	glGenVertexArrays(1, &context->vertex_array);
	glBindVertexArray(context->vertex_array);
	glGenBuffers(1, &context->vertex_buffer);
	glBindBuffer(GL_ARRAY_BUFFER, context->vertex_buffer);
	glGenBuffers(1, &context->index_buffer);
	glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, context->index_buffer);
	glVertexAttribPointer(0, 4, GL_FLOAT, GL_FALSE, sizeof(CGL_mesh_vertex), (void*)offsetof(CGL_mesh_vertex, position));
	glEnableVertexAttribArray(0);
	glVertexAttribPointer(1, 4, GL_FLOAT, GL_FALSE, sizeof(CGL_mesh_vertex), (void*)offsetof(CGL_mesh_vertex, normal));
	glEnableVertexAttribArray(1);
	glVertexAttribPointer(2, 4, GL_FLOAT, GL_FALSE, sizeof(CGL_mesh_vertex), (void*)offsetof(CGL_mesh_vertex, texture_coordinates));
	glEnableVertexAttribArray(2);
	glVertexAttribPointer(3, 4, GL_FLOAT, GL_FALSE, sizeof(CGL_mesh_vertex), (void*)offsetof(CGL_mesh_vertex, bone_wieghts));
	glEnableVertexAttribArray(3);
	glVertexAttribIPointer(4, 4, GL_INT, sizeof(CGL_mesh_vertex), (void*)offsetof(CGL_mesh_vertex, bone_ids));
	glEnableVertexAttribArray(4);
	context->shader = CGL_shader_create(__CGL_WIDGETS_VERTEX_SHADER_SOURCE, __CGL_WIDGETS_FRAGMENT_SHADER_SOURCE, NULL);
	return context;
}

CGL_void CGL_widgets_context_destory(CGL_widgets_context* context)
{
	glDeleteBuffers(1, &context->index_buffer);
	glDeleteBuffers(1, &context->vertex_buffer);
	glDeleteVertexArrays(1, &context->vertex_array);
	CGL_shader_destroy(context->shader);
	if (context->indices) CGL_free(context->indices);
	if (context->vertices) CGL_free(context->vertices);
	CGL_free(context);
}

CGL_void CGL_widgets_adjust_for_aspect_ratio(CGL_float aspect_ratio)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->aspect_ratio = aspect_ratio;
	__CGL_WIDGETS_CURRENT_CONTEXT->adjust_for_aspect_ratio = true;
}

CGL_void CGL_widgets_do_not_adjust_for_aspect_ratio()
{
	__CGL_WIDGETS_CURRENT_CONTEXT->adjust_for_aspect_ratio = false;
}

CGL_widgets_context* CGL_window_get_current_context()
{
	return __CGL_WIDGETS_CURRENT_CONTEXT;
}

CGL_bool CGL_widgets_init()
{
	__CGL_WIDGETS_CURRENT_CONTEXT = CGL_widgets_context_create(CGL_WIDGETS_MAX_VERTICES, CGL_WIDGETS_MAX_INDICES);
	return __CGL_WIDGETS_CURRENT_CONTEXT != NULL;
}

CGL_void CGL_widgets_shutdown()
{
	if (__CGL_WIDGETS_CURRENT_CONTEXT) CGL_widgets_context_destory(__CGL_WIDGETS_CURRENT_CONTEXT);
}

CGL_void CGL_window_set_current_context(CGL_widgets_context* context)
{
	if (context) __CGL_WIDGETS_CURRENT_CONTEXT = context;
}

CGL_bool CGL_widgets_begin_int(CGL_float scale_x, CGL_float scale_y, CGL_float offset_x, CGL_float offset_y)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->flushed = false;
	__CGL_WIDGETS_CURRENT_CONTEXT->is_fill = true;
	__CGL_WIDGETS_CURRENT_CONTEXT->transform_points_on_cpu = false;
	__CGL_WIDGETS_CURRENT_CONTEXT->stroke_color = CGL_vec4_init(0.0f, 0.0f, 0.0f, 1.0f);
	__CGL_WIDGETS_CURRENT_CONTEXT->fill_color = CGL_vec4_init(1.0f, 1.0f, 1.0f, 1.0f);
	__CGL_WIDGETS_CURRENT_CONTEXT->model_matrix = CGL_mat4_identity();
	__CGL_WIDGETS_CURRENT_CONTEXT->view_matrix = CGL_mat4_identity();
	__CGL_WIDGETS_CURRENT_CONTEXT->projection_matrix = CGL_mat4_identity();
	__CGL_WIDGETS_CURRENT_CONTEXT->view_proj_matrix = CGL_mat4_identity();
	__CGL_WIDGETS_CURRENT_CONTEXT->diffuse_shading_enabled = false;
	__CGL_WIDGETS_CURRENT_CONTEXT->light_color = CGL_vec3_init(1.0f, 1.0f, 1.0f);
	__CGL_WIDGETS_CURRENT_CONTEXT->light_position = CGL_vec3_init(100.0f, 100.0f, 100.0f);
	__CGL_WIDGETS_CURRENT_CONTEXT->stroke_thickness = 0.05f;
	__CGL_WIDGETS_CURRENT_CONTEXT->scale = CGL_vec4_init(scale_x, scale_y, 1.0f, 1.0f);
	__CGL_WIDGETS_CURRENT_CONTEXT->offset = CGL_vec4_init(offset_x, offset_y, 0.0f, 0.0f);
	__CGL_WIDGETS_CURRENT_CONTEXT->mask = CGL_vec4_init(-1.0f, -1.0f, 1.0f, 1.0f);
	__CGL_WIDGETS_CURRENT_CONTEXT->tex_coord_scale_offset = CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f);
	__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_count = 0;
	__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_id = -1;
	__CGL_WIDGETS_CURRENT_CONTEXT->is_font_texture = false;
	return true;
}

CGL_bool CGL_widgets_begin()
{
	return CGL_widgets_begin_int(1.0f, 1.0f, 0.0f, 0.0f);
}

CGL_bool CGL_widgets_end()
{
	return CGL_widgets_flush();
}

CGL_bool CGL_widgets_flush()
{
	//if(__CGL_WIDGETS_CURRENT_CONTEXT->flushed) return false;
	if (__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count == 0 || __CGL_WIDGETS_CURRENT_CONTEXT->indices_count == 0) return false;
	// first upload the data
	glBindVertexArray(__CGL_WIDGETS_CURRENT_CONTEXT->vertex_array);
	glBindBuffer(GL_ARRAY_BUFFER, __CGL_WIDGETS_CURRENT_CONTEXT->vertex_buffer);
	glBufferData(GL_ARRAY_BUFFER, __CGL_WIDGETS_CURRENT_CONTEXT->vertices_count * sizeof(CGL_mesh_vertex), __CGL_WIDGETS_CURRENT_CONTEXT->vertices, GL_DYNAMIC_DRAW);
	glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, __CGL_WIDGETS_CURRENT_CONTEXT->index_buffer);
	glBufferData(GL_ELEMENT_ARRAY_BUFFER, __CGL_WIDGETS_CURRENT_CONTEXT->indices_count * sizeof(uint32_t), __CGL_WIDGETS_CURRENT_CONTEXT->indices, GL_DYNAMIC_DRAW);
	// render
	CGL_shader_bind(__CGL_WIDGETS_CURRENT_CONTEXT->shader);
	CGL_shader_set_uniform_bool(__CGL_WIDGETS_CURRENT_CONTEXT->shader, CGL_shader_get_uniform_location(__CGL_WIDGETS_CURRENT_CONTEXT->shader, "u_TransformPointsOnCPU"), __CGL_WIDGETS_CURRENT_CONTEXT->transform_points_on_cpu);
	if (!__CGL_WIDGETS_CURRENT_CONTEXT->transform_points_on_cpu)
	{
		CGL_shader_set_uniform_mat4(__CGL_WIDGETS_CURRENT_CONTEXT->shader, CGL_shader_get_uniform_location(__CGL_WIDGETS_CURRENT_CONTEXT->shader, "u_ViewProjMatrix"), &__CGL_WIDGETS_CURRENT_CONTEXT->view_proj_matrix);
		CGL_shader_set_uniform_mat4(__CGL_WIDGETS_CURRENT_CONTEXT->shader, CGL_shader_get_uniform_location(__CGL_WIDGETS_CURRENT_CONTEXT->shader, "u_ModelMatrix"), &__CGL_WIDGETS_CURRENT_CONTEXT->model_matrix);
	}
	CGL_shader_set_uniform_bool(__CGL_WIDGETS_CURRENT_CONTEXT->shader, CGL_shader_get_uniform_location(__CGL_WIDGETS_CURRENT_CONTEXT->shader, "u_DiffuseShadingEnabled"), __CGL_WIDGETS_CURRENT_CONTEXT->diffuse_shading_enabled);
	if (__CGL_WIDGETS_CURRENT_CONTEXT->diffuse_shading_enabled)
	{
		CGL_shader_set_uniform_vec3v(__CGL_WIDGETS_CURRENT_CONTEXT->shader, CGL_shader_get_uniform_location(__CGL_WIDGETS_CURRENT_CONTEXT->shader, "u_LightPosition"), __CGL_WIDGETS_CURRENT_CONTEXT->light_position.x, __CGL_WIDGETS_CURRENT_CONTEXT->light_position.y, __CGL_WIDGETS_CURRENT_CONTEXT->light_position.z);
		CGL_shader_set_uniform_vec3v(__CGL_WIDGETS_CURRENT_CONTEXT->shader, CGL_shader_get_uniform_location(__CGL_WIDGETS_CURRENT_CONTEXT->shader, "u_LightColor"), __CGL_WIDGETS_CURRENT_CONTEXT->light_color.x, __CGL_WIDGETS_CURRENT_CONTEXT->light_color.y, __CGL_WIDGETS_CURRENT_CONTEXT->light_color.z);
	}
	//CGL_shader_set_uniform_bool(__CGL_WIDGETS_CURRENT_CONTEXT->shader, CGL_shader_get_uniform_location(__CGL_WIDGETS_CURRENT_CONTEXT->shader, "u_TextureEnabled"), __CGL_WIDGETS_CURRENT_CONTEXT->texture != NULL);
	//if(__CGL_WIDGETS_CURRENT_CONTEXT->texture != NULL)
	//{
		//CGL_texture_bind(__CGL_WIDGETS_CURRENT_CONTEXT->texture, 5);
		//CGL_shader_set_uniform_int(__CGL_WIDGETS_CURRENT_CONTEXT->shader, CGL_shader_get_uniform_location(__CGL_WIDGETS_CURRENT_CONTEXT->shader, "u_Texture"), 5);
	//}
	CGL_shader_set_uniform_vec4v(__CGL_WIDGETS_CURRENT_CONTEXT->shader, CGL_shader_get_uniform_location(__CGL_WIDGETS_CURRENT_CONTEXT->shader, "u_Mask"), __CGL_WIDGETS_CURRENT_CONTEXT->mask.x, __CGL_WIDGETS_CURRENT_CONTEXT->mask.y, __CGL_WIDGETS_CURRENT_CONTEXT->mask.z, __CGL_WIDGETS_CURRENT_CONTEXT->mask.w);
	for (CGL_int i = 0; i < __CGL_WIDGETS_CURRENT_CONTEXT->active_texture_count; i++)
	{
		static CGL_byte texture_uniform_name_buffer[64];
		sprintf(texture_uniform_name_buffer, "u_Texture[%d]", i);
		if (__CGL_WIDGETS_CURRENT_CONTEXT->active_textures[i] != NULL) CGL_texture_bind(__CGL_WIDGETS_CURRENT_CONTEXT->active_textures[i], i);
		CGL_shader_set_uniform_int(__CGL_WIDGETS_CURRENT_CONTEXT->shader, CGL_shader_get_uniform_location(__CGL_WIDGETS_CURRENT_CONTEXT->shader, texture_uniform_name_buffer), i);
	}
	glBindVertexArray(__CGL_WIDGETS_CURRENT_CONTEXT->vertex_array);
	glDrawElements(GL_TRIANGLES, (GLsizei)__CGL_WIDGETS_CURRENT_CONTEXT->indices_count, GL_UNSIGNED_INT, NULL);
	glBindVertexArray(0);
	glUseProgram(0);
	__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count = 0;
	__CGL_WIDGETS_CURRENT_CONTEXT->indices_count = 0;
	__CGL_WIDGETS_CURRENT_CONTEXT->flushed = true;
	return true;
}

bool CGL_widgets_flush_if_required()
{
	//if(__CGL_WIDGETS_CURRENT_CONTEXT->flushed) return false;
	if (__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count >= (__CGL_WIDGETS_CURRENT_CONTEXT->max_vertices - 10) && __CGL_WIDGETS_CURRENT_CONTEXT->indices_count % 3 == 0) return CGL_widgets_flush();
	return false;
}


// NOTE: Deprecated
/*
bool CGL_widgets_add_vertices(CGL_mesh_vertex* vertices, size_t vertex_count, uint32_t* indices, size_t index_count)
{
	if(__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count + vertex_count >= (__CGL_WIDGETS_CURRENT_CONTEXT->max_vertices - 10)) return false;
	if(__CGL_WIDGETS_CURRENT_CONTEXT->indices_count + index_count >= (__CGL_WIDGETS_CURRENT_CONTEXT->max_indices - 10)) return false;
	memcpy(&__CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count], vertices, sizeof(CGL_mesh_vertex) * vertex_count);
	memcpy(&__CGL_WIDGETS_CURRENT_CONTEXT->indices[__CGL_WIDGETS_CURRENT_CONTEXT->indices_count], indices, sizeof(uint32_t) * index_count);
	for(size_t i = __CGL_WIDGETS_CURRENT_CONTEXT->indices_count ; i < __CGL_WIDGETS_CURRENT_CONTEXT->indices_count + index_count ; i++) __CGL_WIDGETS_CURRENT_CONTEXT->indices[i] += (uint32_t)__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count;
	__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count += vertex_count;
	__CGL_WIDGETS_CURRENT_CONTEXT->indices_count += index_count;
	CGL_widgets_flush_if_required();
	return true;
}
*/

CGL_void CGL_widgets_add_vertex(CGL_mesh_vertex* vertex)
{
	CGL_widgets_flush_if_required();
	CGL_vec4 scale = __CGL_WIDGETS_CURRENT_CONTEXT->scale;
	if (__CGL_WIDGETS_CURRENT_CONTEXT->adjust_for_aspect_ratio)
	{
		// for now only works for 2D
		if (scale.x > scale.y) scale.x = scale.y / __CGL_WIDGETS_CURRENT_CONTEXT->aspect_ratio;
		else scale.y = scale.x * __CGL_WIDGETS_CURRENT_CONTEXT->aspect_ratio;
	}


	vertex->position.x = vertex->position.x * scale.x + __CGL_WIDGETS_CURRENT_CONTEXT->offset.x;
	vertex->position.y = vertex->position.y * scale.y + __CGL_WIDGETS_CURRENT_CONTEXT->offset.y;
	vertex->position.z = vertex->position.z * scale.z + __CGL_WIDGETS_CURRENT_CONTEXT->offset.z; // for future

	if (__CGL_WIDGETS_CURRENT_CONTEXT->transform_points_on_cpu)
	{
		// BUG: This is not working properly
		CGL_mat4 transform_matrix = CGL_mat4_mul(__CGL_WIDGETS_CURRENT_CONTEXT->view_proj_matrix, __CGL_WIDGETS_CURRENT_CONTEXT->model_matrix);
		vertex->position.w = 1.0f; vertex->position = CGL_mat4_mul_vec4(transform_matrix, vertex->position);
		vertex->normal.w = 0.0f; vertex->normal = CGL_mat4_mul_vec4(transform_matrix, vertex->normal);
	}


	__CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count++] = *vertex;
	__CGL_WIDGETS_CURRENT_CONTEXT->indices[__CGL_WIDGETS_CURRENT_CONTEXT->indices_count++] = (uint32_t)(__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 1);
	CGL_vec4 vt_color = __CGL_WIDGETS_CURRENT_CONTEXT->stroke_color;
	if (__CGL_WIDGETS_CURRENT_CONTEXT->is_fill) vt_color = __CGL_WIDGETS_CURRENT_CONTEXT->fill_color;
	__CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 1].bone_wieghts = __CGL_WIDGETS_CURRENT_CONTEXT->tex_coord_scale_offset;
	if (__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_id == -1 || __CGL_WIDGETS_CURRENT_CONTEXT->active_textures[__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_id] == NULL) __CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 1].bone_ids = CGL_ivec4_init(-1, 0, 0, 0);
	else   __CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 1].bone_ids = CGL_ivec4_init(__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_id, __CGL_WIDGETS_CURRENT_CONTEXT->is_font_texture ? 1 : 0, 0, 0);
	__CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 1].position.w = vt_color.x;
	__CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 1].texture_coordinates.z = vt_color.y;
	__CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 1].texture_coordinates.w = vt_color.z;
	__CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 1].normal.w = vt_color.w;
}

CGL_void CGL_widgets_add_mesh(CGL_mesh_cpu* mesh)
{
	for (size_t i = 0; i < mesh->index_count_used / 3; i++)
	{
		CGL_int fa = mesh->indices[i * 3], fb = mesh->indices[i * 3 + 1], fc = mesh->indices[i * 3 + 2];
		CGL_widgets_add_vertex(&mesh->vertices[fa]);
		CGL_widgets_add_vertex(&mesh->vertices[fb]);
		CGL_widgets_add_vertex(&mesh->vertices[fc]);
	}
}

CGL_void CGL_widgets_add_vertex_pt(CGL_vec3 position, CGL_vec2 tex_coord)
{
	CGL_mesh_vertex vertex = { 0 };
	vertex.position = CGL_vec4_init(position.x, position.y, position.z, 1.0f);
	vertex.texture_coordinates = CGL_vec4_init(tex_coord.x, tex_coord.y, 0.0f, 0.0f);
	vertex.normal = CGL_vec4_init(0.0f, 0.0f, 0.0f, 0.0f);
	if ((__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count + 1) % 3 == 0)
	{
		CGL_vec4 a = __CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 2].position;
		CGL_vec4 b = __CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 1].position;
		CGL_vec4 c = vertex.position;
		CGL_vec3 ab = CGL_vec3_sub(b, a);
		CGL_vec3 bc = CGL_vec3_sub(c, b);
		CGL_vec3 normal = CGL_vec3_cross(ab, bc);
		__CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 2].normal = CGL_vec4_init(normal.x, normal.y, normal.z, 0.0f);
		__CGL_WIDGETS_CURRENT_CONTEXT->vertices[__CGL_WIDGETS_CURRENT_CONTEXT->vertices_count - 1].normal = CGL_vec4_init(normal.x, normal.y, normal.z, 0.0f);
		vertex.normal = CGL_vec4_init(normal.x, normal.y, normal.z, 0.0f);
	}
	CGL_widgets_add_vertex(&vertex);
}

CGL_void CGL_widgets_add_vertex_p3ft2f(CGL_float pos_x, CGL_float pos_y, CGL_float pos_z, CGL_float tex_x, CGL_float tex_y)
{
	CGL_widgets_add_vertex_pt(CGL_vec3_init(pos_x, pos_y, pos_z), CGL_vec2_init(tex_x, tex_y));
}

CGL_void CGL_widgets_add_vertex_p(CGL_vec3 position)
{
	CGL_widgets_add_vertex_pt(position, CGL_vec2_init(0.0f, 0.0f));
}

CGL_void CGL_widgets_add_vertex_p3f(CGL_float pos_x, CGL_float pos_y, CGL_float pos_z)
{
	CGL_widgets_add_vertex_pt(CGL_vec3_init(pos_x, pos_y, pos_z), CGL_vec2_init(0.0f, 0.0f));
}

CGL_void CGL_widgets_add_vertex_p3ft(CGL_float pos_x, CGL_float pos_y, CGL_float pos_z, CGL_vec2 tex_coord)
{
	CGL_widgets_add_vertex_pt(CGL_vec3_init(pos_x, pos_y, pos_z), tex_coord);
}

CGL_void CGL_widgets_add_vertex_pt2f(CGL_vec3 position, CGL_float tex_x, CGL_float tex_y)
{
	CGL_widgets_add_vertex_pt(position, CGL_vec2_init(tex_x, tex_y));
}

CGL_void CGL_widgets_set_stroke_color(CGL_color color)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_id = -1;
	__CGL_WIDGETS_CURRENT_CONTEXT->stroke_color = CGL_vec4_init(color.x, color.y, color.z, color.w);
}

CGL_void CGL_widgets_set_stroke_colorf(CGL_float r, CGL_float g, CGL_float b, CGL_float a)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_id = -1;
	__CGL_WIDGETS_CURRENT_CONTEXT->stroke_color = CGL_vec4_init(r, g, b, a);
}

CGL_void CGL_widgets_set_mask(CGL_vec4 mask)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->mask = mask;
}

CGL_void CGL_widgets_set_maskf(CGL_float min_x, CGL_float min_y, CGL_float max_x, CGL_float max_y)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->mask = CGL_vec4_init(min_x, min_y, max_x, max_y);
}

CGL_void CGL_widgets_set_stroke_thicnkess(CGL_float thickness)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->stroke_thickness = thickness;
}

CGL_void CGL_widgets_set_fill_color(CGL_color color)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_id = -1;
	__CGL_WIDGETS_CURRENT_CONTEXT->fill_color = CGL_vec4_init(color.x, color.y, color.z, color.w);
}

CGL_void CGL_widgets_set_fill_colorf(CGL_float r, CGL_float g, CGL_float b, CGL_float a)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_id = -1;
	__CGL_WIDGETS_CURRENT_CONTEXT->fill_color = CGL_vec4_init(r, g, b, a);
}

CGL_void CGL_widgets_set_fill_mode(bool is_enabled)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->is_fill = is_enabled;
}

CGL_void CGL_widgets_set_projection_matrix(CGL_mat4* matrix)
{
	if (!__CGL_WIDGETS_CURRENT_CONTEXT->transform_points_on_cpu) CGL_widgets_flush();
	if (matrix == NULL)
	{
		__CGL_WIDGETS_CURRENT_CONTEXT->projection_matrix = CGL_mat4_identity();
		__CGL_WIDGETS_CURRENT_CONTEXT->view_proj_matrix = CGL_mat4_mul(__CGL_WIDGETS_CURRENT_CONTEXT->projection_matrix, __CGL_WIDGETS_CURRENT_CONTEXT->view_matrix);
		return;
	}
	__CGL_WIDGETS_CURRENT_CONTEXT->projection_matrix = *matrix;
	__CGL_WIDGETS_CURRENT_CONTEXT->view_proj_matrix = CGL_mat4_mul(__CGL_WIDGETS_CURRENT_CONTEXT->projection_matrix, __CGL_WIDGETS_CURRENT_CONTEXT->view_matrix);
}

CGL_void CGL_widgets_set_view_matrix(CGL_mat4* matrix)
{
	if (!__CGL_WIDGETS_CURRENT_CONTEXT->transform_points_on_cpu) CGL_widgets_flush();
	if (matrix == NULL)
	{
		__CGL_WIDGETS_CURRENT_CONTEXT->view_matrix = CGL_mat4_identity();
		__CGL_WIDGETS_CURRENT_CONTEXT->view_proj_matrix = CGL_mat4_mul(__CGL_WIDGETS_CURRENT_CONTEXT->projection_matrix, __CGL_WIDGETS_CURRENT_CONTEXT->view_matrix);
		return;
	}
	__CGL_WIDGETS_CURRENT_CONTEXT->view_matrix = *matrix;
	__CGL_WIDGETS_CURRENT_CONTEXT->view_proj_matrix = CGL_mat4_mul(__CGL_WIDGETS_CURRENT_CONTEXT->projection_matrix, __CGL_WIDGETS_CURRENT_CONTEXT->view_matrix);
}

CGL_void CGL_widgets_set_model_matrix(CGL_mat4* matrix)
{
	if (!__CGL_WIDGETS_CURRENT_CONTEXT->transform_points_on_cpu) CGL_widgets_flush();
	if (matrix == NULL) { __CGL_WIDGETS_CURRENT_CONTEXT->model_matrix = CGL_mat4_identity(); return; }
	__CGL_WIDGETS_CURRENT_CONTEXT->model_matrix = *matrix;
}



static CGL_void __CGL_widgets_set_texture(CGL_texture* texture, CGL_bool is_font_texture)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->is_font_texture = is_font_texture;
	for (CGL_int i = 0; i < __CGL_WIDGETS_CURRENT_CONTEXT->active_texture_count; i++)
	{
		if (__CGL_WIDGETS_CURRENT_CONTEXT->active_textures[i] == texture)
		{
			__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_id = i;
			return;
		}
	}
	if (__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_count >= CGL_WIDGETS_MAX_TEXTURES)
	{
		CGL_widgets_flush();
		__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_count = 0;
	}
	__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_id = __CGL_WIDGETS_CURRENT_CONTEXT->active_texture_count;
	__CGL_WIDGETS_CURRENT_CONTEXT->active_textures[__CGL_WIDGETS_CURRENT_CONTEXT->active_texture_count++] = texture;
	__CGL_WIDGETS_CURRENT_CONTEXT->tex_coord_scale_offset = CGL_vec4_init(1.0f, 1.0f, 0.0f, 0.0f);

}

CGL_void CGL_widgets_set_texture(CGL_texture* texture)
{
	__CGL_widgets_set_texture(texture, false);
}

CGL_void CGL_widgets_set_font_texture(CGL_texture* texture)
{
	__CGL_widgets_set_texture(texture, true);
}

CGL_void CGL_widgets_set_texture_coordinate_so(CGL_float scale_x, CGL_float scale_y, CGL_float offset_x, CGL_float offset_y)
{
	__CGL_WIDGETS_CURRENT_CONTEXT->tex_coord_scale_offset = CGL_vec4_init(scale_x, scale_y, offset_x, offset_y);
}

CGL_void CGL_widgets_enable_diffuse_shading(CGL_vec3 light_position, CGL_vec3 light_color)
{
	CGL_widgets_flush();
	__CGL_WIDGETS_CURRENT_CONTEXT->diffuse_shading_enabled = true;
	__CGL_WIDGETS_CURRENT_CONTEXT->light_position = light_position;
	__CGL_WIDGETS_CURRENT_CONTEXT->light_color = light_color;
}

CGL_void CGL_widgets_disable_diffuse_shading()
{
	CGL_widgets_flush();
	__CGL_WIDGETS_CURRENT_CONTEXT->diffuse_shading_enabled = false;
}

CGL_void CGL_widgets_apply_transformations_on_cpu()
{
	CGL_widgets_flush();
	__CGL_WIDGETS_CURRENT_CONTEXT->transform_points_on_cpu = true;
}
CGL_void CGL_widgets_apply_transformations_on_gpu()
{
	CGL_widgets_flush();
	__CGL_WIDGETS_CURRENT_CONTEXT->transform_points_on_cpu = false;
}

CGL_void __CGL_widgets_add_triangle_filled(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c)
{
	CGL_widgets_add_vertex_p(a);
	CGL_widgets_add_vertex_p(b);
	CGL_widgets_add_vertex_p(c);
}

static CGL_void __CGL_widgets_add_triangle_stroked(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c)
{
	CGL_widgets_add_line(a, b);
	CGL_widgets_add_line(b, c);
	CGL_widgets_add_line(a, c);
}

CGL_void CGL_widgets_add_triangle(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c)
{
	if (__CGL_WIDGETS_CURRENT_CONTEXT->is_fill) __CGL_widgets_add_triangle_filled(a, b, c);
	else __CGL_widgets_add_triangle_stroked(a, b, c);
}

static CGL_void __CGL_widgets_add_quad_filled(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c, CGL_vec3 d)
{
	CGL_widgets_add_vertex_pt2f(a, 0.0f, 0.0f);
	CGL_widgets_add_vertex_pt2f(c, 1.0f, 1.0f);
	CGL_widgets_add_vertex_pt2f(d, 0.0f, 1.0f);
	CGL_widgets_add_vertex_pt2f(a, 0.0f, 0.0f);
	CGL_widgets_add_vertex_pt2f(b, 1.0f, 0.0f);
	CGL_widgets_add_vertex_pt2f(c, 1.0f, 1.0f);
}

static CGL_void __CGL_widgets_add_quad_stroked(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c, CGL_vec3 d)
{
	CGL_widgets_add_line(a, b);
	CGL_widgets_add_line(b, c);
	CGL_widgets_add_line(c, d);
	CGL_widgets_add_line(a, d);
}

CGL_void CGL_widgets_add_quad(CGL_vec3 a, CGL_vec3 b, CGL_vec3 c, CGL_vec3 d)
{
	if (__CGL_WIDGETS_CURRENT_CONTEXT->is_fill) __CGL_widgets_add_quad_filled(a, b, c, d);
	else __CGL_widgets_add_quad_stroked(a, b, c, d);
}

CGL_void CGL_widgets_add_quad_8f(CGL_float ax, CGL_float ay, CGL_float bx, CGL_float by, CGL_float cx, CGL_float cy, CGL_float dx, CGL_float dy)
{
	CGL_widgets_add_quad(
		CGL_vec3_init(ax, ay, 0.0f),
		CGL_vec3_init(bx, by, 0.0f),
		CGL_vec3_init(cx, cy, 0.0f),
		CGL_vec3_init(dx, dy, 0.0f)
	);
}

CGL_void CGL_widgets_add_line(CGL_vec3 start, CGL_vec3 end)
{
	CGL_vec3 a, b, c, d;

	CGL_float original_slope = (end.y - start.y) / (end.x - start.x);
	CGL_float perp_slope = -1.0f / original_slope;
	CGL_float angle = atanf(perp_slope);
	CGL_float thickness = __CGL_WIDGETS_CURRENT_CONTEXT->stroke_thickness;
	CGL_float r = thickness / 2.0f;

	a = CGL_vec3_init(start.x + r * cosf(angle), start.y + r * sinf(angle), start.z);
	b = CGL_vec3_init(start.x - r * cosf(angle), start.y - r * sinf(angle), start.z);

	c = CGL_vec3_init(end.x - r * cosf(angle), end.y - r * sinf(angle), end.z);
	d = CGL_vec3_init(end.x + r * cosf(angle), end.y + r * sinf(angle), end.z);

	bool was_fill = __CGL_WIDGETS_CURRENT_CONTEXT->is_fill;
	__CGL_WIDGETS_CURRENT_CONTEXT->is_fill = false;
	__CGL_widgets_add_quad_filled(a, b, c, d);
	__CGL_WIDGETS_CURRENT_CONTEXT->is_fill = was_fill;
}

CGL_void CGL_widgets_add_line2f(CGL_float start_x, CGL_float start_y, CGL_float end_x, CGL_float end_y)
{
	CGL_widgets_add_line(
		CGL_vec3_init(start_x, start_y, 0.0f),
		CGL_vec3_init(end_x, end_y, 0.0f)
	);
}

CGL_void CGL_widgets_add_rect(CGL_vec3 start, CGL_vec2 size)
{
	CGL_widgets_add_quad(
		CGL_vec3_init(start.x, start.y, start.z),
		CGL_vec3_init(start.x + size.x, start.y, start.z),
		CGL_vec3_init(start.x + size.x, start.y + size.y, start.z),
		CGL_vec3_init(start.x, start.y + size.y, start.z)
	);
}

CGL_void CGL_widgets_add_rect2f(CGL_float start_x, CGL_float start_y, CGL_float size_x, CGL_float size_y)
{
	CGL_widgets_add_quad(
		CGL_vec3_init(start_x, start_y, 0.0f),
		CGL_vec3_init(start_x + size_x, start_y, 0.0f),
		CGL_vec3_init(start_x + size_x, start_y + size_y, 0.0f),
		CGL_vec3_init(start_x, start_y + size_y, 0.0f)
	);
}

CGL_void CGL_widgets_add_rounded_rect2f(CGL_float start_x, CGL_float start_y, CGL_float size_x, CGL_float size_y, CGL_float radius, CGL_int res)
{
	radius = CGL_utils_clamp(radius, 0.0f, 1.0f);
	CGL_float r = radius * CGL_utils_min(size_x, size_y) * 0.5f;

	CGL_widgets_add_arc2f(start_x + r, start_y + r, r, CGL_deg_to_rad(180.0f), CGL_deg_to_rad(270.0f), res);
	CGL_widgets_add_arc2f(start_x + size_x - r, start_y + r, r, CGL_deg_to_rad(270.0f), CGL_deg_to_rad(360.0f), res);
	CGL_widgets_add_arc2f(start_x + size_x - r, start_y + size_y - r, r, CGL_deg_to_rad(0.0f), CGL_deg_to_rad(90.0f), res);
	CGL_widgets_add_arc2f(start_x + r, start_y + size_y - r, r, CGL_deg_to_rad(90.0f), CGL_deg_to_rad(180.0f), res);

	if (__CGL_WIDGETS_CURRENT_CONTEXT->is_fill)
	{
		CGL_widgets_add_rect2f(start_x + r, start_y + r, size_x - 2.0f * r, size_y - 2.0f * r);
		CGL_widgets_add_rect2f(start_x, start_y + r, r, size_y - 2.0f * r);
		CGL_widgets_add_rect2f(start_x + size_x - r, start_y + r, r, size_y - 2.0f * r);
		CGL_widgets_add_rect2f(start_x + r, start_y, size_x - 2.0f * r, r);
		CGL_widgets_add_rect2f(start_x + r, start_y + size_y - r, size_x - 2.0f * r, r);
	}
	else
	{
		CGL_widgets_add_line2f(start_x + r, start_y, start_x + size_x - r, start_y);
		CGL_widgets_add_line2f(start_x + r, start_y + size_y, start_x + size_x - r, start_y + size_y);
		CGL_widgets_add_line2f(start_x, start_y + r, start_x, start_y + size_y - r);
		CGL_widgets_add_line2f(start_x + size_x, start_y + r, start_x + size_x, start_y + size_y - r);
	}
}

CGL_void __CGL_widgets_add_oval_filled(CGL_vec3 position, CGL_vec2 radius)
{
	CGL_float x = 0.0f, y = 0.0f;
	for (CGL_float i = 0; i <= 360;)
	{
		x = radius.x * cosf(i); y = radius.y * sinf(i);
		CGL_widgets_add_vertex_p3f(x + position.x, y + position.y, position.z);
		i = i + 0.5f; x = radius.x * cosf(i); y = radius.y * sinf(i);
		CGL_widgets_add_vertex_p3f(x + position.x, y + position.y, position.z);
		CGL_widgets_add_vertex_p3f(position.x, position.y, position.z);
		i = i + 0.5f;
	}
}

CGL_void __CGL_widgets_add_oval_stroked(CGL_vec3 position, CGL_vec2 radius)
{
	(void)position;
	(void)radius;
	CGL_LOG("void __CGL_widgets_add_oval_stroked(CGL_vec3 position, CGL_vec2 radius) not implemented\n");
}

CGL_void CGL_widgets_add_circle2f(CGL_float pos_x, CGL_float pos_y, CGL_float radius)
{
	if (__CGL_WIDGETS_CURRENT_CONTEXT->is_fill) __CGL_widgets_add_oval_filled(CGL_vec3_init(pos_x, pos_y, 0.0f), CGL_vec2_init(radius, radius));
	else __CGL_widgets_add_oval_stroked(CGL_vec3_init(pos_x, pos_y, 0.0f), CGL_vec2_init(radius, radius));
}

CGL_void CGL_widgets_add_circler(CGL_vec3 position, CGL_float radius, CGL_int res)
{
	// CGL_widgets_add_arc2f(position.x, position.y, radius, 0.0f, CGL_2PI, res);
	CGL_widgets_add_oval2fr(position.x, position.y, radius, radius, res);
}

CGL_void CGL_widgets_add_circle2fr(CGL_float pos_x, CGL_float pos_y, CGL_float radius, CGL_int res)
{
	CGL_widgets_add_circler(CGL_vec3_init(pos_x, pos_y, 0.0f), radius, res);
}

CGL_void CGL_widgets_add_oval(CGL_vec3 position, CGL_vec2 radius)
{
	if (__CGL_WIDGETS_CURRENT_CONTEXT->is_fill) __CGL_widgets_add_oval_filled(position, radius);
	else __CGL_widgets_add_oval_stroked(position, radius);
}

CGL_void CGL_widgets_add_oval2f(CGL_float pos_x, CGL_float pos_y, CGL_float radius_x, CGL_float radius_y)
{
	if (__CGL_WIDGETS_CURRENT_CONTEXT->is_fill) __CGL_widgets_add_oval_filled(CGL_vec3_init(pos_x, pos_y, 0.0f), CGL_vec2_init(radius_x, radius_y));
	else __CGL_widgets_add_oval_stroked(CGL_vec3_init(pos_x, pos_y, 0.0f), CGL_vec2_init(radius_x, radius_y));
}

static CGL_void __CGL_widgets_add_arc_filled2f(CGL_float pos_x, CGL_float pos_y, CGL_float radius, CGL_float start_angle, CGL_float end_angle, CGL_int resolution)
{
	CGL_float x = 0.0f, y = 0.0f;
	CGL_float angle = start_angle;
	CGL_float angle_step = (end_angle - start_angle) / resolution;
	for (CGL_int i = 0; i < resolution; i++)
	{
		x = radius * cosf(angle); y = radius * sinf(angle);
		CGL_widgets_add_vertex_p3f(x + pos_x, y + pos_y, 0.0f);
		angle += angle_step;
		x = radius * cosf(angle); y = radius * sinf(angle);
		CGL_widgets_add_vertex_p3f(x + pos_x, y + pos_y, 0.0f);
		CGL_widgets_add_vertex_p3f(pos_x, pos_y, 0.0f);
	}
}

static CGL_void __CGL_widgets_add_arc_stroked2f(CGL_float pos_x, CGL_float pos_y, CGL_float radius, CGL_float start_angle, CGL_float end_angle, CGL_int resolution)
{
	CGL_float x0 = 0.0f, y0 = 0.0f, x1 = 0.0f, y1 = 0.0f;
	CGL_float angle = start_angle;
	CGL_float angle_step = (end_angle - start_angle) / resolution;

#ifdef CGL_WIDGETS_DRAW_ARC_WITH_LINES
	CGL_widgets_add_line2f(pos_x, pos_y, pos_x + radius * cosf(start_angle), pos_y + radius * sinf(start_angle));
	CGL_widgets_add_line2f(pos_x, pos_y, pos_x + radius * cosf(end_angle), pos_y + radius * sinf(end_angle));
#endif

	for (CGL_int i = 0; i < resolution; i++)
	{
		x0 = radius * cosf(angle); y0 = radius * sinf(angle);
		angle += angle_step;
		x1 = radius * cosf(angle); y1 = radius * sinf(angle);
		CGL_widgets_add_line2f(pos_x + x0, pos_y + y0, pos_x + x1, pos_y + y1);
	}
}

static CGL_void __CGL_widgets_add_oval_filled2f(CGL_float pos_x, CGL_float pos_y, CGL_float radiusx, CGL_float radiusy, CGL_int resolution)
{
	CGL_float x = 0.0f, y = 0.0f;
	CGL_float angle = 0.0f;
	CGL_float angle_step = (CGL_2PI - 0.0f) / resolution;
	for (CGL_int i = 0; i < resolution; i++)
	{
		x = radiusx * cosf(angle); y = radiusy * sinf(angle);
		CGL_widgets_add_vertex_p3f(x + pos_x, y + pos_y, 0.0f);
		angle += angle_step;
		x = radiusx * cosf(angle); y = radiusy * sinf(angle);
		CGL_widgets_add_vertex_p3f(x + pos_x, y + pos_y, 0.0f);
		CGL_widgets_add_vertex_p3f(pos_x, pos_y, 0.0f);
	}
}

static CGL_void __CGL_widgets_add_oval_stroked2f(CGL_float pos_x, CGL_float pos_y, CGL_float radiusx, CGL_float radiusy, CGL_int resolution)
{
	CGL_float x0 = 0.0f, y0 = 0.0f, x1 = 0.0f, y1 = 0.0f;
	CGL_float angle = 0.0f;
	CGL_float angle_step = (CGL_2PI - 0.0f) / resolution;
	for (CGL_int i = 0; i < resolution; i++)
	{
		x0 = radiusx * cosf(angle); y0 = radiusy * sinf(angle);
		angle += angle_step;
		x1 = radiusx * cosf(angle); y1 = radiusy * sinf(angle);
		CGL_widgets_add_line2f(pos_x + x0, pos_y + y0, pos_x + x1, pos_y + y1);
	}
}

CGL_void CGL_widgets_add_arc2f(CGL_float pos_x, CGL_float pos_y, CGL_float radius, CGL_float start_angle, CGL_float end_angle, CGL_int resolution)
{
	if (__CGL_WIDGETS_CURRENT_CONTEXT->is_fill) __CGL_widgets_add_arc_filled2f(pos_x, pos_y, radius, start_angle, end_angle, resolution);
	else __CGL_widgets_add_arc_stroked2f(pos_x, pos_y, radius, start_angle, end_angle, resolution);
}

CGL_void CGL_widgets_add_oval2fr(CGL_float pos_x, CGL_float pos_y, CGL_float radiusx, CGL_float radiusy, CGL_int resolution)
{
	if (__CGL_WIDGETS_CURRENT_CONTEXT->is_fill) __CGL_widgets_add_oval_filled2f(pos_x, pos_y, radiusx, radiusy, resolution);
	else __CGL_widgets_add_oval_stroked2f(pos_x, pos_y, radiusx, radiusy, resolution);
}

CGL_void CGL_widgets_add_circle(CGL_vec3 position, CGL_float radius)
{
	if (__CGL_WIDGETS_CURRENT_CONTEXT->is_fill) __CGL_widgets_add_oval_filled(position, CGL_vec2_init(radius, radius));
	else __CGL_widgets_add_oval_stroked(position, CGL_vec2_init(radius, radius));
}



bool CGL_widgets_add_character(char c, CGL_float x, CGL_float y, CGL_float sx, CGL_float sy)
{
	bool was_fill = __CGL_WIDGETS_CURRENT_CONTEXT->is_fill;
	__CGL_WIDGETS_CURRENT_CONTEXT->is_fill = true;
	switch (c)
	{
	case '0':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		return true;
	}
	case '1':
	{
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		return true;
	}
	case '2':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y + 0.5f * sy, sx * 0.25f, sy * 0.5f);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy * 0.5f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		return true;
	}
	case '3':
	{
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		return true;
	}
	case '4':
	{
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y + 0.5f * sy, sx * 0.25f, sy * 0.5f);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		return true;
	}
	case '5':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y + 0.5f * sy, sx * 0.25f, sy * 0.5f);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy * 0.5f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		return true;
	}
	case '6':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy * 0.5f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		return true;
	}
	case '7':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		return true;
	}
	case '8':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		return true;
	}
	case '9':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y + 0.5f * sy, sx * 0.25f, sy * 0.5f);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		return true;
	}
	case 'a':
	case 'A':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		return true;
	}
	case 'b':
	case 'B':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		return true;
	}
	case 'c':
	case 'C':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		return true;
	}
	case 'd':
	case 'D':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		return true;
	}
	case 'e':
	case 'E':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		return true;
	}
	case 'f':
	case 'F':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		return true;
	}
	case 'g':
	case 'G':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy * 0.5f);
		CGL_widgets_add_rect2f(x + 0.5f * sx, y + (0.5f - 0.125f) * sy, sx * 0.5f, sy * 0.25f);
		return true;
	}
	case 'h':
	case 'H':
	{
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		return true;
	}
	case 'i':
	case 'I':
	{
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		return true;
	}
	case 'j':
	case 'J':
	{
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy * 0.5f);
		return true;
	}
	case 'k':
	case 'K':
	{
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_quad_8f(
			x, y + (0.5f + 0.15f) * sy,
			x, y + (0.5f - 0.15f) * sy,
			x + sx, y + 0.85f * sy,
			x + 0.85f * sx, y + sy
		);
		CGL_widgets_add_quad_8f(
			x, y + (0.5f + 0.15f) * sy,
			x, y + (0.5f - 0.15f) * sy,
			x + 0.85f * sx, y,
			x + sx, y + 0.15f * sy
		);
		return true;
	}
	case 'l':
	case 'L':
	{
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		return true;
	}
	case 'm':
	case 'M':
	{
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x + (0.5f - 0.125f) * sx, y + 0.5f * sy, sx * 0.25f, sy * 0.5f);
		return true;
	}
	case 'n':
	case 'N':
	{
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_quad_8f(
			x + 0.15f * sx, y + sy,
			x, y + 0.85f * sy,
			x + 0.85f * sx, y,
			x + sx, y + 0.15f * sy
		);
		return true;
	}
	case 'o':
	case 'O':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		return true;
	}
	case 'p':
	case 'P':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y + 0.5f * sy, sx * 0.25f, sy * 0.5f);
		return true;
	}
	case 'q':
	case 'Q':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x + (0.5f - 0.125f) * sx, y, sx * 0.25f, sy * 0.5f);
		return true;
	}
	case 'r':
	case 'R':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y + 0.5f * sy, sx * 0.25f, sy * 0.5f);
		CGL_widgets_add_quad_8f(
			x, y + (0.5f + 0.15f) * sy,
			x, y + (0.5f - 0.15f) * sy,
			x + 0.85f * sx, y,
			x + sx, y + 0.15f * sy
		);
		return true;
	}
	case 's':
	case 'S':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy * 0.5f);
		CGL_widgets_add_rect2f(x, y + 0.5f * sy, sx * 0.25f, sy * 0.5f);
		return true;
	}
	case 't':
	case 'T':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x + (0.5f - 0.125f) * sx, y, sx * 0.25f, sy);
		return true;
	}
	case 'u':
	case 'U':
	{
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		return true;
	}
	case 'v':
	case 'V':
	{
		CGL_widgets_add_quad_8f(
			x + sx, y + 0.85f * sy,
			x + 0.85f * sx, y + sy,
			x + (0.5f - 0.125f) * sx, y,
			x + (0.5f + 0.125f) * sx, y
		);
		CGL_widgets_add_quad_8f(
			x + 0.15f * sx, y + sy,
			x, y + 0.85f * sy,
			x + (0.5f - 0.125f) * sx, y,
			x + (0.5f + 0.125f) * sx, y
		);
		return true;
	}
	case 'w':
	case 'W':
	{
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x + (0.5f - 0.125f) * sx, y, sx * 0.25f, sy * 0.5f);
		return true;
	}
	case 'x':
	case 'X':
	{
		CGL_widgets_add_quad_8f(
			x + 0.15f * sx, y + sy,
			x, y + 0.85f * sy,
			x + 0.85f * sx, y,
			x + sx, y + 0.15f * sy
		);
		CGL_widgets_add_quad_8f(
			x + 0.85f * sx, y + sy,
			x + sx, y + 0.85f * sy,
			x + 0.15f * sx, y,
			x, y + 0.15f * sy
		);
		return true;
	}
	case 'y':
	case 'Y':
	{
		CGL_widgets_add_rect2f(x, y + 0.5f * sy, sx * 0.25f, sy * 0.5f);
		CGL_widgets_add_rect2f(x + sx * 0.75f, y, sx * 0.25f, sy);
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		return true;
	}
	case 'z':
	case 'Z':
	{
		CGL_widgets_add_rect2f(x, y + sy * 0.75f, sx, sy * 0.25f);
		CGL_widgets_add_rect2f(x, y, sx, sy * 0.25f);
		CGL_widgets_add_quad_8f(
			x + 0.85f * sx, y + sy,
			x + sx, y + 0.85f * sy,
			x + 0.15f * sx, y,
			x, y + 0.15f * sy
		);
		return true;
	}
	case '-':
	{
		CGL_widgets_add_rect2f(x, y + (0.5f - 0.125f) * sy, sx, sy * 0.25f);
		return true;
	}
	case '\'':
	{
		CGL_widgets_add_rect2f(x + (0.5f - 0.125f) * sx, y + sy * 0.75f, sx * 0.25f, sy * 0.25f);
		return true;
	}
	case '.':
	{
		CGL_widgets_add_rect2f(x + (0.5f - 0.125f) * sx, y, sx * 0.25f, sy * 0.25f);
		return true;
	}
	case ':':
	{
		CGL_widgets_add_rect2f(x + (0.5f - 0.125f) * sx, y + 0.1f * sy, sx * 0.25f, sy * 0.25f);
		CGL_widgets_add_rect2f(x + (0.5f - 0.125f) * sx, y + (0.1f + 0.25f + 0.1f) * sy, sx * 0.25f, sy * 0.25f);
		return true;
	}
	case ' ':
	{
		return true;
	}
	}
	__CGL_WIDGETS_CURRENT_CONTEXT->is_fill = was_fill;
	// return false;
	return true;
}

CGL_bool CGL_widgets_add_string(const char* str, CGL_float x, CGL_float y, CGL_float sx, CGL_float sy)
{
	const CGL_float line_gap = 0.01f;
	const CGL_float char_gap = 0.01f;
	CGL_int length = (int)strlen(str);
	CGL_int line_length = 0;
	CGL_int line_length_max = 0;
	CGL_int num_lines = 1;
	CGL_float ix = x;
	for (CGL_int i = 0; i < length; i++)
	{
		line_length++;
		if (str[i] == '\n')
		{
			line_length_max = CGL_utils_max(line_length, line_length_max);
			line_length = 0;
			num_lines++;
		}
	}
	line_length_max = CGL_utils_max(line_length, line_length_max);
	CGL_float character_sx = sx / line_length - char_gap;
	CGL_float character_sy = (sy - line_gap * num_lines) / (num_lines);
	y += sy - character_sy;
	for (CGL_int i = 0; i < length; i++)
	{
		if (str[i] == '\n')
		{
			y = y - line_gap - character_sy;
			x = ix;
			continue;
		}
		if (!CGL_widgets_add_character(str[i], x, y, character_sx, character_sy)) return false;
		x = x + character_sx + char_gap;
	}
	return true;
}

#ifndef CGL_EXCLUDE_TEXT_RENDER
CGL_float CGL_widgets_add_string_with_font(const char* str, CGL_font* font, CGL_float x, CGL_float y, CGL_float sx, CGL_float scale_y)
{
	CGL_int string_length = (CGL_int)strlen(str);
	CGL_float max_char_width = 0.0f, average_char_width = 0.0f;
	CGL_font_character* characters = CGL_font_get_characters(font);
	for (CGL_int i = 0; i < string_length; i++) { max_char_width = CGL_utils_max(max_char_width, characters[str[i]].advance_normalized.x); average_char_width += characters[str[i]].advance_normalized.x; }
	average_char_width /= (CGL_float)string_length;
	CGL_float approx_each_char_width = sx / (CGL_float)string_length;
	// NOTE: Its a question whether to use max character width or average character width here!
	CGL_float character_scale = approx_each_char_width / average_char_width;
	CGL_float initial_x = x;
	CGL_widgets_set_font_texture(CGL_font_get_atlas(font));
	for (CGL_int i = 0; i < string_length; i++)
	{
		CGL_byte c = str[i];
		CGL_widgets_set_texture_coordinate_so(characters[c].normalized_size.x, -characters[c].normalized_size.y, characters[c].normalized_offset.x, characters[c].normalized_offset.y + characters[c].normalized_size.y);
		CGL_widgets_add_rect2f(x + character_scale * characters[c].bearing_normalized.x, y - character_scale * (characters[c].normalized_size.y - characters[c].bearing_normalized.y), characters[c].normalized_size.x * character_scale, characters[c].normalized_size.y * character_scale * scale_y);
		x += characters[c].advance_normalized.x * character_scale;
	}
	CGL_widgets_set_texture(NULL);
	return x - initial_x;
}
#endif

CGL_void CGL_widgets_add_shape_out_line(CGL_shape* shape)
{
	for (CGL_sizei i = 0; i < shape->vertices_count; i++)
	{
		CGL_vec3 p0 = CGL_vec3_apply_transformations(shape->vertices[i], &shape->position, &shape->rotation, &shape->scale);
		CGL_vec3 p1 = CGL_vec3_apply_transformations(shape->vertices[(i + 1) % shape->vertices_count], &shape->position, &shape->rotation, &shape->scale);
		CGL_widgets_add_line(p0, p1);
	}
}

CGL_void CGL_widgets_add_cubic_bazier(CGL_vec3 start, CGL_vec3 end, CGL_vec3 control_1, CGL_vec3 control_2, CGL_int resolution)
{
	CGL_float step_size = 1.0f / (CGL_float)resolution;
	CGL_float t = 0.0f;
	CGL_vec2 p = CGL_vec2_init(0.0f, 0.0f);
	CGL_vec2 p_old = CGL_vec2_init(0.0f, 0.0f);
	for (CGL_int i = 0; i <= resolution; i++)
	{
		p.x = CGL_float_cubic_lerp(start.x, end.x, control_1.x, control_2.x, t);
		p.y = CGL_float_cubic_lerp(start.y, end.y, control_1.y, control_2.y, t);
		if (i > 0) CGL_widgets_add_line2f(p_old.x, p_old.y, p.x, p.y);
		p_old = p;
		t += step_size;
	}
}

CGL_void CGL_widgets_add_cubic_bazier2v(CGL_vec2 start, CGL_vec2 end, CGL_vec2 control_1, CGL_vec2 control_2, CGL_int resolution)
{
	CGL_widgets_add_cubic_bazier(
		CGL_vec3_init(start.x, start.y, 0.0f),
		CGL_vec3_init(end.x, end.y, 0.0f),
		CGL_vec3_init(control_1.x, control_1.y, 0.0f),
		CGL_vec3_init(control_2.x, control_2.y, 0.0f),
		resolution
	);
}

CGL_void CGL_widgets_add_cubic_bazier2f(CGL_float start_x, CGL_float start_y, CGL_float end_x, CGL_float end_y, CGL_float control_1_x, CGL_float control_1_y, CGL_float control_2_x, CGL_float control_2_y, CGL_int resolution)
{
	CGL_widgets_add_cubic_bazier(
		CGL_vec3_init(start_x, start_y, 0.0f),
		CGL_vec3_init(end_x, end_y, 0.0f),
		CGL_vec3_init(control_1_x, control_1_y, 0.0f),
		CGL_vec3_init(control_2_x, control_2_y, 0.0f),
		resolution
	);
}

CGL_void CGL_widgets_add_cubic_bazier_points(CGL_vec3 start, CGL_vec3 end, CGL_vec3 control_1, CGL_vec3 control_2, CGL_int resolution)
{
	CGL_float step_size = 1.0f / (CGL_float)resolution;
	CGL_float t = 0.0f;
	CGL_vec2 p = CGL_vec2_init(0.0f, 0.0f);
	for (CGL_int i = 0; i <= resolution; i++)
	{
		p.x = CGL_float_cubic_lerp(start.x, end.x, control_1.x, control_2.x, t);
		p.y = CGL_float_cubic_lerp(start.y, end.y, control_1.y, control_2.y, t);
		CGL_widgets_add_circle2f(p.x, p.y, 0.02f);
		t += step_size;
	}
}

CGL_void CGL_widgets_add_cubic_bazier_points2v(CGL_vec2 start, CGL_vec2 end, CGL_vec2 control_1, CGL_vec2 control_2, CGL_int resolution)
{
	CGL_widgets_add_cubic_bazier_points(
		CGL_vec3_init(start.x, start.y, 0.0f),
		CGL_vec3_init(end.x, end.y, 0.0f),
		CGL_vec3_init(control_1.x, control_1.y, 0.0f),
		CGL_vec3_init(control_2.x, control_2.y, 0.0f),
		resolution
	);
}

CGL_void CGL_widgets_add_cubic_bazier_points2f(CGL_float start_x, CGL_float start_y, CGL_float end_x, CGL_float end_y, CGL_float control_1_x, CGL_float control_1_y, CGL_float control_2_x, CGL_float control_2_y, CGL_int resolution)
{
	CGL_widgets_add_cubic_bazier_points(
		CGL_vec3_init(start_x, start_y, 0.0f),
		CGL_vec3_init(end_x, end_y, 0.0f),
		CGL_vec3_init(control_1_x, control_1_y, 0.0f),
		CGL_vec3_init(control_2_x, control_2_y, 0.0f),
		resolution
	);
}

CGL_void CGL_widgets_add_plot_function(CGL_float start_x, CGL_float start_y, CGL_float size_x, CGL_float size_y, CGL_float(*func_to_plot)(CGL_float), CGL_int num_samples, CGL_float x_min, CGL_float x_max, CGL_float y_min, CGL_float y_max, CGL_float plot_thickness, CGL_vec3 plot_color, CGL_bool draw_axes, CGL_float axes_thickness, CGL_vec3 axes_color)
{
	CGL_float step_size = (x_max - x_min) / (CGL_float)num_samples;
	CGL_float step_size_plot = size_x / (CGL_float)num_samples;

	CGL_vec2 prev_point = CGL_vec2_init(0.0f, 0.0f);
	CGL_vec2 curr_point = CGL_vec2_init(0.0f, 0.0f);

	prev_point.x = x_min;
	prev_point.y = func_to_plot(x_min);

	CGL_widgets_set_stroke_colorf(plot_color.x, plot_color.y, plot_color.z, 1.0f);
	CGL_widgets_set_stroke_thicnkess(plot_thickness);
	for (CGL_int i = 1; i < num_samples; i++)
	{
		curr_point.x = x_min + (step_size * (CGL_float)i);
		curr_point.y = CGL_utils_clamp(func_to_plot(curr_point.x), y_min, y_max);

		CGL_widgets_add_line2f(
			start_x + (step_size_plot * (CGL_float)i),
			start_y + (size_y * (prev_point.y - y_min) / (y_max - y_min)),
			start_x + (step_size_plot * (CGL_float)(i + 1)),
			start_y + (size_y * (curr_point.y - y_min) / (y_max - y_min))
		);

		prev_point = curr_point;
	}


	if (draw_axes)
	{
		CGL_widgets_set_stroke_colorf(axes_color.x, axes_color.y, axes_color.z, 1.0f);
		CGL_widgets_set_stroke_thicnkess(axes_thickness);
		if (y_min < 0.0f && y_max > 0.0f)
		{
			CGL_widgets_add_line2f(
				start_x,
				start_y + (size_y * fabsf(y_min) / (y_max - y_min)),
				start_x + size_x,
				start_y + (size_y * fabsf(y_min) / (y_max - y_min))
			);
		}
		if (x_min < 0.0f && x_max > 0.0f)
		{
			CGL_widgets_add_line2f(
				start_x + (size_x * fabsf(x_min) / (x_max - x_min)),
				start_y,
				start_x + (size_x * fabsf(x_min) / (x_max - x_min)),
				start_y + size_y
			);
		}
	}
}

CGL_void CGL_widgets_add_plot_array(CGL_float start_x, CGL_float start_y, CGL_float size_x, CGL_float size_y, CGL_vec2* values, CGL_sizei count, CGL_float marker_size, CGL_vec3 marker_color, CGL_bool draw_axes, CGL_float axes_thickness, CGL_vec3 axes_color)
{
	CGL_vec2 x_min_max = CGL_vec2_init(values[0].x, values[0].x);
	CGL_vec2 y_min_max = CGL_vec2_init(values[0].y, values[0].y);
	for (CGL_sizei i = 1; i < count; i++)
	{
		x_min_max.x = CGL_utils_min(x_min_max.x, values[i].x);
		x_min_max.y = CGL_utils_max(x_min_max.y, values[i].x);
		y_min_max.x = CGL_utils_min(y_min_max.x, values[i].y);
		y_min_max.y = CGL_utils_max(y_min_max.y, values[i].y);
	}

	CGL_widgets_set_fill_colorf(marker_color.x, marker_color.y, marker_color.z, 1.0f);
	for (CGL_sizei i = 0; i < count; i++)
	{
		CGL_widgets_add_rect2f(
			start_x + (size_x * (values[i].x - x_min_max.x) / (x_min_max.y - x_min_max.x)),
			start_y + (size_y * (values[i].y - y_min_max.x) / (y_min_max.y - y_min_max.x)),
			marker_size, marker_size
		);
	}

	if (draw_axes)
	{
		CGL_widgets_set_stroke_colorf(axes_color.x, axes_color.y, axes_color.z, 1.0f);
		CGL_widgets_set_stroke_thicnkess(axes_thickness);
		if (y_min_max.x < 0.0f && y_min_max.y > 0.0f)
		{
			CGL_widgets_add_line2f(
				start_x,
				start_y + (size_y * fabsf(y_min_max.x) / (y_min_max.y - y_min_max.x)),
				start_x + size_x,
				start_y + (size_y * fabsf(y_min_max.x) / (y_min_max.y - y_min_max.x))
			);
		}
		if (x_min_max.x < 0.0f && x_min_max.y > 0.0f)
		{
			CGL_widgets_add_line2f(
				start_x + (size_x * fabsf(x_min_max.x) / (x_min_max.y - x_min_max.x)),
				start_y,
				start_x + (size_x * fabsf(x_min_max.x) / (x_min_max.y - x_min_max.x)),
				start_y + size_y
			);
		}
	}

}

CGL_void CGL_widgets_add_plot_pie_chart(CGL_float start_x, CGL_float start_y, CGL_float radius, CGL_float* values, CGL_vec3* colors, CGL_sizei count, CGL_int resolution)
{
	CGL_float total = 0.0f;
	for (CGL_sizei i = 0; i < count; i++)
	{
		total += values[i];
	}

	CGL_float curr_angle = 0.0f;
	for (CGL_sizei i = 0; i < count; i++)
	{
		CGL_widgets_set_fill_colorf(colors[i].x, colors[i].y, colors[i].z, 1.0f);
		CGL_widgets_add_arc2f(
			start_x, start_y, radius, curr_angle, curr_angle + (values[i] / total) * CGL_2PI, (CGL_int)(resolution * (values[i] / total) + 1.0f)
		);
		curr_angle += (values[i] / total) * CGL_2PI;
	}
}

CGL_void CGL_widgets_add_bar_graph(CGL_float start_x, CGL_float start_y, CGL_float size_x, CGL_float size_y, CGL_float* values, CGL_vec3* colors, CGL_sizei count, CGL_bool draw_axes, CGL_float axes_thickness, CGL_vec3 axes_color, CGL_bool vertical)
{
	CGL_float max_value = values[0];
	for (CGL_sizei i = 1; i < count; i++) max_value = CGL_utils_max(max_value, values[i]);

	CGL_float bar_width = ((vertical ? size_x : size_y) / (CGL_float)(count + 2)) * 0.8f;
	CGL_float bar_spacing = ((vertical ? size_x : size_y) / (CGL_float)(count + 2)) * 0.2f;

	CGL_float curr_x = start_x + bar_spacing;
	CGL_float curr_y = start_y + bar_spacing;

	for (CGL_sizei i = 0; i < count; i++)
	{
		CGL_widgets_set_fill_colorf(colors[i].x, colors[i].y, colors[i].z, 1.0f);
		if (vertical)
		{
			CGL_widgets_add_rect2f(curr_x, start_y + bar_spacing, bar_width, (size_y - bar_spacing * 2.0f) * (values[i] / max_value));
			curr_x += bar_width + bar_spacing;
		}
		else
		{
			CGL_widgets_add_rect2f(start_x + bar_spacing, curr_y, (size_x - bar_spacing * 2.0f) * (values[i] / max_value), bar_width);
			curr_y += bar_width + bar_spacing;
		}
	}

	if (draw_axes)
	{
		CGL_widgets_set_stroke_colorf(axes_color.x, axes_color.y, axes_color.z, 1.0f);
		CGL_widgets_set_stroke_thicnkess(axes_thickness);
		CGL_widgets_add_line2f(start_x + bar_spacing, start_y, start_x + bar_spacing, start_y + size_y);
		CGL_widgets_add_line2f(start_x, start_y + bar_spacing, start_x + size_x, start_y + bar_spacing);
	}
}

#endif
#endif

#ifndef CGL_EXCLUDE_NODE_EDITOR

struct CGL_node_editor
{
	CGL_node_editor_input* input;
	CGL_node_editor_pin* start_pin;
	CGL_node_editor_pin* end_pin;
	void(*ondrop)(float, float, CGL_node_editor_pin*);
	void(*onconnect)(CGL_node_editor_pin*, CGL_node_editor_pin*);
	CGL_float mouse_pos_x;
	CGL_float mouse_pos_y;
	CGL_float mouse_delta_x;
	CGL_float mouse_delta_y;
	CGL_float offset_x;
	CGL_float offset_y;
	CGL_float aspect_ratio;
	CGL_float scale;
	CGL_int num_selected;
	bool has_lifted;
};

CGL_node_editor* CGL_node_editor_create()
{
	CGL_node_editor* editor = (CGL_node_editor*)CGL_malloc(sizeof(CGL_node_editor));
	if (!editor) return NULL;
	editor->mouse_pos_x = 0.0f;
	editor->mouse_pos_y = 0.0f;
	editor->mouse_delta_x = 0.0f;
	editor->mouse_delta_y = 0.0f;
	editor->offset_x = 0.0f;
	editor->offset_y = 0.0f;
	editor->input = NULL;
	editor->aspect_ratio = 1.0f;
	editor->scale = 1.0f;
	editor->start_pin = editor->end_pin = NULL;
	editor->ondrop = NULL;
	editor->onconnect = NULL;
	editor->has_lifted = true;
	return editor;
}

CGL_void CGL_node_editor_destroy(CGL_node_editor* editor)
{
	CGL_free(editor);
}

CGL_void CGL_node_editor_set_on_connect(CGL_node_editor* editor, void(*onconnect)(CGL_node_editor_pin*, CGL_node_editor_pin*))
{
	editor->onconnect = onconnect;
}

CGL_void CGL_node_editor_set_on_drop(CGL_node_editor* editor, void(*ondrop)(float, float, CGL_node_editor_pin*))
{
	editor->ondrop = ondrop;
}

CGL_void CGL_node_editor_update(CGL_node_editor* editor, CGL_node_editor_input* input)
{
	editor->input = input;
	editor->mouse_delta_x = CGL_utils_clamp(input->mouse_pos_x - editor->mouse_pos_x, -0.2f, 0.2f);
	editor->mouse_delta_y = CGL_utils_clamp(input->mouse_pos_y - editor->mouse_pos_y, -0.2f, 0.2f);
	editor->mouse_pos_x = input->mouse_pos_x;
	editor->mouse_pos_y = input->mouse_pos_y;
	editor->aspect_ratio = input->aspect_ratio;
	editor->scale = CGL_utils_max(input->scale, 0.01f);
	if (editor->start_pin && editor->end_pin) { if (editor->onconnect) editor->onconnect(editor->start_pin, editor->end_pin); editor->start_pin = editor->end_pin = NULL; editor->has_lifted = false; }
	if (editor->start_pin && !input->mouse_button_left) { if (editor->ondrop) editor->ondrop(editor->mouse_pos_x / editor->scale, editor->mouse_pos_y / editor->scale, editor->start_pin); editor->start_pin = NULL; }
	if (!input->mouse_button_left) editor->has_lifted = true;
	if (input->mouse_button_middle)
	{
		editor->offset_x += editor->mouse_delta_x * editor->scale;
		editor->offset_y += editor->mouse_delta_y * editor->scale;
	}
	editor->num_selected = 0;
}

CGL_void CGL_node_editor_render_begin(CGL_node_editor* editor)
{
	CGL_widgets_begin_int(editor->scale, editor->scale, 0.0f, 0.0f);
	CGL_widgets_set_stroke_thicnkess(0.03f);
}

CGL_void CGL_node_editor_clear_focused_pins(CGL_node_editor* editor)
{
	editor->start_pin = editor->end_pin = NULL;
}

CGL_void CGL_node_editor_render_end(CGL_node_editor* editor)
{
	if (editor->start_pin && !editor->end_pin)
	{
		CGL_widgets_set_stroke_colorf(1.0f, 1.0f, 0.0f, 1.0f);
		CGL_widgets_add_line(
			CGL_vec3_init(editor->offset_x + editor->start_pin->pos_x, editor->offset_y + editor->start_pin->pos_y, 0.0f),
			CGL_vec3_init(editor->mouse_pos_x / editor->scale, editor->mouse_pos_y / editor->scale, 0.0f)
		);
	}
	CGL_widgets_end();
}

CGL_void CGL_node_editor_set_offset(CGL_node_editor* editor, CGL_float x, CGL_float y)
{
	editor->offset_x = x;
	editor->offset_y = y;
}

CGL_void CGL_node_editor_get_offset(CGL_node_editor* editor, CGL_float* x, CGL_float* y)
{
	if (x) *x = editor->offset_x;
	if (y) *y = editor->offset_y;
}

CGL_void CGL_node_editor_get_linked_pins(CGL_node_editor* editor, CGL_node_editor_pin** x, CGL_node_editor_pin** y)
{
	if (x) *x = editor->start_pin;
	if (y) *y = editor->end_pin;
}

CGL_void CGL_node_editor_render_link(CGL_node_editor_pin* left, CGL_node_editor_pin* right, CGL_color color, CGL_float midper)
{
	if (!left || !right) return;
	CGL_widgets_set_stroke_color(color);

	CGL_float mx = CGL_utils_mix(left->pos_x, right->pos_x, midper);

	CGL_float ofx = right->parent->editor->offset_x;
	CGL_float ofy = right->parent->editor->offset_y;

	CGL_widgets_add_line(
		CGL_vec3_init(ofx + left->pos_x, ofy + left->pos_y, 0.0f),
		CGL_vec3_init(ofx + mx, ofy + left->pos_y, 0.0f)
	);

	CGL_widgets_add_line(
		CGL_vec3_init(ofx + mx, ofy + left->pos_y, 0.0f),
		CGL_vec3_init(ofx + mx, ofy + right->pos_y, 0.0f)
	);

	CGL_widgets_add_line(
		CGL_vec3_init(ofx + mx, ofy + right->pos_y, 0.0f),
		CGL_vec3_init(ofx + right->pos_x, ofy + right->pos_y, 0.0f)
	);
}

CGL_void CGL_node_editor_render_linkf(CGL_node_editor_pin* left, CGL_node_editor_pin* right, CGL_float cr, CGL_float cg, CGL_float cb, CGL_float ca, CGL_float midper)
{
	CGL_node_editor_render_link(left, right, CGL_vec4_init(cr, cg, cb, ca), midper);
}

CGL_void CGL_node_editor_render_link_curved(CGL_node_editor_pin* left, CGL_node_editor_pin* right, CGL_color color, CGL_float x_dist, CGL_float y_dist, CGL_int resolution)
{
	if (!left || !right) return;


	CGL_float y_length = fabsf(right->pos_y - left->pos_y);

	CGL_float ofx = right->parent->editor->offset_x;
	CGL_float ofy = right->parent->editor->offset_y;

	CGL_float mx0 = CGL_utils_mix(left->pos_x, right->pos_x, x_dist);
	CGL_float my0 = CGL_utils_clamp(y_length * y_dist, 0.0f, 0.1f);

	CGL_float mx1 = CGL_utils_mix(left->pos_x, right->pos_x, (1.0f - x_dist));
	CGL_float my1 = CGL_utils_clamp(y_length * (1.0f - y_dist), 0.0f, 0.1f);



	CGL_vec2 end = CGL_vec2_init(ofx + right->pos_x, ofy + right->pos_y);
	CGL_vec2 start = CGL_vec2_init(ofx + left->pos_x, ofy + left->pos_y);
	CGL_vec2 control0 = CGL_vec2_init(ofx + mx0, ofy + left->pos_y + my0);
	CGL_vec2 control1 = CGL_vec2_init(ofx + mx1, ofy + right->pos_y - my1);

	CGL_widgets_set_stroke_color(color);
	CGL_widgets_add_cubic_bazier2v(start, end, control0, control1, resolution);
}

CGL_void CGL_node_editor_render_link_curvedf(CGL_node_editor_pin* left, CGL_node_editor_pin* right, CGL_float cr, CGL_float cg, CGL_float cb, CGL_float ca, CGL_float x_dist, CGL_float y_dist, CGL_int resolution)
{
	CGL_node_editor_render_link_curved(left, right, CGL_vec4_init(cr, cg, cb, ca), x_dist, y_dist, resolution);
}

CGL_void CGL_node_editor_node_init(CGL_node_editor* editor, CGL_node_editor_node* node)
{
	node->editor = editor;
	node->color = CGL_utils_random_color();
	strcpy(node->title, "Node");
	node->render_title = true;
	node->pins_count[0] = node->pins_count[1] = 0;
	node->pos_y = node->pos_x = 0.0f;
	node->size_y = node->size_x = 0.3f;
	node->selected = false;
	memset(node->left_pins, 0, sizeof(CGL_node_editor_pin) * CGL_NODE_EDITOR_NODE_MAX_PINS);
	memset(node->right_pins, 0, sizeof(CGL_node_editor_pin) * CGL_NODE_EDITOR_NODE_MAX_PINS);
}

static bool __CGL_node_editor_pin_update(CGL_node_editor_pin* pin)
{
	CGL_node_editor_node* node = pin->parent;
	CGL_node_editor* editor = node->editor;
	CGL_float sx = 0.05f / pin->parent->editor->input->aspect_ratio;
	CGL_float sy = 0.05f;

	bool focused = false;
	CGL_float ofx = node->editor->offset_x;
	CGL_float ofy = node->editor->offset_y;

	if (editor->input->mouse_button_left
		&& CGL_utils_is_point_in_rect(
			editor->input->mouse_pos_x, editor->input->mouse_pos_y,
			ofx + pin->pos_x, ofy + pin->pos_y,
			sx, sy,
			editor->scale, editor->scale
		)) focused = true;

	if (focused && editor->has_lifted)
	{
		if (editor->start_pin && pin != editor->start_pin) editor->end_pin = pin;
		else if (editor->start_pin == NULL) { editor->start_pin = pin; editor->end_pin = NULL; }
	}

	return focused;
}

CGL_void CGL_node_editor_node_update(CGL_node_editor_node* node)
{
	const CGL_node_editor* editor = node->editor;
	node->pins_count[0] = node->pins_count[1] = 0;
	for (CGL_int i = 0; i < CGL_NODE_EDITOR_NODE_MAX_PINS; i++)
	{
		if (node->left_pins[i].is_set) node->pins_count[0]++;
		if (node->right_pins[i].is_set) node->pins_count[1]++;
	}
	CGL_float ofx = node->editor->offset_x;
	CGL_float ofy = node->editor->offset_y;
	CGL_float sx = node->size_x;
	CGL_float sy = node->size_y = (0.1f + (float)CGL_utils_max(node->pins_count[0], node->pins_count[1]) * (0.05f + 0.1f));
	if (node->render_title) sy += 0.1f;
	bool require_movement = false;
	if (editor->input->mouse_button_left && !editor->input->shift) node->selected = false;
	require_movement = node->selected && editor->input->ctrl;
	if (editor->input->mouse_button_left && !editor->start_pin
		&& CGL_utils_is_point_in_rect(
			editor->input->mouse_pos_x, editor->input->mouse_pos_y,
			ofx + node->pos_x, ofy + node->pos_y,
			sx, sy,
			editor->scale, editor->scale
		))  require_movement = node->selected = true;
	if (node->selected) node->editor->num_selected++;

	// TODO: try to do it in the loop above
	for (CGL_int i = 0; i < CGL_NODE_EDITOR_NODE_MAX_PINS; i++)
	{
		if (node->left_pins[i].is_set)
			require_movement &= !__CGL_node_editor_pin_update(&node->left_pins[i]);
		if (node->right_pins[i].is_set)
			require_movement &= !__CGL_node_editor_pin_update(&node->right_pins[i]);
	}

	if (require_movement)
	{
		node->pos_x += editor->mouse_delta_x;
		node->pos_y += editor->mouse_delta_y;
	}
}

CGL_void CGL_node_editor_node_render(CGL_node_editor_node* node)
{
	const CGL_node_editor* editor = node->editor;
	CGL_float sx = node->size_x;
	CGL_float sy = node->size_y;
	if (node->render_title) sy += 0.1f;
	//if(sx > sy) sy = sx * node->editor->input->aspect_ratio;
	//else sx = sy / node->editor->input->aspect_ratio;    
	CGL_float ofx = editor->offset_x;
	CGL_float ofy = editor->offset_y;
	// render selection
	if (node->selected)
	{
		CGL_widgets_set_fill_colorf(0.8f, 0.8f, 0.1f, 1.0f);
		CGL_widgets_add_rect2f(ofx + node->pos_x - 0.01f, ofy + node->pos_y - 0.01f, sx + 0.02f, sy + 0.02f);
	}
	// render body
	CGL_widgets_set_fill_color(node->color);
	CGL_widgets_add_rect2f(ofx + node->pos_x, ofy + node->pos_y, sx, sy);
	//render title
	if (node->render_title)
	{
		CGL_widgets_set_fill_colorf(node->color.x * 0.7f, node->color.y * 0.7f, node->color.z * 0.7f, 1.0f);
		CGL_widgets_add_rect2f(ofx + node->pos_x, ofy + node->pos_y + sy - 0.1f - 0.01f, sx, 0.1f);
		CGL_widgets_set_fill_colorf(0.0f, 0.0f, 0.0f, 1.0f);
		CGL_widgets_add_string(node->title, ofx + node->pos_x + 0.01f, ofy + node->pos_y + sy - 0.1f - 0.01f, sx - 0.02f, (0.1f - 0.02f));
	}
	// render pins

	// left pins
	CGL_float ty1 = ofy + node->pos_y + 0.1f;
	CGL_float ty2 = ofy + node->pos_y + 0.1f;
	for (CGL_int i = CGL_NODE_EDITOR_NODE_MAX_PINS - 1; i >= 0; i--)
	{
		if (node->left_pins[i].is_set)
		{
			CGL_widgets_set_fill_color(node->left_pins[i].color);
			CGL_widgets_add_rect2f(ofx + node->pos_x - 0.02f, ty1, 0.05f / node->editor->input->aspect_ratio, 0.05f);
			node->left_pins[i].pos_x = node->pos_x - 0.02f;
			node->left_pins[i].pos_y = ty1 - ofy;
			ty1 += 0.1f + 0.05f;
		}

		if (node->right_pins[i].is_set)
		{
			CGL_widgets_set_fill_color(node->right_pins[i].color);
			CGL_widgets_add_rect2f(ofx + node->pos_x + sx - 0.05f / node->editor->input->aspect_ratio + 0.02f, ty2, 0.05f / node->editor->input->aspect_ratio, 0.05f);
			node->right_pins[i].pos_x = node->pos_x + sx - 0.05f / node->editor->input->aspect_ratio + 0.02f;
			node->right_pins[i].pos_y = ty2 - ofy;
			ty2 += 0.1f + 0.05f;
		}
	}

}

CGL_void CGL_node_editor_node_set_position(CGL_node_editor_node* node, CGL_float x, CGL_float y)
{
	node->pos_x = x;
	node->pos_y = y;
}

CGL_void CGL_node_editor_node_set_title(CGL_node_editor_node* node, const char* title)
{
	if (title == NULL) { node->render_title = false; return; }
	node->render_title = true;
	strcpy(node->title, title);
}

CGL_node_editor_pin* CGL_node_editor_node_get_pin(CGL_node_editor_node* node, bool left, CGL_int index)
{
	CGL_node_editor_pin* pin = NULL;
	if (left) pin = &node->left_pins[index];
	else pin = &node->right_pins[index];
	pin->index = index;
	pin->left = left;
	pin->parent = node;
	pin->color = CGL_vec4_init(0.0f, 0.0f, 0.0f, 1.0f);
	return pin;
}

#endif


#ifndef CGL_EXCLUDE_RAY_CASTER

struct CGL_ray_caster
{
	CGL_shape_triangle triangles[CGL_RAY_CASTER_MAX_TRIANGLES];
	CGL_vec4 walls[CGL_RAY_CASTER_MAX_WALLS];
	CGL_int wall_count;
	CGL_int triangle_count;
	CGL_float theta_min;
	CGL_float theta_max;
	CGL_float max_dist;
#ifndef CGL_EXCLUDE_GRAPHICS_API
	CGL_mesh_gpu* mesh;
#endif
};

CGL_ray_caster* CGL_ray_caster_create()
{
	CGL_ray_caster* caster = (CGL_ray_caster*)CGL_malloc(sizeof(CGL_ray_caster));
	if (!caster) return NULL;
	caster->theta_max = 3.141f;
	caster->theta_min = 0.0f;
	caster->max_dist = 1.0f;
	caster->triangle_count = 0;
	caster->wall_count = 0;
#ifndef CGL_EXCLUDE_GRAPHICS_API
	caster->mesh = CGL_mesh_gpu_create();
#endif
	return caster;
}

CGL_void CGL_ray_caster_destroy(CGL_ray_caster* caster)
{
#ifndef CGL_EXCLUDE_GRAPHICS_API
	if (caster->mesh) CGL_mesh_gpu_destroy(caster->mesh);
#endif
	CGL_free(caster);
}

CGL_void CGL_ray_caster_add_walls(CGL_ray_caster* caster, CGL_vec4* walls, CGL_int walls_count)
{
	if ((caster->wall_count + walls_count) >= CGL_RAY_CASTER_MAX_WALLS) CGL_warn("Max Ray Caster walls exceeded");
	walls_count = CGL_utils_min(walls_count, CGL_RAY_CASTER_MAX_WALLS - caster->wall_count - 1);
	memcpy(caster->walls + caster->wall_count, walls, sizeof(CGL_vec4) * walls_count);
	caster->wall_count += walls_count;
}

CGL_void CGL_ray_caster_add_wall(CGL_ray_caster* caster, CGL_vec4 wall)
{
	CGL_ray_caster_add_walls(caster, &wall, 1);
}

CGL_void CGL_ray_caster_clear_walls(CGL_ray_caster* caster)
{
	caster->wall_count = 0;
}

// algorithm from http://www.gamers.org/dEngine/rsc/usenet/comp.graphics.algorithms.faq
float CGL_ray_caster_get_intersection_point_for_wall(CGL_vec2 pos, CGL_vec2 dir, CGL_vec4 wall, CGL_vec2* intersection_point, float* angle, CGL_float max_dist)
{
	const CGL_float infinity = max_dist;
	CGL_vec2 A = pos;
	CGL_vec2 B = CGL_vec2_init(pos.x + infinity * dir.x, pos.y + infinity * dir.y);
	CGL_vec2 C = CGL_vec2_init(wall.x, wall.y);
	CGL_vec2 D = CGL_vec2_init(wall.z, wall.w);
	CGL_float n = 0.0f, d = 0.0f;
	// calculate r
	n = (A.y - C.y) * (D.x - C.x) - (A.x - C.x) * (D.y - C.y);
	d = (B.x - A.x) * (D.y - C.y) - (B.y - A.y) * (D.x - C.x);
	if (d == 0.0f) return -1.0f; // they are parallel
	CGL_float r = n / d;
	// calculate s
	n = (A.y - C.y) * (B.x - A.x) - (A.x - C.x) * (B.y - A.y);
	d = (B.x - A.x) * (D.y - C.y) - (B.y - A.y) * (D.x - C.x);
	if (d == 0.0f) return -1.0f; // they are parallel
	CGL_float s = n / d;
	// check if they intersect
	if (r < 0.0f || r > 1.0f || s < 0.0f || s > 1.0f) return -1.0f;
	// calculate intersection point
	if (intersection_point)
	{
		intersection_point->x = A.x + r * (B.x - A.x);
		intersection_point->y = A.y + r * (B.y - A.y);
	}
	if (angle) *angle = atan2f(dir.y, dir.x);
	return r * infinity;
}

float CGL_ray_caster_get_intersection_point_for_walls(CGL_vec2 pos, CGL_vec2 dir, CGL_vec4* walls, CGL_int wall_count, CGL_vec2* intersection_point, float* angle, CGL_float max_dist)
{
	CGL_float t = max_dist;
	CGL_float tmp = 0.0f;
	for (CGL_int i = 0; i < wall_count; i++)
	{
		tmp = CGL_ray_caster_get_intersection_point_for_wall(pos, dir, walls[i], NULL, NULL, max_dist);
		if (tmp > 0.0001f) t = CGL_utils_min(t, tmp);
	}
	CGL_float a = pos.x;
	CGL_float b = pos.y;
	CGL_float d = dir.x;
	CGL_float e = dir.y;
	if (intersection_point) *intersection_point = CGL_vec2_init(a + t * d, b + t * e);
	if (angle) *angle = atan2f(dir.y, dir.x);
	return t;
}

struct __CGL_ray_caster_ray
{
	CGL_vec2 target;
	CGL_vec2 dir;
	CGL_float angle;
	CGL_float dist;
};
typedef struct __CGL_ray_caster_ray __CGL_ray_caster_ray;

static void __CGL_ray_caster_calc_ray(CGL_ray_caster* caster, CGL_vec2* pos, CGL_float theta, __CGL_ray_caster_ray* ray)
{
	ray->dir = CGL_vec2_init(cosf(theta), sinf(theta));
	CGL_float t = CGL_ray_caster_get_intersection_point_for_walls(*pos, ray->dir, caster->walls, caster->wall_count, &ray->target, &ray->angle, caster->max_dist);
	ray->dist = t;
}

static CGL_int __CGL_ray_caster_ray_compare(const void* a, const void* b) {
	CGL_float c = ((__CGL_ray_caster_ray*)a)->angle;
	CGL_float d = ((__CGL_ray_caster_ray*)b)->angle;
	if (c > d) return -1;
	if (c < d) return 1;
	return 0;
}

float __CGL_ray_caster_calculate_angle_in_range(CGL_float ang)
{
	CGL_int n = (int)(fabsf(ang) / 3.141f);
	CGL_float th = fmodf(fabsf(ang), 3.141f);
	if (ang > 3.141f) ang = th - ((n % 2 == 0) ? 0.0f : 3.141f);
	else if (ang < -3.141f) ang = ((n % 2 == 0) ? 0.0f : 3.141f) - th;
	return ang;
}

CGL_void CGL_ray_caster_calculate(CGL_ray_caster* caster, CGL_vec2 pos, CGL_float rotation, bool visualise_rays)
{
	static __CGL_ray_caster_ray rays[CGL_RAY_CASTER_MAX_WALLS * 2];
	CGL_int ray_count = 0;

	CGL_float angmn = __CGL_ray_caster_calculate_angle_in_range(caster->theta_min + rotation);
	CGL_float angmx = __CGL_ray_caster_calculate_angle_in_range(caster->theta_max + rotation);
	CGL_vec2 min_border = CGL_vec2_init(cosf(angmn), sinf(angmn));
	CGL_vec2 max_border = CGL_vec2_init(cosf(angmx), sinf(angmx));
	CGL_vec2 dir = CGL_vec2_add(min_border, max_border);
	CGL_vec2_normalize(dir);


	//__CGL_ray_caster_calc_ray(caster, &pos, caster->theta_min + rotation, &rays[ray_count++]);
	//__CGL_ray_caster_calc_ray(caster, &pos, caster->theta_max + rotation, &rays[ray_count++]);
	for (CGL_float st = -3.141f; st < 3.141f; st += 0.5f)
		__CGL_ray_caster_calc_ray(caster, &pos, st, &rays[ray_count++]);
	const CGL_float epsilon = 0.0001f;
	for (CGL_int i = 0; i < caster->wall_count; i++)
	{
		CGL_vec4 wall = caster->walls[i];
		CGL_float theta = 0.0f;

		// calculate theta for wall start
		theta = atan2f(wall.y - pos.y, wall.x - pos.x);
		__CGL_ray_caster_calc_ray(caster, &pos, theta, &rays[ray_count++]);
		// calculate theta for wall start +- 0.0001f theta
		__CGL_ray_caster_calc_ray(caster, &pos, theta + epsilon, &rays[ray_count++]);
		__CGL_ray_caster_calc_ray(caster, &pos, theta - epsilon, &rays[ray_count++]);

		// calculate theta for wall end
		theta = atan2f(wall.w - pos.y, wall.z - pos.x);
		__CGL_ray_caster_calc_ray(caster, &pos, theta, &rays[ray_count++]);
		// calculate theta for wall end +- 0.0001f theta
		__CGL_ray_caster_calc_ray(caster, &pos, theta + epsilon, &rays[ray_count++]);
		__CGL_ray_caster_calc_ray(caster, &pos, theta - epsilon, &rays[ray_count++]);
	}

	// sort rays by angle using quicksort
	qsort(rays, ray_count, sizeof(__CGL_ray_caster_ray), __CGL_ray_caster_ray_compare);

	// create tiangle fans
	caster->triangle_count = 0;
	for (CGL_int i = 0; i < ray_count; i++)
	{
		//CGL_widgets_set_fill_color(CGL_utils_random_color());
		caster->triangles[caster->triangle_count].a = CGL_vec3_init(pos.x, pos.y, 0.0f);
		caster->triangles[caster->triangle_count].b = CGL_vec3_init(rays[(i + 1) % ray_count].target.x, rays[(i + 1) % ray_count].target.y, 0.0f);
		caster->triangles[caster->triangle_count].c = CGL_vec3_init(rays[i].target.x, rays[i].target.y, 0.0f);
#ifndef CGL_EXCLUDE_WIDGETS
		if (visualise_rays) CGL_widgets_add_triangle(caster->triangles[caster->triangle_count].a, caster->triangles[caster->triangle_count].b, caster->triangles[caster->triangle_count].c);
#endif
		caster->triangle_count++;
	}
	/*
	if(ray_count > 1)
	{
		caster->triangles[caster->triangle_count].a = CGL_vec3_init(pos.x, pos.y, 0.0f);
		caster->triangles[caster->triangle_count].b = CGL_vec3_init(rays[0].target.x, rays[0].target.y, 0.0f);
		caster->triangles[caster->triangle_count].c = CGL_vec3_init(rays[ray_count - 1].target.x, rays[ray_count - 1].target.y, 0.0f);
#ifndef CGL_EXCLUDE_WIDGETS
		if(visualise_rays) CGL_widgets_add_triangle(caster->triangles[caster->triangle_count].a, caster->triangles[caster->triangle_count].b, caster->triangles[caster->triangle_count].c);
#endif
		caster->triangle_count++;
	}
	*/


#ifndef CGL_EXCLUDE_WIDGETS
	// visualize rays
	if (visualise_rays)
	{
		CGL_widgets_set_stroke_colorf(0.2f, 0.3f, 0.7f, 1.0f);
		CGL_widgets_set_stroke_thicnkess(0.01f);
		for (CGL_int i = 0; i < ray_count; i++)
		{
			//if( ((rays[i].angle) >= (angmn - 0.1f) && (rays[i].angle) <= (angmx + 0.1f)) || ( (angmn >= 3.141f / 2 && angmx <= -3.141f/2) && (rays[i].angle >= (angmx - 0.1f) || (rays[i].angle) <= (angmn + 0.1f)) ) )
			// if( CGL_vec2_dot(dir, rays[i].dir) >= cdelta_half - 0.01f) // for future
			CGL_widgets_add_line(
				CGL_vec3_init(pos.x, pos.y, 0.0f),
				CGL_vec3_init(rays[i].target.x, rays[i].target.y, 0.0f)
			);
		}
	}
#endif
}

bool CGL_ray_caster_is_in_view(CGL_ray_caster* caster, CGL_vec2 point)
{
	for (CGL_int i = 0; i < caster->triangle_count; i++)
		if (CGL_utils_is_point_in_triangle(point, CGL_vec2_init(caster->triangles[i].a.x, caster->triangles[i].a.y), CGL_vec2_init(caster->triangles[i].b.x, caster->triangles[i].b.y), CGL_vec2_init(caster->triangles[i].c.x, caster->triangles[i].c.y))) return true;
	return false;
}

CGL_void CGL_ray_caster_set_angle_limits(CGL_ray_caster* caster, CGL_float min_angle, CGL_float max_angle)
{
	caster->theta_min = min_angle;
	caster->theta_max = max_angle;
}

CGL_void CGL_ray_caster_set_max_distance(CGL_ray_caster* caster, CGL_float val)
{
	caster->max_dist = val;
}

CGL_shape_triangle* CGL_ray_caster_get_triangles(CGL_ray_caster* caster, CGL_int* count)
{
	if (count) *count = caster->triangle_count;
	return caster->triangles;
}


#endif

#ifndef CGL_EXCLUDE_SQUARE_MARCHER

struct CGL_square_marcher
{
	void* user_data;
	bool interpolate;
};

CGL_square_marcher* CGL_square_marcher_create()
{
	CGL_square_marcher* marcher = (CGL_square_marcher*)CGL_malloc(sizeof(CGL_square_marcher));
	if (!marcher) return NULL;
	marcher->user_data = NULL;
	marcher->interpolate = false;
	return marcher;
}

CGL_void CGL_square_marcher_destroy(CGL_square_marcher* marcher)
{
	CGL_free(marcher);
}

CGL_void CGL_square_marcher_set_user_data(CGL_square_marcher* marcher, void* user_data)
{
	marcher->user_data = user_data;
}

CGL_void* CGL_square_marcher_get_user_data(CGL_square_marcher* marcher)
{
	return marcher->user_data;
}

CGL_void CGL_square_marcher_enable_interpolation(CGL_square_marcher* marcher, bool enable)
{
	marcher->interpolate = enable;
}


CGL_void __CGL_square_marcher_generate_mesh_add_triangle(CGL_list* list, CGL_vec2 a, CGL_vec2 b, CGL_vec2 c)
{
	CGL_mesh_vertex v = { 0 };
	v.normal = CGL_vec4_init(0.0f, 0.0f, 1.0f, 1.0f);
	v.position = CGL_vec4_init(a.x, a.y, 0.0f, 0.0f);
	CGL_list_push(list, &v);
	v.position = CGL_vec4_init(b.x, b.y, 0.0f, 0.0f);
	CGL_list_push(list, &v);
	v.position = CGL_vec4_init(c.x, c.y, 0.0f, 0.0f);
	CGL_list_push(list, &v);
}


CGL_mesh_cpu* CGL_square_marcher_generate_mesh(CGL_square_marcher* marcher, CGL_square_marcher_distance_function sampler, CGL_vec2 start, CGL_vec2 end, CGL_int resolution_x, CGL_int resolution_y)
{
	CGL_vec2 step_size = CGL_vec2_init((end.x - start.x) / (float)resolution_x, (end.y - start.y) / (float)resolution_y);
	CGL_vec2 pos[4] = { 0 }, mpts[4] = { 0 };
	CGL_bool smpb[4];
	CGL_float smpv[4] = { 0 }, intr[4] = { 0 };
	CGL_list* mesh_list = CGL_list_create(sizeof(CGL_mesh_vertex), 1000);

	for (CGL_int xi = -1; xi < resolution_x; xi++)
	{
		for (CGL_int yi = -1; yi < resolution_y; yi++)
		{
			pos[0] = CGL_vec2_init(start.x + xi * step_size.x, start.y + (yi + 1) * step_size.y);
			pos[1] = CGL_vec2_init(start.x + (xi + 1) * step_size.x, start.y + (yi + 1) * step_size.y);
			pos[2] = CGL_vec2_init(start.x + (xi + 1) * step_size.x, start.y + yi * step_size.y);
			pos[3] = CGL_vec2_init(start.x + xi * step_size.x, start.y + yi * step_size.y);

			for (CGL_int i = 0; i < 4; i++) intr[i] = 0.5f;

			/*
			*  A Possible Optimization
			*
			* We could have a cache of say CGL_float cache[10 * 10];
			* Now we loop from x = 0 to x = resolution_x / 10 and y = 0 to y = resolution_y / 10 in the outer loops
			* And have 2 inner loops from 1 - 10 each there e could cache the vlaue of the distance function
			* And then use the cached values in the inner loop saving a lot of calls to the distance function
			*/

			for (CGL_int i = 0; i < 4; i++) smpb[i] = sampler(pos[i], &smpv[i], marcher->user_data);

			if (marcher->interpolate) for (CGL_int i = 0; i < 4; i++) intr[i] = smpv[i] / (smpv[i] + smpv[(i + 1) % 4]);

			for (CGL_int i = 0; i < 4; i++) mpts[i] = CGL_vec2_init(CGL_utils_mix(pos[i].x, pos[(i + 1) % 4].x, intr[i]), CGL_utils_mix(pos[i].y, pos[(i + 1) % 4].y, intr[i]));

			if (!smpb[0] && !smpb[1] && !smpb[2] && !smpb[3]) // 0000
			{

			}
			else if (!smpb[0] && !smpb[1] && !smpb[2] && smpb[3]) // 0001
			{
				//CGL_widgets_add_line2f(mpts[2].x, mpts[2].y, mpts[3].x, mpts[3].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[3], mpts[2], mpts[3]);
			}
			else if (!smpb[0] && !smpb[1] && smpb[2] && !smpb[3]) // 0010
			{
				//CGL_widgets_add_line2f(mpts[1].x, mpts[1].y, mpts[2].x, mpts[2].y); 
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[2], mpts[1], mpts[2]);
			}
			else if (!smpb[0] && !smpb[1] && smpb[2] && smpb[3]) // 0011
			{
				//CGL_widgets_add_line2f(mpts[3].x, mpts[3].y, mpts[1].x, mpts[1].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[3], pos[2], mpts[1]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[3], mpts[1], mpts[3]);
			}
			else if (!smpb[0] && smpb[1] && smpb[2] && smpb[3]) // 0111
			{
				//CGL_widgets_add_line2f(mpts[0].x, mpts[0].y, mpts[3].x, mpts[3].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[3], pos[2], pos[1]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[3], pos[1], mpts[0]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[3], mpts[0], mpts[3]);
			}
			else if (!smpb[0] && smpb[1] && smpb[2] && !smpb[3]) // 0110
			{
				//CGL_widgets_add_line2f(mpts[0].x, mpts[0].y, mpts[2].x, mpts[2].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[2], pos[1], mpts[0]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[2], mpts[0], mpts[2]);
			}
			else if (!smpb[0] && smpb[1] && !smpb[2] && smpb[3]) // 0101
			{
				//CGL_widgets_add_line2f(mpts[0].x, mpts[0].y, mpts[1].x, mpts[1].y);
				//CGL_widgets_add_line2f(mpts[2].x, mpts[2].y, mpts[3].x, mpts[3].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[3], mpts[2], mpts[3]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[1], mpts[1], mpts[0]);
			}
			else if (!smpb[0] && smpb[1] && !smpb[2] && !smpb[3]) // 0100
			{
				//CGL_widgets_add_line2f(mpts[0].x, mpts[0].y, mpts[1].x, mpts[1].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[1], mpts[1], mpts[0]);
			}
			else if (smpb[0] && !smpb[1] && !smpb[2] && !smpb[3]) // 1000
			{
				//CGL_widgets_add_line2f(mpts[0].x, mpts[0].y, mpts[3].x, mpts[3].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], mpts[0], mpts[3]);
			}
			else if (smpb[0] && !smpb[1] && smpb[2] && !smpb[3]) // 1010
			{
				//CGL_widgets_add_line2f(mpts[0].x, mpts[0].y, mpts[3].x, mpts[3].y);
				//CGL_widgets_add_line2f(mpts[1].x, mpts[1].y, mpts[2].x, mpts[2].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], mpts[0], mpts[3]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[2], mpts[1], mpts[2]);
			}
			else if (smpb[0] && !smpb[1] && smpb[2] && smpb[3]) // 1011
			{
				//CGL_widgets_add_line2f(mpts[0].x, mpts[0].y, mpts[1].x, mpts[1].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], pos[3], pos[2]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], pos[2], mpts[1]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], mpts[1], mpts[0]);
			}
			else if (smpb[0] && smpb[1] && !smpb[2] && smpb[3]) // 1101
			{
				//CGL_widgets_add_line2f(mpts[1].x, mpts[1].y, mpts[2].x, mpts[2].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], pos[1], pos[3]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[1], mpts[2], pos[3]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[1], mpts[1], mpts[2]);
			}
			else if (smpb[0] && smpb[1] && smpb[2] && !smpb[3]) // 1110
			{
				//CGL_widgets_add_line2f(mpts[2].x, mpts[2].y, mpts[3].x, mpts[3].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], pos[1], pos[2]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], pos[2], mpts[2]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], mpts[2], mpts[3]);
			}
			else if (smpb[0] && smpb[1] && !smpb[2] && !smpb[3]) // 1100
			{
				//CGL_widgets_add_line2f(mpts[3].x, mpts[3].y, mpts[1].x, mpts[1].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], pos[1], mpts[1]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], mpts[1], mpts[3]);
			}
			else if (smpb[0] && !smpb[1] && !smpb[2] && smpb[3]) // 1001
			{
				//CGL_widgets_add_line2f(mpts[0].x, mpts[0].y, mpts[2].x, mpts[2].y);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[3], mpts[2], pos[0]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, mpts[2], mpts[0], pos[0]);
			}
			else if (smpb[0] && smpb[1] && smpb[2] && smpb[3]) // 1111
			{
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], pos[2], pos[1]);
				__CGL_square_marcher_generate_mesh_add_triangle(mesh_list, pos[0], pos[3], pos[2]);
			}

		}

	}
	size_t vt_ct = CGL_list_get_size(mesh_list);
	CGL_mesh_cpu* mesh = CGL_mesh_cpu_create(vt_ct, vt_ct);
	memcpy(mesh->vertices, mesh_list->data, sizeof(CGL_mesh_vertex) * vt_ct);
	for (size_t i = 0; i < vt_ct; i++) mesh->indices[i] = (CGL_uint)i;
	CGL_list_destroy(mesh_list);
	return mesh;
}



#endif



#ifndef CGL_EXCLUDE_POST_PROCESSOR



struct CGL_post_processor
{
	CGL_shader* shades_shader;
	CGL_shader* outlines_shader;
	CGL_shader* hatching_shader;
};



static CGL_post_processor* __CGL_POST_PROCESSOR_CONTEXT = NULL;



static const CGL_byte* __CGL_TOON_SHADES_SHADER_SOURCE =
"#version 430 core\n"
"\n"
"layout (local_size_x = 16, local_size_y = 16) in;\n"
"\n"
"layout (rgba32f, binding = 0) uniform image2D output_tex;\n"
"layout (rgba32f, binding = 1) uniform image2D input_tex;\n"
"\n"
"uniform int shades = 1;\n"
"uniform sampler2D albedo_tex;\n"
"uniform ivec2 resolution;\n"
"\n"
"void main()\n"
"{\n"
"    ivec2 pixel_coord = ivec2(gl_GlobalInvocationID.xy);\n"
"    vec2 uv = vec2(pixel_coord) / vec2(resolution);\n"
"    vec3 scene_pixel = imageLoad(input_tex, pixel_coord).rgb;\n"
"    scene_pixel = floor(scene_pixel * float(shades)) / float(shades);\n"
"    vec3 albedo_pixel = texture(albedo_tex, uv).rgb;\n"
"    vec3 output_pixel = scene_pixel + albedo_pixel;\n"
"    imageStore(output_tex, pixel_coord, vec4(output_pixel, 1.0));\n"
"}\n"
"\n";



static const CGL_byte* __CGL_TOON_OUTLINES_SHADER_SOURCE =
"#version 430 core\n"

"layout (local_size_x = 16, local_size_y = 16) in;\n"

"layout (rgba32f, binding = 0) uniform image2D output_tex;\n"
"layout (rgba32f, binding = 1) uniform image2D scene;\n"

"uniform float outline_width = 1.0f;\n"
"uniform ivec2 resolution;\n"
"uniform sampler2D normal_tex;\n"
"uniform sampler2D depth_tex;\n"

"float max_vec3(vec3 v)\n"
"{\n"
"    return max(max(v.x, v.y), v.z);\n"
"}\n"

// TODO: Take zFar and zNear as uniforms 
"float linearize_depth(float depth)\n"
"{\n"
"    float zFar = 100.0f;\n"
"    float zNear = 0.01f;\n"
"    return (2.0f * zNear) / (zFar + zNear - depth * (zFar - zNear));\n"
"}\n"


"float get_n_factor(vec2 uv)\n"
"{\n"
"    float current_normal = max_vec3(texture(normal_tex, uv).rgb);\n"
"    float left_normal = max_vec3(texture(normal_tex, uv + vec2(-outline_width / float(resolution.x), 0.0)).rgb);\n"
"    float right_normal = max_vec3(texture(normal_tex, uv + vec2(outline_width / float(resolution.x), 0.0)).rgb);\n"
"    float top_normal = max_vec3(texture(normal_tex, uv + vec2(0.0, outline_width / float(resolution.y))).rgb);\n"
"    float bottom_normal = max_vec3(texture(normal_tex, uv + vec2(0.0, -outline_width / float(resolution.y))).rgb);\n"
"    float n_factor = 0.0;\n"
"    n_factor = abs(current_normal - left_normal) + abs(current_normal - right_normal) + abs(current_normal - top_normal) + abs(current_normal - bottom_normal);\n"
//"    return clamp(n_factor, 0.0f, 1.0f);\n" // another special effect
"    return 1.0f - clamp(smoothstep(n_factor, 0.2f, 0.85f), 0.0f, 1.0f);\n"
"}\n"

"float get_d_factor(vec2 uv)\n"
"{\n"
"    float current_depth = linearize_depth(texture(depth_tex, uv).r);\n"
"    float left_depth = linearize_depth(texture(depth_tex, uv + vec2(-outline_width / float(resolution.x), 0.0)).r);\n"
"    float right_depth = linearize_depth(texture(depth_tex, uv + vec2(outline_width / float(resolution.x), 0.0)).r);\n"
"    float top_depth = linearize_depth(texture(depth_tex, uv + vec2(0.0, outline_width / float(resolution.y))).r);\n"
"    float bottom_depth = linearize_depth(texture(depth_tex, uv + vec2(0.0, -outline_width / float(resolution.y))).r);\n"
"    float d_factor = 0.0;\n"
"    d_factor = abs(current_depth - left_depth) + abs(current_depth - right_depth) + abs(current_depth - top_depth) + abs(current_depth - bottom_depth);\n"
"    return clamp(d_factor, 0.0f, 1.0f);\n"
"}\n"

"void main()\n"
"{\n"
"    ivec2 pixel_coord = ivec2(gl_GlobalInvocationID.xy);\n"
"    vec2 uv = vec2(pixel_coord) / vec2(resolution);\n"
"    float n_factor = get_n_factor(uv);\n"
"    float d_factor = get_d_factor(uv);\n"
"    float factor = max(n_factor, d_factor);\n"
"    vec3 scene_pixel = imageLoad(scene, pixel_coord).rgb;\n"
"    vec3 output_pixel = scene_pixel * (1.0f - factor);\n"
"    imageStore(output_tex, pixel_coord, vec4(output_pixel, 1.0));\n"
"}\n";



static const CGL_byte* __CGL_TOON_HATCHING_SHADER_SOURCE =
"#version 430 core\n"
"\n"
"layout (local_size_x = 16, local_size_y = 16) in;\n"
"\n"
"layout (rgba32f, binding = 0) uniform image2D output_tex;\n"
"\n"
"uniform sampler2D input_tex;\n"
"uniform sampler2D uv_tex;\n"
"uniform sampler2D hatch_tex[8];\n"
"uniform int hatch_tex_count;\n"
"uniform ivec2 resolution;\n"
"\n"
"vec3 hatching(vec2 uv, float intensity)\n"
"{\n"
"   vec3 overbright = vec3(max(0.0f, intensity - 1.0f));\n"
"   vec3 opt = overbright;\n"
"   float tot_weight = 0.0f;\n"
"   for(int i = 0 ; i < hatch_tex_count; i++)\n"
"   {\n"
"       float a0 = clamp(intensity * float(hatch_tex_count) - float(i), 0.0f, 1.0f);\n"
"       float a1 = clamp(intensity * float(hatch_tex_count) - float(i + 1), 0.0f, 1.0f);\n"
"       float weight = a0 - a1;\n"
"       tot_weight += weight;"
"       opt += texture(hatch_tex[i], uv * 8.0f).rgb * weight;\n"
"   }\n"
"   return opt / tot_weight;\n"
"}\n"
"\n"
"void main()\n"
"{\n"
"    ivec2 pixel_coord = ivec2(gl_GlobalInvocationID.xy);\n"
"    vec2 uv = vec2(pixel_coord) / vec2(resolution);\n"
"    vec2 sc_uv = texture(uv_tex, uv).rg;\n"
"    float filter_f = length(sc_uv);\n"
"    vec3 input_color = texture(input_tex, uv).rgb;\n"
"    vec3 output_pixel = vec3(0.0f);\n"
"    output_pixel = hatching(uv, dot(input_color, vec3(0.2326f, 0.7152f, 0.0722f)));\n"
"    if(filter_f > 1.0f) {output_pixel = vec3(1.0f); }\n"
"    imageStore(output_tex, pixel_coord, vec4(output_pixel, 1.0));\n"
"}\n"
"\n";


CGL_void CGL_post_processor_init()
{
	__CGL_POST_PROCESSOR_CONTEXT = (CGL_post_processor*)CGL_malloc(sizeof(CGL_post_processor));
	__CGL_POST_PROCESSOR_CONTEXT->shades_shader = CGL_shader_compute_create(__CGL_TOON_SHADES_SHADER_SOURCE, NULL);
	__CGL_POST_PROCESSOR_CONTEXT->outlines_shader = CGL_shader_compute_create(__CGL_TOON_OUTLINES_SHADER_SOURCE, NULL);
	__CGL_POST_PROCESSOR_CONTEXT->hatching_shader = CGL_shader_compute_create(__CGL_TOON_HATCHING_SHADER_SOURCE, NULL);
}


CGL_void CGL_post_processor_shutdown()
{
	CGL_shader_destroy(__CGL_POST_PROCESSOR_CONTEXT->shades_shader);
	CGL_shader_destroy(__CGL_POST_PROCESSOR_CONTEXT->outlines_shader);
	CGL_shader_destroy(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader);
	CGL_free(__CGL_POST_PROCESSOR_CONTEXT);
}


CGL_void CGL_post_processor_process_shades(CGL_texture* output, CGL_texture* scene, CGL_texture* albedo, CGL_int shades)
{
	CGL_shader_bind(__CGL_POST_PROCESSOR_CONTEXT->shades_shader);
	glBindImageTexture(0, output->handle, 0, GL_FALSE, 0, GL_WRITE_ONLY, GL_RGBA32F);
	glBindImageTexture(1, scene->handle, 0, GL_FALSE, 0, GL_READ_ONLY, GL_RGBA32F);
	CGL_shader_set_uniform_int(__CGL_POST_PROCESSOR_CONTEXT->shades_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->shades_shader, "shades"), shades);
	CGL_texture_bind(albedo, 2);
	CGL_shader_set_uniform_int(__CGL_POST_PROCESSOR_CONTEXT->shades_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->shades_shader, "albedo_tex"), 2);
	CGL_shader_set_uniform_ivec2v(__CGL_POST_PROCESSOR_CONTEXT->shades_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->shades_shader, "resolution"), output->width, output->height);
	CGL_shader_compute_dispatch(__CGL_POST_PROCESSOR_CONTEXT->shades_shader, output->width / 16 + 1, output->height / 16 + 1, 1);
	glMemoryBarrier(GL_SHADER_IMAGE_ACCESS_BARRIER_BIT);
}


CGL_void CGL_post_processor_process_outline(CGL_texture* output, CGL_texture* scene, CGL_texture* normal, CGL_texture* depth, CGL_float outline_width)
{
	CGL_shader_bind(__CGL_POST_PROCESSOR_CONTEXT->outlines_shader);
	glBindImageTexture(0, output->handle, 0, GL_FALSE, 0, GL_WRITE_ONLY, GL_RGBA32F);
	glBindImageTexture(1, scene->handle, 0, GL_FALSE, 0, GL_READ_ONLY, GL_RGBA32F);
	CGL_texture_bind(normal, 2);
	CGL_shader_set_uniform_int(__CGL_POST_PROCESSOR_CONTEXT->outlines_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->outlines_shader, "normal_tex"), 2);
	CGL_texture_bind(depth, 3);
	CGL_shader_set_uniform_int(__CGL_POST_PROCESSOR_CONTEXT->outlines_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->outlines_shader, "depth_tex"), 3);
	CGL_shader_set_uniform_ivec2v(__CGL_POST_PROCESSOR_CONTEXT->outlines_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->outlines_shader, "resolution"), output->width, output->height);
	CGL_shader_set_uniform_float(__CGL_POST_PROCESSOR_CONTEXT->outlines_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->outlines_shader, "outline_width"), outline_width);
	CGL_shader_compute_dispatch(__CGL_POST_PROCESSOR_CONTEXT->outlines_shader, output->width / 16 + 1, output->height / 16 + 1, 1);
	glMemoryBarrier(GL_SHADER_IMAGE_ACCESS_BARRIER_BIT);
}



CGL_void CGL_post_processor_process_hatching(CGL_texture* output, CGL_texture* scene, CGL_texture* uv_tex, CGL_texture** hatch_tex, CGL_int hatch_tex_count)
{
	static char buffer[256];
	CGL_shader_bind(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader);
	glBindImageTexture(0, output->handle, 0, GL_FALSE, 0, GL_READ_WRITE, GL_RGBA32F);
	CGL_texture_bind(uv_tex, 2);
	CGL_shader_set_uniform_int(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader, "uv_tex"), 2);
	CGL_texture_bind(scene, 3);
	CGL_shader_set_uniform_int(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader, "input_tex"), 3);
	for (CGL_int i = 0; i < hatch_tex_count; i++)
	{
		sprintf(buffer, "hatch_tex[%d]", i);
		CGL_texture_bind(hatch_tex[i], 4 + i);
		CGL_shader_set_uniform_int(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader, buffer), 4 + i);
	}
	CGL_shader_set_uniform_int(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader, "hatch_tex_count"), hatch_tex_count);
	CGL_shader_set_uniform_ivec2v(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader, CGL_shader_get_uniform_location(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader, "resolution"), output->width, output->height);
	CGL_shader_compute_dispatch(__CGL_POST_PROCESSOR_CONTEXT->hatching_shader, output->width / 16 + 1, output->height / 16 + 1, 1);
	glMemoryBarrier(GL_SHADER_IMAGE_ACCESS_BARRIER_BIT);
}

#endif

#define __CGL_WAV_LOADER_FAIL_AND_RETURN { CGL_log_internal("WAV Loader (%s): Invalid file", filename); fclose(fd); return false; }
#define __CGL_WAV_LOADER_SAFE_READ(varname, sze, cnt) if (fread(&varname, sze, cnt, fd) != cnt) __CGL_WAV_LOADER_FAIL_AND_RETURN

// Referred from https://www.mmsp.ece.mcgill.ca/Documents/AudioFormats/WAVE/WAVE.html
CGL_bool CGL_wav_file_load(CGL_wav_file* file, const char* filename)
{
	FILE* fd = fopen(filename, "rb");
	if (!fd) return false;
	CGL_int tmp = 0, ck_size = 0, fmt_ck_size = 0, sample_rate = 0, byte_rate = 0, data_ck_size = 0;
	CGL_short audio_format = 0, block_align = 0, bits_per_sample = 0, channel_count = 0;

	// check RIFF signature
	__CGL_WAV_LOADER_SAFE_READ(tmp, 4, 1)
		if (memcmp((CGL_byte*)&tmp, "RIFF", 4) != 0) { CGL_log_internal("WAV Loader (%s): Invalid RIFF signature", filename); fclose(fd); return false; }

	// read chunk size
	__CGL_WAV_LOADER_SAFE_READ(ck_size, 4, 1)
		CGL_utils_little_endian_to_current(&ck_size, 4);

	// check WAVE signature
	__CGL_WAV_LOADER_SAFE_READ(tmp, 4, 1)
		if (memcmp((CGL_byte*)&tmp, "WAVE", 4) != 0) { CGL_log_internal("WAV Loader (%s): Invalid WAVE signature", filename); fclose(fd); return false; }

	// check fmt signature
	__CGL_WAV_LOADER_SAFE_READ(tmp, 4, 1)
		if (memcmp((CGL_byte*)&tmp, "fmt ", 4) != 0) { CGL_log_internal("WAV Loader (%s): Invalid fmt signature", filename); fclose(fd); return false; }

	// read fmt chunk size
	__CGL_WAV_LOADER_SAFE_READ(fmt_ck_size, 4, 1)
		CGL_utils_little_endian_to_current(&fmt_ck_size, 4);

	// read audio format
	__CGL_WAV_LOADER_SAFE_READ(audio_format, 2, 1)
		CGL_utils_little_endian_to_current(&audio_format, 2);
	//audio_format = (CGL_int)(*((CGL_short*)&audio_format));
	if (audio_format != 1) { CGL_log_internal("WAV Loader (%s): Unsupported audio format", filename); fclose(fd); return false; }

	// read channel count
	__CGL_WAV_LOADER_SAFE_READ(channel_count, 2, 1)
		CGL_utils_little_endian_to_current(&channel_count, 2);
	//channel_count = (CGL_int)(*((CGL_short*)&channel_count));

	// read sample rate
	__CGL_WAV_LOADER_SAFE_READ(sample_rate, 4, 1)
		CGL_utils_little_endian_to_current(&sample_rate, 4);

	// read byte rate = sample rate * block align(= channel count * bits per sample / 8)
	__CGL_WAV_LOADER_SAFE_READ(byte_rate, 4, 1)
		CGL_utils_little_endian_to_current(&byte_rate, 4);

	// read block align = channel count * bits per sample / 8
	__CGL_WAV_LOADER_SAFE_READ(block_align, 2, 1)
		CGL_utils_little_endian_to_current(&block_align, 2);
	// block_align = (CGL_int)(*((CGL_short*)&block_align));

	// read bits per sample
	__CGL_WAV_LOADER_SAFE_READ(bits_per_sample, 2, 1)
		CGL_utils_little_endian_to_current(&bits_per_sample, 2);
	// bits_per_sample = (CGL_int)(*((CGL_short*)&bits_per_sample));

	// skip to data chunk
	__CGL_WAV_LOADER_SAFE_READ(tmp, 4, 1)
		while (memcmp((CGL_byte*)&tmp, "data", 4) != 0)
		{
			__CGL_WAV_LOADER_SAFE_READ(tmp, 4, 1)
				fseek(fd, tmp, SEEK_CUR);
			if (fread(&tmp, 4, 1, fd) < 1) { CGL_log_internal("WAV Loader (%s): Failed to read data chunk", filename); fclose(fd); return false; }
		}
	if (memcmp((CGL_byte*)&tmp, "data", 4) != 0) { CGL_log_internal("WAV Loader (%s): Invalid data signature", filename); fclose(fd); return false; }

	// read data chunk size
	__CGL_WAV_LOADER_SAFE_READ(data_ck_size, 4, 1)
		CGL_utils_little_endian_to_current(&data_ck_size, 4);

	// read data
	file->data = (CGL_byte*)CGL_malloc(data_ck_size);
	if (!file->data) { CGL_log_internal("WAV Loader (%s): Failed to allocate memory", filename); fclose(fd); return false; }

	if (fread(file->data, data_ck_size, 1, fd) < 1) { CGL_log_internal("WAV Loader (%s): Failed to read data", filename); fclose(fd); return false; }

	file->channel_count = channel_count;
	file->sample_rate = sample_rate;
	file->bits_per_sample = bits_per_sample;
	file->data_size = data_ck_size;
	file->duration = (CGL_float)data_ck_size / (CGL_float)(sample_rate * channel_count * bits_per_sample / 8);


	fclose(fd);
	return true;
}

CGL_void CGL_wav_file_destroy(CGL_wav_file* file)
{
	CGL_free(file->data);
}

CGL_int CGL_wav_file_sample(CGL_wav_file* file, CGL_int channel, CGL_int sample_offset)
{
	if (channel >= file->channel_count) return 0;
	if (sample_offset >= file->data_size) return 0;
	CGL_short sample = 0;
	sample_offset += channel * file->bits_per_sample / 8;
	memcpy(&sample, file->data + sample_offset, file->bits_per_sample / 8);
	//CGL_utils_little_endian_to_current(&sample, file->bits_per_sample / 8);
	return (CGL_int)sample;
}

CGL_int CGL_wav_file_sample_at_time(CGL_wav_file* file, CGL_int channel, CGL_float time)
{
	if (channel >= file->channel_count) return 0;
	if (time >= file->duration) return 0;
	CGL_int sample_offset = (CGL_int)((CGL_int)(time * file->sample_rate) * file->channel_count * file->bits_per_sample / 8);
	return CGL_wav_file_sample(file, channel, sample_offset);
}

#ifndef CGL_EXCLUDE_AUDIO

#include <AL/al.h>
#include <AL/alc.h>

struct CGL_audio_context
{
	ALCdevice* device;
	ALCcontext* context;
};

struct CGL_audio_source
{
	CGL_vec3 position;
	CGL_vec3 velocity;
	CGL_vec3 direction;
	ALuint source;
	float pitch;
	float gain;
	CGL_bool loop;
};

struct CGL_audio_buffer
{
	ALuint buffer;
	size_t size;
};



CGL_int CGL_audio_get_last_error()
{
	return alGetError();
}

const CGL_byte* CGL_audio_get_error_string(CGL_int error)
{
	return alGetString(error);
}

const CGL_byte* CGL_audio_get_device_list()
{
	return alcGetString(NULL, ALC_DEVICE_SPECIFIER);
}

const CGL_byte* CGL_audio_get_default_device()
{
	return alcGetString(NULL, ALC_DEFAULT_DEVICE_SPECIFIER);
}

CGL_audio_context* CGL_audio_context_create(const CGL_byte* device_name)
{
	ALCdevice* device = alcOpenDevice(device_name);
	if (!device) { CGL_log_internal("Audio: Failed to open device %s", device_name); return NULL; }
	CGL_log_internal("Audio: Opened device %s", device_name);
	ALCcontext* context = alcCreateContext(device, NULL);
	if (!context) { CGL_log_internal("Audio: Failed to create context"); alcCloseDevice(device); return NULL; }
	CGL_log_internal("Audio: Created context");
	alcMakeContextCurrent(context);
	CGL_audio_context* cgl_context = (CGL_audio_context*)CGL_malloc(sizeof(CGL_audio_context));
	if (!cgl_context) { CGL_log_internal("Audio: Failed to allocate memory"); alcDestroyContext(context); alcCloseDevice(device); return NULL; }
	cgl_context->device = device;
	cgl_context->context = context;
	return cgl_context;
}

CGL_void CGL_audio_context_destroy(CGL_audio_context* context)
{
	alcMakeContextCurrent(NULL);
	alcDestroyContext(context->context);
	alcCloseDevice(context->device);
	CGL_free(context);
}

CGL_void CGL_audio_make_context_current(CGL_audio_context* context)
{
	if (context) alcMakeContextCurrent(context->context);
	else alcMakeContextCurrent(NULL);
}



CGL_audio_source* CGL_audio_source_create()
{
	CGL_audio_source* source = (CGL_audio_source*)CGL_malloc(sizeof(CGL_audio_source));
	if (!source) { CGL_log_internal("Audio: Failed to allocate memory"); return NULL; }
	alGenSources(1, &source->source);
	source->position = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	source->velocity = CGL_vec3_init(0.0f, 0.0f, 0.0f);
	source->pitch = 1.0f;
	source->gain = 1.0f;
	source->loop = false;
	return source;
}

CGL_void CGL_audio_source_destroy(CGL_audio_source* source)
{
	alDeleteSources(1, &source->source);
	CGL_free(source);
}

CGL_void CGL_audio_source_reset_to_defaults(CGL_audio_source* source)
{
	CGL_audio_source_set_position(source, CGL_vec3_init(0.0f, 0.0f, 0.0f));
	CGL_audio_source_set_velocity(source, CGL_vec3_init(0.0f, 0.0f, 0.0f));
	CGL_audio_source_set_direction(source, CGL_vec3_init(0.0f, 0.0f, -1.0f));
	CGL_audio_source_set_pitch(source, 1.0f);
	CGL_audio_source_set_gain(source, 1.0f);
	CGL_audio_source_set_looping(source, false);
}

CGL_void CGL_audio_source_set_buffer(CGL_audio_source* source, CGL_audio_buffer* buffer)
{
	alSourcei(source->source, AL_BUFFER, buffer->buffer);
}

CGL_void CGL_audio_source_set_looping(CGL_audio_source* source, CGL_bool looping)
{
	source->loop = looping;
	alSourcei(source->source, AL_LOOPING, looping);
}

CGL_void CGL_audio_source_set_pitch(CGL_audio_source* source, CGL_float pitch)
{
	source->pitch = pitch;
	alSourcef(source->source, AL_PITCH, pitch);
}

CGL_void CGL_audio_source_set_gain(CGL_audio_source* source, CGL_float gain)
{
	source->gain = gain;
	alSourcef(source->source, AL_GAIN, gain);
}

CGL_void CGL_audio_source_set_position(CGL_audio_source* source, CGL_vec3 position)
{
	source->position = position;
	alSource3f(source->source, AL_POSITION, position.x, position.y, position.z);
}

CGL_void CGL_audio_source_set_velocity(CGL_audio_source* source, CGL_vec3 velocity)
{
	source->velocity = velocity;
	alSource3f(source->source, AL_VELOCITY, velocity.x, velocity.y, velocity.z);
}

CGL_void CGL_audio_source_set_direction(CGL_audio_source* source, CGL_vec3 direction)
{
	source->direction = direction;
	alSource3f(source->source, AL_DIRECTION, direction.x, direction.y, direction.z);
}

CGL_float CGL_audio_source_get_seconds_offset(CGL_audio_source* source)
{
	ALfloat offset = 0;
	alGetSourcef(source->source, AL_SEC_OFFSET, &offset);
	return (CGL_float)offset;
}

CGL_void CGL_audio_source_set_seconds_offset(CGL_audio_source* source, CGL_sizei seconds)
{
	alSourcei(source->source, AL_SEC_OFFSET, (ALint)seconds);
}

CGL_sizei CGL_audio_source_get_samples_offset(CGL_audio_source* source)
{
	ALint offset = 0;
	alGetSourcei(source->source, AL_SAMPLE_OFFSET, &offset);
	return (CGL_sizei)offset;
}

CGL_void CGL_audio_source_set_samples_offset(CGL_audio_source* source, CGL_sizei samples)
{
	alSourcei(source->source, AL_SAMPLE_OFFSET, (ALint)samples);
}

CGL_sizei CGL_audio_source_get_bytes_offset(CGL_audio_source* source)
{
	ALint offset = 0;
	alGetSourcei(source->source, AL_BYTE_OFFSET, &offset);
	return (CGL_sizei)offset;
}

CGL_void CGL_audio_source_set_bytes_offset(CGL_audio_source* source, CGL_sizei bytes)
{
	alSourcei(source->source, AL_BYTE_OFFSET, (ALint)bytes);
}

CGL_void CGL_audio_source_play(CGL_audio_source* source)
{
	alSourcePlay(source->source);
}

CGL_void CGL_audio_source_pause(CGL_audio_source* source)
{
	alSourcePause(source->source);
}

CGL_void CGL_audio_source_stop(CGL_audio_source* source)
{
	alSourceStop(source->source);
}

CGL_bool CGL_audio_source_is_playing(CGL_audio_source* source)
{
	CGL_int state = 0;
	alGetSourcei(source->source, AL_SOURCE_STATE, &state);
	return state == AL_PLAYING;
}

CGL_bool CGL_audio_source_is_paused(CGL_audio_source* source)
{
	CGL_int state = 0;
	alGetSourcei(source->source, AL_SOURCE_STATE, &state);
	return state == AL_PAUSED;
}

CGL_bool CGL_audio_source_is_stopped(CGL_audio_source* source)
{
	CGL_int state = 0;
	alGetSourcei(source->source, AL_SOURCE_STATE, &state);
	return state == AL_STOPPED;
}

CGL_audio_buffer* CGL_audio_buffer_create()
{
	CGL_audio_buffer* buffer = (CGL_audio_buffer*)CGL_malloc(sizeof(CGL_audio_buffer));
	if (!buffer) { CGL_log_internal("Audio: Failed to allocate memory"); return NULL; }
	buffer->size = 0;
	alGenBuffers(1, &buffer->buffer);
	return buffer;
}

CGL_void CGL_audio_buffer_destroy(CGL_audio_buffer* buffer)
{
	alDeleteBuffers(1, &buffer->buffer);
	CGL_free(buffer);
}

CGL_void CGL_audio_buffer_set_data_from_wav_file(CGL_audio_buffer* buffer, CGL_wav_file* file)
{
	ALenum format = AL_FORMAT_MONO16;
	ALsizei size = 0;
	ALsizei freq = 0;
	if (file->channel_count == 1 && file->bits_per_sample == 8)
		format = AL_FORMAT_MONO8;
	else if (file->channel_count == 1 && file->bits_per_sample == 16)
		format = AL_FORMAT_MONO16;
	else if (file->channel_count == 2 && file->bits_per_sample == 8)
		format = AL_FORMAT_STEREO8;
	else if (file->channel_count == 2 && file->bits_per_sample == 16)
		format = AL_FORMAT_STEREO16;
	else
	{
		CGL_log_internal("Audio: Unsupported WAV file format");
		return;
	}
	size = file->data_size;
	freq = file->sample_rate;
	alBufferData(buffer->buffer, format, file->data, size, freq);
}

CGL_void CGL_audio_buffer_set_data(CGL_audio_buffer* buffer, void* data, ALenum format, ALsizei size, ALsizei freq)
{
	alBufferData(buffer->buffer, format, data, size, freq);
}

CGL_void CGL_audio_listener_set_position(CGL_vec3 position)
{
	alListener3f(AL_POSITION, position.x, position.y, position.z);
}

CGL_void CGL_audio_listener_set_velocity(CGL_vec3 velocity)
{
	alListener3f(AL_VELOCITY, velocity.x, velocity.y, velocity.z);
}

CGL_void CGL_audio_listener_set_orientation(CGL_vec3 forward, CGL_vec3 up)
{
	CGL_float orientation[6] = { forward.x, forward.y, forward.z, up.x, up.y, up.z };
	alListenerfv(AL_ORIENTATION, orientation);
}


#endif



#ifndef CGL_EXCLUDE_TRAIL_RENDERER

#ifndef CGL_TRAIL_MAX_POINTS
#define CGL_TRAIL_MAX_POINTS 1024
#endif

/*
struct CGL_trail_point
{
	CGL_vec3 position;
	CGL_trail_point* next;
	void* user_data;
	CGL_int index;
	CGL_float lifespan;
	CGL_float thickness;
	CGL_float distance;
};
*/

static const char* __CGL_TRAIL_DEFAULT_VERTEX_SHADER =
#ifdef CGL_WASM
"#version 300 es\n"
"precision highp float;\n"
"precision highp int;\n"
"\n"
"in vec4 position;\n" // w is lifespan
"in vec4 normal;\n" // w is distance
"in vec4 texcoord;\n" // zw is reserved for future use
#else
"#version 430 core\n"
"\n"
"layout (location = 0) in vec4 position;\n" // w is lifespan
"layout (location = 1) in vec4 normal;\n" // w is distance
"layout (location = 2) in vec4 texcoord;\n" // zw is reserved for future use
#endif
"\n"
"out vec3 Position;\n"
"out vec2 TexCoord;\n"
"out float Distance;\n"
"\n"
"uniform mat4 projection;\n"
"uniform mat4 view;\n"
"\n"
"void main()\n"
"{\n"
"	gl_Position = projection * view * vec4(position.xyz, 1.0f);\n"
"	Position = position.xyz;\n"
"	TexCoord = texcoord.xy;\n"
"   Distance = normal.w;\n"
"}\n";

static const char* __CGL_TRAIL_DEFAULT_FRAGMENT_SHADER = 
#ifdef CGL_WASM
"#version 300 es\n"
"precision highp float;\n"
"precision highp int;\n"
#else
"#version 430 core\n"
#endif
"\n"
"out vec4 FragColor;\n"
"\n"
"in vec3 Position;\n"
"in vec2 TexCoord;\n"
"in float Distance;\n"
"\n"
"void main()\n"
"{\n"
"	FragColor = vec4(vec3(1.0f - 0.0f), 1.0f);\n"
"}\n";


struct CGL_trail
{
	CGL_trail_point points[CGL_TRAIL_MAX_POINTS];
	CGL_trail_point* first;
	CGL_trail_point* last;
	CGL_shader* shader;
	CGL_mesh_gpu* mesh;
	CGL_mesh_cpu* mesh_cpu;
	void* user_data;
	CGL_trail_point_update_function trail_point_func;
	CGL_int point_count;
	CGL_int resolution;
	CGL_float min_points_distance;
	CGL_float max_length;
	CGL_float length;
};

CGL_int __CGL_trail_get_next_index(CGL_trail* trail)
{
	CGL_int index = -1;
	for (CGL_int i = 0; i < CGL_TRAIL_MAX_POINTS; i++)
	{
		if (trail->points[i].index == -1)
		{
			trail->points[i].distance = 0.0f;
			trail->points[i].next = NULL;
			trail->points[i].lifespan = 0.0f;
			index = i;
			break;
		}
	}
	return index;
}

CGL_trail* CGL_trail_create()
{
	CGL_trail* trail = (CGL_trail*)CGL_malloc(sizeof(CGL_trail));
	if (!trail) { CGL_log_internal("Trail: Failed to allocate memory"); return NULL; }
	for (CGL_int i = 0; i < CGL_TRAIL_MAX_POINTS; i++) trail->points[i].index = -1;
	trail->first = NULL;
	trail->last = NULL;
	trail->user_data = NULL;
	trail->trail_point_func = NULL;
	trail->point_count = 0;
	trail->min_points_distance = 0.0f;
	trail->max_length = 1000000000.0f;
	trail->length = 0.0f;
	trail->resolution = 3;
	trail->mesh = CGL_mesh_gpu_create();
	trail->mesh_cpu = CGL_mesh_cpu_create(1024, 1024);
	trail->shader = CGL_shader_create(__CGL_TRAIL_DEFAULT_VERTEX_SHADER, __CGL_TRAIL_DEFAULT_FRAGMENT_SHADER, NULL);
	return trail;
}

CGL_void CGL_trail_destroy(CGL_trail* trail)
{
	CGL_mesh_cpu_destroy(trail->mesh_cpu);
	CGL_mesh_gpu_destroy(trail->mesh);
	CGL_shader_destroy(trail->shader);
	CGL_free(trail);
}

CGL_void CGL_trail_render(CGL_trail* trail, CGL_mat4* view, CGL_mat4* projection, CGL_shader* shader)
{
	if (!trail->mesh) return;
	if (!shader) { shader = trail->shader; CGL_shader_bind(shader); }
	CGL_shader_set_uniform_mat4(shader, CGL_shader_get_uniform_location(shader, "projection"), projection);
	CGL_shader_set_uniform_mat4(shader, CGL_shader_get_uniform_location(shader, "view"), view);
	CGL_shader_set_uniform_float(shader, CGL_shader_get_uniform_location(shader, "total_length"), trail->length);
	CGL_mesh_gpu_render(trail->mesh);
}

CGL_void CGL_trail_add_point(CGL_trail* trail, CGL_vec3 point, CGL_float lifespan, CGL_float thickness)
{
	if (trail->last)
	{
		CGL_float dist = sqrtf(powf(point.x - trail->last->position.x, 2) + powf(point.y - trail->last->position.y, 2) + powf(point.z - trail->last->position.z, 2));
		if (dist < trail->min_points_distance) return;
	}
	CGL_int index = __CGL_trail_get_next_index(trail);
	if (index == -1) { CGL_log_internal("Trail: Failed to add point, trail is full"); return; }
	CGL_trail_point* new_point = &trail->points[index];
	new_point->position = point;
	new_point->lifespan = lifespan;
	new_point->thickness = thickness;
	new_point->distance = 0.0f;
	new_point->user_data = NULL;
	new_point->index = index;
	new_point->next = trail->first;
	trail->first = new_point;
	trail->last = new_point;
	trail->point_count++;
	CGL_trail_calculate_distances(trail);
}

CGL_void CGL_trail_calculate_distances(CGL_trail* trail)
{
	CGL_trail_point* point = trail->first;
	CGL_trail_point* previous = NULL;
	CGL_float distance = 0.0f;
	while (point)
	{
		if (previous) { distance += sqrtf(powf(point->position.x - previous->position.x, 2) + powf(point->position.y - previous->position.y, 2) + powf(point->position.z - previous->position.z, 2)); }
		point->distance = distance;
		previous = point;
		point = point->next;
	}
	trail->length = distance;
}

CGL_void CGL_trail_set_resolution(CGL_trail* trail, CGL_int resolution)
{
	trail->resolution = resolution; // to be implemented in the future
}

CGL_void CGL_trail_update(CGL_trail* trail, CGL_float delta_time)
{
	CGL_trail_point* point = trail->first;
	CGL_trail_point* previous = NULL;
	CGL_bool remove = false;
	while (point)
	{
		remove = false;
		point->lifespan -= delta_time;
		if (trail->trail_point_func) remove = trail->trail_point_func(trail, point);
		if (point->lifespan <= 0.0f || remove || point->distance > trail->max_length)
		{
			if (previous) previous->next = point->next;
			else trail->first = point->next;
			point->index = -1;
			trail->point_count--;
			point = point->next;
		}
		if (!point) break;
		previous = point;
		point = point->next;
	}
}

CGL_void CGL_trail_bake_mesh(CGL_trail* trail)
{
	if (trail->point_count < 2) return;
	CGL_mesh_cpu* mesh = trail->mesh_cpu;

	if ((CGL_int)mesh->index_count < trail->point_count * trail->resolution * 6 || (CGL_int)mesh->vertex_count < trail->point_count * trail->resolution * 6)
	{
		CGL_sizei vct = mesh->vertex_count;
		CGL_sizei ict = mesh->index_count;
		CGL_mesh_cpu_destroy(mesh);
		mesh = CGL_mesh_cpu_create(
			CGL_utils_max(trail->point_count * trail->resolution * 6, (CGL_int)vct),
			CGL_utils_max(trail->point_count * trail->resolution * 6, (CGL_int)ict));
		trail->mesh_cpu = mesh;
	}
	mesh->vertex_count_used = mesh->index_count_used = 0;

	CGL_vec3 rt, tp, front, a0, a1, b0, b1, tmp0, tmp1;
	CGL_float angle0, angle1, angle_step = 360.0f / trail->resolution;
	CGL_trail_point* point = trail->first;
	while (point->next)
	{
		front = CGL_vec3_sub(point->next->position, point->position);
		CGL_vec3_normalize(front);
		if (front.x != 0.0f) rt = CGL_vec3_init(-front.y / front.x, 1.0f, 0.0f);
		else if (front.y != 0.0f) rt = CGL_vec3_init(0.0f, -front.z / front.y, 1.0f);
		else rt = CGL_vec3_init(1.0f, 0.0f, -front.x / front.z);
		tp = CGL_vec3_cross(front, rt);
		CGL_vec3_normalize(rt);
		CGL_vec3_normalize(tp);
		for (CGL_int i = 0; i < trail->resolution; i++)
		{
			angle0 = angle_step * i;
			CGL_float c0 = cosf(angle0) * point->thickness; CGL_float s0 = sinf(angle0) * point->thickness;
			a0 = CGL_vec3_scale(rt, s0);
			tmp0 = CGL_vec3_scale(tp, c0);
			a0 = CGL_vec3_add(a0, tmp0);
			a1 = CGL_vec3_add(a0, point->next->position);
			a0 = CGL_vec3_add(a0, point->position);


			angle1 = angle_step * ((i + 1) % trail->resolution);
			CGL_float c1 = cosf(angle1) * point->thickness; CGL_float s1 = sinf(angle1) * point->thickness;
			b0 = CGL_vec3_scale(rt, s1);
			tmp1 = CGL_vec3_scale(tp, c1);
			b0 = CGL_vec3_add(b0, tmp1);
			b1 = CGL_vec3_add(b0, point->next->position);
			b0 = CGL_vec3_add(b0, point->position);

			//CGL_mesh_cpu_add_quad(mesh, a0, b0, b1, a1);

			// triangle 1
			mesh->vertices[mesh->vertex_count_used + 0].position = CGL_vec4_init(a0.x, a0.y, a0.z, point->lifespan);
			mesh->vertices[mesh->vertex_count_used + 0].normal = CGL_vec4_init(a0.x, a0.y, a0.z, point->distance);

			mesh->vertices[mesh->vertex_count_used + 1].position = CGL_vec4_init(b0.x, b0.y, b0.z, point->lifespan);
			mesh->vertices[mesh->vertex_count_used + 1].normal = CGL_vec4_init(b0.x, b0.y, b0.z, point->distance);

			mesh->vertices[mesh->vertex_count_used + 2].position = CGL_vec4_init(b1.x, b1.y, b1.z, point->lifespan);
			mesh->vertices[mesh->vertex_count_used + 2].normal = CGL_vec4_init(b1.x, b1.y, b1.z, point->distance);

			// triangle 2
			mesh->vertices[mesh->vertex_count_used + 3].position = CGL_vec4_init(a0.x, a0.y, a0.z, point->lifespan);
			mesh->vertices[mesh->vertex_count_used + 3].normal = CGL_vec4_init(a0.x, a0.y, a0.z, point->distance);

			mesh->vertices[mesh->vertex_count_used + 4].position = CGL_vec4_init(b1.x, b1.y, b1.z, point->lifespan);
			mesh->vertices[mesh->vertex_count_used + 4].normal = CGL_vec4_init(b1.x, b1.y, b1.z, point->distance);

			mesh->vertices[mesh->vertex_count_used + 5].position = CGL_vec4_init(a1.x, a1.y, a1.z, point->lifespan);
			mesh->vertices[mesh->vertex_count_used + 5].normal = CGL_vec4_init(a1.x, a1.y, a1.z, point->distance);

			mesh->vertex_count_used += 6;
			mesh->index_count_used += 6;
		}

		point = point->next;
	}


	CGL_mesh_gpu_upload(trail->mesh, mesh, false);
}

CGL_void CGL_trail_clear(CGL_trail* trail)
{
	for (CGL_int i = 0; i < CGL_TRAIL_MAX_POINTS; i++) trail->points[i].index = -1;
	trail->first = NULL;
	trail->last = NULL;
	trail->point_count = 0;
}

CGL_void CGL_trail_set_point_update_function(CGL_trail* trail, CGL_trail_point_update_function function)
{
	trail->trail_point_func = function;
}

CGL_mesh_gpu* CGL_trail_get_mesh_gpu(CGL_trail* trail)
{
	return trail->mesh;
}

CGL_trail_point* CGL_trail_get_first_point(CGL_trail* trail)
{
	return trail->first;
}

CGL_void CGL_trail_set_user_data(CGL_trail* trail, void* user_data)
{
	trail->user_data = user_data;
}

CGL_void* CGL_trail_get_user_data(CGL_trail* trail)
{
	return trail->user_data;
}

CGL_float CGL_trail_get_length(CGL_trail* trail)
{
	return trail->length;
}

CGL_void CGL_trail_set_max_length(CGL_trail* trail, CGL_float length)
{
	trail->max_length = length;
}

CGL_void CGL_trail_set_min_points_distance(CGL_trail* trail, CGL_float min_points_distance)
{
	trail->min_points_distance = min_points_distance;
}

#endif



#ifndef CGL_EXCLUDE_NOISE_API


// ---------------- PERLIN ----------------
// From: https://mrl.cs.nyu.edu/~perlin/noise/



static CGL_int __CGL_NOISE_PERLIN_PERMUTATION_TABLE[512] = {
	151,160,137,91,90,15, 131,13,201,95,96,53,194,233,7,225,140,36,103,30,69,142,8,99,37,240,21,10,23,
	190, 6,148,247,120,234,75,0,26,197,62,94,252,219,203,117,35,11,32,57,177,33,88,237,149,56,87,174,
	20,125,136,171,168, 68,175,74,165,71,134,139,48,27,166,77,146,158,231,83,111,229,122,60,211,133,
	230,220,105,92,41,55,46,245,40,244,102,143,54, 65,25,63,161, 1,216,80,73,209,76,132,187,208, 89,
	18,169,200,196, 135,130,116,188,159,86,164,100,109,198,173,186, 3,64,52,217,226,250,124,123,5,
	202,38,147,118,126,255,82,85,212,207,206,59,227,47,16,58,17,182,189,28,42,223,183,170,213,119,
	248,152, 2,44,154,163, 70,221,153,101,155,167, 43,172,9, 129,22,39,253, 19,98,108,110,79,113,
	224,232,178,185, 112,104,218,246,97,228, 251,34,242,193,238,210,144,12,191,179,162,241, 81,51,
	145,235,249,14,239,107,49,192,214, 31,181,199,106,157,184, 84,204,176,115,121,50,45,127, 4,150,254,
	138,236,205,93,222,114,67,29,24,72,243,141,128,195,78,66,215,61,156,180,
	// Repeat
		151,160,137,91,90,15, 131,13,201,95,96,53,194,233,7,225,140,36,103,30,69,142,8,99,37,240,21,10,23,
		190, 6,148,247,120,234,75,0,26,197,62,94,252,219,203,117,35,11,32,57,177,33,88,237,149,56,87,174,
		20,125,136,171,168, 68,175,74,165,71,134,139,48,27,166,77,146,158,231,83,111,229,122,60,211,133,
		230,220,105,92,41,55,46,245,40,244,102,143,54, 65,25,63,161, 1,216,80,73,209,76,132,187,208, 89,
		18,169,200,196, 135,130,116,188,159,86,164,100,109,198,173,186, 3,64,52,217,226,250,124,123,5,
		202,38,147,118,126,255,82,85,212,207,206,59,227,47,16,58,17,182,189,28,42,223,183,170,213,119,
		248,152, 2,44,154,163, 70,221,153,101,155,167, 43,172,9, 129,22,39,253, 19,98,108,110,79,113,
		224,232,178,185, 112,104,218,246,97,228, 251,34,242,193,238,210,144,12,191,179,162,241, 81,51,
		145,235,249,14,239,107,49,192,214, 31,181,199,106,157,184, 84,204,176,115,121,50,45,127, 4,150,254,
		138,236,205,93,222,114,67,29,24,72,243,141,128,195,78,66,215,61,156,180,
};

static CGL_noise_data_type __CGL_noise_perlin_fade(CGL_noise_data_type t) { return t * t * t * (t * (t * 6 - 15) + 10); }
static CGL_noise_data_type __CGL_noise_perlin_lerp(CGL_noise_data_type t, CGL_noise_data_type a, CGL_noise_data_type b) { return a + t * (b - a); }
static CGL_noise_data_type __CGL_noise_perlin_grad(CGL_int hash, CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	// convert lo 4 bits of hash code into 12 gradient directions
	CGL_int h = hash % 15;
	CGL_noise_data_type u = (h < 8 ? x : y), v = (h < 4 ? y : h == 12 || h == 14 ? x : z);
	return ((h & 1) == 0 ? u : -u) + ((h & 2) == 0 ? v : -v);
}

CGL_noise_data_type CGL_noise_perlin(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	// find unit cube that contains the point
	CGL_int X = (CGL_int)floor(x) & 255, Y = (CGL_int)floor(y) & 255, Z = (CGL_int)floor(z) & 255;
	// find the relative x, y, z cordinates of the point in the cube
	x -= (CGL_noise_data_type)floor(x); y -= (CGL_noise_data_type)floor(y); z -= (CGL_noise_data_type)floor(z);
	// compute the fade curves for each of x, y, z
	CGL_noise_data_type u = __CGL_noise_perlin_fade(x), v = __CGL_noise_perlin_fade(y), w = __CGL_noise_perlin_fade(z);
	// hash coordinates of the 8 cube corners
	CGL_int A = __CGL_NOISE_PERLIN_PERMUTATION_TABLE[X] + Y, B = __CGL_NOISE_PERLIN_PERMUTATION_TABLE[X + 1] + Y, AA = __CGL_NOISE_PERLIN_PERMUTATION_TABLE[A] + Z,
		BA = __CGL_NOISE_PERLIN_PERMUTATION_TABLE[B] + Z, AB = __CGL_NOISE_PERLIN_PERMUTATION_TABLE[A + 1] + Z, BB = __CGL_NOISE_PERLIN_PERMUTATION_TABLE[B + 1] + Z;
	static CGL_noise_data_type tmp0, tmp1, tmp2, tmp3;
	tmp0 = __CGL_noise_perlin_lerp(u, __CGL_noise_perlin_grad(__CGL_NOISE_PERLIN_PERMUTATION_TABLE[AA], x, y, z), __CGL_noise_perlin_grad(__CGL_NOISE_PERLIN_PERMUTATION_TABLE[BA], x - 1, y, z));
	tmp1 = __CGL_noise_perlin_lerp(u, __CGL_noise_perlin_grad(__CGL_NOISE_PERLIN_PERMUTATION_TABLE[AB], x, y - 1, z), __CGL_noise_perlin_grad(__CGL_NOISE_PERLIN_PERMUTATION_TABLE[BB], x - 1, y - 1, z));
	tmp2 = __CGL_noise_perlin_lerp(u, __CGL_noise_perlin_grad(__CGL_NOISE_PERLIN_PERMUTATION_TABLE[AA + 1], x, y, z - 1), __CGL_noise_perlin_grad(__CGL_NOISE_PERLIN_PERMUTATION_TABLE[BA + 1], x - 1, y, z - 1));
	tmp3 = __CGL_noise_perlin_lerp(u, __CGL_noise_perlin_grad(__CGL_NOISE_PERLIN_PERMUTATION_TABLE[AB + 1], x, y - 1, z - 1), __CGL_noise_perlin_grad(__CGL_NOISE_PERLIN_PERMUTATION_TABLE[BB + 1], x - 1, y - 1, z - 1));
	return __CGL_noise_perlin_lerp(w, __CGL_noise_perlin_lerp(v, tmp0, tmp1), __CGL_noise_perlin_lerp(v, tmp2, tmp3));
}

// ---------------- PERLIN ----------------

// ---------------- OPENSIMPLEX ----------------
CGL_noise_data_type CGL_noise_opensimplex(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	// This is redirected to CGL_noise_opensimplex2s
	return CGL_noise_opensimplex2s(x, y, z);
}

// ---------------- OPENSIMPLEX ----------------

// ---------------- OPENSIMPLEX2S ----------------
// I have not implemented this
// This implementation is taken from : https://github.com/Auburn/FastNoiseLite/blob/master/C/FastNoiseLite.h
// Liscence to the above linked file : https://github.com/Auburn/FastNoiseLite/blob/master/LICENSE  (MIT)

#define CGL_NOISE_OPENSIMPLEX2_PRIME_X 501125321
#define CGL_NOISE_OPENSIMPLEX2_PRIME_Y 1136930381
#define CGL_NOISE_OPENSIMPLEX2_PRIME_Z 1720413743

static const CGL_float __CGL_NOISE_OPENSIMPLEX2_GRADIENTS_3D[] =
{
	0, 1, 1, 0,  0,-1, 1, 0,  0, 1,-1, 0,  0,-1,-1, 0,
	1, 0, 1, 0, -1, 0, 1, 0,  1, 0,-1, 0, -1, 0,-1, 0,
	1, 1, 0, 0, -1, 1, 0, 0,  1,-1, 0, 0, -1,-1, 0, 0,
	0, 1, 1, 0,  0,-1, 1, 0,  0, 1,-1, 0,  0,-1,-1, 0,
	1, 0, 1, 0, -1, 0, 1, 0,  1, 0,-1, 0, -1, 0,-1, 0,
	1, 1, 0, 0, -1, 1, 0, 0,  1,-1, 0, 0, -1,-1, 0, 0,
	0, 1, 1, 0,  0,-1, 1, 0,  0, 1,-1, 0,  0,-1,-1, 0,
	1, 0, 1, 0, -1, 0, 1, 0,  1, 0,-1, 0, -1, 0,-1, 0,
	1, 1, 0, 0, -1, 1, 0, 0,  1,-1, 0, 0, -1,-1, 0, 0,
	0, 1, 1, 0,  0,-1, 1, 0,  0, 1,-1, 0,  0,-1,-1, 0,
	1, 0, 1, 0, -1, 0, 1, 0,  1, 0,-1, 0, -1, 0,-1, 0,
	1, 1, 0, 0, -1, 1, 0, 0,  1,-1, 0, 0, -1,-1, 0, 0,
	0, 1, 1, 0,  0,-1, 1, 0,  0, 1,-1, 0,  0,-1,-1, 0,
	1, 0, 1, 0, -1, 0, 1, 0,  1, 0,-1, 0, -1, 0,-1, 0,
	1, 1, 0, 0, -1, 1, 0, 0,  1,-1, 0, 0, -1,-1, 0, 0,
	1, 1, 0, 0,  0,-1, 1, 0, -1, 1, 0, 0,  0,-1,-1, 0
};

static CGL_int __CGL_noise_opensimplex2_hash3d(CGL_int seed, CGL_int xPrimed, CGL_int yPrimed, CGL_int zPrimed)
{
	CGL_int hash = seed ^ xPrimed ^ yPrimed ^ zPrimed;
	hash *= 0x27d4eb2d;
	return hash;
}

static CGL_float __CGL_noise_opensimplex2_grad_coor3d(CGL_int seed, CGL_int xPrimed, CGL_int yPrimed, CGL_int zPrimed, CGL_float xd, CGL_float yd, CGL_float zd)
{
	CGL_int hash = __CGL_noise_opensimplex2_hash3d(seed, xPrimed, yPrimed, zPrimed);
	hash ^= hash >> 15; hash &= 63 << 2;
	return xd * __CGL_NOISE_OPENSIMPLEX2_GRADIENTS_3D[hash] + yd * __CGL_NOISE_OPENSIMPLEX2_GRADIENTS_3D[hash | 1] + zd * __CGL_NOISE_OPENSIMPLEX2_GRADIENTS_3D[hash | 2];
}



CGL_noise_data_type CGL_noise_opensimplex2s(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	CGL_int i = (CGL_int)floor(x), j = (CGL_int)floor(y), k = (CGL_int)floor(z);
	static CGL_int PRIME_X = CGL_NOISE_OPENSIMPLEX2_PRIME_X, PRIME_Y = CGL_NOISE_OPENSIMPLEX2_PRIME_Y, PRIME_Z = CGL_NOISE_OPENSIMPLEX2_PRIME_Z, seed = 42;

	CGL_noise_data_type xi = (CGL_noise_data_type)(x - i), yi = (CGL_noise_data_type)(y - j), zi = (CGL_noise_data_type)(z - k);

	i *= PRIME_X; j *= PRIME_Y; k *= PRIME_Z;
	CGL_int seed2 = seed + 1293373;

	CGL_int xNMask = (CGL_int)(-0.5 - xi);
	CGL_int yNMask = (CGL_int)(-0.5 - yi);
	CGL_int zNMask = (CGL_int)(-0.5 - zi);

	CGL_noise_data_type x0 = xi + xNMask, y0 = yi + yNMask, z0 = zi + zNMask;
	CGL_noise_data_type a0 = 0.75f - x0 * x0 - y0 * y0 - z0 * z0;
	CGL_noise_data_type value = (a0 * a0) * (a0 * a0) * __CGL_noise_opensimplex2_grad_coor3d(seed, i + (xNMask & PRIME_X), j + (yNMask & PRIME_Y), k + (zNMask & PRIME_Z), x0, y0, z0);

	CGL_noise_data_type x1 = xi - 0.5f, y1 = yi - 0.5f, z1 = zi - 0.5f;
	CGL_noise_data_type a1 = 0.75f - x1 * x1 - y1 * y1 - z1 * z1;
	value += (a1 * a1) * (a1 * a1) * __CGL_noise_opensimplex2_grad_coor3d(seed2, i + PRIME_X, j + PRIME_Y, k + PRIME_Z, x1, y1, z1);

	CGL_noise_data_type xAFlipMask0 = ((xNMask | 1) << 1) * x1;
	CGL_noise_data_type yAFlipMask0 = ((yNMask | 1) << 1) * y1;
	CGL_noise_data_type zAFlipMask0 = ((zNMask | 1) << 1) * z1;
	CGL_noise_data_type xAFlipMask1 = (-2 - (xNMask << 2)) * x1 - 1.0f;
	CGL_noise_data_type yAFlipMask1 = (-2 - (yNMask << 2)) * y1 - 1.0f;
	CGL_noise_data_type zAFlipMask1 = (-2 - (zNMask << 2)) * z1 - 1.0f;

	bool skip5 = false;
	CGL_noise_data_type a2 = xAFlipMask0 + a0;
	if (a2 > 0)
	{
		CGL_noise_data_type x2 = x0 - (xNMask | 1), y2 = y0, z2 = z0;
		value += (a2 * a2) * (a2 * a2) * __CGL_noise_opensimplex2_grad_coor3d(seed, i + (~xNMask & PRIME_X), j + (yNMask & PRIME_Y), k + (zNMask & PRIME_Z), x2, y2, z2);
	}
	else
	{
		CGL_noise_data_type a3 = yAFlipMask0 + zAFlipMask0 + a0;
		if (a3 > 0)
		{
			CGL_noise_data_type x3 = x0, y3 = y0 - (yNMask | 1), z3 = z0 - (zNMask | 1);
			value += (a3 * a3) * (a3 * a3) * __CGL_noise_opensimplex2_grad_coor3d(seed, i + (xNMask & PRIME_X), j + (~yNMask & PRIME_Y), k + (~zNMask & PRIME_Z), x3, y3, z3);
		}

		CGL_noise_data_type a4 = xAFlipMask1 + a1;
		if (a4 > 0)
		{
			CGL_noise_data_type x4 = (xNMask | 1) + x1, y4 = y1, z4 = z1;
			value += (a4 * a4) * (a4 * a4) * __CGL_noise_opensimplex2_grad_coor3d(seed2, i + (xNMask & (PRIME_X * 2)), j + PRIME_Y, k + PRIME_Z, x4, y4, z4);
			skip5 = true;
		}
	}

	bool skip9 = false;
	CGL_noise_data_type a6 = yAFlipMask0 + a0;
	if (a6 > 0)
	{
		CGL_noise_data_type x6 = x0, y6 = y0 - (yNMask | 1), z6 = z0;
		value += (a6 * a6) * (a6 * a6) * __CGL_noise_opensimplex2_grad_coor3d(seed, i + (xNMask & PRIME_X), j + (~yNMask & PRIME_Y), k + (zNMask & PRIME_Z), x6, y6, z6);
	}
	else
	{
		CGL_noise_data_type a7 = xAFlipMask0 + zAFlipMask0 + a0;
		if (a7 > 0)
		{
			CGL_noise_data_type x7 = x0 - (xNMask | 1), y7 = y0, z7 = z0 - (zNMask | 1);
			value += (a7 * a7) * (a7 * a7) * __CGL_noise_opensimplex2_grad_coor3d(seed, i + (~xNMask & PRIME_X), j + (yNMask & PRIME_Y), k + (~zNMask & PRIME_Z), x7, y7, z7);
		}

		CGL_noise_data_type a8 = yAFlipMask1 + a1;
		if (a8 > 0)
		{
			CGL_noise_data_type x8 = x1, y8 = (yNMask | 1) + y1, z8 = z1;
			value += (a8 * a8) * (a8 * a8) * __CGL_noise_opensimplex2_grad_coor3d(seed2, i + PRIME_X, j + (yNMask & (PRIME_Y << 1)), k + PRIME_Z, x8, y8, z8);
			skip9 = true;
		}
	}

	bool skipD = false;
	CGL_noise_data_type aA = zAFlipMask0 + a0;
	if (aA > 0)
	{
		CGL_noise_data_type xA = x0, yA = y0, zA = z0 - (zNMask | 1);
		value += (aA * aA) * (aA * aA) * __CGL_noise_opensimplex2_grad_coor3d(seed, i + (xNMask & PRIME_X), j + (yNMask & PRIME_Y), k + (~zNMask & PRIME_Z), xA, yA, zA);
	}
	else
	{
		CGL_noise_data_type aB = xAFlipMask0 + yAFlipMask0 + a0;
		if (aB > 0)
		{
			CGL_noise_data_type xB = x0 - (xNMask | 1), yB = y0 - (yNMask | 1), zB = z0;
			value += (aB * aB) * (aB * aB) * __CGL_noise_opensimplex2_grad_coor3d(seed, i + (~xNMask & PRIME_X), j + (~yNMask & PRIME_Y), k + (zNMask & PRIME_Z), xB, yB, zB);
		}

		CGL_noise_data_type aC = zAFlipMask1 + a1;
		if (aC > 0)
		{
			CGL_noise_data_type xC = x1, yC = y1, zC = (zNMask | 1) + z1;
			value += (aC * aC) * (aC * aC) * __CGL_noise_opensimplex2_grad_coor3d(seed2, i + PRIME_X, j + PRIME_Y, k + (zNMask & (PRIME_Z << 1)), xC, yC, zC);
			skipD = true;
		}
	}

	if (!skip5)
	{
		CGL_noise_data_type a5 = yAFlipMask1 + zAFlipMask1 + a1;
		if (a5 > 0)
		{
			CGL_noise_data_type x5 = x1, y5 = (yNMask | 1) + y1, z5 = (zNMask | 1) + z1;
			value += (a5 * a5) * (a5 * a5) * __CGL_noise_opensimplex2_grad_coor3d(seed2, i + PRIME_X, j + (yNMask & (PRIME_Y << 1)), k + (zNMask & (PRIME_Z << 1)), x5, y5, z5);
		}
	}

	if (!skip9)
	{
		CGL_noise_data_type a9 = xAFlipMask1 + zAFlipMask1 + a1;
		if (a9 > 0)
		{
			CGL_noise_data_type x9 = (xNMask | 1) + x1, y9 = y1, z9 = (zNMask | 1) + z1;
			value += (a9 * a9) * (a9 * a9) * __CGL_noise_opensimplex2_grad_coor3d(seed2, i + (xNMask & (PRIME_X * 2)), j + PRIME_Y, k + (zNMask & (PRIME_Z << 1)), x9, y9, z9);
		}
	}

	if (!skipD)
	{
		CGL_noise_data_type aD = xAFlipMask1 + yAFlipMask1 + a1;
		if (aD > 0)
		{
			CGL_noise_data_type xD = (xNMask | 1) + x1, yD = (yNMask | 1) + y1, zD = z1;
			value += (aD * aD) * (aD * aD) * __CGL_noise_opensimplex2_grad_coor3d(seed2, i + (xNMask & (PRIME_X << 1)), j + (yNMask & (PRIME_Y << 1)), k + PRIME_Z, xD, yD, zD);
		}
	}

	return value * 9.046026385208288f;
}

// ---------------- OPENSIMPLEX2S ----------------

// ---------------- VALUE  ----------------


#define CGL_NOISE_VALUE_LERP(t, a, b)  (a + t * (b - a))
#define CGL_NOISE_VALUE_SMOOTHSTEP(t)  (t * t * (3 - 2 * t))
#define CGL_NOISE_VALUE_SAMPLE_NOISE_VALUE(i, x, y, z)  { \
    __CGL_NOISE_VALUE_RAND_SEED = (x) * 73856093 ^ (y) * 19349663 ^ (z) * 83492791; \
    ns[i] = __CGL_noise_value_rand(); \
}

static CGL_int __CGL_NOISE_VALUE_RAND_SEED = 45;

static CGL_noise_data_type __CGL_noise_value_rand()
{
	__CGL_NOISE_VALUE_RAND_SEED = (214013 * __CGL_NOISE_VALUE_RAND_SEED + 2531011);
	return (CGL_noise_data_type)(((__CGL_NOISE_VALUE_RAND_SEED >> 16) & 0x7FFF) / 32767.0);
}

CGL_noise_data_type CGL_noise_value(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	static CGL_int X, Y, Z;
	static CGL_noise_data_type u, v, w, ns[8], tmp0, tmp1, tmp2, tmp3;
	X = (CGL_int)floor(x), Y = (CGL_int)floor(y), Z = (CGL_int)floor(z);
	u = x - (CGL_noise_data_type)X, v = y - (CGL_noise_data_type)Y, w = z - (CGL_noise_data_type)Z;
	u = CGL_NOISE_VALUE_SMOOTHSTEP(u), v = CGL_NOISE_VALUE_SMOOTHSTEP(v), w = CGL_NOISE_VALUE_SMOOTHSTEP(w);
	CGL_NOISE_VALUE_SAMPLE_NOISE_VALUE(0, X, Y, Z);
	CGL_NOISE_VALUE_SAMPLE_NOISE_VALUE(1, X + 1, Y, Z);
	CGL_NOISE_VALUE_SAMPLE_NOISE_VALUE(2, X, Y + 1, Z);
	CGL_NOISE_VALUE_SAMPLE_NOISE_VALUE(3, X + 1, Y + 1, Z);
	CGL_NOISE_VALUE_SAMPLE_NOISE_VALUE(4, X, Y, Z + 1);
	CGL_NOISE_VALUE_SAMPLE_NOISE_VALUE(5, X + 1, Y, Z + 1);
	CGL_NOISE_VALUE_SAMPLE_NOISE_VALUE(6, X, Y + 1, Z + 1);
	CGL_NOISE_VALUE_SAMPLE_NOISE_VALUE(7, X + 1, Y + 1, Z + 1);
	tmp0 = CGL_NOISE_VALUE_LERP(w, ns[0], ns[4]);
	tmp1 = CGL_NOISE_VALUE_LERP(w, ns[1], ns[5]);
	tmp2 = CGL_NOISE_VALUE_LERP(w, ns[2], ns[6]);
	tmp3 = CGL_NOISE_VALUE_LERP(w, ns[3], ns[7]);
	tmp0 = CGL_NOISE_VALUE_LERP(u, tmp0, tmp1);
	tmp1 = CGL_NOISE_VALUE_LERP(u, tmp2, tmp3);
	tmp0 = CGL_NOISE_VALUE_LERP(v, tmp0, tmp1);
	return tmp0;
}

// ---------------- VALUE  ----------------

// ---------------- VALUE CUBIC  ----------------

CGL_noise_data_type CGL_noise_valuecubic(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	// TODO: implement this
	//CGL_warn("CGL_noise_data_type CGL_noise_valuecubic(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z) is not yet implemented! This call is being redirected to CGL_noise_data_type CGL_noise_value(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)");
	return CGL_noise_value(x, y, z);
}

// ---------------- VALUE CUBIC  ----------------

// ---------------- WORLEY  ----------------

static CGL_int __CGL_NOISE_WORLEY_RAND_SEED = 45;

static CGL_noise_data_type __CGL_noise_worley_rand()
{
	__CGL_NOISE_WORLEY_RAND_SEED = (214013 * __CGL_NOISE_WORLEY_RAND_SEED + 2531011);
	return (CGL_noise_data_type)(((__CGL_NOISE_WORLEY_RAND_SEED >> 16) & 0x7FFF) / 32767.0);
}

CGL_noise_data_type CGL_noise_worley(CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	CGL_int X = (CGL_int)floor(x), Y = (CGL_int)floor(y), Z = (CGL_int)floor(z);
	//x -= (CGL_noise_data_type)floor(x); y -= (CGL_noise_data_type)floor(y); z -= (CGL_noise_data_type)floor(z);
	static CGL_noise_data_type vec[3], dist, /* max_dist = (CGL_noise_data_type)-1.0,*/ min_dist = (CGL_noise_data_type)10000000.0;
	/* max_dist = (CGL_noise_data_type)-1.0; */ min_dist = (CGL_noise_data_type)10000000.0;
	for (CGL_int i = -1; i <= 1; i++) for (CGL_int j = -1; j <= 1; j++) for (CGL_int k = -1; k <= 1; k++)
	{
		CGL_int sx = X + i, sy = Y + j, sz = Z + k;
		__CGL_NOISE_WORLEY_RAND_SEED = (sx * 73856093 ^ sy * 19349663 ^ sz * 83492791);
		vec[0] = __CGL_noise_worley_rand() + sx; vec[1] = __CGL_noise_worley_rand() + sy; vec[2] = __CGL_noise_worley_rand() + sz;
		dist = (CGL_noise_data_type)((vec[0] - x) * (vec[0] - x) + (vec[1] - y) * (vec[1] - y) + (vec[2] - z) * (vec[2] - z));
		/*if(dist > max_dist) max_dist = dist; */ if (dist < min_dist) min_dist = dist;
	}
	return (CGL_noise_data_type)sqrt(min_dist);
}
// ---------------- WORLEY  ----------------

CGL_void CGL_noise_params_default(CGL_noise_params* params)
{
	params->octaves = 3;
	params->fractal_type = CGL_NOISE_FRACTAL_TYPE_NONE;
	params->type = CGL_NOISE_TYPE_PERLIN;
	params->lacunarity = 2.0f;
	params->gain = 0.5f;
	params->frequency = 1.0f;
	params->weighted_strength = 0.0f;
	params->ping_pong_strength = 2.0f;
}

static void __CGL_noise_transform_coordinates(CGL_noise_params* params, CGL_noise_data_type* x, CGL_noise_data_type* y, CGL_noise_data_type* z)
{
	*x *= params->frequency; *y *= params->frequency; *z *= params->frequency;
	if (params->type == CGL_NOISE_TYPE_OPENSIMPLEX2S || params->type == CGL_NOISE_TYPE_OPENSIMPLEX)
	{
		const CGL_noise_data_type R3 = (CGL_noise_data_type)(2.0 / 3.0);
		CGL_noise_data_type r = (*x + *y + *z) * R3; // Rotation, not skew
		*x = r - *x; *y = r - *y; *z = r - *z;
	}
}

/*
static CGL_noise_data_type __CGL_pingpong(CGL_noise_data_type t)
{
	t -= (CGL_int)(t * 0.5) * 2;
	return t < 1 ? t : 2 - t;
}
*/

static CGL_noise_data_type __CGL_noise_calculate_fractal_bounding(CGL_noise_params* params)
{
	CGL_noise_data_type gain = (CGL_noise_data_type)fabs(params->gain);
	CGL_noise_data_type amp = gain, amp_fractal = (CGL_noise_data_type)1.0;
	for (CGL_int i = 1; i < params->octaves; i++)
	{
		amp_fractal += amp;
		amp *= gain;
	}
	return (CGL_noise_data_type)1.0 / amp_fractal;
}

static CGL_noise_data_type __CGL_noise_get_plain(CGL_noise_params* params, CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	switch (params->type)
	{
	case CGL_NOISE_TYPE_PERLIN:
		return CGL_noise_perlin(x, y, z);
	case CGL_NOISE_TYPE_OPENSIMPLEX:
		return CGL_noise_opensimplex(x, y, z);
	case CGL_NOISE_TYPE_OPENSIMPLEX2S:
		return CGL_noise_opensimplex2s(x, y, z);
	case CGL_NOISE_TYPE_VALUE:
		return CGL_noise_value(x, y, z);
	case CGL_NOISE_TYPE_VALUECUBIC:
		return CGL_noise_valuecubic(x, y, z);
	case CGL_NOISE_TYPE_WORLEY:
		return CGL_noise_worley(x, y, z);
	default:
		return 0.0f;
	};
	//    return (CGL_noise_data_type)0.0;
}


static CGL_noise_data_type __CGL_noise_get_fbm(CGL_noise_params* params, CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	CGL_noise_data_type sum = 0.0f, amp = __CGL_noise_calculate_fractal_bounding(params), noise_val;
	for (CGL_int i = 0; i < params->octaves; i++)
	{
		noise_val = __CGL_noise_get_plain(params, x, y, z);
		sum += noise_val * amp;
		amp *= (CGL_noise_data_type)CGL_utils_lerp(1.0, (CGL_noise_data_type)(CGL_utils_min(noise_val + 1.0, 2.0) * 0.5), params->weighted_strength);
		x *= params->lacunarity; y *= params->lacunarity; z *= params->lacunarity;
		amp *= params->gain;
	}
	return sum;
}

static CGL_noise_data_type __CGL_noise_get_billow(CGL_noise_params* params, CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	CGL_noise_data_type sum = 0.0f, amp = __CGL_noise_calculate_fractal_bounding(params), noise_val;
	for (CGL_int i = 0; i < params->octaves; i++)
	{
		noise_val = __CGL_noise_get_plain(params, x, y, z);
		sum += (CGL_noise_data_type)(fabs(noise_val) * 2.0 - 1.0) * amp;
		amp *= (CGL_noise_data_type)CGL_utils_lerp(1.0, (CGL_noise_data_type)(CGL_utils_min(noise_val + 1.0, 2.0) * 0.5), params->weighted_strength);
		x *= params->lacunarity; y *= params->lacunarity; z *= params->lacunarity;
		amp *= params->gain;
	}
	return sum;
}

static CGL_noise_data_type __CGL_noise_get_riged(CGL_noise_params* params, CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	CGL_noise_data_type sum = 0.0f, amp = __CGL_noise_calculate_fractal_bounding(params), noise_val;
	for (CGL_int i = 0; i < params->octaves; i++)
	{
		noise_val = (CGL_noise_data_type)fabs(__CGL_noise_get_plain(params, x, y, z));
		sum += (CGL_noise_data_type)(noise_val * -2.0 + 1.0) * amp;
		amp *= (CGL_noise_data_type)CGL_utils_lerp(1.0, 1.0 - noise_val, params->weighted_strength);
		x *= params->lacunarity; y *= params->lacunarity; z *= params->lacunarity;
		amp *= params->gain;
	}
	return sum;
}

static CGL_noise_data_type __CGL_noise_get_pingpong(CGL_noise_params* params, CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	CGL_noise_data_type sum = 0.0f, amp = __CGL_noise_calculate_fractal_bounding(params), noise_val;
	for (CGL_int i = 0; i < params->octaves; i++)
	{
		noise_val = (CGL_noise_data_type)fabs(__CGL_noise_get_plain(params, x, y, z));
		sum += (CGL_noise_data_type)((noise_val - 0.5) * 2.0) * amp;
		amp *= (CGL_noise_data_type)CGL_utils_lerp(1.0, noise_val, params->weighted_strength);
		x *= params->lacunarity; y *= params->lacunarity; z *= params->lacunarity;
		amp *= params->gain;
	}
	return sum;
}

CGL_noise_data_type CGL_noise_get(CGL_noise_params* params, CGL_noise_data_type x, CGL_noise_data_type y, CGL_noise_data_type z)
{
	__CGL_noise_transform_coordinates(params, &x, &y, &z);
	switch (params->fractal_type)
	{
	case CGL_NOISE_FRACTAL_TYPE_NONE: return __CGL_noise_get_plain(params, x, y, z);
	case CGL_NOISE_FRACTAL_TYPE_FBM: return __CGL_noise_get_fbm(params, x, y, z);
	case CGL_NOISE_FRACTAL_TYPE_BILLOW: return __CGL_noise_get_billow(params, x, y, z);
	case CGL_NOISE_FRACTAL_TYPE_RIGID: return __CGL_noise_get_riged(params, x, y, z);
	case CGL_NOISE_FRACTAL_TYPE_PINGPONG: return __CGL_noise_get_pingpong(params, x, y, z);
	default: return 0.0f;
	}
}


CGL_void CGL_noise_init()
{
}

CGL_void CGL_noise_shutdown()
{

}


#endif


#ifndef CGL_EXCLUDE_AI_API

struct CGL_simple_neural_network_layer
{
	CGL_float* weights;
	CGL_float* activations;
	CGL_float* errors;
	CGL_simple_neural_network_activation_function activation_function;
	CGL_simple_neural_network_activation_function activation_function_derivative;
	CGL_int input_count;
	CGL_int output_count;
	CGL_int weight_count;
};

struct CGL_simple_neural_network
{
	CGL_simple_neural_network_layer* layers;
	CGL_int layer_count;
};


CGL_simple_neural_network* CGL_simple_neural_network_create(CGL_int* layer_sizes, CGL_int layer_count)
{
	CGL_simple_neural_network* network = (CGL_simple_neural_network*)CGL_malloc(sizeof(CGL_simple_neural_network));
	network->layer_count = layer_count;
	network->layers = (CGL_simple_neural_network_layer*)CGL_malloc(sizeof(CGL_simple_neural_network_layer) * layer_count);
	for (CGL_int i = 0; i < layer_count; i++)
	{
		CGL_simple_neural_network_layer* layer = network->layers + i;
		layer->activation_function = CGL_utils_sigmoid;
		layer->activation_function_derivative = CGL_utils_sigmoid_derivative;
		layer->input_count = i > 0 ? layer_sizes[i - 1] : 0;
		layer->output_count = layer_sizes[i];
		layer->weight_count = (layer->input_count + 1) * layer->output_count;
		layer->weights = (CGL_float*)CGL_malloc(sizeof(CGL_float) * layer->weight_count);
		layer->activations = (CGL_float*)CGL_malloc(sizeof(CGL_float) * (layer->output_count + 1));
		layer->errors = (CGL_float*)CGL_malloc(sizeof(CGL_float) * (layer->output_count + 1));
	}
	return network;
}

static CGL_sizei __CGL_simple_neural_network_calculate_serialized_size(CGL_simple_neural_network* network)
{
	CGL_sizei size = 0;
	for (CGL_int i = 0; i < network->layer_count; i++)
		size += sizeof(CGL_int) + sizeof(CGL_float) * network->layers[i].weight_count;
	return size;
}

CGL_byte* CGL_simple_neural_network_serialize_weights(CGL_simple_neural_network* network, CGL_sizei* size_out)
{
	CGL_sizei size = __CGL_simple_neural_network_calculate_serialized_size(network); // calculate size of serialized data
	CGL_byte* data = (CGL_byte*)CGL_malloc(size); // allocate memory for serialized data
	if (!data) return NULL; // if allocation failed, return NULL
	CGL_byte* ptr = data; // pointer to current position in serialized data
	for (CGL_int i = 0; i < network->layer_count; i++) // for each layer
	{
		CGL_simple_neural_network_layer* layer = network->layers + i; // get layer
		memcpy(ptr, &layer->weight_count, sizeof(CGL_int)); // copy weight count
		ptr += sizeof(CGL_int); // move pointer
		memcpy(ptr, layer->weights, sizeof(CGL_float) * layer->weight_count); // copy weights
		ptr += sizeof(CGL_float) * layer->weight_count; // move pointer
	}
	if (size_out) *size_out = size; // if size_out is not NULL, set it to size of serialized data
	return data; // return serialized data
}

CGL_bool CGL_simple_neural_network_deserialize_weights(CGL_simple_neural_network* network, CGL_byte* data)
{
	if (!data) return false; // if data is NULL, return false
	CGL_byte* ptr = data; // pointer to current position in serialized data
	for (CGL_int i = 0; i < network->layer_count; i++) // for each layer
	{
		CGL_simple_neural_network_layer* layer = network->layers + i; // get layer
		CGL_int weight_count; // weight count
		memcpy(&weight_count, ptr, sizeof(CGL_int)); // copy weight count
		ptr += sizeof(CGL_int); // move pointer
		if (weight_count != layer->weight_count) return false; // if weight count does not match, return false
		memcpy(layer->weights, ptr, sizeof(CGL_float) * layer->weight_count); // copy weights
		ptr += sizeof(CGL_float) * layer->weight_count; // move pointer
	}
	return true; // return true
}

CGL_void CGL_simple_neural_network_set_layer_activation_function(CGL_simple_neural_network* network, CGL_int layer_index, CGL_simple_neural_network_activation_function activation_function, CGL_simple_neural_network_activation_function activation_function_derivative)
{
	network->layers[layer_index].activation_function = activation_function; // set activation function
	network->layers[layer_index].activation_function_derivative = activation_function_derivative; // set activation function derivative
}

CGL_void CGL_simple_neural_network_randomize_weights(CGL_simple_neural_network* network, CGL_float min_v, CGL_float max_v)
{
	for (CGL_int i = 0; i < network->layer_count; i++)
		for (CGL_int j = 0; j < network->layers[i].weight_count; j++)
			network->layers[i].weights[j] = CGL_utils_random_float_in_range(min_v, max_v);
}

CGL_void CGL_simple_neural_network_destroy(CGL_simple_neural_network* network)
{
	for (CGL_int i = 0; i < network->layer_count; i++)
	{
		CGL_simple_neural_network_layer* layer = network->layers + i;
		CGL_free(layer->weights);
		CGL_free(layer->activations);
		CGL_free(layer->errors);
	}
	CGL_free(network->layers);
	CGL_free(network);
}

CGL_void CGL_simple_neural_network_evaluate(CGL_simple_neural_network* network, CGL_float* input, CGL_float* output)
{
	CGL_simple_neural_network_layer* layer_pr = network->layers; // layer 0
	CGL_simple_neural_network_layer* layer_cr = layer_pr + 1; // layer 1
	memcpy(layer_pr->activations, input, sizeof(CGL_float) * layer_pr->output_count); // copy input to layer 0
	layer_pr->activations[layer_pr->output_count] = 1.0f; // bias
	for (CGL_int i = 1; i < network->layer_count; i++)
	{
		for (CGL_int j = 0; j < layer_cr->output_count; j++)
		{
			CGL_float sum = 0.0f;
			for (CGL_int k = 0; k < layer_pr->output_count + 1; k++)
				sum += layer_pr->activations[k] * layer_cr->weights[k * layer_cr->output_count + j];
			layer_cr->activations[j] = layer_cr->activation_function(sum);
		}
		layer_cr->activations[layer_cr->output_count] = 1.0f; // bias
		layer_pr = layer_cr; layer_cr++;
	}
	if (output) memcpy(output, layer_pr->activations, sizeof(CGL_float) * layer_pr->output_count);
}

CGL_void CGL_simple_neural_network_train(CGL_simple_neural_network* a, CGL_float* input, CGL_float* output, CGL_float learning_rate)
{
	CGL_simple_neural_network_evaluate(a, input, NULL); // evaluate network for prediced output
	CGL_simple_neural_network_layer* layer_pr = a->layers + a->layer_count - 1; // layer 0
	CGL_simple_neural_network_layer* layer_cr = layer_pr - 1; // layer 1
	// calculate errors for the last layer
	for (CGL_int i = 0; i < layer_pr->output_count; i++) 
		layer_pr->errors[i] = (output[i] - layer_pr->activations[i]) * layer_pr->activation_function_derivative(layer_pr->activations[i]);
	// calculate (propagate) errors for the rest of the layers
	for (CGL_int i = a->layer_count - 2; i >= 0; i--) // loop through layers n-1 to 0
	{
		for (CGL_int j = 0; j < layer_cr->output_count; j++) // loop through neurons in current layer
		{
			// error[j] = sum(error[k] * weight[j][k]) * derivative(activation[j])
			CGL_float sum = 0.0f; // accumulator for sum
			for (CGL_int k = 0; k < layer_pr->output_count; k++)
				sum += layer_pr->errors[k] * layer_pr->weights[j * layer_pr->output_count + k];  // accumulate sum
			layer_cr->errors[j] = sum * layer_cr->activation_function_derivative(layer_cr->activations[j]); // calculte error for the neuron
		}
		layer_pr = layer_cr; layer_cr--; // update layer pointers
	}
	layer_pr = a->layers; // layer 0
	layer_cr = layer_pr + 1; // layer 1
	// update weights with respect to respective errors of neurons and layers
	for (CGL_int i = 1; i < a->layer_count; i++)
	{
		for (CGL_int j = 0; j < layer_cr->output_count; j++)
		{
			for (CGL_int k = 0; k < layer_pr->output_count + 1; k++)
				layer_cr->weights[k * layer_cr->output_count + j] += learning_rate * layer_pr->activations[k] * layer_cr->errors[j];
		}
		layer_pr = layer_cr; layer_cr++;
	}
}

CGL_void CGL_simple_neural_network_copy_weights(CGL_simple_neural_network* a, CGL_simple_neural_network* b)
{
	for (CGL_int i = 0; i < a->layer_count; i++) memcpy(a->layers[i].weights, b->layers[i].weights, sizeof(CGL_float) * a->layers[i].weight_count);
}

CGL_void CGL_simple_neural_network_mutate(CGL_simple_neural_network* a, CGL_float mutation_ratio)
{
	for (CGL_int i = 0; i < a->layer_count; i++) for (CGL_int j = 0; j < a->layers[i].weight_count; j++) if (CGL_utils_random_float_in_range(0.0f, 1.0f) < mutation_ratio) a->layers[i].weights[j] += CGL_utils_random_gaussian(0.0f, 0.1f);
}


struct CGL_linear_regression_context
{
	CGL_matrix* coefficents;
	CGL_matrix* input;
	CGL_float* input_data;
	CGL_matrix* evaluate_temp0;
	CGL_matrix* train_temp0;
	CGL_int input_count;
};

CGL_linear_regression_context* CGL_linear_regression_context_create(CGL_int input_count_)
{
	CGL_linear_regression_context* context = (CGL_linear_regression_context*)CGL_malloc(sizeof(CGL_linear_regression_context));
	context->input_count = input_count_;
	context->coefficents = CGL_matrix_create(1, input_count_ + 1);
	context->input = CGL_matrix_create(input_count_ + 1, 1);
	context->evaluate_temp0 = CGL_matrix_create(1, 1);
	context->train_temp0 = CGL_matrix_create(1, input_count_ + 1);
	context->input_data = (CGL_float*)CGL_malloc(sizeof(CGL_float) * (input_count_ + 1));
	return context;
}

CGL_void CGL_linear_regression_context_destroy(CGL_linear_regression_context* context)
{
	CGL_matrix_destroy(context->coefficents);
	CGL_matrix_destroy(context->input);
	CGL_matrix_destroy(context->evaluate_temp0);
	CGL_matrix_destroy(context->train_temp0);
	CGL_free(context->input_data);
	CGL_free(context);
}

CGL_void CGL_linear_regression_randomize_coefficents(CGL_linear_regression_context* context, CGL_float min_v, CGL_float max_v)
{
	for (CGL_int i = 0; i < context->input_count + 1; i++) CGL_matrix_set_elem(context->coefficents, 0, i, CGL_utils_random_float_in_range(min_v, max_v));
}

CGL_float CGL_linear_regression_evaluate(CGL_linear_regression_context* context, CGL_float* input, CGL_float* output)
{
	memcpy(context->input_data, input, sizeof(CGL_float) * context->input_count);
	context->input_data[context->input_count] = 1.0f;
	CGL_matrix_set_col(context->input, 0, context->input_data);
	CGL_matrix_mul_to(context->coefficents, context->input, context->evaluate_temp0);
	if (output) *output = CGL_matrix_get_elem(context->evaluate_temp0, 0, 0);
	return CGL_matrix_get_elem(context->evaluate_temp0, 0, 0);
}

CGL_bool CGL_linear_regression_train(CGL_linear_regression_context* context, CGL_linear_regression_sample_function sample_function, void* user_data, CGL_int sample_count, CGL_float learning_rate, CGL_int max_iterations)
{
	CGL_float y_hat = 0.0f, error = 0.0f, factor = 0.0f;
	for (CGL_int i = 0; i < max_iterations; i++)
	{
		context->train_temp0 = CGL_matrix_make_zero(context->train_temp0);
		for (CGL_int k = 0; k < sample_count; k++)
		{
			y_hat = sample_function(user_data, context->input_data, &y_hat, k);
			CGL_matrix_set_col(context->input, 0, context->input_data);
			CGL_matrix_mul_to(context->coefficents, context->input, context->evaluate_temp0);
			error = CGL_matrix_get_elem(context->evaluate_temp0, 0, 0) - y_hat;
			for (CGL_int j = 0; j < context->input_count + 1; j++)
				CGL_matrix_set_elem(context->train_temp0, 0, j, CGL_matrix_get_elem(context->train_temp0, 0, j) + error * CGL_matrix_get_elem(context->input, j, 0));
		}
		factor = -learning_rate / (CGL_float)sample_count;
		CGL_matrix_scale_to(context->train_temp0, factor);
		CGL_matrix_add_to(context->coefficents, context->train_temp0, context->coefficents);
	}
	return CGL_TRUE;
}


#endif


#ifndef CGL_EXCLUDE_PATH_FINDING_API

struct CGL_path_finding_a_star_context
{
	CGL_path_finding_node* nodes;
	CGL_path_finding_node* start_node;
	CGL_path_finding_node* current_node;
	void* user_data;
	CGL_byte* nodes_data;
	CGL_int max_nodes_count;
	CGL_int nodes_count;
	CGL_int nodes_data_size;
	CGL_bool copy_data;
};

CGL_void CGL_path_finding_node_init(CGL_path_finding_node* node, void* data_ptr)
{
	node->data_ptr = data_ptr;
	node->id = node->parent_id = node->child_id = -1;
	node->is_open = CGL_FALSE;
	node->is_active = CGL_FALSE;
	node->g = node->h = node->f = 0.0f;
}

CGL_path_finding_a_star_context* CGL_path_finding_a_star_context_create(CGL_int max_nodes_count, CGL_bool copy_data, CGL_int data_size)
{
	CGL_path_finding_a_star_context* context = (CGL_path_finding_a_star_context*)CGL_malloc(sizeof(CGL_path_finding_a_star_context));
	context->nodes = (CGL_path_finding_node*)CGL_malloc(sizeof(CGL_path_finding_node) * max_nodes_count);
	if (copy_data) context->nodes_data = (CGL_byte*)CGL_malloc(CGL_utils_max(data_size, 1) * max_nodes_count); else context->nodes_data = NULL;
	context->max_nodes_count = max_nodes_count;
	context->nodes_count = 0;
	context->nodes_data_size = data_size;
	context->copy_data = copy_data;
	context->start_node = NULL;
	context->user_data = NULL;
	for (CGL_int i = 0; i < max_nodes_count; i++) context->nodes[i].data_ptr = context->nodes_data + i * context->nodes_data_size;
	return context;
}

static CGL_int __CGL_path_finding_a_star_find_node(CGL_path_finding_a_star_context* context, CGL_path_finding_node* node, CGL_path_finding_node_equals_function node_equals_function)
{
	CGL_path_finding_node* nodes = context->nodes;
	for (CGL_int i = 0; i < context->max_nodes_count; i++) if (nodes[i].is_active) if (node_equals_function(context->user_data, &nodes[i], node)) return i;
	return -1;
}

static CGL_int __CGL_path_finding_a_star_add_node(CGL_path_finding_a_star_context* context, CGL_path_finding_node* node, CGL_path_finding_node_equals_function node_equals_function)
{
	node->id = __CGL_path_finding_a_star_find_node(context, node, node_equals_function); if (node->id != -1) return node->id;
	CGL_path_finding_node* nodes = context->nodes;
	if (context->nodes_count >= context->max_nodes_count) return -1;
	//for(CGL_int i = 0 ; i < context->max_nodes_count ; i++) if(!nodes[i].is_active) // find inactive node
	CGL_int i = context->nodes_count;
	{
		node->id = i; nodes[i] = *node;
		if (context->copy_data) nodes[i].data_ptr = context->nodes_data + i * context->nodes_data_size;
		nodes[i].is_active = true;
		if (context->copy_data) memcpy(context->nodes_data + i * context->nodes_data_size, node->data_ptr, context->nodes_data_size);
		//CGL_int *data = (CGL_int*)(context->nodes_data + i * context->nodes_data_size);
		context->nodes_count++;
		return node->id;
	}
	// return -1;
}

static CGL_int __CGL_path_finding_a_star_find_node_with_lowest_f(CGL_path_finding_a_star_context* context)
{
	CGL_path_finding_node* nodes = context->nodes;
	CGL_int lowest_f_node = -1;
	CGL_float lowest_f_v = 0.0f;
	for (CGL_int i = 0; i < context->max_nodes_count; i++) if (nodes[i].is_active && nodes[i].is_open && (lowest_f_node == -1 || nodes[i].f <= lowest_f_v)) { lowest_f_node = i; lowest_f_v = nodes[i].f; }
	// CGL_int *data = (CGL_int*)nodes[lowest_f_node].data_ptr;
	nodes[lowest_f_node].is_open = false;
	return lowest_f_node;
}

/*
// for debug
static void __CGL_path_finding_a_star_print_nodes(CGL_path_finding_a_star_context* context)
{
	CGL_path_finding_node* nodes = context->nodes;
	printf("Nodes [ ");
	for (CGL_int i = 0; i < context->nodes_count; i++)
	{
		CGL_int* dat = (CGL_int*)nodes[i].data_ptr;
		printf("{ (%d -> %d %d) (%d %d) -> %f %s} ", i, nodes[i].parent_id, nodes[i].child_id, *dat % 10, *dat / 10, nodes[i].f, nodes[i].is_open ? "open" : "closed");
	}
	printf("]\n");
}
*/

static void __CGL_path_finding_a_star_calculate_gfh(CGL_path_finding_a_star_context* context, CGL_int node, CGL_int parent_node, CGL_path_finding_heuristic_function heuristic_function, CGL_path_finding_cost_function cost_function, CGL_int node_count_old)
{
	//context->nodes[node].h = heuristic_function(context->user_data, &context->nodes[node]);
	CGL_float total_cost = context->nodes[parent_node].g + cost_function(context->user_data, &context->nodes[parent_node], &context->nodes[node]);
	if (node_count_old <= node)
	{
		context->nodes[node].g = total_cost;
		context->nodes[node].h = heuristic_function(context->user_data, &context->nodes[node]);
		context->nodes[node].is_open = true;
		context->nodes[node].parent_id = parent_node;
	}
	else if (total_cost <= context->nodes[node].g)
	{
		context->nodes[node].g = total_cost;
		context->nodes[node].parent_id = parent_node;
		context->nodes[node].is_open = true;
	}
	context->nodes[node].f = context->nodes[node].g + context->nodes[node].h;
}

CGL_int __CGL_path_finding_a_star_get_open_node_count(CGL_path_finding_a_star_context* context)
{
	CGL_int count = 0;
	for (CGL_int i = 0; i < context->max_nodes_count; i++) if (context->nodes[i].is_active && context->nodes[i].is_open) count++;
	return count;
}

CGL_int CGL_path_finding_a_star_add_node(CGL_path_finding_a_star_context* context, CGL_path_finding_node node, CGL_path_finding_node_equals_function node_equals_function)
{
	return __CGL_path_finding_a_star_add_node(context, &node, node_equals_function);
}


// the actual a* algorithm
CGL_bool CGL_path_finding_a_star_find_path(CGL_path_finding_a_star_context* context, CGL_path_finding_node start_node_n, CGL_path_finding_node end_node_n, CGL_path_finding_heuristic_function heuristic_function, CGL_path_finding_cost_function cost_function, CGL_path_finding_get_neighbors_function get_neighbors_function, CGL_path_finding_node_equals_function node_equals_function, void* user_data)
{
	CGL_path_finding_a_star_clear_path(context); // clear previous path
	CGL_path_finding_node* nodes = context->nodes; // shorthand
	CGL_int start_node = __CGL_path_finding_a_star_add_node(context, &start_node_n, node_equals_function); // add start node
	context->start_node = &context->nodes[start_node]; // update context variable
	context->user_data = user_data; // update context variable
	if (start_node == -1) return CGL_FALSE; // if initial couldn't be added, return
	CGL_int current_node = start_node;  // current node is start node
	CGL_int neighbors[CGL_PATH_FINDING_A_STAR_MAX_NEIGHBOURS], neighbour_count = 0; // array of storing neighbors
	CGL_int epochs = 0, node_count_old = 0; // epochs is used to prevent infinite loops
	while (__CGL_path_finding_a_star_get_open_node_count(context) > 0 && epochs <= 100 * context->max_nodes_count) // while there are open nodes
	{
		epochs++; current_node = __CGL_path_finding_a_star_find_node_with_lowest_f(context); // find node with lowest f
		if (node_equals_function(context->user_data, &nodes[current_node], &end_node_n)) // if current node is end node
		{
			// reorder path
			while (current_node != start_node)
			{
				CGL_int tmp = current_node;
				current_node = nodes[current_node].parent_id;
				nodes[current_node].child_id = tmp;
			}
			CGL_path_finding_a_star_reorder_path(context); // set transversal cursor to start node
			return true; // path found successfully
		}
		nodes[current_node].is_open = false; node_count_old = context->nodes_count; // close current node
		neighbour_count = get_neighbors_function(context->user_data, &nodes[current_node], neighbors); // get neighbors
		for (CGL_int j = 0; j < neighbour_count; j++) if (neighbors[j] != -1) // for each valid neighbor
		{
			context->nodes[neighbors[j]].is_open = false; // close neighbor (will be opened if needed)
			__CGL_path_finding_a_star_calculate_gfh(context, neighbors[j], current_node, heuristic_function, cost_function, node_count_old); // calculate g, h and f for neighbor
		}
	}
	return false; // path not found
}

CGL_float CGL_path_finding_a_star_get_path_length(CGL_path_finding_a_star_context* context)
{
	if (context->start_node == NULL) return 0.0f;
	CGL_path_finding_node* node = context->start_node;
	CGL_float length_v = 0.0f;
	while (node->child_id != -1)
	{
		length_v += node->g;
		node = &context->nodes[node->child_id];
	}
	return length_v;
}

CGL_path_finding_node* CGL_path_finding_a_star_get_path_start_node(CGL_path_finding_a_star_context* context)
{
	return context->start_node;
}

CGL_bool CGL_path_finding_a_star_has_path(CGL_path_finding_a_star_context* context)
{
	return context->start_node != NULL;
}

CGL_void CGL_path_finding_a_star_reorder_path(CGL_path_finding_a_star_context* context)
{
	context->current_node = context->start_node;
}

CGL_void* CGL_path_finding_a_star_next_in_path(CGL_path_finding_a_star_context* context, void* data_out)
{
	if (context->current_node == NULL) return NULL;
	CGL_path_finding_node* cn_copy = context->current_node;
	if (context->current_node->child_id == -1) context->current_node = NULL;
	else context->current_node = &context->nodes[context->current_node->child_id];
	if (cn_copy && data_out) memcpy(data_out, cn_copy->data_ptr, context->nodes_data_size);
	return cn_copy;
}
CGL_void CGL_path_finding_a_star_clear_path(CGL_path_finding_a_star_context* context)
{
	context->start_node = NULL;
	context->current_node = NULL;
	for (CGL_int i = 0; i < context->max_nodes_count; i++)
	{
		context->nodes[i].is_open = CGL_FALSE;
		context->nodes[i].is_active = CGL_FALSE;
		context->nodes[i].parent_id = context->nodes[i].child_id = -1;
		context->nodes[i].g = context->nodes[i].h = context->nodes[i].f = 0.0f;
	}
	if (context->copy_data) memset(context->nodes_data, 0, context->nodes_data_size * context->max_nodes_count);
	context->nodes_count = 0;
}

CGL_void CGL_path_finding_a_star_context_destroy(CGL_path_finding_a_star_context* context)
{
	CGL_free(context->nodes);
	if (context->copy_data) CGL_free(context->nodes_data);
	CGL_free(context);
}

#endif


#ifndef CGL_EXCLUDE_CSV_API

struct CGL_csv
{
	CGL_sizei item_max_size;
	CGL_sizei column_count;
	CGL_sizei row_count;
	CGL_list* parser_list;
	CGL_byte* item_buffer;
	CGL_list* columns;
};

CGL_csv* CGL_csv_create(CGL_sizei item_max_size)
{
	CGL_csv* csv = CGL_malloc(sizeof(CGL_csv));
	if (csv == NULL) return NULL;
	csv->item_buffer = CGL_malloc(item_max_size + 100);
	if (csv->item_buffer == NULL)
	{
		CGL_free(csv);
		return NULL;
	}
	csv->columns = CGL_list_create(sizeof(CGL_list*), 100);
	if (csv->columns == NULL)
	{
		CGL_free(csv->item_buffer);
		CGL_free(csv);
		return NULL;
	}
	csv->parser_list = CGL_list_create(item_max_size, 100);
	if (csv->parser_list == NULL)
	{
		CGL_list_destroy(csv->columns);
		CGL_free(csv->item_buffer);
		CGL_free(csv);
		return NULL;
	}
	csv->item_max_size = item_max_size;
	csv->column_count = 0;
	csv->row_count = 0;
	return csv;
}

CGL_void CGL_csv_destroy(CGL_csv* csv)
{
	CGL_sizei column_count = CGL_list_get_size(csv->columns);
	for (CGL_sizei i = 0; i < column_count; i++)
	{
		CGL_list* column = *(CGL_list**)CGL_list_get(csv->columns, i, NULL);
		CGL_list_destroy(column);
	}
	CGL_list_destroy(csv->columns);
	CGL_list_destroy(csv->parser_list);
	CGL_free(csv->item_buffer);
	CGL_free(csv);
}

#define __CGL_CSV_ERROR_AND_RETURN(...) \
{\
    CGL_log_internal(__VA_ARGS__); \
    return CGL_FALSE; \
}

CGL_bool CGL_csv_load_from_buffer(CGL_csv* csv, const CGL_byte* buffer, const CGL_byte* seperator)
{
	CGL_sizei seperator_length = strlen(seperator);
	CGL_sizei line_start_index = 0, current_index = 0, line_end_index = 0, line_number = 0, column_count = 0, prev_column_start = 0, seperator_count = 0, line_iterator = 0;
	while (buffer[current_index])
	{
		line_start_index = current_index;
		while (buffer[current_index] && (buffer[current_index] != '\n' && !(buffer[current_index] == '\r' && buffer[current_index + 1] == '\n'))) current_index++;
		line_end_index = current_index;
		if (buffer[current_index] == '\r' && buffer[current_index + 1] == '\n') current_index += 2; else current_index++;
		// fwrite(buffer + line_start_index, (line_end_index - line_start_index), 1, stdout);
		if (column_count != 0) if (line_end_index - line_start_index <= seperator_length * (column_count - 1))  __CGL_CSV_ERROR_AND_RETURN("CGL_csv_load_from_buffer: line %d is too short", line_number);
		if (line_end_index - line_start_index == 0) __CGL_CSV_ERROR_AND_RETURN("CGL_csv_load_from_buffer: line %d is empty", line_number);
		prev_column_start = line_start_index; seperator_count = 0;
		CGL_list_clear(csv->parser_list);
		for (line_iterator = line_start_index; line_iterator <= line_end_index - seperator_length; line_iterator++)
		{
			if (strncmp(buffer + line_iterator, seperator, seperator_length) == 0)
			{
				if (line_iterator - prev_column_start > csv->item_max_size) __CGL_CSV_ERROR_AND_RETURN("CGL_csv_load_from_buffer: item %d in line %d is too long", seperator_count, line_number);
				sprintf(csv->item_buffer, "%.*s ", (CGL_int)(line_iterator - prev_column_start), buffer + prev_column_start);
				CGL_list_push(csv->parser_list, csv->item_buffer);
				seperator_count++; line_iterator += seperator_length - 1; prev_column_start = line_iterator + 1;
			}
		}
		if (prev_column_start < line_end_index)
		{
			if (line_end_index - prev_column_start > csv->item_max_size) __CGL_CSV_ERROR_AND_RETURN("CGL_csv_load_from_buffer: item %d in line %d is too long", seperator_count, line_number);
			sprintf(csv->item_buffer, "%.*s ", (CGL_int)(line_end_index - prev_column_start), buffer + prev_column_start);
			CGL_list_push(csv->parser_list, csv->item_buffer);
		}
		if (line_number == 0) column_count = CGL_list_get_size(csv->parser_list);
		else if (CGL_list_get_size(csv->parser_list) != column_count) __CGL_CSV_ERROR_AND_RETURN("CGL_csv_load_from_buffer: line %d has %d columns, but %d columns are expected", line_number, CGL_list_get_size(csv->parser_list), column_count);
		if (line_number == 0) for (CGL_sizei i = 0; i < column_count; i++) CGL_csv_add_column(csv);
		CGL_csv_add_row(csv);
		for (CGL_sizei i = 0; i < column_count; i++)
		{
			CGL_list* column = *(CGL_list**)CGL_list_get(csv->columns, i, NULL);
			CGL_list_set(column, line_number, CGL_list_get(csv->parser_list, i, NULL));
		}
		line_number++;
	}
	return CGL_TRUE;
}

CGL_bool CGL_csv_load(CGL_csv* csv, const CGL_byte* file_path, const CGL_byte* seperator)
{
	CGL_byte* data = CGL_utils_read_file(file_path, NULL);
	if (data == NULL) return CGL_FALSE;
	CGL_bool result = CGL_csv_load_from_buffer(csv, data, seperator);
	CGL_free(data);
	return result;
}

CGL_bool CGL_csv_save_to_buffer(CGL_csv* csv, CGL_byte* buffer, const CGL_byte* seperator)
{
	buffer[0] = '\0';
	CGL_sizei column_count = CGL_list_get_size(csv->columns);
	// NOTE: I am not sure wether to return false here
	//       as this is technically not an error
	if (column_count == 0) return CGL_TRUE;
	CGL_list* first_column = *(CGL_list**)CGL_list_get(csv->columns, 0, NULL);
	CGL_sizei row_count = CGL_list_get_size(first_column);
	for (CGL_sizei i = 0; i < row_count; i++)
	{
		for (CGL_sizei j = 0; j < column_count; j++)
		{
			CGL_list* column = *(CGL_list**)CGL_list_get(csv->columns, j, NULL);
			if (j == column_count - 1) sprintf(csv->item_buffer, "%s%s", (CGL_byte*)CGL_list_get(column, i, NULL), CGL_NEWLINE);
			else sprintf(csv->item_buffer, "%s%s", (CGL_byte*)CGL_list_get(column, i, NULL), seperator);
			strcat(buffer, csv->item_buffer);
		}
	}
	return CGL_TRUE;
}

CGL_bool CGL_csv_save(CGL_csv* csv, const CGL_byte* file_path, const CGL_byte* separator)
{
	static CGL_byte save_buffer[1024 * 1024 * 16];
	CGL_bool result = CGL_csv_save_to_buffer(csv, save_buffer, separator);
	if (!result) return CGL_FALSE;
	CGL_utils_write_file(file_path, save_buffer, strlen(save_buffer));
	return CGL_TRUE;
}

CGL_bool CGL_csv_add_column(CGL_csv* csv)
{
	CGL_sizei prev_column_count = CGL_list_get_size(csv->columns);
	CGL_sizei row_count = 0;
	if (prev_column_count > 0)
	{
		CGL_list* column0 = *(CGL_list**)CGL_list_get(csv->columns, 0, NULL);
		row_count = CGL_list_get_size(column0);
	}
	CGL_list* column = CGL_list_create(csv->item_max_size, 100);
	if (column == NULL) return CGL_FALSE;
	csv->item_buffer[0] = '\0';
	for (CGL_sizei i = 0; i < row_count; i++) CGL_list_push(column, csv->item_buffer);
	CGL_list_push(csv->columns, &column);
	csv->column_count++;
	return CGL_TRUE;
}

CGL_bool CGL_csv_add_row(CGL_csv* csv)
{
	CGL_sizei column_count = CGL_list_get_size(csv->columns);
	csv->item_buffer[0] = '\0';
	for (CGL_sizei i = 0; i < column_count; i++)
	{
		CGL_list* column = *(CGL_list**)CGL_list_get(csv->columns, i, NULL);
		CGL_list_push(column, csv->item_buffer);
	}
	return CGL_TRUE;
}

CGL_byte* CGL_csv_set_item(CGL_csv* csv, CGL_int row, CGL_int column, const CGL_byte* item)
{
	CGL_list* column_ptr = *(CGL_list**)CGL_list_get(csv->columns, column, NULL);
	if (column_ptr == NULL) return NULL;
	sprintf(csv->item_buffer, "%s", item);
	CGL_list_set(column_ptr, row, csv->item_buffer);
	return CGL_list_get(column_ptr, row, NULL);
}

CGL_byte* CGL_csv_get_item(CGL_csv* csv, CGL_int row, CGL_int column, CGL_byte* item_out)
{
	CGL_list* column_ptr = *(CGL_list**)CGL_list_get(csv->columns, column, NULL);
	if (column_ptr == NULL) return CGL_FALSE;
	CGL_byte* item = (CGL_byte*)CGL_list_get(column_ptr, row, NULL);
	if (item == NULL) return CGL_FALSE;
	if (item_out) sprintf(item_out, "%s", item);
	return item;
}

CGL_bool CGL_csv_get_row(CGL_csv* csv, CGL_int row, CGL_byte* row_out)
{
	CGL_sizei column_count = CGL_list_get_size(csv->columns);
	for (CGL_sizei i = 0; i < column_count; i++)
	{
		CGL_list* column = *(CGL_list**)CGL_list_get(csv->columns, i, NULL);
		CGL_byte* item = (CGL_byte*)CGL_list_get(column, row, NULL);
		if (item == NULL) return CGL_FALSE;
		sprintf(row_out + (csv->item_max_size * i), "%s", item);
	}
	return CGL_TRUE;
}


CGL_bool CGL_csv_get_column(CGL_csv* csv, CGL_int column, CGL_byte* column_out)
{
	CGL_list* column_ptr = *(CGL_list**)CGL_list_get(csv->columns, column, NULL);
	if (column_ptr == NULL) return CGL_FALSE;
	CGL_sizei row_count = CGL_list_get_size(column_ptr);
	memcpy(column_out, column_ptr->data, row_count * csv->item_max_size);
	return CGL_TRUE;
}

CGL_int CGL_csv_get_row_count(CGL_csv* csv)
{
	CGL_sizei column_count = CGL_list_get_size(csv->columns);
	if (column_count == 0) return 0;
	CGL_list* column = *(CGL_list**)CGL_list_get(csv->columns, 0, NULL);
	CGL_sizei row_count = CGL_list_get_size(column);
	return (CGL_int)row_count;
}

CGL_int CGL_csv_get_column_count(CGL_csv* csv)
{
	return (CGL_int)CGL_list_get_size(csv->columns);
}

CGL_void CGL_csv_clear(CGL_csv* csv)
{
	CGL_sizei column_count = CGL_list_get_size(csv->columns);
	for (CGL_sizei i = 0; i < column_count; i++)
	{
		CGL_list* column = *(CGL_list**)CGL_list_get(csv->columns, i, NULL);
		CGL_list_destroy(column);
	}
	// while (CGL_list_get_size(csv->columns) > 0) CGL_list_pop(csv->columns, NULL);
	CGL_list_clear(csv->columns);
}


#endif

#ifndef CGL_EXCLUDE_IMAGE_FILE_API

CGL_bool CGL_image_file_is_png_f(FILE* file)
{
	static const CGL_ubyte png_signature[8] = { 137, 80, 78, 71, 13, 10, 26, 10 };
	for (CGL_int i = 0; i < 8; ++i)
	{
		CGL_ubyte byte = 0;
		if (fread(&byte, sizeof(CGL_ubyte), 1, file) != 1) return CGL_FALSE;
		if (byte != png_signature[i]) return CGL_FALSE;
	}
	fseek(file, 0, SEEK_SET);
	return CGL_TRUE;
}

CGL_bool CGL_image_file_is_png(const CGL_byte* file_path)
{
	FILE* file = fopen(file_path, "rb");
	if (file == NULL) return CGL_FALSE;
	CGL_bool result = CGL_image_file_is_png_f(file);
	fclose(file);
	return result;
}

CGL_bool CGL_image_file_is_bmp_f(FILE* file)
{
	CGL_byte d_i8 = 0;
	CGL_uint d_u32 = 0;
	if (fread(&d_i8, sizeof(CGL_byte), 1, file) != 1) return CGL_FALSE;
	if (d_i8 != 'B') return CGL_FALSE;
	if (fread(&d_i8, sizeof(CGL_byte), 1, file) != 1) return CGL_FALSE;
	if (d_i8 != 'M') return CGL_FALSE;
	if (fread(&d_u32, sizeof(CGL_uint), 1, file) != 1) return CGL_FALSE;  // file size
	if (fread(&d_u32, sizeof(CGL_uint), 1, file) != 1) return CGL_FALSE; // reserved
	if (fread(&d_u32, sizeof(CGL_uint), 1, file) != 1) return CGL_FALSE; // data offset
	if (fread(&d_u32, sizeof(CGL_uint), 1, file) != 1) return CGL_FALSE; // header size
	fseek(file, 0, SEEK_SET);
	return (d_u32 == 12 || d_u32 == 40 || d_u32 == 56 || d_u32 == 108 || d_u32 == 124);
}

CGL_bool CGL_image_file_is_bmp(const CGL_byte* file_path)
{
	FILE* file = fopen(file_path, "rb");
	if (file == NULL) return CGL_FALSE;
	CGL_bool result = CGL_image_file_is_bmp_f(file);
	fclose(file);
	return result;
}

CGL_bool CGL_image_file_is_gif_f(FILE* file)
{
	CGL_byte d_i8 = 0;
	if (fread(&d_i8, sizeof(CGL_byte), 1, file) != 1) return CGL_FALSE;
	if (d_i8 != 'G') return CGL_FALSE;
	if (fread(&d_i8, sizeof(CGL_byte), 1, file) != 1) return CGL_FALSE;
	if (d_i8 != 'I') return CGL_FALSE;
	if (fread(&d_i8, sizeof(CGL_byte), 1, file) != 1) return CGL_FALSE;
	if (d_i8 != 'F') return CGL_FALSE;
	if (fread(&d_i8, sizeof(CGL_byte), 1, file) != 1) return CGL_FALSE;
	if (d_i8 != '8') return CGL_FALSE;
	if (fread(&d_i8, sizeof(CGL_byte), 1, file) != 1) return CGL_FALSE;
	if (d_i8 != '7' && d_i8 != '9') return CGL_FALSE;
	if (fread(&d_i8, sizeof(CGL_byte), 1, file) != 1) return CGL_FALSE;
	if (d_i8 != 'a') return CGL_FALSE;
	fseek(file, 0, SEEK_SET);
	return CGL_TRUE;
}

CGL_bool CGL_image_file_is_gif(const CGL_byte* file_path)
{
	FILE* file = fopen(file_path, "rb");
	if (file == NULL) return CGL_FALSE;
	CGL_bool result = CGL_image_file_is_gif_f(file);
	fclose(file);
	return result;
}

CGL_bool CGL_image_file_is_jpeg_f(FILE* file)
{
	CGL_ubyte d_i8 = 0;
	if (fread(&d_i8, sizeof(CGL_byte), 1, file) != 1) return CGL_FALSE;
	if (d_i8 != 0xFF) return CGL_FALSE;
	if (fread(&d_i8, sizeof(CGL_byte), 1, file) != 1) return CGL_FALSE;
	if (d_i8 != 0xD8) return CGL_FALSE;
	fseek(file, 0, SEEK_SET);
	return CGL_TRUE;
}

CGL_bool CGL_image_file_is_jpeg(const CGL_byte* file_path)
{

	FILE* file = fopen(file_path, "rb");
	if (file == NULL) return CGL_FALSE;
	CGL_bool result = CGL_image_file_is_jpeg_f(file);
	fclose(file);
	return result;
}

CGL_int CGL_image_file_get_format_f(FILE* file)
{
	if (CGL_image_file_is_png_f(file)) return CGL_IMAGE_FORMAT_PNG;
	if (CGL_image_file_is_bmp_f(file)) return CGL_IMAGE_FORMAT_BMP;
	if (CGL_image_file_is_gif_f(file)) return CGL_IMAGE_FORMAT_GIF;
	if (CGL_image_file_is_jpeg_f(file)) return CGL_IMAGE_FORMAT_JPEG;
	return CGL_IMAGE_FORMAT_UNKNOWN;
}

CGL_int CGL_image_file_get_format(const CGL_byte* file_path)
{
	FILE* file = fopen(file_path, "rb");
	if (file == NULL) return CGL_FALSE;
	CGL_int result = CGL_image_file_get_format_f(file);
	fclose(file);
	return result;
}

#endif


#ifndef CGL_EXCLUDE_ND_TREE_API

struct CGL_nd_tree
{
	CGL_bool(*aabb_subdivide_function)(CGL_int, CGL_float*, CGL_float*, CGL_float*, CGL_float*);
	CGL_bool(*aabb_contains_point_function)(CGL_int, CGL_float*, CGL_float*, CGL_float*);
	CGL_bool(*aabb_intersects_aabb_function)(CGL_int, CGL_float*, CGL_float*, CGL_float*, CGL_float*);

	CGL_sizei* children_node_pointers;
	CGL_float* children_node_aabbs;
	CGL_nd_tree_node* nodes_bank;
	CGL_int nodes_bank_size;

	CGL_float* positions_bank;
	CGL_sizei positions_bank_size;

	CGL_void* memory_bank;
	CGL_sizei mem_bank_allocation_count;
	CGL_sizei max_mem_banks;
	CGL_sizei max_items_total;

	CGL_float* aabb_out_min_tmp;
	CGL_float* aabb_out_max_tmp;

	CGL_int max_items_per_node;
	CGL_int items_per_node;
	CGL_int bank_size_per_node;
	CGL_int dimension;
	CGL_bool fast_approx_check;
	CGL_sizei item_size;
	CGL_int max_depth;
};

struct CGL_nd_tree_node
{
	CGL_sizei banks[CGL_ND_TREE_MAX_MEMORY_BANKS_PER_NODE];
	CGL_int items_count;
	CGL_int max_capacity;
	CGL_int depth;
	CGL_float* aabb_min;
	CGL_float* aabb_max;
	CGL_sizei* children_nodes;
	CGL_bool has_been_subdivided;
};

CGL_nd_tree* CGL_nd_tree_create(CGL_int dimensions, CGL_sizei item_size, CGL_int max_items_per_node, CGL_sizei max_nodes, CGL_sizei max_items, CGL_bool store_positions)
{
	// the main tree object
	CGL_nd_tree* tree = (CGL_nd_tree*)CGL_malloc(sizeof(CGL_nd_tree));
	if (tree == NULL) return NULL;

	// copy the simple values
	tree->dimension = dimensions;
	tree->item_size = item_size;
	tree->max_items_total = max_items;

	tree->aabb_out_max_tmp = (CGL_float*)CGL_malloc(sizeof(CGL_float) * (CGL_long)(1 << dimensions) * dimensions);
	if (tree->aabb_out_max_tmp == NULL)
	{
		CGL_free(tree);
		return NULL;
	}

	tree->aabb_out_min_tmp = (CGL_float*)CGL_malloc(sizeof(CGL_float) * (CGL_long)(1 << dimensions) * dimensions);
	if (tree->aabb_out_min_tmp == NULL)
	{
		CGL_free(tree->aabb_out_max_tmp);
		CGL_free(tree);
		return NULL;
	}
	// the position bank stores the positions of the items
	// this is allocated and used only if the user wants to store the positions
	// NOTE: if this is not allocated, the tree will always use fast approximations
	tree->positions_bank = NULL;
	tree->positions_bank_size = 0;
	if (store_positions)
	{
		// preallocate the position bank with all possible particles
		tree->positions_bank = (CGL_float*)CGL_malloc(sizeof(CGL_float) * dimensions * max_items);
		if (tree->positions_bank == NULL)
		{
			CGL_free(tree->aabb_out_max_tmp);
			CGL_free(tree->aabb_out_min_tmp);
			CGL_free(tree);
			return NULL;
		}
	}

	// we choose the aabb subdivide function based on the dimensions
	// for 2d and 3d we use hard coded functions rather than special
	// algorithm as they are relatively simple to code and way faster
	if (dimensions == 2) tree->aabb_subdivide_function = CGL_aabb_subdivide_2d;
	else if (dimensions == 3) tree->aabb_subdivide_function = CGL_aabb_subdivide_3d; // 3d is not implemented yet
	else tree->aabb_subdivide_function = CGL_aabb_subdivide_nd;


	if (dimensions == 2) tree->aabb_contains_point_function = CGL_aabb_contains_point_2d;
	else if (dimensions == 3) tree->aabb_contains_point_function = CGL_aabb_contains_point_3d;
	else tree->aabb_contains_point_function = CGL_aabb_contains_point_nd;


	if (dimensions == 2) tree->aabb_intersects_aabb_function = CGL_aabb_intersects_aabb_2d;
	else if (dimensions == 3) tree->aabb_intersects_aabb_function = CGL_aabb_intersects_aabb_3d;
	else tree->aabb_intersects_aabb_function = CGL_aabb_intersects_aabb_nd;

	// allocate the nodes bank
	tree->nodes_bank = (CGL_nd_tree_node*)CGL_malloc(sizeof(CGL_nd_tree_node) * max_nodes);
	tree->nodes_bank_size = 0;
	if (tree->nodes_bank == NULL)
	{
		if (tree->positions_bank) CGL_free(tree->positions_bank);
		CGL_free(tree->aabb_out_max_tmp);
		CGL_free(tree->aabb_out_min_tmp);
		CGL_free(tree);
		return NULL;
	}

	tree->children_node_pointers = (CGL_sizei*)CGL_malloc(sizeof(CGL_sizei) * (CGL_long)(1 << dimensions) * max_nodes);
	if (tree->children_node_pointers == NULL)
	{
		if (tree->positions_bank) CGL_free(tree->positions_bank);
		CGL_free(tree->aabb_out_max_tmp);
		CGL_free(tree->aabb_out_min_tmp);
		CGL_free(tree->nodes_bank);
		CGL_free(tree);
	}

	tree->children_node_aabbs = (CGL_float*)CGL_malloc(sizeof(CGL_float) * dimensions * 2 * (CGL_long)(1 << dimensions) * max_nodes);
	if (tree->children_node_aabbs == NULL)
	{
		if (tree->positions_bank) CGL_free(tree->positions_bank);
		CGL_free(tree->aabb_out_max_tmp);
		CGL_free(tree->aabb_out_min_tmp);
		CGL_free(tree->nodes_bank);
		CGL_free(tree->children_node_pointers);
		CGL_free(tree);
	}

	// set the children node pointers
	for (CGL_sizei i = 0; i < max_nodes; i++)
	{
		tree->nodes_bank[i].children_nodes = tree->children_node_pointers + (1 << dimensions) * (CGL_int)i;
		tree->nodes_bank[i].aabb_min = tree->children_node_aabbs + dimensions * 2 * (1 << dimensions) * i;
		tree->nodes_bank[i].aabb_max = tree->nodes_bank[i].aabb_min + dimensions;
	}


	// allocate the memory bank
	// the memory bank will store the item banks
	// an item bank is a solid collection of min(10, max_items_per_node) items 
	tree->memory_bank = (CGL_void*)CGL_malloc((sizeof(CGL_sizei) + item_size) * max_items);
	tree->mem_bank_allocation_count = 0;
	if (tree->memory_bank == NULL)
	{
		if (tree->positions_bank) CGL_free(tree->positions_bank);
		CGL_free(tree->aabb_out_max_tmp);
		CGL_free(tree->aabb_out_min_tmp);
		CGL_free(tree->nodes_bank);
		CGL_free(tree->children_node_pointers);
		CGL_free(tree->children_node_aabbs);
		CGL_free(tree);
	}

	// calculate the size of the banks
	tree->bank_size_per_node = CGL_utils_min(CGL_ND_TREE_MAX_ITEMS_PER_MEMORY_BANK, max_items_per_node);
	tree->max_items_per_node = max_items_per_node;


	return tree;
}

CGL_nd_tree* CGL_quad_tree_create(CGL_sizei item_size, CGL_int max_items_per_node, CGL_sizei max_nodes, CGL_sizei max_items, CGL_bool store_positions)
{
	return CGL_nd_tree_create(2, item_size, max_items_per_node, max_nodes, max_items, store_positions);
}

CGL_nd_tree* CGL_oct_tree_create(CGL_sizei item_size, CGL_int max_items_per_node, CGL_sizei max_nodes, CGL_sizei max_items, CGL_bool store_positions)
{
	return CGL_nd_tree_create(3, item_size, max_items_per_node, max_nodes, max_items, store_positions);
}

CGL_void CGL_nd_tree_destroy(CGL_nd_tree* tree)
{
	if (tree == NULL) return;
	// free the positions bank
	if (tree->positions_bank) CGL_free(tree->positions_bank);
	// free tmp aabb_min and aabb_max 
	CGL_free(tree->aabb_out_min_tmp);
	CGL_free(tree->aabb_out_max_tmp);
	// free the nodes bank
	CGL_free(tree->nodes_bank);
	// free the children node pointers
	CGL_free(tree->children_node_pointers);
	// free the children node aabbs
	CGL_free(tree->children_node_aabbs);
	// free the memory bank
	CGL_free(tree->memory_bank);
	// free the tree
	CGL_free(tree);
}

CGL_sizei __CGL_nd_tree_add_node(CGL_nd_tree* tree, CGL_int parent_depth, CGL_float* aabb_min, CGL_float* aabb_max)
{
	// NOTE: we do not check here if the nodes bank is full
	//       as we assume that the user will do this sanely
	//       thus by that we can avoid a lot of checks per frame
	//       and make the code faster   
	CGL_nd_tree_node* node = &tree->nodes_bank[tree->nodes_bank_size++];
	node->max_capacity = 0;
	node->items_count = 0;
	node->depth = parent_depth + 1;
	node->has_been_subdivided = CGL_FALSE;

	if (aabb_min && aabb_max)
	{
		// copy the aabbs
		for (CGL_int i = 0; i < tree->dimension; i++)
		{
			node->aabb_min[i] = aabb_min[i];
			node->aabb_max[i] = aabb_max[i];
		}
	}

	return tree->nodes_bank_size - 1;
}

CGL_bool CGL_nd_tree_reset(CGL_nd_tree* tree, CGL_float* aabb_min, CGL_float* aabb_max, CGL_int items_per_node, CGL_int max_depth, CGL_bool fast_approx_mode)
{
	// reset the tree
	tree->positions_bank_size = 0;
	tree->nodes_bank_size = 0;
	tree->mem_bank_allocation_count = 0;
	tree->fast_approx_check = fast_approx_mode;
	tree->max_depth = max_depth;
	tree->items_per_node = items_per_node;
	tree->bank_size_per_node = CGL_utils_min(CGL_ND_TREE_MAX_ITEMS_PER_MEMORY_BANK, tree->max_items_per_node);
	tree->max_mem_banks = tree->max_items_total / tree->bank_size_per_node;

	// add the root node
	// parent depth is -1 as the root node has no parent
	__CGL_nd_tree_add_node(tree, -1, aabb_min, aabb_max);

	return CGL_TRUE;
}

CGL_bool CGL_quad_tree_reset(CGL_nd_tree* tree, CGL_float x_min, CGL_float y_min, CGL_float x_max, CGL_float y_max, CGL_int items_per_node, CGL_int max_depth, CGL_bool fast_approx_mode)
{
	CGL_float aabb_min[2] = { x_min, y_min };
	CGL_float aabb_max[2] = { x_max, y_max };
	return CGL_nd_tree_reset(tree, aabb_min, aabb_max, items_per_node, max_depth, fast_approx_mode);
}

CGL_bool CGL_oct_tree_reset(CGL_nd_tree* tree, CGL_float x_min, CGL_float y_min, CGL_float z_min, CGL_float x_max, CGL_float y_max, CGL_float z_max, CGL_int items_per_node, CGL_int max_depth, CGL_bool fast_approx_mode)
{
	CGL_float aabb_min[3] = { x_min, y_min, z_min };
	CGL_float aabb_max[3] = { x_max, y_max, z_max };
	return CGL_nd_tree_reset(tree, aabb_min, aabb_max, items_per_node, max_depth, fast_approx_mode);
}

CGL_bool __CGL_nd_tree_node_add_item(CGL_nd_tree* tree, CGL_nd_tree_node* node, CGL_sizei position_bank_index, CGL_void* item)
{
	// calculate some common values
	CGL_sizei current_bank_index = (node->items_count) / tree->bank_size_per_node;
	CGL_sizei current_bank_item_index = (node->items_count) % tree->bank_size_per_node;

	// check if the node has enough capacity
	if (node->items_count >= node->max_capacity)
	{
		// if new memory bank is not allowed then return false
		if (current_bank_index >= CGL_ND_TREE_MAX_MEMORY_BANKS_PER_NODE) return CGL_FALSE;
		// we need to allocate another memory bank for this node
		if (tree->mem_bank_allocation_count > tree->max_mem_banks) return CGL_FALSE;
		node->banks[current_bank_index] = (tree->mem_bank_allocation_count++) * (sizeof(CGL_sizei) + tree->item_size) * tree->bank_size_per_node;
		node->max_capacity += tree->bank_size_per_node;
	}

	if (current_bank_index >= CGL_ND_TREE_MAX_MEMORY_BANKS_PER_NODE) return CGL_FALSE;

	// get the memory pointers
	CGL_ubyte* memory_bank = (CGL_ubyte*)tree->memory_bank + node->banks[current_bank_index];
	CGL_ubyte* item_memory = memory_bank + current_bank_item_index * (sizeof(CGL_sizei) + tree->item_size);


	//  copy the values
	//((CGL_sizei*)item_memory)[0] = position_bank_index;
	*(CGL_sizei*)item_memory = position_bank_index;
	if (tree->item_size == 4) *(CGL_int*)((CGL_ubyte*)item_memory + sizeof(CGL_sizei)) = *(CGL_int*)item;
	else if (tree->item_size == 8) ((CGL_sizei*)item_memory)[1] = *(CGL_sizei*)item;
	else memcpy((CGL_ubyte*)item_memory + sizeof(CGL_sizei), item, tree->item_size);

	// update count
	node->items_count += 1;

	return CGL_TRUE;
}

CGL_bool __CGL_nd_tree_node_add(CGL_nd_tree* tree, CGL_sizei node_id, CGL_float* position, CGL_void* item, CGL_sizei position_bank_index, CGL_int depth)
{
	CGL_nd_tree_node* node = &tree->nodes_bank[node_id];
	// check if the item is inside the node or not
	// if (!tree->aabb_contains_point_function(tree->dimension, node->aabb_min, node->aabb_max, position)) return CGL_FALSE;

	// check if we are at the max depth
	if (depth == tree->max_depth)
	{
		// if we are at the max depth then we add the item to the node
		// no matter the node is full or not
		__CGL_nd_tree_node_add_item(tree, node, position_bank_index, item);
		return CGL_TRUE;
	}

	// check if the node is already full
	if (node->items_count >= tree->items_per_node)
	{
		// here we need to subdivide current node creating children nodes if it has not already been divided
		if (!node->has_been_subdivided)
		{
			// first calculate the aabb of children nodes of this node
			if (!tree->aabb_subdivide_function(tree->dimension, node->aabb_min, node->aabb_max, tree->aabb_out_min_tmp, tree->aabb_out_max_tmp)) return CGL_FALSE;

			// initialize the appropiate nodes
			for (CGL_int i = 0; i < (1 << tree->dimension); i++)
			{
				CGL_float* nd_aabb_min = tree->aabb_out_min_tmp + i * tree->dimension;
				CGL_float* nd_aabb_max = tree->aabb_out_max_tmp + i * tree->dimension;
				node->children_nodes[i] = __CGL_nd_tree_add_node(tree, node->depth, nd_aabb_min, nd_aabb_max);
			}

			node->has_been_subdivided = CGL_TRUE;
		}
		// add the point to the appropiate child node
		for (CGL_int i = 0; i < (1 << tree->dimension); i++)
		{
			CGL_nd_tree_node* child_node = &tree->nodes_bank[node->children_nodes[i]];
			if (tree->aabb_contains_point_function(tree->dimension, child_node->aabb_min, child_node->aabb_max, position))
				if (__CGL_nd_tree_node_add(tree, node->children_nodes[i], position, item, position_bank_index, depth + 1))
					return CGL_TRUE;
		}
	}
	else
	{
		// the node is not full so we add the item to the node
		return __CGL_nd_tree_node_add_item(tree, node, position_bank_index, item);
	}

	// this should never happen
	return CGL_FALSE;
}

CGL_bool CGL_nd_tree_add(CGL_nd_tree* tree, CGL_float* position, CGL_void* item)
{
	// this is allocated only if positions are to be stored
	if (tree->positions_bank)
	{
		if (tree->positions_bank_size >= tree->max_items_total) return CGL_FALSE;
		memcpy(tree->positions_bank + tree->positions_bank_size, position, sizeof(CGL_float) * tree->dimension);
		tree->positions_bank_size += tree->dimension;
	}
	if (tree->aabb_contains_point_function(tree->dimension, tree->nodes_bank[0].aabb_min, tree->nodes_bank[0].aabb_max, position))
		return __CGL_nd_tree_node_add(tree, 0, position, item, tree->positions_bank_size - tree->dimension, 0);
	return CGL_FALSE;
}

CGL_bool CGL_quad_tree_add(CGL_nd_tree* tree, CGL_float px, CGL_float py, CGL_void* item)
{
	CGL_float position[2] = { px, py };
	return CGL_nd_tree_add(tree, position, item);
}

CGL_bool CGL_oct_tree_add(CGL_nd_tree* tree, CGL_float px, CGL_float py, CGL_float pz, CGL_void* item)
{
	CGL_float position[3] = { px, py, pz };
	return CGL_nd_tree_add(tree, position, item);
}



CGL_int __CGL_nd_tree_node_get_items_in_range(CGL_nd_tree* tree, CGL_nd_tree_node* node, CGL_float* p_min, CGL_float* p_max, CGL_void* items_out, CGL_int max_items, CGL_int items_size)
{
	if (items_size >= max_items) return items_size;

	// if (!tree->aabb_intersects_aabb_function(tree->dimension, node->aabb_min, node->aabb_max, p_min, p_max)) return items_size;

	static CGL_sizei current_bank_index = 0;
	static CGL_sizei current_bank_item_index = 0;
	static CGL_sizei position_index = 0;
	static CGL_bool point_include_condition = 0;
	static CGL_ubyte* item = NULL;


	// first iterate through over the items in this node
	for (CGL_int i = 0; i < node->items_count; i++)
	{
		current_bank_index = i / tree->bank_size_per_node;
		current_bank_item_index = i % tree->bank_size_per_node;
		item = (CGL_ubyte*)tree->memory_bank + node->banks[current_bank_index] + current_bank_item_index * (sizeof(CGL_sizei) + tree->item_size);
		position_index = *(CGL_sizei*)item;
		point_include_condition = CGL_TRUE;
		if (tree->positions_bank != NULL && !tree->fast_approx_check) point_include_condition = tree->aabb_contains_point_function(tree->dimension, p_min, p_max, tree->positions_bank + position_index);
		if (point_include_condition) memcpy((CGL_ubyte*)items_out + (items_size++) * tree->item_size, item + sizeof(CGL_sizei), tree->item_size);
	}


	// if the node is not a leaf we iterate over its children
	if (node->has_been_subdivided)
	{
		for (CGL_int i = 0; i < (1 << tree->dimension); i++)
		{
			if (tree->aabb_intersects_aabb_function(tree->dimension, tree->nodes_bank[node->children_nodes[i]].aabb_min, tree->nodes_bank[node->children_nodes[i]].aabb_max, p_min, p_max))
				items_size = __CGL_nd_tree_node_get_items_in_range(tree, &tree->nodes_bank[node->children_nodes[i]], p_min, p_max, items_out, max_items, items_size);
		}
	}

	return items_size;
}

CGL_int CGL_nd_tree_get_items_in_range(CGL_nd_tree* tree, CGL_float* p_min, CGL_float* p_max, CGL_void* items_out, CGL_int max_items)
{
	if (tree->aabb_intersects_aabb_function(tree->dimension, tree->nodes_bank[0].aabb_min, tree->nodes_bank[0].aabb_max, p_min, p_max))
		return __CGL_nd_tree_node_get_items_in_range(tree, &tree->nodes_bank[0], p_min, p_max, items_out, max_items, 0);
	return 0;
}

CGL_int CGL_quad_tree_get_items_in_range(CGL_nd_tree* tree, CGL_float x_min, CGL_float y_min, CGL_float x_max, CGL_float y_max, CGL_void* items_out, CGL_int max_items)
{
	CGL_float p_min[2] = { x_min, y_min };
	CGL_float p_max[2] = { x_max, y_max };
	return CGL_nd_tree_get_items_in_range(tree, p_min, p_max, items_out, max_items);
}

CGL_int CGL_oct_tree_get_items_in_range(CGL_nd_tree* tree, CGL_float x_min, CGL_float y_min, CGL_float z_min, CGL_float x_max, CGL_float y_max, CGL_float z_max, CGL_void* items_out, CGL_int max_items)
{
	CGL_float p_min[3] = { x_min, y_min, z_min };
	CGL_float p_max[3] = { x_max, y_max, z_max };
	return CGL_nd_tree_get_items_in_range(tree, p_min, p_max, items_out, max_items);
}



#endif


#endif // CGL_IMPLEMENTATION

#endif // CGL_H